Ask questions and get helpful responses.

Write the ionic equation for these reaction. Ca(HCO3)2 + HCL = CaCl2 + CO2 + H2O ZnO + HNO3 = Zn(NO3)2 + H2O

79,541 results
  1. Chemistry

    Write the ionic equation for these reaction. Ca(HCO3)2 + HCL = CaCl2 + CO2 + H2O ZnO + HNO3 = Zn(NO3)2 + H2O
  2. chemistry

    The reaction of calcium bicarbonate, Ca(HCO3)2 with hydrochloric acid, HCl, produces a solution of CaCl2, gaseous carbon dioxide, CO2, and water, H2O. Write a balanced chemical equation for this reaction and determine the volume of CO2, in mL, that forms
  3. Chemistry

    A 0.879 g sample of a CaCl2 ∙ 2 H2O / K2C2O4 ∙ H2O solid salt mixture is dissolved in 150 mL of deionized water. A precipitate forms which is then filtered and dried. The mass of this precipitate is 0.284 g. The limiting reagent in the salt mixture was
  4. Please double check...GK or Dr.Bobb22

    Hi, i actually posted this up before..please double check the answers if i got them right have to hand in on Wednesday: The Chemicals are: Baking Soda- NaHC03 Calcium Chloride- CaCl2 Bromothymol Blue - (acid base indicator)
  5. chemistry

    How can I change ca(hco3)2+cl(aq)=cacl2(aq) + co2(g) + h2O in to ironic equation?
  6. Science

    Which conversion factor should be used to solve the following problem? How many moles of water (H2O) would be produced from the reaction of 3.25 moles of hydrochloric acid (HCl) reacting with excess calcium hydroxide Ca(OH)2? Ca(OH)2 +2HCl --> CaCl2 + 2H2O
  7. Chemistry

    Calcium carbonate reacts with HCl according to the following equation: 2HCl(aq)+CaCO3(s)→CaCl2(aq)+H2O(l)+CO2(g) How many moles of HCl are in 58 mL of 0.13 M HCl? What mass of calcium carbonate is needed for complete reaction with the HCl in (a)?
  8. Chemistry

    1. Calcium carbonate reacts with HCl according to the following equation: 2HCl(aq)+CaCO3(s)→CaCl2(aq)+H2O(l)+CO2(g) How many moles of HCl are in 65 mL of 0.15 M HCl? 2. What mass of calcium carbonate is needed for complete reaction with the HCl in (a)?
  9. Chemistry

    Consider the reaction in aqueous solution: 6 HCl + 2 KMnO4 + 5 H2O2 ---> 5 O2 + 2 MnCl2 + 2 KCl + 8 H2O 1.) Write the total ionic equation. 2.) Write the net ionic equation. 3.) For each species (molecule or ion) in the net ionic equation, assign oxidation
  10. Science

    Which conversion factor should be used to solve the following problem? How many moles of water (H2O) would be produced from the reaction of 3.25 moles of hydrochloric acid (HCl) reacting with excess calcium hydroxide Ca(OH)2? Ca(OH)2 +2HCl --> CaCl2 + 2H2O
  11. More Chemistry

    I have the answers, I just want to be sure...I'm a little hesitant.. 1. Explain how strong acid solutions conduct an electric current: -Strong acids readily release ions creating electro negativity. 2. Will a strong acid or weak acid conduct electricity
  12. Reaction Descriptions

    Complete the table below: Enter all letters containing appropriate descriptions for each of the equations below. a. precipitation reaction b. neutralization reaction c. oxidation reduction reaction d. molecular equation e. complete (total) ionic equation
  13. chemistry

    We are determining the molarity of HCl by titration of HCl. What would be the complete equation and the net ionic equation? THanks What are you titrating it with? Won't that make a difference in the equation we write? It's titration of HCl with NaOH.
  14. chemistry

    The reaction of limestone with hydrochloric acid is CaCO3+2HCl⟶CaCl2+CO2+H2O If the reaction produced 13.5 g CO2, how many grams of HCl reacted? despertate help needed, 61.3 g is wrong thank you!
  15. chemistry

    The balanced equation is shown below. 2 HCl(aq) +CaCO3(s)=CaCl2(aq) +H2O(l) +CO2(g) 2.00 dm3 of a 3.00 M hydrochloric acid solution is added to the kettle (this is an excess). During the reaction 1.20 dm3 of CO2 is produced (assume 250C and 1 atmosphere)
  16. chemistry

    write the word equation that corresponds to the following chemical equations 1) ch4(g)+o2(g)→co2(g)+h2o(g)↑+△ 2) caco3(s)+2hcl(aq)→cacl2(aq)+co2(g)+h2o(l) 3) Al(OH)3(aq)+3HCN(aq)→Al(CN)3(aq)+3H2O(l) 4)H2So3(aq)+2KOH(aq)+△→K2SO3(aq)+2H2O↑(g)
  17. Chem

    I was given a problem that my book did not explain how to do, so I attempted to figure it out myself. Let me know if my conclusion is fallacious. Given the reactions H2O(g) + CO(g) H2(g) + CO2(g), K= 1.6 FeO(s) + CO(g) Fe(s) + CO2(g), K= .67 Find K for the
  18. Chemistry

    Enter the balanced complete ionic equation for HCl(aq)+K2CO3(aq)→H2O(l)+CO2(g)+KCl(aq) Would it be: 2H+(aq) + 2Cl^-(aq) + 2K^+(aq) + CO3^2-(aq) => H2O(l) + CO2(g) + 2KCl(aq)? Thanks
  19. Chemistry

    which equation represents an oxidation-reduction reaction? 1.HCl+KOH-->KCl+H2O 2.4HCl+MnO2-->MnCl2+2H2O+Cl2 3.2HCl+CaCO3-->CaCl2+H2O+CO2 4.2HCl+FeS-->FeCl2+H2S
  20. Chemistry.

    Ca(HCO3)2(s) decomposes at elevated temperatures according to the stoichiometric equation Ca(HCO3)2(s)-> CaCO3(s) + H2O(g) + CO2(g) a.) If pure Ca(HCO3)2(s) is put into a sealed vessel, the air is pumped out, and the vessel and its contents are heated, the
  21. Chemistry

    I posted before about designing a procedure to determine two unknowns (1 solid, 1 solution). The possible solutions were: NaCl, CaCl2, CuSO4, NaOH,Ba(OH)2, HCl, HNO3, or H2O. The reagents given are: NaOH, HCl, AgNO3, Zn metal, Na2SO4, and H2O. The
  22. Chemistry

    For the reaction CaCO3(s)+ 2HCl(aq)= CaCl2(aq)+ CO2(g)+ H2O(l) how many grams of CaCl2 can be obtained if 14.6 g HCl is allowed in CaCO3?
  23. Chemistry

    Does the reaction between CO2(g) + Mg(OH)2(aq) produce MgCO3(s) + H2O(l) or Mg(HCO3)2 ??? Normally, Mg(CO3)2 but I suspect an excess of CO2 will produce the bicarbonate. For example, CO2(g) + Ca(OH)2(aq) ==> CaCO3(s) + H2O(l) and that is often done by
  24. Chemistry-help

    I am rather confused about writing ionic equations. 1) SOLID sodium carbonate reacts with hydrochloric acid to give NaCl,CO2 & H2O. Is the ionic equation CO32-(aq)+2H+(aq)-> CO2(g) + H2O(l)? Do I consider SOLID sodium carbonate to be in aqueous state since
  25. Chem

    In some solid calcium carbonate samples, calcium bicarbonate Ca(HCO3)2. Write a balanced equation for its reaction with hydrochloric acid. CaCO3 + HCL= Ca^2+ (aq) + HCL + Ca(HCO3)2 I don't know if I have written the reactions and products correctly?
  26. Chemistry

    OK I just need help with two final problems that I am stuck on: The problem states the calcium carbonate in limestone reacts with HCl to produce a calcium chloride solution and carbon dioxide gas CaCO3(s)+2HCl(aq)-->CaCl2(aq)+H2O(l)+CO2(g) 1)Find how many
  27. Chemistry

    What are the Oxidation and Reducation reactions for these equations : BaCl2 + NaHCO3 -> BaCO3 + NaCl + HCl (carbon is the reduction reaction, but I don't know what the oxidation reaction is) CaCO3 + HCl -> CaCl2 + CO2 + H2O
  28. Chemistry

    Write balanced complete ionic equation for HC2H3O2(aq) + K2CO3(aq)-----> H2O(l)+CO2(g)+KC2H3O2(aq) I put 2H+(aq)+2C2H3O2-2(aq)2K+(ag)+CO3-2(aq)------>H2O(l)+CO2(g)+2K+(aq)+C2H3O2-2(aq) and said it was wrong, but I got this part right. 2H+(aq)+CO3
  29. chemistry

    It's hydrogen carbonate, which is HCO3- Should the reactant be H2CO3? How do you balance this reaction?: HCO3 ---> H2O + CO2
  30. Science

    According to the following equation: CaCO3 + 2 HCl---> CaCl2 + H20 + CO2 How many grams of CO2 can be produced from the reaction of 20.0 mL of 0.400M HCl solution with excess CaCO3?
  31. AP Chem

    Complete and balance each of the following molecular equations, including phase labels, if a reaction occurs. Then write the net ionic equation. If no reaction occurs, write NR after the arrow. H2CO3(aq)+Sr(OH)2(aq) -> this is what I put but I think its
  32. chemistry

    write the net ionic equation of the following reaction: HCl(aq)+NaOH(aq)--> NaCl(aq)+H2O(l)
  33. CHEMISTRY

    You carefully weigh out 20.00 g of CaCO3 powder and add it to 81.00 g of HCl solution. You notice bubbles as a reaction takes place. You then weigh the resulting solution and find that it has a mass of 92.80 g . The relevant equation is
  34. Chemistry

    Limestone (CaCO3) emits CO2 gas when exposed to HCl. What is the theoretical yield of CO2 if 56.1 grams of limestone is completely dissolved in HCl? CaCO3(s) + 2 HCl(aq) R CaCl2(aq) + CO2(g) + H2O(l) a. 21.5 g b. 4.16 g c. 9.53 g d. 24.7 g
  35. Chemistry 1

    You carefully weigh out 17.00g of CaCo3 powder and add it to 68.85g of HCl solution. You notice bubbles as a reaction takes place. You then weigh the resulting solution and find that it has a mass of 78.88g . The relevant equation is CaCo3(s)+ 2HCl(aq)--->
  36. Chemistry

    Consider the following acid/base reaction CO3^2− + 2H^+ → H2O + CO2 that produces CO2 gas. 6 L of CO2 is collected at STP. What is the molarity of the HCl solution used in the reaction if 81 mL of HCl was needed?
  37. Chemistry

    What kind of reaction is for the following equation: CO2 + CaCO3 + H2O = Ca(HCO3)2 (ie is it a DDR, SDR, Synthesis, etc)
  38. Chemistry

    Write out the Ka and Kb for the biocarbonate ion with chemical equation: Would this be correct: HCO3^-(aq) H+(aq) + CO3^-2(aq) Ka = [H+][CO3-2]/[HCO3- H2O + CO3-2(aq) HCO3-(aq) + OH-(aq) Kb = [HCO3-][OH-]/[CO3-2] Or in my textbook there a chart that says:
  39. chemistry

    the reaction is......CaCO3+2HCl---->CO2+H2O+CaCl2. what mass of HCl will be neutralized by 0.50g ofCaCO3? How do i figure this out in a non-complicated way??
  40. Chemistry

    How do I do these? 1. Balance the equation for the reaction between zinc and hydrochloric acid. Zn + HCl ZnCl2 + H2 2. Balance the equation for the reaction between iron (steel wool) and oxygen (water). Fe + O2 Fe2O3 3. Balance the equation for the
  41. chemistry

    Write the balanced formula equation, complete ionic equation, and net ionic equation. If no precipitate forms, write "No reaction" a) Hg2(NO3)2 (aq) + CuSO4 (aq) b) Ni(NO3)2 (aq) + CaCl2 (aq) c) K2CO3 (aq) + MgI2 (aq) d) Na2CrO4 (aq) + AlBr3 Please
  42. Chemistry

    Is the equation of the chemical reaction that occurs when you blow your breath through boiling water? CO2 + H2O -> H + HCO3
  43. chemistry

    if the chemical equation is CaCO3(s) + 2HCl(aq) > CaCl2(aq) + H2O(l) +CO2(g) and represents the reaction of an antacid, CaCO3, with a acid,HCl. why might someone using this antacid experience discomfort due to gas pains?
  44. Science

    if the chemical equation is CaCO3(s) + 2HCl(aq) > CaCl2(aq) + H2O(l) +CO2(g) and represents the reaction of an antacid, CaCO3, with a acid,HCl. why might someone using this antacid experience discomfort due to gas pains?
  45. chemistry

    Calcium carbonate reacts with hydrochloric acid according to the following reaction: CaCO3 (s) + 2 HCl (aq) --> CaCl2 (aq) + H2O (l) + CO2 (g) How many grams of calcium carbonate would be required to neutralize 50.0 cm3 of 8.00 M HCl?
  46. Chemistry

    what is the 1. chemical equation 2. complete ionic equation 3. net ionic equation include phase of HCH3COO+NaHCO3 pls correct my answers 1. CH3COOH(aq)+NaHCO3(aq)+CH3COONa(aq)+H2O(l)+CO2(g) 2. CH3COOH(aq)+OH-(aq)=CH3COO-(aq)+H2O(l) 3. OH(aq)+CO2(g)
  47. chemistry

    Calcium carbonate CaCO3 reacts with stomach acid (HCl, hydrochloric acid) according to the following equation: CaCO3(s)+2HCl(aq)->CaCl2(aq)+H2O(l)+CO2(g) Tums, an antacid, contains CaCO3. If Tums is added to 35.0 mL of 0.300 M HCl,how many grams of CO2 gas
  48. Chemistry

    Given the reactant side of the total ionic equation for the neutralization reaction of ammonium hydroxide (NH4OH) with hydrochloric acid (HCl), write the total ionic equation (also known as the complete ionic equation) by entering both the reactant and the
  49. chemistry

    3. When a mixture of 10.0 grams of acetylene (C2H2) and 10.0 grams of oxygen (O2) is ignited, the resulting combustion reaction produces CO2 and H2O. A) Write a balanced equation for this reaction. B) What is the limiting reactant? C) How many grams of C2,
  50. Chemistry

    What is the ionic and net ionic equation for Na2CO3 + 2 HNO3 -> 2 NaNO3 + H2O + CO2 (g) This is what i have so far... Na2(aq)+CO3+H+NO3 -> Na+ NO3+ H2O(l)+CO2(g)... i don't know what to do!!!
  51. chemistry

    Write the balanced net ionic equation for the following reaction and determine the conjugate acid-base pairs. HNO3(aq)+Li2CO3(aq)LiNo3(aq)+LiHCO3(aq) Which component in the net ionic equation is the acid, the base, the conjugate base, and the conjugate
  52. chemistry

    Write the balanced net ionic equation for the following reaction and determine the conjugate acid-base pairs. HNO3(aq)+Li2CO3(aq)LiNo3(aq)+LiHCO3(aq) Which component in the net ionic equation is the acid, the base, the conjugate base, and the conjugate
  53. chemistry

    Balanced equation: 2HCL+CaCO2>CaCl2+CO2+H2O what volume of 6.00 M HCL is needed to completely react with .750 moles of CaCO3
  54. chemistry

    Balanced equation: 2HCL+CaCO2>CaCl2+CO2+H2O what volume of 6.00 M HCL is needed to completely react with .750 moles of CaCO3
  55. Chemistry

    For which reaction is delta Ssys > 0? A) CH4(g) + 2 O2(g) �¨ CO2(g) + 2 H2O(l) B) NH3(g) + HCl(g) �¨ NH4Cl(s) C) 2 NH4NO3(s) �¨ 2 N2(g) + O2(g) + 4 H2O(g) D) HCl(aq) + NaOH(aq) �¨ NaCl(aq) + H2O(l)
  56. Chemistry

    Given the reactant side of the total ionic equation for the neutralization reaction of ammonium hydroxide (NH4OH) with hydrochloric acid (HCl), write the total ionic equation (also known as the complete ionic equation) by entering both the reactant and the
  57. CHEMISTRY

    . For which reaction is ƒ´Ssys ƒ® 0? A) CH4(g) + 2 O2(g) ¡÷ CO2(g) + 2 H2O(l) B) NH3(g) + HCl(g) ¡÷ NH4Cl(s) C) 2 NH4NO3(s) ¡÷ 2 N2(g) + O2(g) + 4 H2O(g) D) HCl(aq) + NaOH(aq) ¡÷ NaCl(aq) + H2O(l)
  58. chemistry

    how to prepare CO from this equation in the lab CaCo3 + 2HCl → CaCl2+H2O+ CO2 (g) Or CaCo3 ----(Heat 500 to 600 C0→ Cao +Co2 (g) 2- CO2 + H2 → CO (s) + H2O(g)
  59. science( chem)

    The total Carbon dioxide content (HCO3- + CO2) in a blood sample is determined by acidifiying the sample and measuring the volume of CO2 evolved with a van slyke manometric apparatuses. The total concent was determined to be 28.5 mmol/L. The blood pH at
  60. Chemistry--please check

    1. Which is true about spontaneous reactions? a. For a reaction to be spontaneous, Keq = 1. b. Spontaneous reactions happen very rapidly. c. A chemical reaction is spontaneous in both directions. *** d. Spontaneous reactions do not require that anything be
  61. Science/Chemistry

    Write a Balanced equation for the chemcial reaction Acetylene gas (C2H2) burns in a welding torch with oxygen to form carbon dioxide gas and water vapor. C2H2(g) + O2(g) ==> CO2(g) + H2O(g) It isn't balanced. I will leave that for you. How do i balance it?
  62. chemistry

    Carbon dioxide (CO2) reacts with water (H2O) to form carbonic acid (H2CO3). Which equation demonstrates the law of conservation of matter for this reaction? A. 2 CO + H2O —> H2CO3 B. CO2 + H2O —> H2CO3 C. CO2 + 2 H2O —> 2 H2CO3 D. 2 CO2 + 2 H2O —>
  63. Chemistry

    A solution made up of 1.00 M NH3 and 0.500 M (NH4)2SO4 has a pH of 9.26. a. Write the net ionic equation that represents the reaction of this solution with a strong acid. b. Write the net ionic equation that represents the reaction of this solution with a
  64. chemistry

    Reaction: CaCO3 + 2 HCl -> CaCl2 + CO2 + H2O Calculate the molarity of hydrochloric acid solution if an initial mass of 4.568g of CaCO3 was reacted with 25.0mL of the acid and 2.678g of CaCO3 remain after the reaction is complete.
  65. chemistry

    How do you write a net ionic and complete ionic equation for the reaction HClO4 + Mg(OH)2 --> MgClO4 + H2O?
  66. Chemistry- acids and bases

    Given the following neutralization raction: HCO3^- + OH^- CO2[over]3^- + H2O a. label the conjugate acid-base pairs in this system b. is the forward or reverse reaction favored? Explain. Write net ionic equations that represent the following ractions: a.
  67. Chemistry

    For the reaction 1 CaCO3(s) + 2 HCl(aq) 1 CaCl2(aq) + 1 H2O(l) + 1 CO2(g) Calculate K, the equilibrium constant, from thermodynamic data at 293 K. (Hint #1: Assume that S and H do not change with temperature.) (Hint #2: Work in J/mol)
  68. Chemistry

    NaHCO3 + HCl = NaCl + H2O + CO2 The HCl in the reaction is 2 molar what i need it to figure out how much CO2 if produced when 10g of each substance is mixed. And the limmiting reagent and any information that can be produced around the ammount of CO2
  69. Chemistry

    In aqueous solution, hydrochloric acid, HCl, and sodium carbonate, Na2CO3 react to produce gaseous carbon dioxide, CO2, water, H2O and sodium chloride, NaCl. A 10.0 g impure sample of Na2CO3 is dissolved completely in water; then treated with 3.00 mol
  70. chemistry check

    A) Write a balanced chemical equation for the reaction between sulfuric acid and potassium hydroxide. I got H2SO4 + KOH ---> H2OH + KSO4 B) Write the ionic equation for the reaction. H2 + S2O4-2 + K + OH- ---> H2 + OH + K2SO4-2 C) Write the net ionic
  71. Chemistry

    If a tablet of TUMS contains 500mg of the active ingredient, CaCO3, how many tablets would it take to neturalize the 1.5g of HCl? From balanced equation: CaCO3 + 2HCl = CaCl2 + H2O + CO2
  72. Chemistry

    A 0.450-gram sample of impure CaCO3(s) is dissolved in 50.0 mL of 0.150 M HCl(aq). The equation for the reaction is: CaCO3(s)+2HCl(aq) -> CaCl2(aq) + H2O(l) + CO2(g) The excess HCl(aq) is titrated by 9.75 mL of 0.125 M NaOH(aq). Calculate the mass
  73. Chemistry

    What are the correct and accurate products for the following ion combination reaction? Then write the ionic form of the reaction and the net ionic form of the reaction. K2CO3 + CaCl2 ->
  74. Chemistry

    Please help me answer the question: What does it mean Write a net ionic equation for the reaction 2HCl + Ca(OH)2 -> CaCl2 + 2H20
  75. chemistry

    equilibrium constant expression of CaCO3(s) + 2 HCl(aq) --> CaCl2(aq) + CO2(g) + H2O(l)
  76. Chemistry, reactions w/ water

    Write the equation for the reaction of each of the following with water. a) HCl b) CH3COOH c) NaOH d) NH3 Are these correct? a. HCl (aq) + H2O (l) --> H3O+ (aq) + Cl- (aq) b. CH3COOH (aq) + H2O (l) --> CH3COO- (aq) + H3O+ (aq) c. NaOH (aq) + H2O (l) -->
  77. NEED HELP!

    A mixture contained CaCO3 and MgCo3. A sample of this mixture weighing 7.85g was reacted with excess HCl. The reactions are-- CaCO3 + 2HCl --> CaCl2 + H2O + CO2 MgCO3 + 2HCl --> MgCl2 + H2O + CO2 Is the sample reacted completely and produced 1.94L of CO2,
  78. chemistry help!

    A mixture contained CaCO3 and MgCo3. A sample of this mixture weighing 7.85g was reacted with excess HCl. The reactions are-- CaCO3 + 2HCl --> CaCl2 + H2O + CO2 MgCO3 + 2HCl --> MgCl2 + H2O + CO2 Is the sample reacted completely and produced 1.94L of CO2,
  79. Chemistry

    I need to know how to right a net ionic equation for the following chemical reaction: 5 H2C2O4 + 3 H2SO4 + 2 KMnO4 = K2SO4 + 2 MnSO4 + 8 H2O + 10 CO2
  80. chemistry

    balance equation CA(HCO3)2(aq) = CaCO3(s) + H2O(l) =CO2(g)
  81. chemistry

    Which of the following chemical reactions represents a neutralization reaction? A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl C. NH3 + H2O NH4++ OH- D. CH3COOH + H2O CH3COO- + H3O+
  82. Chemistry

    Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide
  83. chemistry

    could someone check my answers to see if they are right? Balance the following equation and give the value of the stoichiometric coefficient marked with a question mark. 6 KNO3+ _ S + ? H2O _ H2SO4+ _ N2+ _ K2SO4 answer:6KNO3 + 5S + 2H2O --> 3 K2SO4 + 3N2
  84. Chemistry

    a 110 g solid sample that is a mixture of CaCO3 and CaCl2 is reacted with 1.50 L of 1.45M HCl. Of the calcium salts, only calcium carbonate reacts with HCl- the reaction forms CaCl2 and CO2. The excess/unreacted HCl requires 0.850 L of 0.543 M NaOH to
  85. chemistry

    Consider the following reaction: Na2CO3 + NiCl2 �¨ NiCO3 + 2NaCl Using the solubility rules determine the solubility of all reactants and products. Explain your answer Please. Which product is the precipitate in this reaction? Write the complete ionic
  86. Physical Science

    In a certain reaction 1.5 mol of CO and 1.5 mol of H2O are placed in a 2,0 dm3 sealed vessel. Equilibrium is established at a temperature of 1 000 C. The equilibrium reaction equation is CO(g) + H2O(g) = CO2(g) + H2(g) The value of Kc for this reaction is
  87. chemistry

    The standard enthalpy of formation at 298k for ccl4,h2o,co2,hcl are -22.5,-57.8,-94.1 and-22.1 kcal/mol.calculate ▲rH FOR reaction ccl4+2h2o→co2+HCL
  88. analytical chemistry

    a 0.4617g sample containing sodium bicarbonate was dissolved and titrated with standard 0.106M of hydrochloric acid solution , requiring 40.72ml. the reaction is: HCO3- + H+ -> H2O + CO2 Calculate the percent sodium bicarbonate in the sample. (Given
  89. Chemistry

    NaCl [Symbol] Na + Cl2 Type of reaction: synthesis KOH + HNO3 [Symbol] HOH + KNO3 Type of reaction: double replacement Ca + S [Symbol] CaS Type of reaction: synthesis BaBr2 + Cl2 [Symbol] BaCl2 + Br2 Type of reaction: Cs2 + H2O [Symbol] CsOH + H2 Type of
  90. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing
  91. chemistry

    A mixture of CaCO3 and MgCO3 weighing 7.85 g was reacted with excess HCL. The reactions are CaCO3+2HCL=CaCl2+H2O+CO2 and MgCO3+2HCl=MgCl2+H2O+CO2. The sample reacted completely to produce 1.94 L CO2 at 25 degrees C and 785 torr. Calculate the percentage of
  92. Chemistry

    Formula: CaCO3(s) + HCl(aq) --> CO2(g) + CaCl2(aq) + H2O How many grams of CO2 can be made by reacting 125 g of CaCO3 with 125 grams of HCl?
  93. chemistry

    A 1.0 L reaction vessel contained 0.750 mol of CO(g) and 0.275 mol of H2O(g). After 1.0 h, equilibrium was reached. Analysis showed that 0.25 mol of CO2(g) was present. The equation for the reaction is: CO(g) + H2O(g) ↔ CO2(g) + H2(g) Find Keq for the
  94. Biochemistry

    The pH of arterial blood is 7.42. When 10 mL of the blood is acidified, 5.91 mL of CO2 is produced. 1) what is the total concentration of CO2 in the blood [CO2]+[HCO3-]? The experimental value for the volume of one mole of CO2 is 22.26 L/mol. 2) What are
  95. chemistry

    what is the method to prepartion CO from these equation in the lab CaCo3 + 2HCl → CaCl2+H2O+ CO2 (g) Or CaCo3 ----(Heat 500 to 600 C0→ Cao +Co2 (g) 2- CO2 + H2 → CO (s) + H2O(g) i have CaCo3 powder and i do not have any idea how to work in lab???
  96. Honors Chemistry

    How do I write a complete ionic equation and net ionic equation for: 2HCl(aq)+Ca(OH)2(aq) �¨ 2H2O(l)+CaCl2(aq) ?
  97. Chemistry

    carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= 4.5 x 10^-7). Ignoring
  98. chemistry

    carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= 4.5 x 10^-7). Ignoring
  99. chemistry check

    1. 48 KNO3+ _ C 12 H22O11-„³ ? CO2+ _ N2+ _ K2CO3+ _ H2O a. 12 b. 24 s c. 36 d. 48 The reaction is 48 KNO3 + 5 C12H22O11 --> 24 K2CO3 + 36 CO2 + 55 H2O + 24 N2 So the answer is C =36 2. 6 KNO3+ _ S + ? H2O„³ _ H2SO4+ _ N2+ _ K2SO4 a. 2 b. 4 c. 6 d. 8
  100. Chemistry

    When a mixture of 13.0 g of acetylene (C2H2) and 13.0 g of oxygen (O2) is ignited, the resultant combustion reaction produces CO2 and H2O. A)Write the balanced chemical equation for this reaction. B)Which is the limiting reactant? Express in chemical

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20