Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

74,126 results
  1. chemistry

    Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  2. Chem

    Separate the following balanced chemical equation into its total ionic equation. AgNO3​(aq)+NaCl(aq) --> NaNO3​(aq)+AgCl(s) (List the ions in order of the above equation.) Write the net ionic equation for the reaction above. (Make sure the cation is

  3. Chemistry

    Write the balanced chemical equation for the reaction of the weak acid HCN with water. Include the phase of each species.

  4. chemistry

    Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  5. chemistry

    Consider the following reagents: zinc, copper, mercury (density: 13.6 g/mL), silver nitrate solution, nitric acid solution. a. Given a 500-mL Erlenmeyer flask and a balloon can you combine two or more of the foregoing reagents to initiate a chemical

  6. chemistry

    Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation. Identify all of the phases

  7. Chemistry

    Write a balanced chemical equation for the reaction of propylamine with water. Is propylamine --> CH3CH2CH2NH2? Is the equation CH3CH2CH2NH2 + H2O --> CH3CH2CH2NH3+ + OH- right? Isn't this balanced?

  8. chemistry

    Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  9. Chemistry

    When a mixture of 13.0 g of acetylene (C2H2) and 13.0 g of oxygen (O2) is ignited, the resultant combustion reaction produces CO2 and H2O. A)Write the balanced chemical equation for this reaction. B)Which is the limiting reactant? Express in chemical

  10. AP Chemistry

    Hydrogen gas is blown over hot iron (ii) oxide. a. Write the balanced reduction half reaction that occurs. b. Write the balanced oxidation half reaction that occurs. c. Write the balanced net ionic equation for this reaction.

  11. chemistry

    Write a balanced chemical equation for the reaction that occurs when the hydrocarbon styrene, {\rm C}_{8}{\rm H}_{8}(l), is combusted in air.

  12. AP Chem

    Write the half reactions and the balanced equation for the galvanic cell Hg(ℓ)| Hg2+ 2 (aq)|| MnO− 4 (aq), Mn2+(aq), H +(aq)| Pt(s). What is the smallest possible integer coef- ficient of H+(aq) in the combined balanced equation?

  13. chemistry

    The reaction of aqueous barium bromide and aqueous lithium carbonate is represented by the balanced net ionic equation. Ba2+(aq) + CO32-(aq) → BaCO3(s) Give the balanced formula equation for the reaction. Include the states.

  14. Chemistry

    The reaction of aqueous sodium bromide and aqueous lead(II) nitrate is represented by the balanced net ionic equation. 2Br-(aq) + Pb2+(aq) → PbBr2(s) Give the balanced ionic equation for the reaction. Include the states.

  15. Chemistry!!

    1) Write balanced chemical equation for the oxidation of Fe^2+(aq) by S2O6^2-(aq)? 2)Write balanced chemical equation for the oxidation of Fe^2+ by N2O 3)Write balanced chemical equation for the oxidation of Fe^2+ by VO2+

  16. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on the oxidation states for

  17. Chemistry (Help)

    For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each

  18. Chemistry

    Consider the following unbalanced equation. H1+(aq) + Fe(s) H2(g) + Fe2+(aq) What is the balanced oxidation half-reaction? What is the balanced reduction half-reaction? What is the balanced overall cell reaction?

  19. cHEMISTRY

    The reaction of aqueous iron(II) sulfate and aqueous barium nitrate is represented by the balanced net ionic equation. SO42-(aq) + Ba2+(aq) → BaSO4(s) Give the balanced formula equation for the reaction. Include the states.

  20. Chemistry

    When iron metal reacts with oxygen, the reaction can form Fe2o3 (numbers are subscripts). Write a balanced chemical equation for this reaction and find the number of moles of oxygen that are needed to form 6 mol of Fe2o3. Show your work. I am really stuck

  21. chemistry

    The reaction of aqueous cobalt(II) iodide and aqueous lead(II) nitrate is represented by the balanced formula equation. CoI2(aq) + Pb(NO3)2(aq) → PbI2(s) + Co(NO3)2(aq) Give the balanced ionic equation for the reaction. Include the states.

  22. Chemistry1

    The questions asks to write a word equation and a balanced chemical equation for a reaction between aqueous copper (ii) sulfate and solid iron. Assume that iron forms the Fe2+ ion.) Include proper states of matter after each substance (s, l, g, aq). Here

  23. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

  24. chemistry

    Pt(s) | H2(g) | H+(aq) || SO42-(aq) | PbSO4(s) | Pb(s) Which balanced chemical equation, for an overall reaction, corresponds to this cell notation?

  25. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing

  26. Chem Help!

    I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide forms from hydrogen and

  27. chemistry

    The reaction of aqueous iron(III) bromide and aqueous lithium phosphate is represented by the balanced ionic equation. Fe3+(aq) + 3Br-(aq) + 3Li+(aq) + PO43-(aq) → FePO4(s) + 3Li+(aq) + 3Br-(aq) Give the balanced formula equation for the reaction.

  28. Chemistry

    Write balanced chemical equations for all transferals of the compounds from organic to aqueous phases and for all precipitation reactions. **Note: If a compound does not move from one layer to another, no reaction has occurred, and no equation can be

  29. chemistry

    Write the equations describing the electrode reactions and the net cell reaction for this electrochemical cell containing indium and cadmium: This is what I have so far: anode: In(s) --> In^3+ + 3e- cathode: Cd^2+ + 2e- --> Cd (s) Need help writing the

  30. Chemistry

    "A voltaic cell is constructed by immersing a strip of sillver metal in a 1.0 MAgNO3 solution and a strip of cadmium metal in a 1.0M Cd(NO3)2 solution. The circuit is completed by a wire and a salt bridge in the usual way. a. Write the balanced overall

  31. Chemistry

    1a). If you react 16 mol A with 15 mol B in the reaction 4A + 3B → 2C, what is the limiting reactant? 1b). What is the theoretical yield of product C in mol? 3a.) If Pb(NO3)2 were the limiting reactant in this reaction: Pb(NO3)2(aq) + 2KI(aq) → PbI2(s)

  32. chemistry

    Need Help Finishing: Purpose: • To observe a chemical reaction. Materials: • Vinegar (acetic acid, CH3COOH) • Baking soda (NaHCO3) • Measuring cups and spoons • Cup Procedure: 1. Place ½ cup of vinegar in the cup. 2. Add 1 tablespoon on baking

  33. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing

  34. chemistry

    What is the difference between biochemical, pharmaceutical, and diagnostic chemical reactions in healthcare? What is a specific example that exists for each of these chemical reaction types above and why might it be of importance to healthcare

  35. Science

    Write the balanced chemical equation for the following reaction: A piece of zinc is added to an aqueous solution of copper (II) sulfate

  36. physical science with earth science

    Write a balanced chemical equation for the reaction for propane C3H8 burning in oxygen to for carbon dioxide and water vapor

  37. Chemistry - please help

    1. Write the balanced chemical equation for the single displacement reaction of magnesium and sodium thiosulfate. Is this right? 6Mg + (S*2*O*3)*2 -> 6MgO + 2S*2 2. Write the balanced chemical equation for the double displacement reaction of hydrogen

  38. chemistry

    Based on the following chemical equation, answer the questions below. Show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide is as follows: H2S(g)+I2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced

  39. Chemistry

    The reaction of aqueous barium hydroxide and aqueous sodium sulfate is represented by the balanced net ionic equation. Ba2+(aq) + SO42-(aq) → BaSO4(s) Give the balanced ionic equation for the reaction. Include the states.

  40. college chem

    Two questions where I have to write a balanced net ionic equation. 1. Write a balanced net ionic equation for the reaction that occurs when aqueous solutions of sodium chromate and silver nitrate are mixed 2. Write a balanced net ionic equaion reaction for

  41. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

  42. Chemistry

    The reaction of aqueous aluminum sulfate and aqueous calcium nitrate is represented by the balanced ionic equation. 2Al3+(aq) + 3SO42-(aq) + 3Ca2+(aq) + 6NO3-(aq) → 3CaSO4(s) + 2Al3+(aq) + 6NO3-(aq) Give the balanced formula equation for the reaction.

  43. ap chemistry

    Write the half reactions and the balanced equation for the galvanic cell Hg(ℓ)|Hg2+2(aq)||MnO4(aq),Mn2+(aq),H+(aq)|Pt(s). What is the smallest possible integer coefficient of H2O(ℓ) in the combined balanced equation?

  44. Chemistry

    Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the

  45. AP Chemistry

    Write the balanced net ionic equation for the following chemical reaction: Solutions of nitric acid, HNO3, and barium sulfite, BaSO3, are mixed.

  46. Gen Chemistry

    What is the balanced chemical equation for the galvanic cell reaction expressed using shorthand notation below? Al(s)|Al3+(aq)||Ni2+(aq)|Ni(s)

  47. Chemistry

    Based on the following chemical equation answer the question below show all your calculation The balanced chemical reaction of iodine with hydrogen sulfide h2s(g)+i2(s)-----2HI(g) + S(s) (a) Based on the above chemically balanced equation, how many grams

  48. chemistry

    The reaction of aqueous calcium bromide and aqueous lithium oxalate is represented by the balanced net ionic equation. Ca2+(aq) + C2O42-(aq) → CaC2O4(s) Give the balanced formula equation for the reaction. Include the states.

  49. chemistry

    I want to know if someone could let me know if I have written my balanced equations correct for the following questions. Write a balanced equation for the reaction of zinc with sulfuric acid. Zn + H2SO4 >>> Zn(S04) +H2 Write a balanced equation for the

  50. Chemistry

    Hello! I am having a little difficulty answering these two questions on my homework, I was wondering if anyone could please help me out! Thank you! 1) Consider the following balanced chemical equation for the neutralization reaction of calcium hydroxide

  51. chemistry

    Please help me!!! Write a balanced chemical equation for oxidation-reduction reaction of fluorene

  52. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to ΔHf° [NH3(g)]

  53. science

    Hydrogen Cyanide (boiling temperature 26 degrees Celsius) is an important chemical for the production of nylon and various transparent plastics. It is produced on an industrial scale by the oxidation of methane in the presence of ammonia. The equation

  54. chemistry

    write the balanced chemical equation for the reaction that occurs when BaCl2.2H2O is heated.

  55. Chemistry

    Write a balanced chemical equation for each single replacement reaction. A) Au(s) + KNO3(aq) ==> ??? B) Al(s) + H2SO4(aq) ==> ???

  56. Chemistry

    Write the balanced chemical reaction (showing appropriate symbols and states) for the chemical reaction with enthalpy change equal to and defined by the quantity dHformation [NH3(g)] N2(g) + 3H2(g) --> 2NH3(g) Is that all the question is asking for?

  57. Chemistry

    Write a balanced chemical equation that represents the reaction between methane and hydrochloric acid. CH4+HCl-> I'm not quite sure what happens...help please? Thanks in advance!

  58. Chemistry

    Hello, I really don't understand how to find the grams of moles in some of these reactions. If someone could help I would appreciate it. 1) Balance the following chemical reaction and determine the number of moles of HI produced when 2.33 moles of H2(g)

  59. Chemical Equations

    Starting with nitrogen and hydrogen, millions of kilograms of ammonia are produced every year for use as a fertilizer. Use this info to answer the next 3 questions. Communicate the balanced chemical equation using molecular models. Communicate the balanced

  60. Chemistry- Stoichiometry

    "Why must a chemical reaction be balanced before it can be used in stoichiometry?" I mean, I get it, that the equation will be off if it doesn't start out balanced, but, why? How do I phrase that?

  61. AP CHEMISTRY

    A solution is prepared in which a trace or small amount of Fe2+ is added to a much larger amount of solution in which the [OH-] is 1.0 x 10^-2 M. Some Fe(OH)2 precipitates. The value of Ksp for Fe(OH)2 = 8.0 x10^-10. A. Assuming that the hydroxide is 1.0 x

  62. College Chemistry

    One liter of benzene (C6H6) is completely burned (oxidized) with air. Write a balanced chemical equation to represent this reaction.

  63. Chemistry

    For the chemical reaction, sodium hydroxide + copper (II) chloride = "robin's egg blue" precipitate, do the following: write the balanced molecular, balanced total ionic, and balanced net ionic equations; determine the Limiting Reactant (LR) for each

  64. chemistry

    Write a balanced chemical equation for the overall cell reaction represented as: a) Ag(s)|Ag^+(aq)||Sn^4+(aq), Sn^2+(aq)|Pt(s) b) Al(s)|Al^3+(aq)||Cu^2+(aq)|Cu(s) c) Pt(s)|Fe^2+(aq), Fe^3+(aq)||MnO4^-(aq),Mn^2+(aq)|Pt(s)

  65. chemistry

    Answer the following questions based on the following electrochemical reaction: Al(s) + Cu 2+(aq) Cu(s) + Al3+ (aq) Write the balanced chemical equation for this cell. I'm confused.. how would this be balanced?

  66. chem help

    i just don't know where to begin/how a) Write a balanced chemical equation for: potassium carbonate + magnesium chloride b) Write a balanced chemical equation for: sulfuric acid + calcium carbonate c) Write a balanced chemical equation for: sodium sulfate

  67. chemistry

    write a balanced net ionic equation for the overall reaction represented by the cell notation below. Pt/ Fe2+, Fe3+ // I-/AgI/Ag

  68. Chemistry Cell notations

    Enter the balanced chemical equation including states that describes the electrochemical cell that is represented by the cell notation as shown. Pt(s) l H2O(l) l O2(g) l H+(aq) ll H+(aq), Cr2O72-(aq), Cr3+(aq) l Pt(s)

  69. chemistry

    consider the following electrochemical cell: Pt(s) | Hg2^2+ (0.250M), Hg^2+ (0.800M) || MnO4^-(0.650M), H^+ (1.00M), Mn^2+ (0.375M) | Pt(s) Using the half-reaction method, write a balanced chemical equation for the electrochemical cell.

  70. Chemistry - Cell Notation

    Enter the balanced chemical equation including states that describes the electrochemical cell that is represented by the cell notation as shown. Pt(s) | F-(aq) | F2(g) || Cl-(aq), AuCl4-(aq) | Au(s) I'm having trouble balancing this... I get AuCl4- + 2F-

  71. Chem 3A

    please help me with this chemistry problem. 1) Write out a balanced chemical reaction equation for the reaction of magnesium with hydrochloric acid, and then What is the Theoretical Yield after balancing the chemical equation?

  72. chemistry

    write the balanced chemical equation for the reaction that would occur ewhen a base is added to a solution containing H2PO4-/HPO4^2- buffer system can you please help we write this balanced equation. thank you

  73. Chemistry

    Consider the following electrochemical cell: Al(s) | Al^3+(aq)(0.155 M) || H^(aq) (0.00233 M), MnO4^-(aq)(0.0377 M), Mn^2+(aq) (0.0168 M) | C (graphite) Write a balanced equation for the redox reaction taking place in this cell. i am having trouble with

  74. chemistry

    A voltaic cell consists of two half-cells. One half-cell contains a chromium electrode immersed in 1.00 M Cr(NO3)3 solution. The second half-cell contains a nickel electrode immersed in 1.00 M Ni(NO3)2 solution. Nickel plates out on the nickel electrode as

  75. chemistry

    1. what would happen to the the cell potential in a voltaic cell if the salt bridge lost contact with one of the solutions? 2. would a reaction occur if solid tin was placed in a solution of copper II nitrate? If so, write the balanced net ionic equation

  76. Cemistry

    Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the

  77. Chemistry

    What type of reaction may be occurring when a person's skin develops a green stain beneath a 14 K gold bracelet? Using HA as the chemical formula for acid in skin, write a balanced chemical equation to represent the reaction.

  78. Chemistry

    A solution is made by mixing NaOH and HNO3. Write a balanced equation for the reaction that occurs between the solutes. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  79. Chemistry

    Provide the balanced reaction, the value of K, and E(cell) at equilibrium for the for the electrochemical cell created from the two half-cell reactions below Cr^(3+) + e ==> Cr^(2+) Fe^(2+) + 2e ==> Fe Well, I got the balanced reaction: 2Cr^(2+) + Fe^(2+)

  80. Chemistry

    A voltaic cell is based on the reduction of Ag^+(aq) to Ag(s) and the oxidation of Sn(s) to SN^2+(aq). Write half-reactions for the cell's anode and cathode, and write a balanced cell reaction.

  81. chemistry

    A balanced equation that represents an overall cell reaction is shown. Choose the cell notation which corresponds to the electrochemical cell that is described by this equation. 2H2O(l) → 2H2(g) + O2(g) i don't get why the answer is this. How can OH-

  82. Chemistry

    in a neutralization reaction, dilute tetraoxosulphate (vi) acid completely reacted with sodium hydroxide solution.write a balanced chemical equation for the reaction

  83. HELP PLEASE

    I am extremely confused on how to balance a chemical equation. I have an exam tomorrow and I'm lost. In the book it says Chemical Equation: CH4 + O2 > CO2 + H2O Balanced Chemical Equation: CH2 + 2O2 > CO2 + 2H2O How did this happen? Thanks. Oh and what is

  84. Chemistry

    Write a balanced chemical equation for single eisplacement reaction. Al+H2SO4

  85. chemistry

    testing bronsted lowry reaction predictions...... im super stuck can someone help me steo by step how to figure this out assuming i use the 5 step process? write a balanced chemical equation for ch3coona and hcl reaction position of equilibrium. I know

  86. chemistry

    write a balanced chemical equation for the following reaction including states not complete; no question.

  87. Chemistry

    Electrochemisry. Candy Chemist wishes to determine the concentration of CrO4^2- by electrochemical means in solution, and subsequently the Ksp of Ag2CrO4. She sets up one half-cell comprised of the Ag+|Ag couple (E=+0.799V) and a second half-cell in which

  88. Chemistry

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction. I'm not

  89. chem

    Pb(aq)2+ + 2e- → Pb(s) Ero = - 0.13 V Sc(aq)3+ + 3e- → Sc(s) Ero = - 2.02 V a) Write a balanced chemical equation for a spontaneous reaction involving these half reactions. b) Explain your rationale for the reaction going in this direction.

  90. Chemistry

    Write out a balanced chemical equation to show the dissociation reaction of magnesium carbonate in distilled water

  91. chemistry 20

    A student mixed a solution of aqueous calcium chloride with an aqueous solution of magnesium sulphate. A precipitate formed. 1) Write the balance chemical equation for the reaction including states of matter. Ensure you write the reactants as a dissociated

  92. Chemistry

    Completion Stuck on number 7 & 11 on my homewowrk 7)An Equation must never be balanced by changing the _______ in the chemical formula of a substance. 11)If a _______ is used to increases the rate of a chemical reaction its formula is written above the

  93. chemistry

    write a balanced chemical equation for the process of photosynthesis and the conditions of the reaction giving physical state of all the substances

  94. Chemistry

    Design an electrochemical cell using Pb(s) and Mn(s) and their solutions to answer the following questions. I just want to see if my answers are correct. I drew the cell already. Thanks 1. Give the line notation for this electrochemical cell. Mn(s) ∣

  95. chemistry

    write a balanced chemical equation for the reaction of aluminium selenide with water (to include physical states of reactants and products)to include brief decription of the strategy used and the sequence of partially balanced equations needed to reach

  96. Chemistry

    Suppose you tired to carry out a double-replacement reaction by mixing together equal volumes if a solution that contained dissolved NaF and a solution NaCl. Would you expect a reaction, if Si write the balanced chemical equation

  97. Science

    Write the half reactions and the balanced equation for the galvanic cell Hg(ℓ)| Hg2(+2)(aq)|| MnO(−4)(aq), Mn2 (aq), H(+)(aq)| Pt(s). What is the smallest possible integer coefficient of Mn(2+)(aq) in the combined balanced equation?

  98. chemistry

    The reaction of aqueous zinc chloride and aqueous sodium oxalate is represented by the balanced ionic equation. Zn2+(aq) + 2Cl-(aq) + 2Na+(aq) + C2O42-(aq) → ZnC2O4(s) + 2Na+(aq) + 2Cl-(aq) Give the balanced net ionic equation for the reaction. Include

  99. chemistry

    What is the balanced chemical equation of Shampoo? And what is the chemical reaction of it? Please i need a help ASAP! Thank you!

  100. AP CHEMISTRY

    A solution is prepared in which a trace or small amount of Fe2+ is added to a much larger amount of solution in which the [OH-] is 1.0 x 10^-2 M. Some Fe(OH)2 precipitates. The value of Ksp for Fe(OH)2 = 8.0 x10^-10. (A) Assuming that the hydroxide is 1.0

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20