K+(aq) + Al3+(aq) + 2SO42-(aq) + 2H2O(l)→KAl (SO4)2 * 12H2O(s) Al is limiting and 1.007 g Find the theoretical yield and percent yield I think the answer is 17 and 40, respect. I just need help figuring it out

2,949 results
  1. Chemistry

    Alumminum hydroxide reacts with sulfuric acid as follows: 2Al(OH)3+H2SO4-->Al2(SO4)+6H2O. Which reagent is the limiting reactant when 0.500 mol Al(OH)3 and 0.500 mol H2SO4 are allowed to react? How many moles of Al2(SO4)3 can form under these conditions?

  2. Limiting Reagents

    in the synthesis of FeC2O4 (dot) 2H2O, which reagent would be the limiting reagent? FeSO4(NH4)2SO4 (dot) 6H2O - 2.68g. H2C2O4 (dot) 2H2O - 1.99g. I just want to know how the H2Os would effect finding the limiting reagent. As in do they change the ratio?

  3. Chemistry

    What is the net ionic equation when H2SO4 is neutralized by NaOH in aqueous solution? Write the molecular equation. H2SO4 + 2NaOH ==> Na2SO4 + 2H2O Convert to ions. 2H^+ + SO4^= + 2Na^+ + 2 OH^- ==> 2Na^+ + SO4^= + 2H2O Now cancel those ions that appear on

  4. Chemistry

    The equation for the complete combustion of ethene (C2H4) is C2H4(g) + 3 O2(g) ==> 2CO2(g) + 2H2O(g) If 2.70 mol C2H4 is reacted with 6.30 mole O2, identify the limiting reagent. show all work.

  5. Chemistry Help Please!!!

    Find Net Ionic equation for hydrolysis , Expression for equilibrium constant (Ka or Kb) and Value of (Ka or Kb) Net Ionic equations I've got NaC2H3O2 == CH3COO^-+H2O -->CH3COOH+OH^- Na2CO3 ==== CO3 + 2H2O → H2CO3 + 2-OH Kb = [H2CO3] [-OH]2 / [CO3]. Kb =

  6. electric chem

    What is the reduction potential for the half-reaction Al3+(aq) + 3e- Al(s) at 25°C if [Al3+] = 0.10 M and E° = –1.66 V?

  7. chemistry

    In a solution of Al2(SO4)3 the Al3+ concentration is .12 M. What mass of Al2(SO4)3 is in 50 mL of this solution. Please explain the steps. Thanks. The Al3+ part confuses me the most.

  8. Chemistry

    How many moles and how many grams of potassium alum, KAl(SO4)2 · 12 H2O, can be prepared from 5.00 g of aluminum?

  9. ap chemistry

    The formula for epsom salt is MgSO4 . 7H20 If 1.250 g of the compound is dissolved in water, calculate the number of milliliters of .200 M Ba(NO3)2 that would be required to precipitate all of the sulfate ions as barium sulfate. Do it for 1.000 g of alum,

  10. Chemistry

    2Al + 3CuSO4 --> + 3Cu + Al2(SO4)3 * copper(II) sulphate is a hydrate 1.2g of CuSo4 50mL of water 1.0 g of aluminum foil What is the limiting reactant?

  11. Chemistry

    Calculate the volume (in mL) of 9.0M H2SO4 that you would need to convert 0.070 moles of KAl(OH)4 to K2SO4 and Al2(SO4)3 according to the following equation: 2 KAl(OH)4 + 4 H2SO4->K2SO4 + Al2(SO4)3 + 8 H2O

  12. chemistry

    The formula for epsom salt is MgSO4 . 7H20 If 1.250 g of the compound is dissolved in water, calculate the number of milliliters of .200 M Ba(NO3)2 that would be required to precipitate all of the sulfate ions as barium sulfate. I got that right with an

  13. Chemistry

    I have a reaction here: 2Na3PO4.12H2O + 3BaCl.2H2O --> Ba3(PO4)2 + 6NaCl + 30H2O and a question: 0.349g of BaCl2.2H2O and 0.624g of Na3PO4.12H2O are dissolved in 500mL of water to form a solution - how many grams of the excess reactant remain after the

  14. chem-Am I Right????

    For 0.10 M ZnCl2 and 0.10 M KAl(SO4)2, find:? a) spectator ions (if any) b) ions expected to hydrolyze (if any) c) net ionic equation for hydrolysis d) expression for equilibrium constant (Ka or Kb) e) value of Ka or Kb My answers are: a) Cl- ; K+ ; SO4^2-

  15. chem

    write the balanced half reaction for the reaction of Al3+ to Al (3+ is the oxidation state) i don't understand... wouldn't you just subtract 3 electrons from the Al3+ to make it neutral? and then the final answer would be Al-> Al? please help.. i don't

  16. chemistry

    What is the equivalent weight of: (a) Potassium tetraoxalate, KHC2O4•H2C2O4•2H2O, if the complete neutralization is assumed. (b) Sodium carbonate if it is titrated to the phenolphthalein end point with HCl. The reaction is Na2CO3 + HCl = NaCl + NaHCO3.

  17. Chemistry

    Al(s) + H₂SO₄(aq) → Al₂(SO₄)₃(aq) + H₂ (g) Which of the following are the PRODUCTS in the NET ionic equation? Is the answer Al³⁺, H₂, H₃O⁺ ? or is it Al³⁺, H₂, H₂0

  18. chemistry

    1) All of the following are oxidation-reduction reactions except (a) 2Al(s) + Fe2O3(s) ¨A12O3(s) + 2Fe(s) (b) (NH4)2Cr2O7(s) ¨ Cr2O3(s) + N2(g) + H2O(1) (c) Cu(s) + 2H2SO4(aq) ¨ CuSO4(aq) + SO2(g) + 2H2O(1) (d) Hg(NO3)2 + 4KI ¨ K2HgI4(aq) + 2

  19. Science ASAP!!!

    Which one of the following is not a redox reaction? A. H2O(l) + NH3(g) → NH4+(aq) + OH¯(aq) B. 2H2(g) + O2(g) → 2H2O(l) C. Cl2(g) + 2KBr(aq) → Br2(l) + 2KCl(aq) D. 6FeSO4(aq) + K2Cr2O7(aq)+ 7H2SO4(aq) → Cr2(SO4)3(aq) + 3Fe2(SO4)3(aq)+ K2SO4(aq) +

  20. chemistry

    consider the reaction, 2Al(OH)3+3H2SO4---->Al2(SO4)3+6H2O a. Given that 152g of H2SO4 reacts with 234g of Al(OH)3 Howmany grams of Al2(SO4)3 will be theoretical generated? b. which of the reactants is the limiting reagent? c. If the actuall yield was 135 g

  21. Chemistry

    Find the number of unpaired electrons on the central metal atom of following: MgSO4 NiSO4.6H2O CoCl2.6H2O KCr(SO4)2.12H2O CuSO4.5H2O (NH4)2Cr2O7 FeSO4.7H2O MnCl2.4H2O FeCl3.6H2O K3Mn(CN)6

  22. science

    Which of the following would be the limiting reagent in the reaction shown below? There are 50 molecules of O2 and 50 molecules of H2. 2H2(g) + O2(g) ==> 2H2O(g)

  23. CHEMISTRY HELP !!!!

    NH4CL , ZNCL2 , KAL(SO4)2 FIND THE FOLLOWING NET IONIC EQUATION FOR HYDROLYSIS EXPRESSION FOR EQUILIBRIUM CONSTANT (KA OR KB) VALUE THANK YOU SO MUCH!!!

  24. Chemistry

    What how can I calculate the amount in moles and the mass in grams of KOH needed to convert 1.50 g of aluminum to KAl(OH)4. Balanced equation = 2 Al (s) + 2 KOH (aq) + 6 H2O (l)->2 KAl(OH)4 (aq) + 3 H2 (g) Please show steps ..

  25. Chemistry

    calculate cell potential at 25C for: 3Fe3+(aq) + AL(s)= 3Fe2+(aq)+ Al3+ (aq) if Fe3+ = 0.300 M, Fe2+ = 0.150M Al3+ = 0.300M. The standard reduction potentials are as follows: Fe3+ (aq) + e- = Fe2+ (aq) Al3+ (aq) + 3e-=Al (s) Eo = +0.771 V Eo = -1.66 V

  26. Chemistry

    A mixture of KCr(SO4)2 and its hydrate KCr(SO4)2•12H2O has a mass of 1.6336 g. After heating to drive off all the water, the mass is only 1.4659 g. What is the weight percentage of KCr(SO4)2•12H2O in the original mixture? Report your answer to 4

  27. Chemistry

    Charges on the metal MgSO4 = +2 NiSO4*6H2O = +2 CoCl2*6H2O = +2 KCr(SO4)2*12H2O = +3 CuSO4*5H2O = +2 (NH4)2Cr2O7 = +2 FeSO4*7H2O = +2 MnCl2*4H2O = +2 FeCl3*6H2O = +3

  28. chemistry

    Given the following list from the activity se- ries of metals (from most active to least ac- tive) K, Na, Al, Mn, Cr, Cd, Co, Pb, Hg which reaction would you NOT expect to oc- cur? 1. Na(s) +Mn2+(aq) ! Na+(aq) +Mn(s) 2. Co2+(aq) + Al(s) ! Al3+(aq) + Co(s)

  29. Chemistry

    K+(aq) + Al3+(aq) + 2SO42-(aq) + 2H2O(l)→KAl (SO4)2 * 12H2O(s) Al is limiting and 1.007 g Find the theoretical yield and percent yield I think the answer is 17 and 40, respect. I just need help figuring it out

  30. Chemistry

    is KAl(SO4)2 12H2O hygroscopic, deliquescent, or efflorescent?

  31. Chemistry

    Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4

  32. Chemistry

    How would I find the limiting reagent in the chemical equation...CuSO4*5H2O+2K2C2O4*H2O-->K2[Cu(C2O4)2]*2H2O+K2SO4+5H2O I got that K2C2O4 was the limiting reagent but I don't know if that is correct.

  33. University Chemistry (first year)

    I'm working on a first year chemistry lab where we synthesized alum from alunimini foil and I'm doing the report and one of the questions is as follows: Based on your findings, what volume of water can be cleared of suspended solids by one beverage can

  34. chemistry

    A 0.972g sample of a CaCl2*2H2O/K2C2O4*H2O solid salt mixture is dissolved in ~ 150ml of deionized water, previously adjusted to a pH that is basic. The precipitate, after having been filtered and air-dried, has a mass of 0.375 g. The limiting reactant in

  35. Chemistry Repost?

    Many important metals occur as sulfide, arsenide, and antimonide minerals, especially in the Sudbury mineral complex. The first step in processing these ores involves “roasting” the ore in air to produce the metal or metal oxide, along with nonmetal

  36. Chemistry

    Consider the equation: A + 4B=3C+3D, when equal masses of A and B are reacted, which is limiting? My possible answers are: A)if the molar mass of A is less than the molar mass of B, then B must be limiting. B) If the molar mass of A is greater than the

  37. chemistry

    Aluminum reacts with sulfuric acid, which is the acid in car batteries. If 20.0 grams of Al is placed into a solution contain 115 gram of H2SO4, how many grams of hydrogen ga could be be produced? 2Al + 3H2SO4 ---> Al(SO4)3 + 3H2 20.0g/27 = .741 .741 X 3/2

  38. chemistry

    How many grams of iron(II) oxalate dihydrate, Fe(C2O4)·2H2O,mass can be produced when a student begins the synthesis with 3.238 g of ammonium iron(II) disulfate hexahydrate, (NH4)2Fe(SO4)2·6H2O?

  39. AP Chem

    An electrochemical cell consists of a nickel metal electrode immersed in a solution with [Ni2+] = 1.0 M separated by a porous disk from an aluminum metal electrode. (a) What is the potential of this cell at 25°C if the aluminum electrode is placed in a

  40. Chem 2

    A voltaic cell consists of an Al/Al3+ half-cell and a Cd/Cd2+ half-cell. Calculate {Al3+} when {Cd2+} = 0.401 M and Ecell = 1.299 V.Use reduction potential values of Al3+ = -1.66 V and for Cd2+ = -0.40 V.

  41. Chemistry

    In H2SO4 + 2NaOH = 2H2O + Na2SO4 How much of the excess reagent will remain after the reaction has been completed? I know that NaOH is the limiting reactant

  42. chemistry

    Part A Identify the anode and cathode, and indicate the direction of Na+ ion and NO3 - ion flow from the salt bridge. 1) Al is the anode and Co is the cathode; Na+ ions flow into half-cell compartment (A) and NO3 - ions flow into half-cell compartment (B).

  43. Chemistry

    Calculate the amount in moles and the mass in grams of KOH needed to convert 1.50 g of aluminum to KAl(OH)4. Balanced equation = 2 Al (s) + 2 KOH (aq) + 6 H2O (l)->2 KAl(OH)4 (aq) + 3 H2 (g)

  44. science

    A 0.972g sample of a CaCl2*2H2O/K2C2O4*H2O solid salt mixture is dissolved in ~ 150ml of deionized water, previously adjusted to a pH that is basic. The precipitate, after having been filtered and air-dried, has a mass of 0.375 g. The limiting reactant in

  45. Science

    Al+(Cr2O7)2- = Al3+ + Cr3+ [al3+]=0.01M [(cr2o7)2-]= 0.1M [cr3+]=0.001M find the E cell if we add Naoh to each electrode until al(oh)3 precipitates pH=8 KPT of al(oh)3=5 * 10 -33 Eal=-1.66 V Ecr=1.33V

  46. college chemistry

    Calculate the pH of the cathode compartment for the following reaction given Ecell = 3.01 V when [Cr3+] = 0.15 M, [Al3+] = 0.30 M, and [Cr2O72-] = 0.55 M. 2 Al(s) + Cr2O72-(aq) + 14 H+(aq) → 2 Al3+(aq) + 2 Cr3+(aq) + 7 H2O(l)

  47. Chemistry 2

    calculate the theorectical yield of the compounds to be prepared in the experiment. The metal ion in both cases is the limiting reagent.Find nuber of moles of Cu(II) in the sample of CuSO4 x 5H2O that you used. The equal the number of moles of [Cu(NH3)4]x

  48. chemistry

    For each solution whose pH value deviated from 7.0 by at least 1.0 pH unit, give an equation accompanied by a statement which gives the reasons and/or explanation for the deviation. pH values: NaCl 6.89 NaC2H3O2 7.75 Na2CO3 11.20 Cu(NO3)3 4.73 NH4Cl 5.91

  49. Chemistry

    Write so the charges are equal Li+ and OH1- Ca2+ and O2- Al3+ and PO43- Na1+ and S2- Zn2+ and Cl1- Al3+ and 02-

  50. chemistry

    State one reagent that can be used to distinguish btwn each of the pairs of ions and in each case state what is observed if each ion is treated with the named reagent.a)Pb2+(aq) and Al3+ b)SO4 2- and SO3 2-

  51. chemistry

    Given the following two half reactions: Al³⁺(aq) + 3e⁻ → Al(s) E° = -1.66 V; Cl₂(aq) + 2e⁻ → 2 Cl⁻(aq) E° = +1.36 V. Determine the equilibrium constant for 2 Al³⁺(aq) + 6 Cl⁻(aq) → 2 Al(s) + 3 Cl₂(aq)

  52. Chemistry

    Using the half reaction potentials calculate the E^o cell for the Ni-Al cell. Ni (aq) + 2e- Ni (s) -0.25v Al3+ (aq) + 3e- Al (s) -1.66v Using that answer determine Ecell for Ni-Al cell when the concentration of Al3+ is 4.00M and the concentration of Ni2+

  53. chemistry

    Would these be a redox reaction? CaO(s) + H2O(l) = Ca(OH)2(aq) 2FeSO4(aq) + 3H2O2(aq) = Fe2O3(s) + 3H2O(l) + 2SO42-(aq)

  54. Chemistry

    Can someone check my answers for me thank you. I have the equation balanced below. 2H2O + K2SO4 --> H2SO4 + 2KOH Ionic equation for the reaction between sulfuric acid and potassium hydroxide. 2H+ + SO4^2- + 2K+ + 2OH- --> 2K+ + SO4^2- + 2H2O Net equation

  55. CHEMISTRY

    ******* Please check. Also check sig figs. Ion Concentrations 1.) A solution is prepared by dissolving 5.00 g of stannic nitrate in enough water to make 250.0 mL of stock solution. A 15.0 mL aliquot (portion) of this stock solution is then removed and

  56. chemistry

    Hi, the question is: in each reaction, identify what have been oxidised and reduced. The equation is: 2Al + 3H2SO4 ---> Al2(SO4)3 + 3H2 I am confused about the Al2(SO4)3 I know what oxides and reductions us I just don't understant how Al2(SO4)3 balances

  57. chem

    what would the equation for this reaction be?; KAL(SO4)2.12H2O crystallizes out when water is cooled enough to cause the soluble ions to coalesce and precipitate out of solution.

  58. chemistry

    Determine the limiting reactant for this reaction if 3.027 grams of Aluminum are reacted with 60.00 mL of a solution that is 6 M KOH. Determine the amount of KAl(SO4)2•12 H2O that can be produced from this reaction. Molar mass Alum = 474 g/mol 2 Al (s) +

  59. chemistry

    Calculate the volume (in mL) of 9.0M H2SO4 that you would need to convert 0.070 moles of KAl(OH)4 to K2SO4 and Al2(SO4)3 according to the following equation: 2 KAl(OH)4 + 4 H2SO4 --> K2SO4 + Al2(SO4)3 + 8 H2O

  60. science(chem)

    For an example of charge balance in my text it says Write a charge balance eqzn for an aqueous sol that contains NaCl, Ba(ClO4)2, & Al2(SO4)3 The answer given is: [Na+] + [H30+] + 2[Ba+] + 3[Al3+]= [ClO4-] + [NO3-] + 2[SO42-] + [HSO4-] + [OH-] I know that

  61. Chemistry

    Calculate the amount in moles and the mass in grams of KOH needed to convert 1.50 g of aluminum to KAl(OH)4. Balanced equation = 2 Al (s) + 2 KOH (aq) + 6 H2O (l) ¨ 2 KAl(OH)4 (aq) + 3 H2 (g)

  62. Chemistry

    What is the molarity of each ion present if 18.0 g of Al2(SO4)3 is present in 201 mL of solution? _____ M Al3+ _____M SO42-

  63. language

    Opponents of no-fault disapprove of limiting a person's right to sue and collect damages. 1)disapprove of limiting 2)disapproves of limiting 3)disapproved of limiting 4)are disapproving of limiting 5)disapprove of having limited 1

  64. Chemistry

    There's reaction involving gas: Fe + H2SO4 -> Fe2(SO4)3 + H2O + SO2 How Fe2(SO4)3 is occur? I know the "2" comes from the ion of SO4, but I don't know where the "3" comes up. Is the Fe2(SO4)3 comes up from half-reaction method? Is the reaction occurs in

  65. Chemistry

    In the following equations determine which reactant is the limiting and which reaactant is in excess. 1. KCL + HNO3--->KNO3 + HCL 22.0g 18.3g 2. 2Al(OH)3 + 3H2SO4---> Al2(SO4)3 + 6H2O where there is 25 g of Al(OH)3 and 25g H2SO4.

  66. AP Chem

    which would be the limiting reagent in the reaction: 2H2(g) + O2(g) => 2H2O(g) 1. 50 molecules of H2 or 2. 50 molecules of O2

  67. Chemistry

    Given the following list from the activity series of metals (from most active to least active) K, Na, Al, Mn, Cr, Cd, Co, Pb, Hg which reaction would you NOT expect to occur? 1. All of the listed reactions will occur. 2. Na(s) +Mn2+(aq) -> Na+(aq) +Mn(s)

  68. is the ph= o for the H+

    Calculate the pH of the cathode compartment for the following reaction given Ecell = 3.01 V when [Cr3+] = 0.15 M, [Al3+] = 0.30 M, and [Cr2O72-] = 0.55 M. 2 Al(s) + Cr2O72-(aq) + 14 H+(aq) → 2 Al3+(aq) + 2 Cr3+(aq) + 7 H2O(l)

  69. Chem Check Please!!!

    A voltaic cell is constructed that uses the following reaction and operates at 298 K: 2 Al(s) + 3 Mn2+(aq) 2 Al3+(aq) + 3 Mn(s). What is the potential, E, of this cell when [Mn2+] = 0.10 M and [Al3+] = 1.5 M? Answer: The EMF of this cell under standard

  70. chemistry

    If 840 mL of 0.0140 M aqueous Al3+ and 500 mL of 0.0680 M aqueous Br- are reacted, what mass (g) of Br- is produced? Al2(SO4)3(aq) + 3 CaBr2(aq) → 2 AlBr3(aq) + 3 CaSO4(s) Molar Mass (g) Br- 79.904 Al3+ 26.982 Br- 79.904 Molar Volume (L) 22.400 at STP

  71. Chemistry Intro

    If the solubility of alum is 1g @ 1 degree celcius and 1.7 g at 6 degree celcius how much alum (KAl(SO4)2.12H20) would you expect to dissolve at 5.5% C?

  72. Chemistry

    Which of the following species is the strongest oxidizing agent under standard state conditions? a. Ag+(aq) b. H2(g) c. H+(aq) d. Cl2(g) e. Al3+(aq) An oxidizing agent is a substance that gains electrons in a redox chemical reaction. I think Al3+ has a

  73. Chemistry

    Write the overall cell reaction for a cell containing aluminum metal and Zinc(II)sulfate so would it be: Al (s) + ZnSO4 (aq) Al3+ + ZnSO4 ?????? I tried to do it myself but I'm a bit confused... I'm confused about the charges because isn't ZnSO4 neutral

  74. CHemistry

    The first step of the synthesis is described by the reaction below. When 1.200 g of Fe(NH4)2(SO4)2 6H2O is mixed with 13 mL of 1.0 M H2C2O4, the theoretical yield of FeC2O42H2O is ? grams im not sure what to do. do u convert 1.0M to grams first? by

  75. Chemistry

    30g of hydrogen is mixed with 100g of oxygen. The balanced equation is 2H2 +O2 = 2H2O. Determine the limiting reagents and excess reagents.

  76. i need help finding PH

    Calculate the pH of the cathode compartment for the following reaction given Ecell = 3.01 V when [Cr3+] = 0.15 M, [Al3+] = 0.30 M, and [Cr2O72-] = 0.55 M. 2 Al(s) + Cr2O72-(aq) + 14 H+(aq) → 2 Al3+(aq) + 2 Cr3+(aq) + 7 H2O(l)

  77. College Chemistry

    Calculate the pH of the cathode compartment for the following reaction given ℰcell = 3.01 V when [Cr3+ ] = 0.15 M, [Al3+ ] = 0.28 M, and [Cr2O72− ] = 0.66 M. 2 Al(s) + Cr2O72−(aq) + 14 H +(aq) → 2 Al3+(aq) + 2 Cr3+(aq) + 7 H2O(l)

  78. Chemistry

    I had a 1.094g of mystery Alum. "AB(SO4)c. dH2O" (I assume that that the Alum is KAl(SO4)2-12H2O but we don't know A B c or d, we do know that mass percent of water is 51.9) After processing the alum (Ba(NO3)2 and HNO3 through a gooch crucible) we end up

  79. College Chemistry I

    A method for recycling scrap aluminum converts it to alum [potassium aluminum sulfate dodecahydrate, KAl(SO4)2·12H2O]. What is the maximum amount of alum (in metric tons) that can be prepared from 3.12 metric tons of scrap aluminum (1 metric ton = 1000

  80. chemistry

    Calculate the mass of salt needed to prepare 100 cm3 of 0.05 M solution of: (i) Fe(NH4)2(SO4)2.6H2O (ii) FeNH4(SO4)2.12H2O

  81. chemistry

    Calculate the mass of salt needed to prepare 100 cm3 of 0.05 M solution of: (i) Fe(NH4)2(SO4)2.6H2O (ii) FeNH4(SO4)2.12H2O

  82. Chemistry -Assignment Followup

    Many important metals occur as sulfide, arsenide, and antimonide minerals, especially in the Sudbury mineral complex. The first step in processing these ores involves “roasting” the ore in air to produce the metal or metal oxide, along with nonmetal

  83. Chemistry

    Complete each ionic equation Cu+2 + SO4-2 + 4H2O ----> Ca+2 +2NO3-1 + 4H2O ----> 3K+1 +PO4-3 + 6H2O ----> Na+1 + Br-1 + 2H2O ----> 2Na+1 + S-2 + 2H2O -----> 2NH4+1 + CO3-3 + H2O ----> 2Na+1 + Cr-2 + 2H2O -----> Mg+2 + 2Br-1 + 4H2O -----> Na+1 + Cl-1 + 2H2O

  84. Chemistry....

    Wouldn't it be 3*0.234 instead of 2* 0.234? since....2Al3+ +3SO4 2- ----> Al2(SO4)3 4.) A solution is prepared by dissolving 25.0 g of aluminum sulfate in enough water to make 125.0 mL of stock solution. A 10.0 mL aliquot (portion) of this stock solution

  85. chemistry

    How many moles and how many grams of potassium alum, KAl(SO4)2 · 12 H2O, can be prepared from 5.00 g of aluminum?

  86. Chemistry

    what reagent with observations are used to separate(i)Fe2+$Fe3+ (ii)Mg2+$Fe2+ (iii)Cu2+$Al3+ (iv)SO4(2+)$CO3(2+)

  87. Chemistry

    What is the molarity of each ion present if 18.0 g of Al2(SO4)3 is present in 201 mL of solution? _____ M Al3+ _____M SO42-

  88. chemistry

    If 0.755 g of Al3+ dissolved in 960 mL of water reacts stoichiometrically according to the balanced equation, what volume (mL) of 0.0875 M aqueous Cl- is required? Al2(SO4)3(aq) + 3 BaCl2(aq) → 2 AlCl3(aq) + 3 BaSO4(s)

  89. University of Belize

    5. A 0.500 g sample of a BaCl2•2H2O/Na2SO4 salt mixture, when mixed with water, filtered, and dried, produced 0.225 g of BaSO4. The Na2SO4 was determined to be the limiting reactant. a. Calculate the mass, in grams, of Na2SO4 in the mixture. b. Calculate

  90. Chemistry: Compound

    1) ZnSO4 would it be Zn(SO4) does the polyatomic ion always have to have ( ) ? 2) Is Ba(SO4) right? since Ba is 2+ and SO4 is 2- right? 3) In a net ionic equation for BaCI2 would it become Ba ^(2+) + 2CI or Ba ^(2+) + CI2 ?

  91. writing skills

    Sentence 9: Opponents of no-fault disapprove of limiting a person's right to sue and collect damages. which of the following is the best way to write the underlined portion of this sentence?If you think the original is the best way, choose option 1 1.

  92. Chemistry

    I really don't know how to approach this problem and I really need help. Using the average molarity of your initial acetic acid solutions, the initial volumes, and the volume of NaOH added to reach the equivalence point, calculate the [C2H3O2-]

  93. Biology of the environment term

    Teacher explained to us what limiting factor was but I'm not able to understand she said that a limiting factor causes increase in population but I not get how and why is called limiting factor than ? She also said how Phodphorus and nitrogen were limiting

  94. chem help please

    If 720 mL of 0.0165 M aqueous Al3+ and 300 mL of 0.0567 M aqueous Ca2+ are reacted, how many mol of Br- is produced? Al2(SO4)3(aq) + 3 CaBr2(aq) → 2 AlBr3(aq) + 3 CaSO4(s) my answer was .03564 mol of Br will be produced but the real answer is .0340

  95. chemisry

    2NaHCO3 --- Na2CO3 + H2O + CO2 2Fe + 6 HCl -- 2 FeCl3 + 3H2 2HBr + Ca(OH)2 -- CaBr2 + 2H2O N2 + 3H -- 2NH3 2H2O -- 2H2O + O is this a redox ? what is oxidized, reduced

  96. chemistry

    In aqueous solution Mg consists as an ion +2 . What would the formula of the metal salt magnesium sulfate be?? I think it will be Mg(SO4)2 as Mg is a positive ion +2 and SO4 is negative ion SO4- Can you chceck please?

  97. Chemistry

    An 800-mg sample containing sulfate was treated with slight excess of barium chloride, yielding a precipitate that contained 4.3 mg of co precipitated CaCO3. after ignition and cooling, the precipitate weighed 277.0 mg. Calculate the a.) apparent % SO4 b.)

  98. chemistry

    *The Nernst Equation and pH* Sulfuric acid is a very strong acid that can act as an oxidizing agent at high concentrations (low pH). Under standard conditions, sulfuric acid has a low reduction potential, SO4^2-(aq) + 4H^+(aq) + 2e^- SO2(g) +

  99. general chemistry

    A 0.500 g sample of a BaCl2•2H2O/Na2SO4 salt mixture, when mixed with water, filtered, and dried, produced 0.225 g of BaSO4. The Na2SO4 was determined to be the limiting reactant.

  100. Batteries

    3 Sn^2+ (aq) + 2 Al (s) 2 Al3+(aq) + 3 Sn(s). What is the voltage for this cell? What is the voltage for the cell if the Sn2+(aq) is [.15] and Al3+(aq) is [1.80]? Using proper line notation, describe the cell described in the question.

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20