1. Calculus

    A 30-in. piece of string is cut into two pieces. One piece is used to form a circle and the other to form a square. How shouls the string be cut so that the sum of the areas is a minimum? Round to the nearest tenth, if necessary.
  2. algebra 1

    how do you worl linear equations and the intercept form?? I assume you meant to write: <<How do you work linear equations and get the intercept from them? >> Rewrite the equation in the form y = m x + b "b" is the value of y where the line
  3. calculus--please help!!

    find the complete zeros of the polynomial function. Write f in factored form. f(x)=3x^4-10x^3-12x^2+122x-39 **Use the complex zeros to write f in factored form.** f(x)= Please show work
  4. pre cal

    find the standard form of the equation of a parabola with the vertex (0,0) and the directrix y=6 find the standard form of the equation of the ellipse with center (0,0) and foci at (+- 4square root 3, 0) and verticies (+-8,0)
  5. Chemistry

    Sorry for postiong twice. But I really need to know if the answers I am getting are correct; Nitrogen and oxygen react to produce nitric oxide according to the following equation: N2 (g) + O2 (g) → 2 NO (g) The equilibrium constant for this reaction is
  6. Chemistry-Dr. Bob

    Reacting 1 L of H2(g) with 1 L C2H2(g) (both at STP) results in the formation of 1 L of C2H4(g) if the reaction is maintained at the same conditions (STP) and goes to completion. If this reaction produced 6.3 kJ of heat (absorbed by the surroundings),
  7. Chemistry

    Nitric acid, HNO3, is produced from ammonia and oxygen by the consecutive reactions: 4NH3 + 5O2 => 4NO3 + 6H2O 2NO + O2 => 2NO2 3NO2 + H2O => 2HNO3 + NO How many grams of nitric acid can be obtained from 1.00kg NH3 if NO in the third reaction is
  8. Chemistry

    (1) Use the thermodynamic values to (a) deduce the enthalpy change of each reaction (b)state if the reaction is exothermic,or endothermic,and also how much energy is released or absorbed. For thi reactions; (1) NH4NO3 (s)------>N2 (g) + 2H2O (l) (2) 4Zn
  9. chemistry

    When 0.712 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 116C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to significant
  10. Chemistry

    Could someone explain the reasoning for this? 6) Which of the following is a false statement about ALL reactions in equilibrium? a) Increasing temperature shifts the reaction toward the products in an endothermic reaction b) Temperature effects on the
  11. chemistry HELP!!

    Reaction Rate = -(1/2) [d(H2O2)/dt] = [d(O2)/ dt] Using 25 mL of a 0.2 M hydrogen peroxide solution, the following results are obtained from the equation above: 8.62 mL of gas is collected in 120 seconds. (Assume 760 Torr = 1 atm) Room temperature is 25
  12. Chemistry

    Consider the gas-phase transfer of an electron from a sodium atom to a chlorine atom: Na(g)+Cl(g)-->Na^(+)(g)+Cl^(-)(g) I was able to write the reaction that relates to an ionization energy and that relates to an electron affinity. I broke it up into:
  13. chemistry

    The reaction of calcium bicarbonate, Ca(HCO3)2 with hydrochloric acid, HCl, produces a solution of CaCl2, gaseous carbon dioxide, CO2, and water, H2O. Write a balanced chemical equation for this reaction and determine the volume of CO2, in mL, that forms
  14. Chemistry. What equation do I use?

    A 20.29 g sample of impure MgCO3 is completely decomposed at 1000oC in previously evacuated 2.0 L reaction vessel. After the reaction was complete the solid residue had a mass of 15.9 g. Assume that only MgCO3 could produce gas CO2 what percent of original
  15. chemistry

    Tantalum metal is produced by reaction of potassium heptafluorotantalate (K2TaF7) with elemental sodium (Na) in a reactor heated to 850oC. The by-products are potassium fluoride (KF) and sodium fluoride (NaF). The reactor is charged with 208.0 kg of K2TaF7
  16. chemistry 105

    Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s)+3H2SO4(aq)-->Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 14.7 g. What minimum mass of H2SO4(in g) would you need? What mass of H2
  17. Chemistry PLEASE HELP!

    Manganese dioxide reacts with bromide ions to form manganese ions and bromate ions in an acidic aqueous solution. Write the balanced equation for this reaction. Select one: a. Br- + MnO2 + 3H2O Mn2+ + BrO3- + 2H3O+ b. Br- + 3MnO2 + 6H3O+ 3Mn2+ + 9H2O +
  18. chemistry

    Instant cold packs, often used to ice athletic injuries on the field, contain ammonium nitrate and water separated by a thin plastic divider. When the divider is broken, the ammonium nitrate dissolves according to the following endothermic reaction:
  19. Chemistry

    The iodide ion can be oxidized in an acidic solution by hydrogen peroxide. One proposed mechanism for the reaction is as follows: Step 1: H2O2 (aq) + I-(aq) → H2O (l) + OI-(aq) slow Step 2: H+(aq) + OI-(aq) → HOI(aq) fast Step 3: HOI (aq) +
  20. Math

    1. Mark is 5 years younger than his 16 year old sister. What is Mark's age. Write in equation form. 2. Vinn works at the petshop for $11 per hour. How many hours did he work if he made $93.50? Write in equation form.
  21. Chemistry

    Ethanoic acid can be reacted with alcohols to form esters, an equilibrium mixture being formed. CH3CO2H + ROH <--> CH3CO2R + H2O The reaction is usually carried out in the presence of an acid catalyst. In an experiment to determine Kc a student
  22. maths

    three number form an arithmetric sequence. Their sum is 24. A)If 'a' is the first number and 'd' the common difference, show that a+d=8 B)If the first number is decreased by 1 and the second number by 2, the three numbers then form a geometric sequence.
  23. math

    In how many positive four-digit integers that are not multiples of 1111 do the digits form an arithmetic sequence? (The digits must form an arithmetic sequence, in order. For example, the number 5137 does not count.)
  24. Algebra 1

    A line passes through (4,2) and is parallel to the graph of x= -3. What equation represents the line in slope-intercept form? It doesn't give me enough information to turn it into slope-intercept form. HELP ME PLEASE!!??!!
  25. Form a polynomial f(x) from coefficient and it's 0

    Form a polynomial, f(x), with real coefficients having the given degree and zeros. Degree: 4; zeros: 6i and 7i I completely don't know what to do with this problem... if someone can solve and give a good explanation, I'd appreciate it. Thanks.
  26. MATHIN-HELPN!

    a. Show that the ratios 10/20 and 30/60 form a proportion by finding a common multiplier. b. Show that the ratios in part (a) are equal by writing them in simplest form. I think that part (a) is 60, but, I dont know what (b) is.
  27. Chemistry

    The following reaction can be used to determine the amount of calcium ion present in milk. Before the reaction below is carried out ca2+ is precipitated out of a sample of milk as CaC2O4(s). The CaC2O4(s) is then titrated with MnO4-. 2MnO4-(aq) +
  28. Chemistry

    In the presence of an alkali, Cl2 reacts to form Cl- and ClO3- , as follows: 3 Cl2(g) + 6 OH−(aq) → 5 Cl−(aq) + ClO3−(aq) + 3 H2O(l) a. Calculate the oxidation number for chlorine in each of the species. b. Write a half equation for
  29. Chemistry

    In the presence of an alkali, Cl2 reacts to form Cl- and ClO3- , as follows: 3 Cl2(g) + 6 OH−(aq) → 5 Cl−(aq) + ClO3−(aq) + 3 H2O(l) a. Calculate the oxidation number for chlorine in each of the species. b. Write a half equation for
  30. Chemistry - please help

    An anyhdrous metal chloride, X, contains 37.4% Cl. X is a reducing agent, 0.895 g requiring 23.60 cm^3 of 0.100M KIO3 for complete oxidation in 3- 9M HCl. X reacts with potassium chloride to form an adduct Y, containing 14.8% K. Identify X and Y, and
  31. SeQuEnCeS and SeRiEs: HELP PLZ!

    The first three terms of the sequence -8,x,y,72... form an arithmetic sequence, while the second, third and fourth terms form a geometric sequence. Determine x and y.
  32. Chem

    what is NH3 in written form? ammonia As a note, it is becoming more and more common to see ammonia written in IUPAC form, H3N, and the ammonium Ion written as H4N+
  33. biology help

    Does photosynthesis require energy? What type of energy reaction would photosynthesis be? Is photosynthesis an example of a coupled reaction?
  34. Parabolas in standard form!

    Hello, I am having the worst time trying to solve these parabolas and putting them into x-h = a(y-k)^2 form. :( There are two problems that i keep doing something wrong. could someone solve them so I can have a set up for the rest of my problems? :)
  35. English Grammar

    Correct the incorrect verb form. Write the correct verb form in the space provided. Identify any sentence as correct. Bob speeded up his car when he saw the light turn yellow. would this be correct or would it be sped?
  36. Science fir 11 yr olds

    Experiment in rust: does anhydrous calcium chloride in solid form prevent rust on matal nails is submerged for 5 days? Is it available in liquid form? If yes, does that prevent a nail from rusting after 5 days? Many thanks
  37. Chemistry

    The reaction described takes place in solution in a coffe-cup style calorimeter. We will assume that the cups absorb or release a negligible amount of heat so we will not need to worry about the calorimeter constant or qcal. If the total mass of the
  38. Chemistry

    I had to perform an experiment for rate of reaction. The point of the experiment was to show how changes in reactant concentration, temperature, and catalyst presence can affect the rate of a reaction. The reaction that we studied was H2O2 + 2I^- + 2H^+
  39. science

    Which of the following statement best describes the two different types of electrical energy involved in the situation above? 1.Both the lightning and the electricity used to light the floor lamp are forms of static electricity. 2. Both the lightning and
  40. Algebra

    Write the equation of the line containing the given point and parallel to the given line. The equation of the line is y= Express your answer in the form y=mx+b. (7,8); x+7y=6 Express your answer in the form y=mx+b. (8,9); 5x+y=9 Express your answer in the
  41. Chemistry

    A common laboratory reaction is the neutralization of an acid with a base. When 50.0 mL of the .500 M HCl at 25 C is assed to 50 mL of .500 M NaOH at 25 C in a coffee cup calorimeter, the temperature of the mixture rises to 28.2 C. What is the heat of
  42. Chemistry

    Consider the reaction of Lithium with water: 2 Li(s) + 2H2O(l) ----> 2 LiOH(aq) + H2(g) The delta H of the reaction is -160 KJ The enthalpy of fusion of H2O is 6.0 kJ/mol The specific heat capacity of H2O(l) is 4.18 J/gC When 10 grams of Li(s) is
  43. Precalculus

    Polynomials Problem: 1. List two factors of h(x) of the form x−r: x, x + 2 (right answer) 2. A function of the form ax^n that approximates h(x) for large values of |x| is f(x)= 2x^4. (right answer) 3. This tells us that the degree of h is 4 and the
  44. Math

    According to the Department of Health and Human Services, 30% of 18- to 25-year-olds have some form of mental illness. (a) What is the probability two randomly selected 18- to 25-year-olds have some form of mental illness? (b) What is the probability six
  45. Math

    For the given equation r=1/(3-4sintheta) a. Graph the equation in polar form. b. Reduce the equation to simplest rectangular form. c. Determine the Center and the type of graph of the resulting equation.
  46. literature/ GUM

    Which word is the antecedent of the underlined pronoun? The boy took his time filling out the form and then checked it for spelling errors. A. form B. boy C. errors D. time
  47. Mathematics

    Cristina uses a ruler to measure the length of her math textbook. She says that the book is 11 2/16 inches long. Is her measurement in simplest form? If not, what is the length of the book in simplest form?
  48. find the polynomial

    degree 4 zeros i & (1+i) constant term 12 How do I start this problem. Thanks A degree four polynomial will have the form (x^4 +... x + c), where c is a constant. You will need to generate an equation that has the above form, using c=12. Solve for the
  49. Spanish help please

    1. what is the plural form of libro? a. libros b. libroes c. libroces d. libriones 2. what is the plural form of la television? a. la televisions b. los televisiones c. las televisiones d. el televisions
  50. Chemistry 101

    Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s)+3H2SO4(aq)→Al2(SO4)3(aq)+3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 14.9g .What minimum mass of H2SO4 would you need? What mass of H2 gas
  51. chemistry

    Sulfuric acid dissolves aluminum metal according to the following reaction: 2Al(s) + 3H2SO4(aq) -> Al2(SO4)3(aq) + 3H2(g) Suppose you wanted to dissolve an aluminum block with a mass of 15.9g . A)What minimum mass of H2SO4 (in g) would you need?
  52. Chemistry

    Oxyacetylene torches are fueled by the combustion of acetylene, C2H2. 2C2H2(g) + 5O2(g) --> 4 CO2(g) + 2H2O(g) If the enthalpy change for the reaction is -2511.14 kJ/molrxn, how much heat can be produced by the reaction of a. 2mol of C2H2? b. 1 mol of
  53. chemistry

    4. Calculate the Gibbs’ free energy change for the reaction Mg(s) + H2O(g) → MgO(s) + H2(g) carried out at 100ºC given the data below. Under these conditions is this reaction product favoured? ΔHºformation (kJ mol^-1) MgO(g) -602 H2O(g) -242
  54. Chemistry

    Energy, q, w, Enthalpy, and StoichiometrySource(s): Consider the combustion of liquid methanol, CH3OH (l). CH3OH (l) +3/2O2 (g) = CO2 (g) + 2H2O(l) H = -726.5 kJ Part A: What is the enthalpy change for the reverse reaction? Express your answer using four
  55. math

    Dan and Jana were assigned by their teacher to complete a chemical reaction 4 times in the last 12 minutes of lab time. What is the longest time that each reaction will take if the teacher gave them enough time? a.8 seconds b.3 minutes c.8 minutes d.3
  56. Chemistry

    A certain reaction has an activation energy 52.93 kJ/mol. At what kelvin temperature will the reaction proceed 8.00 times faster than it did at 315K? Ea = 52.93 kJ/mol = 52930J R (gas constant) = 8.314 T1 = 315K k1 = rate constant at T1 T2 = ? k2 = rate
  57. Anatomy

    I have a question In a dehydration synthsis reaction which of the following occurs a. hydrogen and oxygen are removed from the reactant b. water is added to the reactants c. water is broken down into hydrgen and oxygen d. both a and c I think it would
  58. Chem16

    The reaction SO2Cl2(g)--> SO2(g) + Cl2(g) has Kc = 2.99 x 10-7 at 227 degrees C. If a reaction mixture initially contains 0.166 M SO2Cl2, what is the equilibrium concentration of Cl2 at 227 degrees C?
  59. Chemistry(Please respond)

    Step 1:H2O2 + I^-^ = H2O + OI^-^ step 2: H2O2 + OI^-^ = H2O + O2 + I^-^ What is the equation for the overall reaction? I am not sure how to do this since there are two equations. Complete the rate law for the overall reaction. I know how to do this one but
  60. Chemistry

    If a precipitation reaction occurs when a solution of one species is added to a solution of the other, enter the formula, including the state, of the soluble product. If there is no reaction, enter the formula and state of all ions in solution, separate by
  61. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O
  62. Chemistry

    If a precipitation reaction occurs when a solution of one species is added to a solution of the other, enter the formula, including the state, of the soluble product. If there is no reaction, enter the formula and state of all ions in solution, separate by
  63. Chemistry

    Dr. Bob222 I still didn't understand which is the reduction half reaction and its products and oxidation half reaction...and why is it O3 to IO3-...0 to -6 and then Please help...entrance exam soon Write the oxidation and reduction half reactions(showing
  64. AP Chem

    I know this might sound easy... but i need these problems for bonus and i want to make sure they are right Silver nitrate reacts with strontium chloride in an aqueous precipitation reaction. What are the formulas of silver nitrate and strontium chloride?
  65. Chemistry

    Consider the following reaction: CO(g)+2H2(g)⇌CH3OH(g) This reaction is carried out at a specific temperature with initial concentrations of [CO] = 0.27 M and [H2] = 0.49 M. At equilibrium, the concentration of CH3OH is 0.11 M. Find the equilibrium
  66. chemistry

    ethane,C2H6 burns in oxygen. A. what are the products of the reaction? B. write the balanced equation for the reaction. C. what mass of O2, in grams is required for complete combustion of 13.6 of ethane? D. what is the total mass of products expected from
  67. chemistry

    Given the equilibrium system PCL55(g) <---> PCL3(g) + Cl2(g) k = 12.5 at 60 degrees Celsius. A 1.0-L reaction vessel is analyzed and found to contain 3.2 mol Cl2(g), 1.5 mol PCl3(g) and 2.0 mol PCl5(g). Show that the reaction mixture has not yet
  68. chemistry

    6. Determine Keq for the reaction: 2 SO2 (g) + O2(g) 2 SO3(g), given that 1.00 x 10-2 moles of SO2 and 2.00 x 10-2 moles of O2 were placed in a 2.00L reaction chamber. The chamber contained 7.5 x 10-3 moles of SO3 when equilibrium was established at 727oC.
  69. CHEMISTRY

    2NO(g) + O2(g) --> 2NO2(g) Derive the theoretical rate law and indicate whether or not this is a possible mechanism for the above reaction: (1) 2NO(g) <-->* N2O2(g) (fast) (2) N2O2(g) + O2(g) --> 2NO2(g) (slow) Extra Info: This reaction is
  70. Chemistry

    An aqueous solution of 0.25 M silver nitrate, AgNO3, and 0.25 M iron(II) nitrate, Fe(NO3)2, are allowed to come to equilibrium in the following chemical reaction:
Ag+(aq) + Fe2+(aq) Fe3 + (aq) + Ag(s)
If the equilibrium constant, Kc, for the
  71. Chemistry

    If the concentration of a reactant is decreased, will the speed of the reaction increase or decrease? Explain. I understand that if the concentration of a reactant is INCREASED, the frequency of coliision increases, making the rate of reaction increase.
  72. Chemistry

    In a reaction between methane, CH4 and chlorine, Cl2 four products can form: CH3Cl, CH2Cl2 + CHCl3 and CCl4. In a particular instance, 20.8 g of CH4 were allowed to react with excess Cl2 and gave 5.0 g CH3Cl, 25.5 g CH2Cl2+ and 59.0 g CHCl3+ all the CH4
  73. chemistry

    In a reaction between methane, CH4+ and chlorine, Cl2+ four products can form: CH3Cl, CH2Cl2 + CHCl3+ and CCl4. In a particular instance, 20.8 g of CH4 were allowed to react with excess Cl2 and gave 5.0 g CH3Cl, 25.5 g CH2Cl2+ and 59.0 g CHCl3+ all the CH4
  74. Chemistry

    If a precipitation reaction occurs when a solution of one species is added to a solution of the other, enter the formula, including the state, of the soluble product. If there is no reaction, enter the formula and state of all ions in solution, separate by
  75. Physics

    To stop a car, first you require a certain reaction time to begin braking. Then the car slows down at a constant rate. Suppose that the total distance moved by your car during these two phases is 56.7 m when its initial speed is 85.0 km/h, and 24.4 m when
  76. Chemistry

    If a precipitation reaction occurs when a solution of one species is added to a solution of the other, enter the formula, including the state, of the soluble product. If there is no reaction, enter the formula and state of all ions in solution, separate by
  77. chemistry

    Administratium bromide (AdBr) decomposes readily at temperatures exceeding 37°C. The figure below shows how the rate of reaction varies with the concentration of AdBr. The rate, r, is in units of M s-1 and the concentration of AdBr, c, is in units of M
  78. chemistry

    The decomposition of N2O5 proceeds according to the following equation 2 N2O5(g) → 4 NO2(g) + O2(g). The rate constant, k, for the reaction at 298 K is 2.20 x 10-3 min-1. If a reaction is set up in a vessel at 298 K, with an initial concentration of
  79. Chemistry

    Design an electrochemical cell using Pb(s) and Mn(s) and their solutions to answer the following questions. I just want to see if my answers are correct. I drew the cell already. Thanks 1. Give the line notation for this electrochemical cell. Mn(s) ∣
  80. math

    a baseball field has four bases that form the shape of a quadrilateral. If someone invented a new game similar to baseball that had an extra base in the field, what type of polygon would the bases form? A. pentagon<My Answer B. octagon C. decagon D.
  81. Math

    How would one write y = 2/3x -4 in standard form? First read: http://www.algebralab.org/studyaids/studyaid.aspx?file=Algebra1_5-5.xml Then: multiply both sides by 3 3y=2x-12 then move terms into standard form -2x+3y=-12 you could multiply both sides by -1
  82. Math

    a baseball field has four bases that form the shape of a quadrilateral. If someone invented a new game similar to baseball that had an extra base in the field, what type of polygon would the bases form? A. pentagon<My Answer B. octagon C. decagon D.
  83. chem-help

    Use the following information to identify element A and come pound B, then answer questions a and b. An empty glass container has a mass of 658.572 g. It has a mass of 659.452 g after it has been filled with nitrogen gas at a pressure of 790. torr and a
  84. science(chem) plastic hedache...can anyone help?

    My hwk Q that I was trying to find the answer to yesterday is this below but I don't know exactly how the placticizing process works. I compiled the chemicals I think I need but other than that I'm stumped as to how to put them together or how. Q: A water
  85. college

    Use the following information to identify element A and compound B, then answer questions a and b. An empty glass container has a mass of 658.572 g. It has a mass of 659.452 g after it has been filled with nitrogen gas at a pressure of 790 torr and a
  86. Please double check...GK or Dr.Bobb22

    Hi, i actually posted this up before..please double check the answers if i got them right have to hand in on Wednesday: The Chemicals are: Baking Soda- NaHC03 Calcium Chloride- CaCl2 Bromothymol Blue - (acid base indicator)
  87. Chem 1LB

    When 0.678 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 11.0C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to
  88. CHEMISTRY

    When 0.756 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 123C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to significant
  89. Chem 1LB

    When 0.678 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 11.0C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to
  90. Chemistry

    Calculate the percent yield of iron if 950 g of Fe3O4 underwent the reaction shown in the chemical equation below and 533 g of Fe was isolated from the reaction mixture. Fe3O4 (s) + 2 C(s) ----> 2 CO2 (g) + 3 Fe(s) 1). 25.9% 2). 77.5% 3). 56.1% 4). None
  91. chemistry

    When 0.767 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 125C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to significant
  92. chemistry

    When 0.667 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 108C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to significant
  93. Chemistry

    When 0.689 g of Ca metal is added to 200.0 mL of 0.500 M HCl(aq), a temperature increase of 112C is observed. Assume the solution's final volume is 200.0 mL, the density is 1.00 g/mL, and the heat capacity is 4.184 J/gC. (Note: Pay attention to significant
  94. Chemistry

    So I do know how to work out letter a) but I'm still very confused with parts b and c. Appreciate the help! 2FeN(s) + 3H2(g) --> 2Fe(s) + 2NH3(g) Suppose that the reaction is carried out at 300C and 3.00 atm. 1.00 grams of iron (III) nitride reacts.
  95. Kinetics Problem I

    A reaction has a rate constant of 1.23×10-4 s at 28 degrees C and 0.235 s at 79 degrees C. A: Determine the activation barrier for the reaction. B: What is the value of the rate constant at 15 degrees C?
  96. Physics

    A rock is falling towards the Earth. Suppose the action force is the pull of the Earth on the rock. What is the reaction force? I do not know how to find the reaction force.
  97. Chemistry

    Determine the identity of an unknown solution that formed a yellow precipitate with solution 1, No Reaction with solution 2, No Reaction with solution 3, and a canary yellow solution with solution 4?
  98. chemistry

    I need help with Part 2 Part 1. Record the following for each of the three experiments: (a) Mass of the empty calorimeter (g): 11.600 g (b) Initial temperature in the calorimeter (C): 21.00 (c) Maximum temperature in the calorimeter from the reaction (C):
  99. Biology

    9. a molecule shaped like a spiral staircase (double helix) is a typical of a. deoxyribonucleic acid b. ribonucleic acid c. carbohydrates d. both a and b D? 10. ATP is important to living organisms because it a. stores hereditary information b. stores
  100. Biology

    9. a molecule shaped like a spiral staircase (double helix) is a typical of a. deoxyribonucleic acid b. ribonucleic acid c. carbohydrates d. both a and b D? 10. ATP is important to living organisms because it a. stores hereditary information b. stores