1. Chemistry

    I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank you.
  2. Chemistry

    Sorry...it came through funny. O3 + H-C=C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 -> CO2 + H2O All of the numbers above are supposed to be subscript but keep coming out the same size as the letters. So this is the equation that i am trying to balance. In my
  3. Chemistry

    It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3 I a.
  4. chem

    what is the balanced equation for ozone gas reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O
  5. Chemistry

    Ignore the dots, just put them in to line things up. 1. What is the asymmetric carbon 5...4...3..2..1 CH3-CH2-CH-CH-CH3 ........|..| CH3.CH3 2. which of the following compounds have an asymmetric carbon? A. CH3-CH-CH-CH3 ........|..| ........OH.CH3 B.
  6. organic chem

    Which are enatiomers? optically active?identical? diastereomers? A.)...CH3 .....| ...H-C-Cl .....| .....Ch2Cl B.).....H .......| ...H3C-C-CH2CL .......| .......CL C.)...CH3 .......| ....CL-C-H ......| ......CH2CL D.)....CH2CL .........| ......CL-C-H
  7. Chemistry

    I am rewriting this question and using dots to make sure that everything lines up correctly so please ignore the dots. 1. name this hydrocarbon .......CH3...CH3 .......|.....| CH3-CH-C-CH2-C-CH2-CH3 ....|..|.....| ....CH3CH2..CH2 .......| ........CH3 I
  8. Chem - IUPAC naming system

    I don't know how to name this. Help? You'll have to write out what I'm describing because I can't set it up in this. In a straight line, there is (1)CH3 - (2)C - (3)CH2 - (4)C - (5)CH - (6)CH3. On #2, there is CH3 and CH3. On #4, there is CH3 CH3 and CH3.
  9. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3 10. CH3C(triple
  10. Chemistry

    Name the following compounds 1. CH3-CH=CH-CH2 l Cl 2. CH3-CH-C=(tripple bond)C-CH3 l CH3 3. Cl Cl l l CH = C-CH3 4. Complete the following reactions and name the products a. CH2-CH=CH3+Cl2>>>> b. CH3-C=C-CH3+Br2 >>> Please help!
  11. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to determine which is the
  12. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O
  13. Chemistry

    So I thought i finally had figured out how to balance these equations but now this one with the formula in it has confused me again. Can you help with the next steps in balancing this equation? Maybe if I can get the answer to this one I can complete my
  14. Chemistry

    Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?
  15. Chemistry

    Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?
  16. Chemistry

    Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?
  17. Chemistry

    I will try these again, as I am really struggling with these compounds. Hard going back to school after all these years. 1. I will list the longest chain and then tell when items are placed above and below CH3-C=CH-CH-CH3 above C is CH3 Below the second CH
  18. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3. CH3-C-C-CH3 with a CH3 attached
  19. Chemistry

    IGNORE MY FIRST POST. I CORRECTED THIS ONE Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2-dimethylpentane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be
  20. CHEMISTRY PLEASE HELP

    Write an isomer of structure for a), b) and c) and name them. *(N.B- ! rep. a bond) a) CH3 ! CH3-CH2-C-CH2-CH3 ! CH3 CH3 ! b) CH3-CH2-CH-CH-C(TRIPLE BOND)CH ! CH2 ! CH3 c) 3,3,4-trimethyl-1-pentene
  21. Chem 32

    1)Number of moles in 2.2 grams of niacin? 2) which compound would not have a hydrogen bonding as a intermolecular attractive Force 1)H-O-CH3 2)CH3-CH2-CH2-O-CH3 3)NH3 4)H2O 5)CH3-NH2?
  22. chemistry

    Which have the following have an asymmetric carbon A. CH3-CH-CH-CH3 | | OH CH3 B. CH3-CH-CH3 | CH3 C. CH3-CH-F | OH
  23. chemistry

    Calculate the volume (mL) of the solute (CH3)2CO and the volume (L) of the solvent H2O that should be added to prepare 1.36 kg of a solution that is 25.7 g (CH3)2CO per 100. g solution. Molar Mass (g/mol) (CH3)2CO 58.05 H2O 18.015 Density (g/mL): (CH3)2CO
  24. FlunkyJunkie

    Calculate the volume (mL) of the solute (CH3)2CO and the volume (L) of the solvent H2O that should be added to prepare 1.36 kg of a solution that is 25.7 g (CH3)2CO per 100. g solution. Molar Mass (g/mol) (CH3)2CO 58.05 H2O 18.015 Density (g/mL): (CH3)2CO
  25. chemistry

    CH3 CH3-C-CH3 CH3CH2CH2-C-CH2CH2CH2CH3 CH3 give the IUPAc name for this compound? is it 4-methyl-4-tert-methyloctane?
  26. Chem.

    Is the number of branches or carbons more important when determining the boiling point of a substance? I have CH3-CH3 and C3-CH (with a branch leading upward to CH3)-CH3. Thanks for your help.
  27. Chemistry

    Can someone help me identify the functional groups and what the chiral carbons are? NOTE: THE LAST C HAS A DOUBLE BOND POINTED UPWARDS CONNECTED TO O. SORRY I TRIED MAKING IT AS CLEAN AS I CAN. STARTING FROM LEFT TO RIGHT THE 2ND C HAS A NH3 ATTACHED. THEN
  28. Chemistry

    I am really stuck on these so will try and explain further and use dots. 1. I have come up with normal heptane on this but not sure .......CH3...CH3 .......|.....| CH3-CH-C-CH2-C-CH2-CH3 ....|....|...| ....CH3..CH2.CH2 .........| .........CH3 In the first
  29. Chemistry

    what is the asymmetric carbon 5 4 3 2 1 CH3-CH2-CH-CH-CH3 | | CH3 CH3 which of the following has an asymmetric carbon CH3-CH-CH-CH3 | | OH CH3 CH3-CH-CH3 | CH3 CH3-CH-F | OH
  30. chemistry

    What is the asymmetric carbon in this compound 5 4 3 2 1 CH3-CH2-CH-CH-CH3 | | CH3 CH3
  31. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When
  32. CHEM 102 (University Chemistry)

    What must be the molarity of an aqueous solution of trimethylamine, (CH3)3N, if it has a pH = 11.20? (CH3)3N(aq)+H2O(l) double arrow (CH3)3NH+(aq)+OH-(aq) Kb value = 6.3x10^-5 mol/L
  33. chemistry

    I can't seem to figure out the name of this organic molecule. I know it's an amine, but that's it. There are two methyls (CH3) attached to a CH, followed by (in order) NH, CH2, CH2, CH2, and CH3. (ignore the ^^^, I had to use them so the atoms would line
  34. Chemistry

    ................CH3 ..................| CH3-CH2-N-CH2-CH2-CH3 Hoping this turns out okay, but it's an amine and branching off of the N (on top) is a CH3. The name is N-ethyl-N-methylpropanamine but I don't get why. How do you know which ones to treat as
  35. Chemistry

    If a sample of C6H4(CH3)2 is found to contain 3.54 * 10^26 CH3 groups how many moles of C6H4(CH3)2 molecules are present? C6H4(CH3)2 - 106.17 CH3 group - 15.035 C6H4 Group - 76.098 Please explain steps
  36. chemistry question

    this is considered to have asymmetrical carbons :ch3ch2ch(chlorine group is connected on bottom)Ch3 why isn't this one: ch3ch2ch (methyl group attach to it) ch3? By convention, we look at the carbon chains, and carbon sidechains when discussing symettry.
  37. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2-dimethylpentane? Wouldn't it look like this: CH3-C-CH2-CH2-CH3 with a CH3 on the top and bottom of the C, which would be the 2nd carbon... right? I don't understand
  38. Chemistry

    Select the most likely rate law for the following: (CH3)3C-Br + OH- > (CH3)3C-OH + Br- a. Rate=k[(CH3)3C-Br] b. Rate=k[(CH3)3C-Br][OH-] c. Rate=k[(CH3)3C-Br][OH-]2 d. Rate=k[(CH3)3C-Br]2[OH-]2 e. Rate=k[(CH3)3C-Br]2[OH-] The correct is answer is "a" but
  39. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing
  40. chemistry

    what is the best synthesis of 2-methyl-2-pentene (CH3)2C=CHCH2CH3? 1.(CH3)2CHCH2CH2CH3+F2,heat 2. KOC(CH3)2 1.(CH3)2CHCH2CH2CH3+Cl2,heat2.NaOCH2CH3 1.(CH3)2CHCH2CH2CH3+Br2,heat2.NaOCH3 1.(CH3)2CHCh2CH2CH3+I2,heat2.NaOCH2CH3
  41. Chemistry

    A solution of hexane in the solvent (CH3)2CO has a mole fraction of CH3(CH2)4CH3 of 0.114. What mass (g) of the solution must be taken if 1690 g of hexane is needed? Molar Mass (g/mol) CH3(CH2)4CH3 100.21 (CH3)2CO 58.05 Density (kg/L): CH3(CH2)4CH3 0.6838
  42. chemistry

    which of the structures are impossible ,give the numbers of bonds that various atoms can form? (a)CH3CH3 CH3 (b)CH3CH=CH2CH2CH3 (c)CH3NHCH3 (d)CH3CCl=CCH2CH3 (e)(CH3)3 CHCH(CH3)2 (f)CH3CHO
  43. organic chemistry!

    Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural formulas for the following as
  44. Chemistry

    Show the steps necessary to transform acid on left to compound on right... Make sure you use SOCl3.................. (CH3)3CCH2C(=O)OH ----------> (CH3)3CCH2C(=O)OCH2CH=CH2 (CH3)3CCH2C(=O)OH-----------> (CH3)3CHC(=O)N(CH2CH3)2
  45. chemistry

    please name this compound CH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3
  46. Chemistry

    I need help naming these compounds. I CL H H | | | | CH3-CH-CH-C=C-CH3 F CH3 O | | || CH3-CH-CH-CH2-CH-C-OH | CH2-CH3 CH3-CH2-CH2 | CH3-CH2-C-C-CH-CH3 | || | Br O CH3
  47. Organic Chemistry 2

    Arrange these in the correct order of their reactivity during nucleophillic substitution by SN2 and SN1 conditions, Ch3-CH=CH-CH2-Cl, Ch3-CCl-Ch-Ch3, and Ch3-Ch2-Ch2-Ch2-Cl
  48. chemistry

    Compound C does not bind to the receptor as effectively as acetylcholine . Explain briefly why this might be the case. (Two or three sentences)(again if the post does not show right, two of the CH3 should be above and below the N^+ with a line directly
  49. Chemistry

    Name these compounds, according to the IUPAC system H H \ / C=C / \ CH3 CH2CH3 and CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3 Thank you
  50. chemisrty

    Is this the stuctual formula for hydolosis of tocainide CH3 NHCOCH^2N(C^2H^3)^2 CH3 WITH THE HEXAGON LINKING THE 2 X CH3
  51. Chemistry

    I have no idea how I would determine the answers to these questions. What am I supposed to do? Based on the properties of the attached functional group, which one of the compounds below would you expect interact most strongly with water, thereby increasing
  52. CHEMISTRY

    Predict the products of the following reactions. a)CH3-CH2-CH2-CH3+O2----> B)CH3-CH2-CH2-CH2-CH3+Br2----> c)CH3-CH=CH-CH3+Br3----> D) HEXENE+KMnO4--> E) HEXENE+Br2---->
  53. Chemistry

    IGNORE MY FIRST POST. I CORRECTED THIS ONE Write IUPAC name of the following alkanes: 1. (CH3)3 -C-CH2-CH2-CH3 all the numbers are subscripts. So there are 3 CH3's, C,CH2,CH2, and CH3 This is what my teacher has in my homework. The parenthesis really throw
  54. Chemistry

    I have this alkene: CH3-CH2-CH2-CH3 1 CH3-CH2-CH2-CH3 The one is supposed to be a bond, but I did not have that feature on my computer. Would it be called hexane? Thanks for checking this.
  55. Chemistry

    (CH3)2CHCH2CH(CH2CH2CH2CH3)CH2CH(CH3)CH((CH3)2) Looking for skeletal diagram and name of formula.
  56. Chemistry

    What is basic like NaOH,from the following? 1)CH3NH2 2)(CH3)2NH 3)(CH3)3N 4)[N(CH3)4]^-(OH^-) 5) 2,4,6-aniline What is the reason?
  57. Chemistry

    I am suppose to name alkanes, but I don't know how to do it, if possible to give me an example on how to do it, but here is one of the questions I have to do. CH3-CH-CH2-CH3 | CH3
  58. Chemistry

    In the condensed structure CH3CH2CHCH double bonded to CHCH(CH3)2 ! CH3 What does it mean when the CH3 is in () followed by the 2?
  59. Organic Chemistry

    Place these in order of decreasing priority according to the R-S convention a) H, CL, Br, CH3 B) OH, CH3, CH2CL, CH3CH2 C) CH3, CH2CH3, CL, c6H5
  60. CHEM

    Europium can have a 2+ or a 3+ charge. which one of the following below is not possible 1. EuSO4 2.Eu2(SO4)3 3.EuPO4 4.Eu(NO3)3 5.EuHCO3 Which of the compounds below would not have hydrogen bonding as an intermolecular attractive force 1. H-O-CH3
  61. chemistry 101

    What alcohol(s) could be used to produce each of the following compounds? Enter the IUPAC names of the alcohol(s). If there are more than one alcohol, enter them separated with commas. 1.CH3-CH2-O-CH2-CH3 2.CH3-CH2-C=CH-CH3 ..........| ..........CH3.
  62. Chemistry

    What is energy difference between staggered and eclipsed conformations of 2,2,3,3-tetramethylbutane? Is it 2k/J/mol? Interaction Energy Cost (kJ/mol) H/H Eclipsed 4 CH3/H Eclipsed 6 CH3/CH3 Eclipsed 11 CH3/CH3 Gauche 3.8
  63. Chem

    COMPOUND 1 CH2 = CH-CH-OH with CH3 under the second CH Plus CH3-CH-CH2-C (double bond O off C and -OH off C) also a CH3 under CH i) complete the equation for this reaction ii) Indentify any new functional groups in the organic product(s)name them iii)State
  64. Chemistry

    Identify the longest, shortest, strongest, and weakest bonds? A. H3C-C---C-H B. (H3C-H)>--<(H-CH3) C. (H-H3C)>--<(CH3-H) D. H3C-CH2-(CH-CH3)-CH3
  65. Chem---DrBob222

    Show the route you would use to go from starting material to product. You should give the reaction conditions for each step, but it is not necessary to give detailed mechanisms. RCH2CH2R TO R-CH(BR is attached under CH)-CH3 RCH2-C-(3 CH3 is attached to
  66. chemistry

    The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 B) 1.00 x 10^-6 C) 4.27
  67. Chem Help Please!

    show the route you would use to go from starting material to product. You should give the reaction conditions for each step, but it is not necessary to give detailed mechanisms. RCH2CH2R to R-CH(BR is attached under CH)-CH3 RCH2-C-(3 CH3 is attached to
  68. Chemistry

    When you're naming organic compounds, is there more than one name that's acceptable for each compound? For example Ch3-CH2-CH2 CH3 1 1 CH3-CH-CH-CH 1 1 CH3-CH2 CH3 Hopefully this appeared alright once I typed it. The ones represent bonds. In the answer
  69. chemistry

    I am totally lost on this one. 1,2,2-trimethylcyclopentane I think I have to draw the cyclopentane shape with the single bond going straight CH3 and I am lost from there. Draw the cyclopentane as a 5-cornered box. C-C |  | C  C  \  /
  70. Chemistry

    Name this compound according to the IUPAC system CH3 | CH=C-CH-CH-CH3 | CH3 Thank you.
  71. chemistry

    A solution of the solute hexane and the solvent acetone that is 28.1 g hexane per 100. g solution is available. Calculate the mass (g) of the solution that must be taken to obtain 0.646 kg of CH3(CH2)4CH3. Molar Mass (g/mol) CH3(CH2)4CH3 100.21 (CH3)2CO
  72. chemistry

    A 893 g sample of a solution of the solute (CH3)2CO in the solvent C4H8O that has a concentration of 28.6 pph(parts per hundred) by mass (CH3)2CO is available. Calculate the amount (g) of acetone that is present in the sample. Molar Mass (g/mol) (CH3)2CO
  73. Chemistry

    A 893 g sample of a solution of the solute (CH3)2CO in the solvent C4H8O that has a concentration of 28.6 pph by mass (CH3)2CO is available. Calculate the amount (g) of acetone that is present in the sample. Molar Mass (g/mol) (CH3)2CO 58.05 C4H8O 72.12
  74. Organic Chemistry

    We are asked to order the following compounds considering their hydrolysis. 1)CH3COCl 2)CH3CO-C2H5 3)CH3-CO-N:H2 4) CH3-CO-O-CH3 What are the main factors which determine how easily they tend to hydrolysis?
  75. Chem

    Estimate the equilibrium constant for the weak base (CH3)2NH, if a 1.59×10-2 M aqueous solution of (CH3)2NH has a pOH 2.58 (make an exact calculation assuming that initial concentration is not equal to the equilibrium concentration). (CH3)2NH + H2O =
  76. science (chem)

    I have a problem drawing this formula. CH3CH2CH2CH(CH3)CCCH3 The problem is the 2 c's next to each other. I don't know what that's supposed to look like since if it's 1 CH like with the bracketed CH3 it would be connected to that C but I'm confused as to
  77. CHEMISTRY

    8) The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 B) 1.00 x 10^-6 C)
  78. Organic chemistry

    Write equations for the reactions that occur. Put conditions and catalysts over the arrow. 1.CH3COOH + CH3(CH2)7OH 2.C6H14 + KMNO4 + H 3. CH3H12 + KMNO4 + H 4. CH3CHOHCH3 + KMNO4 + H 5. (CH3)3COH + KMNO4 + H 6. (CH3)2C=O + KMNO4 + H 7. CH3COOH + KMNO4 + H
  79. Chemistry

    How would I draw the abbreviated structural formulae of the products of the complete hydrolosis of this compound, CH3 O (=) N - C - CH - NH2 (-) (-) H CH3 CH3 Sorry about the drawing, the bonds in brackets should be vertical, thanks. We simply can't draw
  80. Organic Chemistry

    What is the hybridization of all the atoms (other than hydrogen) in each of the following species? a) NH3 e) +NH4 i) H3O+ b) BH3 f) +CH3 j)H2C=O c) -CH3 g) HCN d)*CH3 h) C(CH3)4 There are a couple I don't know how to do. Please help? Did I do the other
  81. Chemistry - - Hydrocarbons

    Name the following hydrocarbons. A) CH3-CH2-CH-CH2-CH2-CH3 | CH3 I don't know if this will show up correctly after I post. But the CH3 at the bottom is supposed to be under the CH. I don`t get how to name. I counted up all the hydrocarbons, and I came up
  82. chem

    The average bond enthalpy for a C=C double bond is 614kj/mol and that of a C-C single bond is 348kj/mol . Estimate the energy needed to break the pi bond in 2-butene. CH3 CH3 CH3 H \ / \ / C=C ------> C=C / \ / \ H H H CH3 Cis-2-butene Trans-2-butene
  83. Chemistry

    CORRECTION: (sorry!) What major product will be obtained if the following alcohol is dehydrated: CH3 | CH3CH2CCH3 | OH (the CH3 is connected to the 3rd Carbon from the left and the OH is attached to the same Carbon) I tried to do it and this is what I got:
  84. Chemistry

    how do you expect the following series of compounds to compare in behavior in the two tests? The two tests performed were... A. Sodium Iodide in Acetone (SN2) B. Silver Nitrate in Ethanol (SN1) 1. CH3-CH=CH-CH2-Br 2. CH3-C=CH-CH3 3. CH3-CH2-CH2-CH2-Br I Br
  85. Chemistry

    Determine the mole fraction of acetone in a solution prepared by adding 0.456 kg of (CH3)2CO to 0.899 L of C4H8O. Molar Mass (g/mol) (CH3)2CO 58.05 C4H8O 72.12 Density (g/ml): (CH3)2CO 0.7899 C4H8O 0.8892 Name/Formula: acetone (CH3)2CO tetrahydrofuran
  86. chemistry

    the diagram below shows a structural formulae of 3 cabon compounds labelled 1 2 and 3 and the eaction between compounds 1 and 2. The equation for this reaction is incomplete only the reactants are shown, the missing products being indicatedby a? :o ch2
  87. Chemistry

    Please heellppppppppp!!!! How do you expect the following series of compounds to compare in behavior in the two tests?(Sn1/Sn2 reaction) CH3-CH=CH-CH2-Br CH3-C=CH-CH3 ! Br CH3-CH2-CH2-CH2-Br Please help me answer this question, I really don't understand
  88. chemistry

    CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound
  89. Chemistry

    A molecule has a glycerol backbone. The branches off of the three carbons are as follows: o-co-(ch2)14 - ch3 o-co-(ch2)12 - ch3 o-co-(ch2)16 - ch3 What is this compound called?
  90. Chemistry

    Complete the following equations. Include names of all reactants and products A) CH3CH2CHCH - CH2+H2O --> | CH3 B) CH3CHC=CCH3 + H2 ---> | CH3
  91. Chem

    Reaction 1 ............................O ...........................// CH2=CH-CH-OH + CH3-CH-CH2-C ........|...........|......\ .......CH3.........CH3......OH Left of the "+" is COMPOUND 1 and the right is COMPOUND 2. a) Identify the Functional groups in
  92. chemistry

    1. name this compound ..........CH2CH3 ........../ hydrocarbon hectagon shaped ring ..........| ..........CH3 CH2CH3 are to the right of the "up/down" line on the right side of the hectago with the CH3 directly under the bottom point 2. name this compound
  93. Chemistry

    Identify any functional groups in compound 1 and 2 COMPOUND 1 CH2 = CH-CH-OH with CH3 under the second CH COMPOUND 2 CH3-CH-CH2-C (double bond O off C and -OH of C) also a CH3 under CH ROH are alcohols. RCOOH are acids.
  94. Chemistry

    Are these an alcohol, phenol, an ether or a thiol. CH3--CH2--CH2--SH CH3--CH2--CH--CH2--CH3 Any help is appreciated, I am trying to get the hang of this.If I know these two, I believe I will be able to do all the other ones I have to. Thanks.
  95. Chemistry

    Apoarently the name of this compound is 4-ethyl-4-methylheptane: ........................CH3 ..........................| CH3-CH2-CH2-C-CH2-CH3 ..........................| .......................CH2 ..........................| .......................CH2
  96. Chemistry

    A solution is prepared by mixing 37.5 mL of 0.20 M (CH3)3N with 50.0 mL of 0.20 M (CH3)3NHC and then diluting the mixture to a total volume of 100.0 mL. Calculate the pH of resulting solution. So far I have been able solve the mols of the two chemicals.
  97. Chemistry

    I wrote the dissociation or ionization in water for each of the following acids. I just want someone to check if they are right. a) HC3H5O2(aq)<===> H^+(aq)+ C3H5O2^-(aq) b) (CH3)2NH2^+(aq)<===> H^+(aq)+ (CH3)2NH(aq) c) CH3COOH(aq)<===>
  98. ochem

    Rank fastest to slowest reaction with HBr: A) H3C-C---C-CH3 (alkyne; that's a triple bond between the carbons) B) H CH3 (alkene; trans) = H3C H C) H3C CH3 (alkene; 3 methyl substituents) = H3C H Please explain why. Thanks!
  99. chemical reaction engineering

    Propane steam reforming over an alumina supported Ni metal catalyst: C3H8 (g) + H2O (g) → CO2 (g) + H2 (g) is proposed to follow these mechanisms: C3H8 + 2S1 ↔ C2H5-S1 + CH3-S1 (M1) H2O + 2S2 ↔ OH-S2 + H-S2 (M2) CH3-S1 + OH-S2 →
  100. chemistry

    Describe the difference in intermolecular forces between the two molecules. How does this affect the properties of the substance first one molecule is made up of H3C,OH,CH3, and another CH3. The second molecule is made up of H3C,O,OH3, and CH3.