Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to ΔHf° [NH3(g)]

57,665 results
  1. chemistry

    Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  2. chemistry

    Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  3. chemistry

    Consider the following reagents: zinc, copper, mercury (density: 13.6 g/mL), silver nitrate solution, nitric acid solution. a. Given a 500-mL Erlenmeyer flask and a balloon can you combine two or more of the foregoing reagents to initiate a chemical

  4. Enthalypy Reaction

    What is the standard enthalpy of reaction for the following chemical reaction? CO2(g) + 2KOH(s) --> H2O(g) + K2CO3 (s) Express your answers numerically in kJ.

  5. chemistry

    Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  6. chemistry BOB

    is this the answer to B ) CH3CH2OH + 3O2 → 2CO2 + 3H2O In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion

  7. Physical Science

    Which of the following statements are true about chemical reactions? Check all that apply. A. Reactants are on the right when writing a chemical reaction. B. Products are produced in a reaction. C. Reactants are present at the end of a reaction. D.

  8. Chemistry

    When a mixture of 13.0 g of acetylene (C2H2) and 13.0 g of oxygen (O2) is ignited, the resultant combustion reaction produces CO2 and H2O. A)Write the balanced chemical equation for this reaction. B)Which is the limiting reactant? Express in chemical

  9. chemistry

    Examine the scenario. Chemical Reaction A and Chemical Reaction B involve the same two reactants. Chemical Reaction A is performed in a hot container, while Chemical Reaction B is performed in a cold container. Which of the answer choices correctly

  10. chemistry

    Write a balanced chemical reaction to show the dissociation of solid magnesium chloride (MgCl2) in water, indicate states of the reactants and products

  11. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on the oxidation states for

  12. Chemistry (Help)

    For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each

  13. Chemistry

    Using the activity series (Table 4.5), write balanced chemical equations for the following reactions. If no reaction occurs, simply write No Reaction. Chromium metal is immersed in an aqueous solution of cobalt(II) chloride.

  14. chemistry

    a) Describe how to determine if a reaction will be thermodynamically favorable. b) Describe what happens to the Gibbs Free Energy term when a chemical reaction is reversed. c) Describe how coupling reactions are used to drive an unfavorable chemical

  15. chem

    Magnesium can react with aqueous nitric acid, HNO3, to form hydrogen gas and magnesium nitrate. Write down the balanced chemical equation for this reaction, remembering to use the state symbols.

  16. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing

  17. biology

    Which of the following is true about the relationship between energy and chemical reactions? Activation energy is required for a chemical reaction to occur. Activitation energy is not necessary in a chemical reaction which releases energy. Chemical bonds

  18. Chemistry

    Write balanced chemical equations for all transferals of the compounds from organic to aqueous phases and for all precipitation reactions. **Note: If a compound does not move from one layer to another, no reaction has occurred, and no equation can be

  19. Calculus

    A chemical reaction proceeds in such a way that after the first second, the amount of a certain chemical involved in the reaction changes at a rate that’s inversely proportional to the product of the mass of the chemical present (in grams) and the time

  20. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

  21. Chemistry

    1. The delta Hf of an element in its standard state is defined to be a) 0 kJ/mol b) 10 kJ/mol c) -10 kJ/mol d) greater than 0 kJ/mol e) a unique value for each element I am assuming its a? 2. Which of the following statements are true? I) The reaction

  22. Chemistry-Dr.Bob

    Since most chemical reactions are conducted in containers open to the armisphere, why is the energy transfer associated with a chemical reaction generally expressed as the change in enthalpy? Is it because the enthalpy of reaction measures the change in

  23. chemistry

    What is the difference between biochemical, pharmaceutical, and diagnostic chemical reactions in healthcare? What is a specific example that exists for each of these chemical reaction types above and why might it be of importance to healthcare

  24. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing

  25. chemistry

    Need Help Finishing: Purpose: • To observe a chemical reaction. Materials: • Vinegar (acetic acid, CH3COOH) • Baking soda (NaHCO3) • Measuring cups and spoons • Cup Procedure: 1. Place ½ cup of vinegar in the cup. 2. Add 1 tablespoon on baking

  26. Chemistry

    What is the difference between a chemical change and a chemical reaction?? My answer: A chemical change leads to a solidifed chemical reaction but more or less they are the same thing because it's a change in which one or more pure substances are converted

  27. Chemistry

    1a). If you react 16 mol A with 15 mol B in the reaction 4A + 3B → 2C, what is the limiting reactant? 1b). What is the theoretical yield of product C in mol? 3a.) If Pb(NO3)2 were the limiting reactant in this reaction: Pb(NO3)2(aq) + 2KI(aq) → PbI2(s)

  28. CHEMISTRY!!!!

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  29. chemistry

    A 31.5 ml aliquot of H2SO4 of an unknown concentration was titration with 0.0134 M NaOH. write the balanced chemical reaction with the correct states of matter.

  30. chemistry

    what are some the different types of chemical reactions that occur on a daily basis our lives? wouldnt there be many? eating, taking medications, would emotion be or cause chemical reaction? All of the above. Add breathing. Don't forget the cars we drive,

  31. Chemistry - please help

    1. Write the balanced chemical equation for the single displacement reaction of magnesium and sodium thiosulfate. Is this right? 6Mg + (S*2*O*3)*2 -> 6MgO + 2S*2 2. Write the balanced chemical equation for the double displacement reaction of hydrogen

  32. Chemistry

    Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the

  33. chemistry DR BOB!

    is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a

  34. chemistry

    Based on the following chemical equation, answer the questions below. Show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide is as follows: H2S(g)+I2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced

  35. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

  36. science

    Magnesium can react with aqueous nitric acid, HNO3, to form hydrogen gas and magnesium nitrate. Write down the balanced chemical equation for this reaction, remembering to use the state symbols.

  37. Physics- Energy Released In Chemical Reaction

    The reaction between two hydrogen isotopes is shown below: 2H + 3H → 4He + n + energy released The energy released in this reaction is: a.equal to that in a fission reaction b.equal to that in a chemical reaction. c.less than that in a chemical reaction.

  38. Chemistry

    The lab we are doing is: Determining the ENTHALPY of a Chemical Reaction. There are three reactions. Reaction 1: NaOH + HCl, Reaction 2: NaOH + NH4Cl, and Reaction 3: HCl + NH3. I found the max temp, initial temp, and temp change of each reaction. Can you

  39. chemistry

    write a balanced chemical reaction for the reaction of aqueous magnesium chloride with aqueous potassium phosphate to form solid magnesium phosphate (Mg3(PO4)2) and aqueous potassium chloride (KCl). Indicate the physical states of the reactants and

  40. Science

    Write the balanced chemical reactions using the appropriate symbols​

  41. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to ΔHf° [NH3(g)]

  42. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to and defined by the quantity dHformation [NH3(g)] N2(g) + 3H2(g) --> 2NH3(g) Is that all the question is asking for?

  43. Chemical Equations

    Starting with nitrogen and hydrogen, millions of kilograms of ammonia are produced every year for use as a fertilizer. Use this info to answer the next 3 questions. Communicate the balanced chemical equation using molecular models. Communicate the balanced

  44. chemistry

    is this the answer to B ) CH3CH2OH + 3O2 → 2CO2 + 3H2O In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a combustion

  45. Chemistry

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  46. chemistry

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  47. chemistry help!!!

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  48. Chemistry

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  49. CHEMISTRY!!!!

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  50. chemistry help!

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  51. chemistry help!!!

    In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with balancing the

  52. chemistry DR BOB

    is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2. Write a

  53. chemistry

    help!!!! is this the answer to B ) C2H5OH(liq)+ 3O2(g) --> 2CO2(g) +3H2O(liq) In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and ethanol are "burned" to water vapor andCO2.

  54. Chemistry

    Hello, I really don't understand how to find the grams of moles in some of these reactions. If someone could help I would appreciate it. 1) Balance the following chemical reaction and determine the number of moles of HI produced when 2.33 moles of H2(g)

  55. Chemistry

    Based on the following chemical equation answer the question below show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide h2s(g)+i2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams

  56. chemistry

    A 31.5 ml aliquot of H2SO4 of an unknown concentration was titration with 0.0134 M NaOH. write the balanced chemical reaction with the correct states of matter.

  57. Chemistry

    For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each

  58. Chemistry Dr. BOB

    I don't get it!! In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for ethanol. I need help with

  59. chem need assistance

    Write a balanced chemical reaction to show the reaction between ammonium and a chlorite? Is this correct? 2NH3 + CLO2 + H2O ⇒ NH4Cl + NH2O2

  60. chemistry

    what would the written chemical reaction be to this problem? How many grams of hydrochloric acid should we use so we have exactly enough to react with 40g of sodium hydroxide? You'll need to write a chemical reaction, balance it, and then perform your

  61. Minoxidil

    So, I'm doing a research project for my chemistry class, and one of the parts that I have to answer is the chemical reaction of the substance that I'm researching. But there's a problem. I've searched every single website regarding minoxidil, but I cannot

  62. Chemistry

    In the reaction of 2.75 g of magnesium metal with excess hydrochloric acid, what volume of hydrogen gas will be produced by the reaction if the lab occurs at 25.0oC and 765 torr? (Hint: write a balanced chemical reaction first and do stoichiometry, then

  63. chemistry Dr BOB

    is this right? C2H6O + 3O2 = 2CO2 + 3H2O In winemaking, the sugars in grapes undergo fermentation by yeast to yield CH3CH2OH and CO2. During cellular respiration, sugar and enthanol are "burned" to water vapor andCO2. Write a combustion reaction for

  64. CHemistry

    The first step of the synthesis is described by the reaction below. When 1.200 g of Fe(NH4)2(SO4)2 6H2O is mixed with 13 mL of 1.0 M H2C2O4, the theoretical yield of FeC2O42H2O is ? grams im not sure what to do. do u convert 1.0M to grams first? by

  65. chemistry

    an ezyme -catalysed reaction was carried out in a solution buffered with 0.05 M phosphate ph 7.2 . As a result of the reaction ,0.06M of acid was formed. (phosphoric acid has three pka values. The one required for this calculation is pka2=7.2). 1) what was

  66. science

    Hydrogen Cyanide (boiling temperature 26 degrees Celsius) is an important chemical for the production of nylon and various transparent plastics. It is produced on an industrial scale by the oxidation of methane in the presence of ammonia. The equation

  67. Chemistry - enthalpy and rate constant (check)

    22. The rate of a chemical reaction is dependent on its ΔH. Do you agree or disagree with this statement? Briefly justify your answer. I agree with the above statement, enthalpy is defined as the internal energy of the reactants and products therefore the

  68. chemistry

    1-Butene (CH2=CHCH2CH3) burns in the presence of O2 to produce CO2 and H2O. Write the balanced chemical equation for this reaction (omit physical states and use condensed molecular formulas). CH2CHCH2CH3+6O2=4CO2+4H2O

  69. chemistry

    Please help me!!! Write a balanced chemical equation for oxidation-reduction reaction of fluorene

  70. chemistry

    write a balanced chemical reaction representing the combustion of hexane? C6H14

  71. anatomy and physiology

    1)Provide the name and chemical symbol of 4 chemical elements you find in the human body. Select 1 of the 4 chemical elements, make the drawing of the atom and label the nucleus, protons, neutrons and electrons. 2)Make a drawing showing the molecular

  72. Chemistry

    Write a balanced chemical equation for each single replacement reaction. A) Au(s) + KNO3(aq) ==> ??? B) Al(s) + H2SO4(aq) ==> ???

  73. chemistry

    write the balanced chemical equation for the reaction that occurs when BaCl2.2H2O is heated.

  74. Chemistry

    Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide

  75. Chemistry

    Answer check: Define a catalyst and explain a catalyst's role in a chemical reaction. A catalyst is a substance that speeds a chemical reaction without being permanently changed itself. It works by providing a convenient surface for the reaction to occur.

  76. chemistry

    What is the complete ionic equation for the double displacement reaction: CuNO3(aq) + K2S(aq)= what is the chemical name and formula of this chemical reaction? plsss. need help

  77. Chemistry

    Potassium is a reactive element. Bromine is a reactive element. Write the complete balanced chemical equation using appropriate chemical symbols for the reaction when potassium reacts with bromine to make a solid product showing correct symbols and states

  78. Chemistry

    Write a balanced chemical reaction showing how the 4.99 g Sn dissolves in HNO3.

  79. Chem 3A

    please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?

  80. Cemistry

    Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the

  81. Chemistry

    The enthalpy of formation for a substance corresponds to the enthalpy change for a reaction. Write the specific chemical reaction defining the enthalpy of formation of butane: Just checking to make sure this is correct: 4C + 5H2 ---> C4H10

  82. Chemistry

    What type of reaction may be occurring when a person's skin develops a green stain beneath a 14 K gold bracelet? Using HA as the chemical formula for acid in skin, write a balanced chemical equation to represent the reaction.

  83. chemistry

    so I don't expect you to answer all of these I just don't understand how they work so if someone could just explain one or two so I can do the rest that would be helpful! Thanks! Use the activity series to predict whether the following reaction will occur.

  84. chemistry

    write a balanced chemical equation for the following reaction including states not complete; no question.

  85. chem help

    i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation for: sodium sulfate

  86. chemistry 20

    A student mixed a solution of aqueous calcium chloride with an aqueous solution of magnesium sulphate. A precipitate formed. 1) Write the balance chemical equation for the reaction including states of matter. Ensure you write the reactants as a dissociated

  87. Chemistry

    in a neutralization reaction, dilute tetraoxosulphate (vi) acid completely reacted with sodium hydroxide solution.write a balanced chemical equation for the reaction

  88. Chemistry

    Diborane and related compounds were proposed as rocket fuels in 1950s. A representative reaction for this class of molecules that B2H6 and O2. Write the balanced chemical reaction

  89. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this happen? Thanks. Oh and what is

  90. Chemistry

    Write the balanced chemical equation for each of the following. (Use the lowest possible coefficients. Include states-of-matter at 1 atm and 25unknown_prefixC in your answer.) (b) the reaction of magnesium metal and hydrobromic acid

  91. chemistry

    What is the balanced chemical equation of Shampoo? And what is the chemical reaction of it? Please i need a help ASAP! Thank you!

  92. chemistry

    Answer the following questions based on the following electrochemical reaction: Al(s) + Cu 2+(aq) Cu(s) + Al3+ (aq) Write the balanced chemical equation for this cell. I'm confused.. how would this be balanced?

  93. chem

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction.

  94. Chemistry

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction. I'm not

  95. Chemistry

    Write a chemical reaction showing an amphiprotic anion reacting as a base in water. Thank-you

  96. Chemistry

    Suppose you tired to carry out a double-replacement reaction by mixing together equal volumes if a solution that contained dissolved NaF and a solution NaCl. Would you expect a reaction, if Si write the balanced chemical equation

  97. chemistry

    write the balanced chemical equation for the reaction that would occur ewhen a base is added to a solution containing H2PO4-/HPO4^2- buffer system can you please help we write this balanced equation. thank you

  98. Chemistry

    Write a balanced chemical equation for single eisplacement reaction. Al+H2SO4

  99. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

  100. chem

    Wwrite a balanced equation for the following chemical processes: the reaction between NaOH an dsalicyclic acid; the reaction between HCl and socium benzoate.

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20