1. chemistry

    What is the total number of valence electrons that must be shown in the Lewis structure for magnesium fluoride I think 16 but im not sure
  2. Chemistry

    How does BF4^- make tetrahedral structure. Because B have 3 outermost electrons. It may combine with three fluorine. But how is it combining with 4?
  3. sociology

    Why do we need a distinction between culture and structure? How is this related to other perspectives like conflict, ethnocentrism, or cultural relativism.
  4. chemistry

    Given that S is the central atom, draw a Lewis structure of OSF4 in which the formal charges of all atoms are zero
  5. biology-mitosis

    what is a structure that holds each chromosome to its exact copy? it begins with a "C", and has "d" as the second to last letter. 10 letters.
  6. Chemistry

    Complete the electron dot structure below to show how beryllium flouride (BeF2) is formed. F F Be+ -> Be F F
  7. chemistry

    Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3
  8. com 140

    in what ways do audience, purpose, tone, and structure affect the memo and paper’s formatting?
  9. physical science

    what helps the muscle structure,hermones, and antibodies and also carries molecules through the membranes?
  10. 12th grade

    How is the structure of the female and the male reproductive system suitable for their functions? Please reply soon!!! Thanks.
  11. chemistry

    How would SiO4 Lewis structure look like? Each oxygen has 1 unfilled electron, so would there be 2 double bonds? Thanks in advance.
  12. science

    cells are the basic units of structure and function in living organisims ture or false
  13. Chemistry

    Draw the Lewis structure for each of these molecules. 1. PH3 2. H2S 3. HCl 4. CCl4 5. SiH4
  14. biology

    examine the intetnet structure of the leaf drawn say how the different layer are suiled for the function of photosynthes
  15. organic chemistry

    Is this a correct structure? CH3CH2 CH3CHCHCH2CH3 CH3 with a name of 3-ethyl 4-methyl hexane?
  16. organic chemistry

    Determine the structure of the compound by using the IR and 1H NMR of a spectra that has the molecular formula:C4H7ClO2
  17. calculus

    The volume of the 3-dimensional structure formed by rotating the circle x^2 +(y−5)^2 =1 around the x-axis can be expressed as V=að^2 . What is the value of a
  18. Chem

    O=S=O what is this molecular structure Sulfur dioxide? It wants it's binary compound name and formula it is written this way SO2?
  19. axiacollegue

    in what ways do audience, purpose, tone, and structure affect the formatting of the memo and the papers
  20. Organic Chemistry

    Draw the most important resonance contributor of the following structure? I'm confused on this one o / \ double bond -> \\ / - CH+
  21. Body Structure and Function

    Conductivity is the ability of a neuron to react to stimuli? True or False
  22. com 140

    In what ways do audience, purpose, tone, and structure affect the memo and paper’s formatting?
  23. Chemistry

    How is the atomic structure of a Copper differ from Germanium, Silicon and Gallium Arsenide ? Tnx :))
  24. chemistry

    What is the chemical structure, its principle source, its legals uses (if any) and its relative addictiveness on scale 1-10 : CAFFEINE
  25. language arts

    please help... Which of the following signal words could identify a problem-solution text structure? A.first B.i think(I PICK THIS) C.therefore
  26. chmistry

    Given that \rm S is the central atom, draw a Lewis structure of \rm OSF_4 in which the formal charges of all atoms are zero.
  27. Physics

    A block of mass m=2 kg on a horizontal surface is connected to a spring connected to a wall (see figure). The spring has a spring constant k= 12 N/m. The static friction coefficient between the block and the surface is μs= 0.5 , and the kinetic
  28. physics

    does the international space station have gravitational pe
  29. Math

    How much space (in ft³ ) will be taken up by the 458 balloons.
  30. Science

    what are some tools used to collect data in space?
  31. space

    What causes the rings around the equators of Saturn and jupiter
  32. geometry

    Parallel lines in space are coplanar. A. always B. sometimes C. never
  33. biology

    what is the space surrounding the nucleus of an atom contain?
  34. space

    what is the difference between the atmosphere on earth and venus
  35. geometry

    What do you do to figure out space in irregular shapes?
  36. Science

    How does the cisternal space divide the cell?
  37. art

    where is the negative space in the rubin case?
  38. english

    The space shuttle was both a marvel and huge.
  39. space

    why is looking through a powerful telescope like looking back through time?
  40. geometry

    I am a location in space. It takes only one letter to name me
  41. ENGLISH

    The space shuttle was both a marvel and huge.
  42. space

    why we don't see comets until they are mear the sun?
  43. space

    how long do scientists believe the universe has been expanding?
  44. 2nd grade

    Why does the sun always shine in space?
  45. Quantum M.

    Why "In Hilbert Space noone can hear you scream"?
  46. Science

    If you are in a spacecraft that has been launched into space your weight would do what
  47. Geography

    How does space influence devolutionary movements
  48. Science

    What are the disadvantages of Hubble Space Telescope?
  49. English

    The space shuttle was both a marvel and huge.
  50. space

    in this century what has been the solar cycle number
  51. MATH

    what would be the space figure of a shoe box?
  52. space

    when the moon changes frorm new to full it is called what?
  53. put was or were in the space

    Tom and Ben ( ) playing
  54. science

    is that electric current occupies space?
  55. sociology

    What does "Social Space" mean when we talk about location
  56. Science

    What is the effect of increasing "dead space" ?
  57. science

    how does the space shuttle maneuver in the exosphere
  58. Science

    How is solar energy used in space? (for what purpose?)
  59. Anthropology

    If a friend were to say, “ He’s the president of the college” the term “president” would refer to an: a)status b)role c)social situation d)social relationship e)social interaction a group ranked in a system of social stratification into which
  60. statistics

    set of data is normally distributed with a mean of 200 and standard deviation of 50. · What would be the standard score for a score of 300? · What percentage of scores is between 200 and 300? · What would be the percentile rank for a score of 300?
  61. English

    How does the author of The Johnstown Flood make the order of the story understandable? by using time order signal words so the reader can follow the events by listing the actual time of events he provided a timeline at the end of the story he uses
  62. Financial Management

    Reading Foods is interested in calculating its weighted average cost of capital (WACC). The company’s CFO has collected the following information: • The target capital structure consists of 40 percent debt and 60 percent common stock. • The company
  63. Literacy

    Efficiency can best be defined as A. the amount of output generated in a given amount of time. B. producing items using the least amount of resources. C. using high-tech equipment on a job. D. producing as much as you can as fast as you can, regardless of
  64. economics

    Discuss the effects on efficient behavior of different liability rules, including comparative negligence. Include in your discussion an analysis of the efficiency of the various rules and discuss the differing costs of administering the rules.
  65. add maths

    Cabinet x which $100 per unit,requires 0.6 square meters of the floor space and can hold 0.8 cubic meters of files.Cabinet y which costs $200 per unit, requires 0.8 square meters of the floor space and can hold 1.2 cubic meters of files. the ratio the
  66. Chemistry - solubility

    Arrange the following compounds in order of increasing solubility in water: * O2 * LiCl * Br2 * CH3OH Like dissolves like; that is, polar compounds usually are soluble in water and non-polar compounds are not soluble in water. From that description, make
  67. Chemistry

    What does ammonia have anything to do with bogdan's rocket building? -can't find this anywhere if we had to order ammonia we don't order in pure. it is ordered in clandestine, liquid solution. the ammonia exists in this aq solution in eq. what is the eq
  68. Chemistry

    What does ammonia have anything to do with bogdan's rocket building? -can't find this anywhere if we had to order ammonia we don't order in pure. it is ordered in clandestine, liquid solution. the ammonia exists in this aq solution in eq. what is the eq
  69. Math

    The population of a small Midwestern town is 4500 The population is decreasing at a rate of 1.5% per year. Write an exponential decay function to model this situation. Then find the number of people in the town after 25 years.
  70. chem

    Using LeChatelier's principle, predict the direction of the net reaction in each of the following system as a result of decreasing the volume of the chamber for the reaction mixture. Where does the direction shifts? a.) N2(g)+ O2(g)= 2NO(g) b.)
  71. calcus

    Related Rates Problem An isosceles triangle with a base of 20root3 cm long. If the length of the leg decreases at rate 3 cm/h, find the rate of decreasing of the area of the triangle in the instant at which the triange becomes equilateral
  72. Calculus

    Related Rates Problem An isosceles triangle with a base of 20root3 cm long. If the length of the leg decreases at rate 3 cm/h, find the rate of decreasing of the area of the triangle in the instant at which the triange becomes equilateral.
  73. chemistry

    how do you solve this problem? consider the reaction A->B the rate of the reaction is 1.6 x 10^-2 M/s when the concentration of A is 0.35 M. Calculate the rate constant if the reaction is a) first order in A and b) second order in A.
  74. Chemistry Kinetics

    If I had the equation H2 + I2 --> 2HI could I write the rate of reaction as d[H2 + I2]/dt = k[H2]^x[I2]^y were x is the order of reaction with respect to x and y is just the order of reaction with respect to y thanks
  75. math algebra?

    Is 1/3 , 3/4 , 0.2 in order from least to greatest or is 5 1/8 , 5 1/4 , 5 2/3 in order from least to greatest?
  76. Math

    The radius r (cm) of a circle at time t seconds is given by r = 9t - t^3 . At each of the following instants, find the rate of change of the radius (w.r.t.'t') and state whether the radius is increasing or decreasing at these instants. a) t =1 b) t =2 c) t
  77. precalculas

    the population of preston is 89000 and is decreasing by 1.8% each year A:Write a function that models the population as a function of time t b predict when the population will be 50000
  78. science

    A ladder 5 m long is leaning against a wall. The bottom of the ladder is pulled along the ground at rate 2 cm/s . How fast is its height on wall decreasing when foot of ladder I'd 4 m
  79. Calculus

    Find the interval(s) where the function is increasing and the interval(s) where it is decreasing. f(x) = 3x + 5 ok...i think you find the derivative first...? but i thought u had to find the critical points somehow... i am so lost! can someone show me how
  80. Math - Int Trig

    31) Locate, name, and classify the extrema of the function. Determine intervals which the function is increasing and decreasing f(x) = -x(x^2 - 2) 32) Determine the end behavior of the function f(x) = 2x - x^3
  81. calculus

    consider the equation below f(x)=e^(7x)+e^(-x) find the intervals on which f is increasing and decreasing (enter your answers using interval notation) find the local minimum of f. find the interval on which f is concave up.
  82. maths

    A clothing firm determines that in order to sell x suits, the price per suit must be p = 150 - 0.5x. It also determines that the total cost of producing x suits is given by C(x) = 4000 + 0.25x^2. a. Find the total revenue R(x). b. Find the total profit
  83. physics

    an engine pumps of 100 kg of water through a height of 10m in 5 second. Given that the efficiency of engine is 60%. If g=10m/s^2 the power of engine is
  84. Physics

    A 0.59g mass of Glynnium goes through a nuclear fission reaction. The energy from the process is used to lift a 97211kg Saturn 5 rocket into orbit. If the mass is transformed with 1% efficiency, what height does the rocket reach? Express your answer in
  85. mabathoana high school maseru

    A block and tackle system of 5 pulley is used to raise a load of 500N steady through a height of 20m the work done against friction is then 2000J. Calculate the work done By effort, efficiency and effort applied
  86. Chemistry!!!

    1.)The silica that makes up the stationary phase in TLC chromatophraphy is more polar than the mobile phase. What then might the relative positions of the analgesics on the developed TLC plate tell you about the polarity of these molecules? Does this match
  87. Social Studies / World Civilizations

    In the initial years after the wars of independence, Latin Americans: A. Had driven out their colonial rulers B. Challenged the colonial economic and social structures C. Capitilized on popular, grassroots movement to effect social changes D. Both B and C
  88. Chemistry

    True/False 1. Diatomic molecules contain two atoms?T 2. Electrons travel in pairs? T 3. The energies needed to break chemical bonds can be measured T 4. Bonding involves all the electrons in an atom T 5. Lewis structures are used to describe bonding? F 6.
  89. Calculus really quick check

    The graph of f ′(x) is continuous and decreasing with an x-intercept at x = 2. Which of the following statements must be true? Edit The graph of f has an inflection point at x = 2. The graph of f has a relative maximum at x = 2. The graph of f is always
  90. Japanese

    okay....so in my Japanese class right now, we're currently writing our speeches.. So far, I've come up with: (This is actually in Japanese but I've chosen to write this in English as I'm on a school computer which only allows English characters!) "At
  91. Calculus-Limits

    Okay, i posted this question yesterday, however, I did not really understand the answer I received. If your the one who answered my question, could you please elaborate. If not, could you try to answer this tough, for me, question. Thanks a lot. lim
  92. Chemistry

    Order the following considering their boiling point in an aqueous solution. 1) pentan-2-one 2) pentan-2-ol 3) 2-aminopropanoic acid The answer key says the order (increasing) is, 1 < 2 < 3 and states 1 only have weak permanent dipole dipole forces
  93. calculus

    a spotlight on the ground shines on a wall 12 m away. if a man 2m tall walks from the spotlight toward the building at a speed of 1.6m/s, how fast is the length of his shadow on the building decreasing when he is 4m from the building?
  94. science

    Which of the following would decrease the magnetic field around a wire? A) Decreasing the current (MY ANSWER) B) reversing the poles of the wire C) looping a section of the wire into a solenoid D) increasing the current
  95. Calculus

    A spotlight on the ground shines on a wall 12 m away. If a man 2 m tall walks from the spotlight toward the building at a speed of 1.5 m/s, how fast is the length of his shadow on the building decreasing when he is 4 m from the building?
  96. Calculus

    A spotlight on the ground shines on a wall 12 m away. If a man 2 m tall walks from the spotlight toward the building at a speed of 1.6 m/s, how fast is the length of his shadow on the building decreasing when he is 4 m from the building?
  97. Statistics and Probability

    One six-sided fair die is rolled, and one two-sided fair coin is tossed. If the coin turns up heads, then the number of spots showing on the die is the value (score) for that trial. If the coin is tails then twice the number of spots showing on the die is
  98. Chemistry

    How many resonance structures do these following acids have? H2CO3-carbonic acid H3PO4-phosphoric acid H2SO4-sulfuric acid HNO3-nitric acid CH3COOH- acetic acid CH2ClCOOH- chloroacetic acid CHCl2COOH- dichloroacetic acid CCl3COOH- trichloroacetic acid
  99. Calculus

    f(x)=4x3−18x2−480x−2 is decreasing on what interval? It is increasing on what interval(s) ? The function has a local maximum at ?
  100. Grammar

    i treid my best to make the sentnce sound good, but its still sounds funny. can you please correct this sentence for me. Thank You so much! It is not surprising that polar bears in the north are decreasing in population due to glacial deterioration nor the