What is the molecular structure around the oxygen in water? What is the molecular structure around all the carbons in ethanol?

38,115 results
  1. chem

    The fact that ice is less dense than water is related to the fact that ____. the molecular structure of ice is much less orderly than that of water the molecules of ice are held to each other by covalent bonding ice has a molecular structure in which water

  2. chemistry

    Which of the following statements concerning differences between ionic and molecular compounds is correct? Molecular compounds contains two elements, and ionic compounds contain three of more elements ionic compounds contain oxygen, and molecular compounds

  3. Chemistry

    Can anyone help me check my classifications of these into metallic, ionic, molecular or covalent network, and if I am wrong tell me why Aluminum - Mettalic Ascorbic acid - ionic Graphite - covalent Paraffin - molecular Palmitic acid - ionic Sodium chloride

  4. chemistry

    what is the molecular geometry of trans-difluroethylene: trans-C2H2F2? I know how to draw the lewis structure but I'm not sure how to find the molecular geometry. I think it's a tetrahedral

  5. Chemistry

    Which of the following is not true about molecular orbital theory? A. The bonding molecular orbital is filled before the antibonding orbital. B. Each molecular orbital can accommodate only one electron. C. The number of molecular orbitals formed is often

  6. Science

    What is the three-dimensional structure of the nuclei of atoms in a molecule or polyatomic ion called? Lewis Dot structure bond length molecular geometry molecular formula Molecular geometry?

  7. Chemistry

    What is the three-dimensional structure of the nuclei of atoms in a molecule or polyatomic ion called? Lewis Dot structure bond length molecular geometry molecular formula Won't it be Molecular geometry

  8. chemistry

    Combustion analysis of 1.0g of a compound containing carbon , hydrogen and oxygen gives 2.3 g of carbon dioxide and 0.93g of water . If The relative molecular mass is 58. Calculate The empirical and molecular formula

  9. chemistry

    2.4g of a compound of carbon, hydrogen and oxygen gave on combustion, 3.52g of CO2 and 1.44g of H2O. The relative molecular mass of the compound was found to be 60. a)What are the masses of carbon, hydrogen and oxygen in 2.4g of the compound? b)What are

  10. chem

    A molecular compound is composed of 58.8% Xe, 7.2% O, and 34.0% F, by mass. If the molecular weight is 223 g/mol, what is the molecular formula? Draw the correct Lewis structure. Predict the molecular geometry using the VSEPR model.

  11. Chemistry

    Analysis of a sample of an organic compound showed it contains 39.9%carbon,6.9%hydrogen and 53.2%oxygen. a)calculate the empirical formula b)if the relative molecular mass is 60,what is the molecular formula of the compound.(C=12,H=1,O=16)

  12. chem

    Using the VSEPR theory, predict the molecular structure of each of the following molecules. (a)NI3 (b)AsH3 (c)OF2

  13. Science Please Check!

    Which statement best explains how the structure of a starch molecule relates to its function? A- A branching structure makes the molecule stronger. B- A branching structure has more chemical bonds than an unbranched structure. C- A branching structure

  14. chemistry

    what is the molecular geometry of IO3- when the angle is 105 degrees? What is it when the molecular geometry is 120 degrees? Which angle creates the most stable structure with the highest Boltzmann Distribution? Create a lewis structure that agrees with

  15. Science

    Which term describes the repeated arrangement of the molecule? A. Bonds B. Atoms C. Molecular Model D. Extended Structure

  16. Chemistry

    In a certain reaction 0.20g of hydrogen gas combines with 3.20g of oxygen gas.if the relative molecular mass of the compound is 34.0 find its molecular formula (H=1,O=16).

  17. chem

    Determine the electron and molecular geometries of each of the following molecules. For those with more than one central atom, indicate the geometry about each central atom. (Enter your answers in the order given in the skeletal structure from left to

  18. chemistry

    I have a chart and I have to draw the structure,name the shape snd lable the bond angle of some compounds. I've done most of them but im stuck on a few so heres what I need.Please and thank you structure of NF3 structure,shape and bond angle of TeCl2 bond

  19. chemistry

    Determine the structure of the compound by using the IR and 1H NMR of a spectra that has the molecular formula: C4H8O2

  20. chem

    A sample of an alcohol is tested and found to contain 52% carbon, 35% oxygen, and 13% hydrogen by mass. Tests indicate that the molecular weight of the molecule is between 30 and 80. What is the molecular formula of the alcohol?

  21. Chemistry

    Reaction of gaseous fluorine with compound x yields a single product y, whose mass percent composition is 61.7% F and 38.3%Cl. (a) What is a probable molecular formula for product Y, and what is a probable molecular formula for X? (b) Draw an electron-dot

  22. chemistry

    Describe the structure of the water molecule and indicate how this structure is responsible for many of the unique properties of this vital compound.

  23. help needed !!! URGENT

    Can some one help me I don’t know what to take out from the aspirin molecule, for the following structures? I have to generate a copy of the molecular structure of aspirin and then for each of the molecular features listed in (i) – (iii) have to

  24. Science

    What is the molecular structure of methylated spirits

  25. chemistry

    can you check my answers in the parenthesis 1)The molecular structure around the oxygen in water is (bent) 2)The molecular structure around all the carbons in ethanol is (tetrahedral)

  26. chemestry

    draw the Lewis structure for the following compounds,and predict the molecular shapes. a) water,H2O b)Oxygen gas,O2 c)Ammonia, NH3 d)Ammonium ion,NH4

  27. science

    Can some one help me I don’t know what to take out from the aspirin molecule, for the following structures? I have to generate a copy of the molecular structure of aspirin and then for each of the molecular features listed in (i) – (iii) have to

  28. Science (SoftChalk)

    Which of the following determines the physical and chemical properties of a substance? [mark all correct answers] a. Size b. Atomic Structure c. Amount of Matter d. Molecular Structure e. Volume of Matter

  29. chemistry

    Based on their molecular structure, how can you figure out which is stronger between two oxyacids? Our textbook is really vague. I thought it had to do with which had more oxygen but one of the question compares CH3COOH and CCl3COOH so now I'm lost again.

  30. chemistry

    what transition metal complex is responsible for transporting oxygen in our blood? Also, what is its structure? The transition metal (there are several transition series---I assume you are referring to the 3d transition metals) is iron. As to its sturcure,

  31. biology

    describe 2 structures of bacterial cells what they look like and their molecular structure

  32. chemistry

    Hi, Is the molecular formula different when it is in a gaseous state? Cheers ;) Sometimes yes, sometimes no. H2O, for example, is thought to be in a group of 6 as a liquid at room temprature, a group of 4 at higher temperatures, and single H2O molecules as

  33. organic chemistry

    Determine the structure of the compound by using the IR and 1H NMR of a spectra that has the molecular formula:C4H7ClO2

  34. Chemistry

    Give the molecular orbital description [e.g. sigma(sp3-sp3)] for each unique bond in the following structure. CH3NCHCCH I know how to draw the lewis structure and what a sigma and pi bond is, but I don't understand what the (sp3-sp3) part after the bond

  35. Science

    Describe how the structure of DNA is correlated with its role as the molecular basis of inheritance in Biology.

  36. math, calculus

    A 3-dimensional structure is obtained from rotating the parabola y=x^2 about the y-axis. Each second, 2π units^3 of water is being poured into the structure from the top. When 8π units^3 of water has been poured in the structure, the instantaneous change

  37. calculus

    A 3-dimensional structure is obtained from rotating the parabola y=x^2 about the y-axis. Each second, 2π units^3 of water is being poured into the structure from the top. When 8π units^3 of water has been poured in the structure, the instantaneous change

  38. calculus

    A 3-dimensional structure is obtained from rotating the parabola y=x^2 about the y-axis. Each second, 2π units^3 of water is being poured into the structure from the top. When 8π units^3 of water has been poured in the structure, the instantaneous change

  39. organic chemistry

    How is overall molecular polarity affected by molecular symmetry (specifically shown for alkenes in book)? And what are the consequences for melting and boiling points (in cases of high molecular symmetry versus low molecular symmetry)?

  40. AP Chemistry

    What percent (by mass) of granulated sugar is fructose, and what percent of it is sucrose? Background: We are doing a colligative properties lab in my class where we are to add 20 grams, 40 grams, 60 grams, and 80 grams of sugar to 100 grams of water, and

  41. chemistry// organic

    This is a pushing question. We discussed how phenols are typically more acidic than alcohols, even though they both contain the same hydroxyl functional group, because phenols possess an aromatic ring that delocalizes the negative charge after a proton is

  42. chemistry

    water: describe how its molecular structure is responsible for its ability to serve as a solvent for salts and other ionic or polar materials. Explain how you can be sure it isn't a straight molecule? Is it because hydrogens can come off a attach to other

  43. chemistry

    Polyglycolic acid, PGA, is a polymer that we know rather well how to control the structure of (even though there are currently only limited applications). So in the lab we have created two types of PGA for testing, a linear chain PGA and a branched chain

  44. chemistry

    a compound with the molecular weight of 276 grams was determined to be 39.10% carbon, 8.77% hydrogen, and 52.13% oxygen. what is the empiricial formula and the molecular formula for the compound? i do not know where to start! i worked it out and i got

  45. Chemistry

    The molecular formula of a compound containg only carbon and hydrogen is to be determined. When a sample of the compound is burned on oxygen gas, 7.2 grams of water and 7.2 liters of carbon dioxide gas are produced(measured at STP). When 0.600grams of the

  46. Science

    The water molecules now in your body were once part of a molecular cloud. Only about onemillionth of the mass of a molecular cloud is in the form of water molecules, and the mass density of such a cloud is roughly 4.0×10−21 {\rm g}/{\rm cm}^{3} Estimate

  47. Chemistry

    Can some please check my answers for the following questions? THANK YOU. 1)The chemical formula for aspirin is C9H8O4. What is the mass of 0.40 mol of aspirin? ANSWER: 45 g 2)The gram molecular mass of oxygen is. ANSWER: 16.0 g 3)What is the mass, in

  48. Chemistry

    What is the Lewis structure formula, electron pair geometry and the molecular geometry for SO4^2-

  49. chemistry

    The combustion of 1.00g of vitamin C, compound that contains only carbon, hydrogen and oxygen produced 1.500g of co2 and 0.401g of H2O. Find the molecular formula of vitamin C knowing that its molecular mass is 176

  50. chemistry

    2.4g of a compound of carbon, hydrogen and oxygen gave on combustion, 3.52g of CO2 and 1.44g of H2O. The relative molecular mass of the compound was found to be 60. a)What are the masses of carbon, hydrogen and oxygen in 2.4g of the compound? b)What are

  51. Chemistry(the)

    An optically active compound having molecular formula C6H12O6 is found in two isomeric forms (A) and (B) in nature. When (A) and (B) are dissolved in water they show the following equilibrium. (A) Equilibrium mixture (B) D = 1110 52.20 19.20 (i) What are

  52. biotechnology!!

    I'd greatly appreciate if some one could very briefly inform me on any two techniques used in agricultural biotechnology - one that relies on new biotechnology (ie molecular) and one that relies on old biotechnology (ie not molecular!) and the same for

  53. biology

    I need help finding diagrams of the leaf structure, stem structure and root structure of a lilac flower with explanations. Sites would help

  54. chemistry

    a compound with the molecular weight of 276 grams was determined to be 39.10% carbon, 8.77% hydrogen, and 52.13% oxygen. what is the empiricial formula and the molecular formula for the compound? i do not know where to start!

  55. Chemistry

    When a 1.200g sample of a compound containing carbon, hydrogen, and nitrogen was combusted using exess oxygen, 2.929g of CO2 and 0.8001g of H2O were obtained. Analasys of the compounds showed the molecular mass to be 108.16g/mol. What is the molecular

  56. Physics

    The molecular mass of oxygen molecules is 32, and the molecular mass of nitrogen molecules is 28. If these two gases are at the same temperature, the ratio of nitrogen's r m s speed to that of oxygen is: (8)1/2:(7)1/2 8:7 (7)1/2:(8)1/2 7:8

  57. chemistry

    When molecular oxygen (O2) is converted to water (H2O). Is O2 being oxidized or reduced.

  58. Chemistry- DrBob222

    I completed this question like you told me to. Are the answers correct? Is my method for finding the molecular formula correct? 2.4g of a compound of carbon, hydrogen and oxygen gave on combustion, 3.52g of CO2 and 1.44g of H2O. The relative molecular mass

  59. chemistry

    The molecular structure around the oxygen in water is ? The molecular structure around all the carbons in ethanol is ?

  60. Chemistry

    The molecular structure around the oxygen in water is ?????? The molecular structure around all the carbons in ethanol is ?????

  61. chemistry

    The molecular structure around the oxygen in water is . The molecular structure around all the carbons in ethanol is .

  62. chemistry

    What is the molecular structure around the oxygen in water? What is the molecular structure around all the carbons in ethanol?

  63. chemistry

    When water freezes and becomes solid ice, the hydrogen bonds create a crystal structure and there is fixed space between each water molecule. This causes ice to? a.become more dense than liquid water because it is a solid* b.become less dense than liquid

  64. Chemistry (organic)

    What is the molecular formula for the below line-angle structure? The structure is a pentagon with one line connected to a corner. I'm sorry if that doesn't make any sense but the picture will not paste here. a C6H11 b C5H11 c C7H12 d C5H13 e C6H12 Thank

  65. chemistry

    C4 H10 O or diethyl ether or with a formula of CH3CH2OCH2CH3 its stick structure is H H H H ! ! ! ! .. H-C-C-C-C- O-H ! ! ! ! .. H H H H I used the this ! sign as a sign for bond. pls help me to determine the geometry for each central atom in this

  66. Advanced Chemistry

    What is the (name of the) molecular structure of AlCl3NH3 ?

  67. Honors Chemistry

    What is the molecular structure of the molecule AlCl3? What characteristic is notable about the structure that helps us to understand the acidic nature of AlCl3?Write a chemical reaction between AlCl3 and NH3 ignoring any reaction between AlCl3 and the

  68. Chemistry

    What is the molecular structure of methylated spirit

  69. chemistry

    draw the structure of 2,4-dimethyl-3-ethyl-2-heptanol and give the molecular formula.

  70. Chemistry

    Find the molecular formula of a compound that is 48.38% carbon, 8.12% hydrogen, and 53.5% oxygen by mass and has a molecular weight of 328 g/mol.

  71. chemistry

    Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3

  72. Chem

    O=S=O what is this molecular structure Sulfur dioxide? It wants it's binary compound name and formula it is written this way SO2?

  73. Chemistry

    Please could you tell me if I am going in the right direction. I am trying to write molecular formula for As2O3 I make molecular mass 197.8 gas density 17.8 to 3 sig figs 2.0 x density of gas at STP / density of hydrogen 17.8/0.0899 = 396 to 3 figs How do

  74. biology

    how to label the ecstasy molecular structure plz name each part the formula is C11 H15 NO2 HCl

  75. science

    Are there any related structure from an asprin? To show how important an asprin is from using a carboxylic acid. You need to clarify your question. I need to produce a related structure of the molecular features of carboxyli acid, size hydrocarbon group on

  76. Chemistry

    A certain compound contains carbon, hydrogen , and oxygen. When 1.00 grams of this compound are burned in oxygen gas 1.47 grams of CO2 and 0.600 grams of water are formed. When 2.75 grams of the compound are dissolved in 10.0 grams of water the resulting

  77. chemistry

    Explain in terms of molecular structure why sugars have a relatively high melting point compared to hydrocarbons of a similar size.

  78. Science- Ms. Sue

    What evidence was found from soft tissue samples of a remarkable well-preserved Tyrannosaurus Rex that provided molecular evidence linking T.Rex to a chicken? A. Antibodies that react in a specific way with chicken proteins reacted in the same way with T.

  79. Chemistry

    Draw the structure of the product formed by the reaction between methyl alcohol and formic acid and give the molecular formula HCOOH + HOCH3 ==> HCOOCH3 + H2O determine this molar concentration 58g of lithium in 54-ml of water molarity = mols/L mols Li =

  80. science

    I need to produce a related structure of the molecular features of carboxyli acid, size hydrocarbon group on ester and distance between oxygeeb atom joined to the ring and -oh group of the carboxylic acid? I have got no ideas on where to start. Start by

  81. Chemistry

    Compound K is a hydrocarbon. Combustion of 6.51 g of K gave 20.47 g of carbon dioxide and 8.36 g of water. The relative molecular mass of K was found to be 84. Calculate the empirical and molecular formula of K

  82. chemistry!

    Of the four general types of solids [molecular, ionic, network covalent, metallic], which one[s] are generally soluble in nonpolar solvents? I'm thinking either molecular or ionic. Are either [or both] correct? molecular: like dissolves like is the rule of

  83. Chemistry

    A compound containing boron and hydrogen has been synthesized. You perform two experiments to determine the molecular formula of the compound. A 0.492 g sample of the compound is burned in pure oxygen to produce B2O3 and 0.540 g of water. In the second

  84. Chemisty

    The molecular structure around the oxygen in water is....????

  85. chemistry

    what is the molecular structure around oxygen in water?

  86. chemistry

    The molecular structure around the oxygen in water is???

  87. Chemistry

    The molecular structure around the oxygen in water is _________ I don't know what to put

  88. chemistry

    The molecular structure around the oxygen in water is . ---is the answer bent or angular?

  89. Chemistry

    Calculate the empirical formula and molecular formula of a compound that contains only carbon, oxygen and hydrogen and has a molecular mass of approximately 90. g/mol. Upon combustion of 12.0g of the compund with an excess of oxygen, the yield was 1.2 g of

  90. science

    What is the molecular structure of water? What are the physical and chemical properties of water?

  91. chemistry

    What is the molecular structure of the molecule AlCl3? What characteristic is notable about the structure that helps us to understand the acidic nature of AlCl3?Write a chemical reaction between AlCl3 and NH3 ignoring any reaction between AlCl3 and the

  92. Science

    How do the properties of methane relate to its molecular structure?

  93. biology

    Identify a property of water that contributes its movement through the capillary tubes. Explain how the molecular structure of water contributes to this property. Plants use a similar mechanism to move water through their stems. In a specific species of

  94. Chemistry

    The molecular structure around all the carbons in ethanol is ________ I don't know what to put

  95. Chemistry

    A certain compound contains carbon, hydrogen , and oxygen. When 1.00 grams of this compound are burned in oxygen gas 1.47 grams of CO2 and 0.600 grams of water are formed. When 2.75 grams of the compound are dissolved in 10.0 grams of water the resulting

  96. Organic Chemistry

    If 3-bromo-1-propanol is treated with NaOH, a compound of molecular formula C3H6O is formed. suggest a structure for this product.

  97. Biology

    Could somebody check this formula for the structure of hyroloysis of lactose C12H22O11+H20 ...> C6H12O6H12O6 OBVIOUSLY THE FIGURES ARE ALL SUBSCRIPT Many thanks Is that not the molecular formulae ???

  98. chemistry

    How is overall molecular polarity affected by molecular symmetry (specifically shown for alkenes in book)? And what are the consequences for melting and boiling points (in cases of high molecular symmetry versus low molecular symmetry)? I looked for help

  99. chemistry

    9 grams of carbon and 1.5 grams of hydrogen combined with oxygen to make a compond whose mass is 22.5 and whose relative molecular mass is 60.determine the molecular formula

  100. Chemistry

    If I am given a molecular hydrocarbon structure, how would I be able to tell how sp3 hybridized carbons it possesses? Like my current question asks How many sp3-hydridized carbon atoms does 11-cis-retinal possess?

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20