What is the value of cos 138 if the cosin 42 = 0.7431

5,387 results
  1. Chemistry..

    A protein subunit from an enzyme is part of a research study and needs to be characterized. A total of 0.180 g of this subunit was dissolved in enough water to produce 2.00 mL of solution. At 28C the osmotic pressure produced by the solution was 0.138 atm.

  2. Trig

    Find sin(s+t) and (s-t) if cos(s)= 1/5 and sin(t) = 3/5 and s and t are in quadrant 1. =Sin(s)cos(t) + Cos(s)Sin(t) =Sin(1/5)Cos(3/5) + Cos(-1/5)Sin(3/5) = 0.389418 Sin(s-t) =sin(s)cos(t) - cos(s)sin(t) =sin(-3/5)cos(1/5) - cos(1/5)sin(3/5) =Sin-3/5

  3. Math

    The graph of f(x), a trigonometric function, and the graph of g(x) = c intersect at n points over the interval 0

  4. Calculus 12th grade (double check my work please)

    1.)Find dy/dx when y= Ln (sinh 2x) my answer >> 2coth 2x. 2.)Find dy/dx when sinh 3y=cos 2x A.-2 sin 2x B.-2 sin 2x / sinh 3y C.-2/3tan (2x/3y) D.-2sin2x / 3 cosh 3yz...>> my answer. 2).Find the derivative of y=cos(x^2) with respect to x. A.-sin (2x) B.-2x

  5. Math Help Please

    What are the ratios for sin A and cos A? The diagram is not drawn to scale. Triangle Description- AB = 29 AC = 20 BC - 21 A. sin A = 20/29, cos A = 21/29 B. sin A = 21/29, cos A = 20/21 C. sin A = 21/29, cos A = 20/29****? D. sin A = 21/20, cos A = 20/21

  6. Pre-Cal (Trig) Help?

    The following relationship is known to be true for two angles A and B: cos(A)cos(B)-sin(A)sin(B)=0.957269 Express A in terms of the angle B. Work in degrees and report numeric values accurate to 2 decimal places. So I'm pretty lost on how to even begin

  7. Studying for Pre Cal exam

    Find the fourth roots of − 1/2 + (square root)3/2 i Write the roots in trigonometric form. A - w 1=cos(35°)+isin(35°) w2 =cos(125°)+isin(125°) w3 =cos(215°)+isin(215°) w4 =cos(305°)+isin(305°) B - w1 =cos(40°)+isin(40°) w2

  8. self-study calculus

    Sketch the curve with the given vector equation. Indicate with an arrow the direction in which t increases. r(t)=cos(t)I -cos(t)j+sin(t)k I don't know what to do. I let x=cos(t), y=-cos(t) and z= sin(t). Should I let t be any number and get the equal

  9. Math

    Find the exact value of cos 1 degree + cos 2 degrees + cos 3 degrees + ... + cos 357 + cos 358 degrees + cos 359 degrees.

  10. math

    Can you please check my work. A particle is moving with the given data. Find the position of the particle. a(t) = cos(t) + sin(t) s(0) = 2 v(0) = 6 a(t) = cos(t) + sin(t) v(t) = sin(t) - cos(t) + C s(t) = -cos(t) - sin(t) + Cx + D 6 = v(0) = sin(0) -cos(0)

  11. math

    if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that cos(B-C)=cos(C-A)=cos(A-B)=-1/2

  12. Trig

    Given: cos u = 3/5; 0 < u < pi/2 cos v = 5/13; 3pi/2 < v < 2pi Find: sin (v + u) cos (v - u) tan (v + u) First compute or list the cosine and sine of both u and v. Then use the combination rules sin (v + u) = sin u cos v + cos v sin u. cos (v - u) = cos u

  13. Math (Trigonometry [Polar Form])

    Let z be a complex number such that z = 2(cos 8∘ + i cos 82∘).Then z^5 can be expressed as r(sin α∘+ i cos α∘), where r is a real number and 0 ≤ α ≤ 90. What is the value of r+α? Hint to solve: Example Question: Let z be a complex number

  14. Precalculus

    Use one of the identities cos(t + 2πk) = cos t or sin(t + 2πk) = sin t to evaluate each expression. (Enter your answers in exact form.) (a) sin(19π/4) (b) sin(−19π/4) (c) cos(11π) (d) cos(53π/4) (e) tan(−3π/4) (f) cos(π/4) (g) sec(π/6+ 2π)

  15. Math

    Explain how to do this with steps please. 1. Simplify cos(x-y)+cos(x+y)/cosx I did some of these so far, don't know if it is correct. Formula: cosxcosy= cos(x+y)+cos(x-y)/2 cos(x-y)+cos(x+y)/cosx =cosxcosy/2cosx

  16. math 1 question pls help!!!

    6. Food Express is running a special promotion in which customers can win a free gallon of milk with their food purchase if there is a star on their receipt. So far, 129 of the first 138 customers have not received a star on their receipts. What is the

  17. tigonometry

    expres the following as sums and differences of sines or cosines cos8t * sin2t sin(a+b) = sin(a)cos(b) + cos(a)sin(b) replacing by by -b and using that cos(-b)= cos(b) sin(-b)= -sin(b) gives: sin(a-b) = sin(a)cos(b) - cos(a)sin(b) Add the two equations:

  18. Chemistry

    Static charge can interfere with the production of plastic products by attracting dust and dirt. to reduce it, manufacturers expose the area to polonium-210, which has a half-life of 138 days. How much of a 25.0-g sample will remain after one year (365

  19. Math

    Solve this equation algebraically: (1-sin x)/cos x = cos x/(1+sin x) --- I know the answer is an identity, and when graphed, it looks like cot x. I just don't know how to get there. I tried multiplying each side by its conjugate, but I still feel stuck.

  20. Calculus

    Evaluate (Integral) sin 4x cos^2 4x dx. A. Cos^3(4x)/3 + C B. -Cos^3(4x)/3 + C C. Cos^3(4x)/12 + C D. -Cos^3(4x)/12 + C

  21. Trigonometry

    Please review and tell me if i did something wrong. Find the following functions correct to five decimal places: a. sin 22degrees 43' b. cos 44degrees 56' c. sin 49degrees 17' d. tan 11degrees 37' e. sin 79degrees 23'30' f. cot 19degrees 0' 25'' g. tan

  22. math

    Determine exact value of cos(cos^-1(19 pi)). is this the cos (a+b)= cos a cos b- sina sin b? or is it something different. When plugging it in the calculator, do we enter it with cos and then the (cos^-1(19 pi)).

  23. Physics

    Find the modulus direction cosin unit vector 1) 4a-2b+3c (2) a-7b+5c (3)4a-3b+c

  24. physics113

    find the modulus direction cosin unit vector 1)4a-2b+3c, 2)a-7b+5c, 3)4a-3b+c.

  25. Calc.

    Differentiate. y= (cos x)^x u= cos x du= -sin x dx ln y = ln(cos x)^x ln y = x ln(cos x) (dy/dx)/(y)= ln(cos x) (dy/dx)= y ln(cos x) = (cos x)^x * (ln cos x) (dx/du)= x(cos x)^(x-1) * (-sin x) = - x sin(x)cos^(x-1)(x) (dy/dx)-(dx/du)=

  26. calculus

    Differentiate. y= (cos x)^x u= cos x du= -sin x dx ln y = ln(cos x)^x ln y = x ln(cos x) (dy/dx)/(y)= ln(cos x) (dy/dx)= y ln(cos x) = (cos x)^x * (ln cos x) (dx/du)= x(cos x)^(x-1) * (-sin x) = - x sin(x)cos^(x-1)(x) (dy/dx)-(dx/du)=

  27. math

    Food Express is running a special promotion in which customers can win a free gallon of milk with their food purchase if there is a star on their receipt. So far, 129 of the first 138 customers have not received a star on their receipts. What is the

  28. Math - Solving Trig Equations

    What am I doing wrong? Equation: sin2x = 2cos2x Answers: 90 and 270 .... My Work: 2sin(x)cos(x) = 2cos(2x) sin(x) cos(x) = cos(2x) sin(x) cos(x) = 2cos^2(x) - 1 cos(x) (+/-)\sqrt{1 - cos^2(x)} = 2cos^2(x) - 1 cos^2(x)(1 - cos^2(x)) = 4cos^4(x) - 4cos^2(x)

  29. trig

    Reduce the following to the sine or cosine of one angle: (i) sin145*cos75 - cos145*sin75 (ii) cos35*cos15 - sin35*sin15 Use the formulae: sin(a+b)= sin(a) cos(b) + cos(a)sin(b) and cos(a+b)= cos(a)cos(b) - sin(a)sin)(b) (1)The quantity = sin(145-75) = sin

  30. Trigonometry

    Write equivalent equations in the form of inverse functions for a.)x=y+cos è b.)cosy=x^2 (can you show how you would solve) a.) x= y+ cos è cos è = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2)

  31. Trig. Law of Cosines

    Show that any triangle with standard labeling... a^2+b^2+c^2/2abc = cos(alpha)/a + cos(beta)/b + cos(gamma)/c I don't get it. Can someone please help me. Start here with the law of cosines: a^2 = b^2 + c^2 -2bc Cos A b^2 = a^2 + c^2 -2ac Cos B c^2 = a^2 +

  32. Maths

    How do I do this Need details solution to follow up prove that cos(a)+cos(a+b)+cos(a+2b)+....+cos(a+(n-1)b)={cos(a+((n-1)/2)bsin(nB/2)}/½sinb for all N£N

  33. Mathematics - Trigonometric Identities

    Let y represent theta Prove: 1 + 1/tan^2y = 1/sin^2y My Answer: LS: = 1 + 1/tan^2y = (sin^2y + cos^2y) + 1 /(sin^2y/cos^2y) = (sin^2y + cos^2y) + 1 x (cos^2y/sin^2y) = (sin^2y + cos^2y) + (sin^2y + cos^2y) (cos^2y/sin^2y) = (sin^2y + cos^2y) + (sin^2y +

  34. MATH

    Hi, I really need help with these questions. I did some of them halfway, but then I got stuck. Would you please help me? Thank you so much. Prove the identity.... 1. sec x + tan x(1-sin x/cos x)=1 1/cos x + sin x/cos x(cos^2 x/cos x)=1 1+sin x/cos

  35. Calculus

    which of the following integrals results from making the substitution u=x^3 in orer to find (squiggly vertical line)x^2cos(x^3)dx ~cos u du ~u^2 cos u du ~u^(2/3) cos u du1/3 os u du ~3 cos u du

  36. Math(Please check)

    Use the fundamental identities to simplify the expression. tan^2 Q / sec^2 Q sin^2/cos^2 / 1/cos^2 = sin^2 / cos^2 times cos^2 / 1 = The cos^2 cancels out so sin^2 is left. Is this correct?

  37. Math

    Explain how to do this with steps please. 1. Simplify cos(x-y)+cos(x+y)/cosx Formula: cosxcosy= cos(x+y)+cos(x-y)/2 cos(x-y)+cos(x+y)/cosx =cosxcosy/2cosx

  38. Math

    Eliminate the parameter and write the corresponding rectangular equation whose graph represents the curve. x = sec Q y = cos Q x^2 + y^2 = 1/cos^2 + sin^2/cos^2 = x^2(1 +sin^2) = x^2(2-cos^2) x^2(2-1/x^2) = 2x^2 - 1 x^2 - y^2 = 1 My teacher said to use

  39. calc

    Where do I start to prove this identity: sinx/cosx= 1-cos2x/sin2x please help!! Hint: Fractions are evil. Get rid of them. Well, cos2x = cos2x - sin2x, so 1-coscx = 1 - cos2x - sin2x = 1 - cos2x + sin2x You should be able to simplify this to 2*something

  40. Physics

    What should be the angle between two vectors of magnitudes 3.20 and 5.70 units, so that their resultant has a magnitude of 6.10 units? Cos x = (b^2 + c^2 - a^2) / 2bc Cos x = (3.2^2 + 5.7^2 - 6.1^2) / (2 * 3.2 * 5.7) Cos x = 5.52/36.48 Cos x = 0.15 x =

  41. Calculus re-post

    Does anybody know how to solve this question? a) Find the arc length function for the curve measured from the point P in the direction of increasing t from P and then reparametrize the curve with respect to arc length starting from P. b) Find the point 4

  42. Pre-Cal

    1) Verify the identity cos^2 B - sin^2 B = 2 cos^2 B -1 I know that cos^2 B - sin^2 B = 2 cos^2 B -1 by the double angle formula but I do not know how to show this.

  43. Math

    Solve the puzzle =RIGHT(LEFT($B$2,84),1) =RIGHT(LEFT($B$2,17),1) =RIGHT(LEFT($B$2,138),1) =RIGHT(LEFT($B$2,2),1) =RIGHT(LEFT($B$2,234),1) =RIGHT(LEFT($B$2,138),1) =RIGHT(LEFT($B$2,4),1) =RIGHT(LEFT($B$2,173),1) =RIGHT(LEFT($B$2,2),1)

  44. Math Trig

    13. What is the equation of a cosine function with amplitude 3, transition point (−1, 1), and period p? A. y = p cos [3(x − 1)] − 1 B. y = 3 cos [2(x − 1)] + 1 C. y = 3 cos [p (x + 1)] − 1 D. y = 3 cos [2(x + 1)] + 1 16. What is the transition

  45. another please help me check~calculus maths

    y=3e^(2x)cos(2x-3) verify that d^2y/dx^2-4dy/dx+8y=0 plz help me i tried all i could but it become too complicated for me here set u=3e^(2x) v=cos(2x-3) du/dx=6e^(2x) i used chain rule dv/dx=-2sin(2x-3) dy/dx=-3e^(2x)sin(2x-3)+cos(2x-3)6e^(2x) d^2y/dx^2

  46. math

    What is the value of cos 138 if the cosin 42 = 0.7431

  47. TRIG!

    Posted by hayden on Monday, February 23, 2009 at 4:05pm. sin^6 x + cos^6 x=1 - (3/4)sin^2 2x work on one side only! Responses Trig please help! - Reiny, Monday, February 23, 2009 at 4:27pm LS looks like the sum of cubes sin^6 x + cos^6 x = (sin^2x)^3 +

  48. pre-cal

    Simplify the given expression........? (2sin2x)(cos6x) sin 2x and cos 6x can be expressed as a series of terms that involve sin x or cos x only, but the end result is not a simplification. sin 2x = 2 sinx cosx cos 6x = 32 cos^6 x -48 cos^4 x + 18 cos^2 x -

  49. math,trigonometry

    how do i state the law of sines and cosin in words ??

  50. Physics

    Find the modulus direction cosin unit (1)4a-2b+3c (2)a-7b+5c (3)4a-3b+c

  51. Physics

    Find the modulus direction cosin unit vector 1)4a-2b+3c, 2)a-7b+5c, 3)4a-3b+c.

  52. algebra

    why does sin cosin doesn't go over 90 degrees It does. Cosine 345 has a value.

  53. math

    Find the exact value of cos 300 degrees. thanks guys cos 300 = 1/2 = 0.500 how do you know? I am supposed to show my work. You ought to know the rule on 30-60-90 triangles. If the hyp is 2, the shorter side is 1, and the longer side is sqrt3. what does

  54. Precalculus

    Solve Cos^2(x)+cos(x)=cos(2x). Give exact answers within the interval [0,2π) Ive got the equation down to -cos^2(x)+cos(x)+1=0 or and it can be simplified too sin^2(x)+cos(x)=0 If you could tell me where to go from either of these two, it would be great

  55. maths

    Find the roots of z^6 + 1 and hence resolve z^6 + 1into read quadratic factors; deduce that cos3x = 4[cos(x) -cos(pi/6)][(cos(x) -cos(pi/2)][(cos(x) -cos(5pi/6)]

  56. maths

    Find the roots of z^6 + 1 and hence resolve z^6 + 1into read quadratic factors; deduce that cos3x = 4[cos(x) -cos(pi/6)][(cos(x) -cos(pi/2)][(cos(x) -cos(5pi/6)]

  57. Trigonometry

    There is an arbitrary triangle with angles A, B, and C and sides of lengths a, b, and c. Angle A is opposite side a. How do I get the formulas: b * cos C + c * cos B = a c * cos A + a * cos C = b a * cos B + b * cos A = c Are these standard trig formulas?

  58. Mathematics - Trigonometric Identities - Reiny

    Mathematics - Trigonometric Identities - Reiny, Friday, November 9, 2007 at 10:30pm (sinx - 1 -cos^2x) (sinx + 1 - cos^2x) should have been (sinx - 1 + cos^2x) (sinx + 1 - cos^2x) and then the next line should be sin^2x + sinx - cos^2xsinx - sinx - 1 +

  59. calculus

    pleaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaasw help can you pleaaaaase help me find the area between y=cos(4x) and y=1-cos(4x) 0

  60. algebra

    Can someone please help me do this problem? That would be great! Simplify the expression: sin theta + cos theta * cot theta I'll use A for theta. Cot A = sin A / cos A Therefore: sin A + (cos A * sin A / cos A) = sin A + sin A = 2 sin A I hope this will

  61. Precal

    I do not understand how to do this problem ((sin^3 A + cos^3 A)/(sin A + cos A) ) = 1 - sin A cos A note that all the trig terms are closed right after there A's example sin A cos A = sin (A) cos (A) I wrote it out like this 0 = - sin^6 A - cos^6 A +

  62. Algebra

    Write an equation for the translation of the function. y = cos x; translated 6 units up A. y = cos x- ­ 6 B. y = cos(x + 6) C. y = cos x + 6 D. y = cos(x ­ 6) I think its B or c..

  63. Maths:Trigonometry

    How do I do this Need details solution to follow up prove that cos(a)+cos(a+b)+cos(a+2b)+....+cos(a+(n-1)b)={cos(a+((n-1)/2)bsin(nB/2)}/½sinb for all N£N ???

  64. trig

    Show that 1-cos2A/Cos^2*A = tan^2*A 1-cos2A/Cos^2*A = [Cos^2(A) - Cos(2A)]/Cos^2(A). Substitute: Cos(2A) = 2Cos^2(A) - 1: [1 - Cos^2(A)]/Cos^2(A)= Sin^2(A)/Cos^2(A) = tan^2(A)

  65. Trig Help!

    Question: Trying to find cos π/12, if cos π/6 = square root 3 over 2, how to find cos π/12 using DOUBLE angle formula? This is what I got so far.. cos 2(π/6) = cos (π/6 + π/6) = (cos π/6)(cos π/6) - (sin π/6)(sin π/6) = cos^2 π/6 - sin^2 π/6 Is

  66. Math - Solving Trig Equations

    Solve each equation for o is less than and/or equal to theta is less than and/or equal to 360 -- sin^2x = 1 = cos^2x -- Work: cos^2x - cos^2x = 0 0 = 0 -- Textbook Answers: 90 and 270 -- Btw, how would you isolate for cos^2x = 0? Would it be... x = cos^-1

  67. Math - Solving for Trig Equations

    Solve the following equation for 0 less than and/or equal to "x" less than and/or equal to 360 -- cos^2x - 1 = sin^2x -- Attempt: cos^2x - 1 - sin^2x = 0 cos^2x - 1 - (1 - cos^2x) = 0 cos^2x - 1 - 1 + cos^2x = 0 2cos^2x - 2 = 0 (2cos^2x/2)= (-2/2) cos^2x =

  68. Math, derivatives

    Let g(x) = sin (cos x^3) Find g ' (x): The choices are a) -3x^2sinx^3cos(cos x^3) b) -3x^2sinx^3sin(cos x^3) c) -3x^2cosx^3sin(cos x^3) d) 3x^2sin^2(cos x^3) I'm not exactly sure where I should start. Should I begin with d/dx of sin? Or do the inside

  69. Calculus - MathMate Please help

    ok, i tried to do what you told me but i cant solve it for c because they cancel each others out! the integral for the first one i got is [sin(c)cos(x)-cos(c)sin(x)+sin(x)+c] and the integral for the 2nd one i got is [-sin(c)cos(x)+cos(c)sin(x)-sin(x)+c] I

  70. trigonomentry out of ideal help ah!crying

    compute.. Cos(1degree)+cos(3degree)+cos(5degree)+...+Cos(179degree) plz show working even an hint can,t help me.Have been do maths alday my brain is fried..Ah thanks

  71. calc.- trig substitution

    s- integral s 1/ [ (x^4) sq.rt(x^2+9)] i know x=3tanx sq.rt(x^2+9)= 3 secx dx= 3/[cos^2(x)] so far i know: = 1/ (3tan^4(x)) 3secx cos^2(x)) dx =1/ 81 [ (sin^4 (x)/cos^4 (x)) (1/cosx) (cos^2(x))] then i'm not really sure what to do next

  72. trig

    it says to verify the following identity, working only on one side: cotx+tanx=cscx*secx Work the left side. cot x + tan x = cos x/sin x + sin x/cos x = (cos^2 x +sin^2x)/(sin x cos x) = 1/(sin x cos x) = 1/sin x * 1/cos x You're almost there. thanks so

  73. Trigonometry - LONESTAR

    Simplifying steps without using the calculator for: tan(cos^-1(-1/10)) cos(sin^−1(1/x)) Assume x is positive tan(cos^−1(12/13)) cos^−1(cos 150°) This is pretty much the entire section we are doing. My teacher is a robot and has us self teach

  74. trig

    2sin(x)cos(x)+cos(x)=0 I'm looking for exact value solutions in [0, 3π] So I need to find general solutions to solve the equation. But do I eliminate cos(x), like this... 2sin(x)cos(x)+cos(x)=0 2sin(x)cos(x)= -cos(x) 2sin(x) = -1 sin(x) = -1/2 at 4pi/3

  75. Trigonometry (repost Reiny)

    at 1:35am I posted ; Write equivalent equations in the form of inverse functions for a.)x=y+cos theta b.)cosy=x^2 my answers were a.) x= y+ cos theta cos theta = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2) your post confused me a

  76. precalculus

    I don't understand this problem: (Tanө + cos ө)/ (sec ө + cot ө) so I start off like this: ={(sinө / cos ө)+cosө}{cos ө + (sinө/cosө)} =[(sin ө +cos^2ө) (cos^2ө +sin ө)]/ cos ө but what comes next?

  77. Trig/Precalc

    So I have two questions that have been puzzling me for quite some time and would really appreciate any help with either of them! (a) There are four positive intergers a, b, c, and d such that 4cos(x)cos(2x)cos(4x)=cos(ax)+cos(bx)+cos(cx)+cos(dx) for all

  78. Trigonometry(please Clarify)

    I posted before ; Write equivalent equations in the form of inverse functions for a.)x=y+cos theta b.)cosy=x^2 my answers were a.) x= y+ cos theta cos theta = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2) your post confused me a little.

  79. trig

    how would you verify this trig identity (1+cos(x) / 1-cos(x)) - (1-cos(x) / 1+cos(x)) = 4cot(x)csc(x) ? help please!

  80. math

    Prove that for all real values of a, b, t (theta): (a * cos t + b * sin t)^2

  81. Math

    Prove each identity: a) 1-cos^2x=tan^2xcos^2x b) cos^2x + 2sin^2x-1 = sin^2x I also tried a question on my own: tan^2x = (1 – cos^2x)/cos^2x R.S.= sin^2x/cos^2x I know that the Pythagorean for that is sin^2x + cos^2x That's all I could do.

  82. Math

    Write the expression in terms of costheta and then simplify. cos^4theta - sin^4theta + sin^2theta Ans: cos^4 θ - 1 - cos^4 θ + 1 - cos^2 θ = -cos^2 θ

  83. Calculus AP

    Use the table of integrals to find int cos^4 3x dx I found the table: ∫cos^n u du = (1/n)cos^(n-1)u sinu + (n-1/n)∫sin^(n-2)u du = 1/4 cos^(4-1)u sinu + (4-1/4)∫sin^(4-2) u du so what i did the problem: let u=3x then du=3dx =1/4*1/3 cos^3u sinu +

  84. Calculus

    Find F '(x) for F(x) = integral[x^3 to 1](cos(t^4)dt) a. cos(x^7) b. -cos(x^12) c. -3x^2cos(x^12) d. cos(1) - cos(x^12)

  85. Calculus

    Evaluate the integral sin4x cos^2 4x dx A. cos^3 4x/3 +C B. - cos^3 4x/3 +C C. cos^3 4x/12 +C D. -cos^3 4x/12 +C

  86. Calculus

    what is the limit n to infinite of cos1*cos(1/2)*cos(1/4)*cos(1/8)*cos(1/16)*...*cos(1/2^n)

  87. Phys (Are my answers correct?)

    1. Vector A=71 grams @138 degrees. What is Ax? (x is a subscript) 2. Vector A=71 grams @ 138 degress. What is Ay? (y is a subscript). Answers: 1. -52.8 (I am not sure if it is the absolute value and I should write it as positive. 2. 47.5 Those answers are

  88. Math

    Can someone please check my answers! 2. Find value of cos(255degrees)cos(105degrees) root3 - 2 / 4 3. cos(pi/12) - cos(5pi/12) Is it root3/4? 4. Use the appropriate sum-to-product formula to rewrite the expression sin6x - sin9x I don't really understand

  89. precalc

    Find the exact value of each expression, if it exists: the -1 are representing the inverse functions! (a) sin -1 (-√2/2) (b) cos−1 (−1) (c) sin( 􏰀sin−1 (π)􏰁) (d) cos−1􏰀(cos􏰀(−4π􏰁􏰁/ 3)) (e) tan−1 (tan(0.6)) (f) cos−1(

  90. math

    Multiple Choice: For each of the given family incomes, find the maximum amount the family should be able to spend on a house. Family income: $61,575 a)$163,936.50 b)$153,836.50 c)$153,937.50 Family income: $54,800 a)$138,500 b)$137,000 c)$138,000

  91. math

    How would you establish this identity: (1+sec(beta))/(sec(beta))=(sin^2(beta))/(1-cos(beta)) on the right, sin^2 = 1-cos^2, that factor to 1-cos * `1+cos, then the denominator makes the entire right side 1+cosB which is 1+1/sec which is 1/sec (sec+1) qed

  92. Calculus

    how do you solve this trig identity? i don't get it at all! cos(a+b)cos(a-b)=cos^2a-cos^2b-1

  93. math

    A trigonmetric polynomial of order n is t(x) = c0 + c1 * cos x + c2 * cos 2x + ... + cn * cos nx + d1 * sin x + d2 * sin 2x + ... + dn * sin nx The output vector space of such a function has the vector basis: { 1, cos x, cos 2x, ..., cos nx, sin x, sin 2x,

  94. PRECALC

    solve the equation 1. cos(θ) − sin(θ) = 1 2.2 cos(θ) tan(θ) + tan(θ) = 1 + 2 cos(θ) 3. sin(θ) cos(3θ) + cos(θ) sin(3θ) = 0 4. sin(2θ) cos(θ) − cos(2θ) sin(θ) = 1/2 5. cos(2θ) + cos(θ) = 2 6. cos(2θ) + sin2(θ) = 0

  95. Algebra

    A cell phone company offers a contract which cost C, in dollars, of t minutes to telephoning is given by C=0.25(t-400)+57.95, where it is assumed that t is greater than and equal to 400 minutes. what times keep cost between $98.95 and $138.95? For the cost

  96. Math - Trigonometry

    Let f(x) be a polynomial such that f(cos theta) = cos(4 theta) for all \theta. Find f(x). (This is essentially the same as finding cos(4 theta) in terms of cos theta; we structure the problem this way so that you can answer as a polynomial. Be sure to

  97. Pre-Calculus

    I don't understand,please be clear! Prove that each equation is an identity. I tried to do the problems, but I am stuck. 1. cos^4 t-sin^4 t=1-2sin^2 t 2. 1/cos s= csc^2 s - csc s cot s 3. (cos x/ sec x -1)- (cos x/ tan^2x)=cot^2 x 4. sin^3 z cos^2 z= sin^3

  98. Math

    cos(tan + cot) = csc only simplify one side to equal csc so far I got this far: [((cos)(sin))/(cos)] + [((cos)(cos))/(sin)] = csc I don't know what to do next

  99. Trigonometry

    Okay, I have been given a trigonometric equation to solve (sin^2(theta) + cos(theta) = 2). So far, I have been able to use the Pythagorean identity to get (-cos^2(theta) + cos(theta) - 1 = 0), which I then multiplied by -1 on both sides to get:

  100. Calculus problem

    Evaulate: integral 3x (sinx/cos^4x) dx I think it's sec3 x , but that from using a piece of software, so you'll have to verify that. Using uppercase 's' for the integral sign we have S 3sin(x)/cos4dx or S cos-4(x)*3sin(x)dx If you let u = cos(x) then du =

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20