1. chem

    Consider the following unbalanced equation: C2H5OH(g) + O2(g) → CO2(g) + H2O(l) 1.55 g of ethanol reacts with 10.0 g of oxygen. What is the total volume of gas present (in L) after the reaction is complete, assuming the reaction takes place at 1.00
  2. chemistry

    While trace impurities of iron and chromium in natural corundum form the gemstones ruby and sapphire, they are basically a binary compound of aluminum and oxygen, with 52.9% Al. Find the empirical formula and give the chemical name for corundum. i really
  3. Chemistry

    For which of the following aqueous salts will electrolysis produce hydrogen gas and oxygen gas? Answered the hint in Mastering Chem & looked over the book and I still have no idea. Check all that apply: A) NiF_2(aq) B) NaF(aq) C) NiI_2(aq) D) NaI(aq) E)
  4. Science

    15. Which of the following factors is the most likely explanation for an energy deficit that results in exercise-induced exhaustion. A.Insufficient protein production B.Insufficient mitochondrial function. C.Impair urea elimination. D.Absence of oxygen
  5. Chemistry

    What is the change in entropy when 9.30 mL of liquid benzene (C6H6, d = 0.879 g/mL) is burned in the presence of 37.2 L of oxygen gas, measured at 298 K and 1 atm pressure? 2C6H6(l) + 15O2(g) → 12CO2(g) + 6H2O(l); ∆S° = –437.7 J/K at 298 K
  6. Chemistry

    You dissolve 5 g of calcium hydroxide in 2 liters of water. What is the molarity of the hydroxide ions in this solution? What is the molarity of the calcium ions in this solution?
  7. Chemistry

    Explain why this reaction is not feasible:CH3CHO^-Na^+ + CH3C(CH3)2Cl=CH3CH2O(CH3)2OCH3. ;->Becos of ion charge of Oxygen and Na in the cpd reacting with non ionic cpd
  8. Chemistry

    Which of the following statements is true regarding a covalent bond in CO? Valence electrons are transferred to the oxygen atom. The bond length is less than the sum of the two atomic radii. Bonding electrons are stationary in the CO molecule. all of the
  9. biology lab

    how to know from the experiment if the oxygen produced as a result of carbon fixation or electron transport? my experiment result show that average bubble/min for tap water is 4.7 while NaHCO3 is 1.8.
  10. chemistry

    An explosive whose chemical formula is C3H6N6O6 produces water, carbon dioxide, and nitrogen gas when detonated in oxygen. write the chemical equation for the detonation reaction of this explosive.
  11. Science

    Hello van some one show me how to draw a dot and cross diagramm for 1 lithium atom and 1 fluorine atom(Lif) and also a diagram for 1 magnesium atom and 1 oxygen atom (MgO) Thankyou Paul.
  12. Chemistry

    When a mixture of 10.0 g of acetylene and 10.0 g of oxygen is ignited, a complete combustion of the reactants takes place. What is the limiting reagent of this reaction? How many grams of each of the reactants and products are present at the end of the
  13. Chemistry

    Iron (II) ions can be precipitated from the following reaction: 4Fe(OH)+(aq) + 4OH-(aq) + O2(g) + 2H2O(l) --> 4Fe(OH)3(s) How many grams of oxygen gas will be needed to precipitate the iron contained in 125mL of 0.085M Fe(OH)+ solution?
  14. chemistry12_2016-1

    In one process, 4.0 grams of sulphur was brunt in 48.0 decimeter cube of oxygen measured at RTP. (A) What is the limiting reactant in this reaction? (B) Calculate the volume of sulphur dioxide formed at RTP.
  15. chemistry

    Fumaric acid, which occurs in many plants, contains, by mass, 41.4% carbon, 3.47% hydrogen, and 55.1% oxygen. A 0.050-mol sample of this compound weighs 5.80 g. The molecular formula of this compound is can you show me the formula
  16. chemistry

    I do not understand how to right a balanced equation for the combustion of cellulose in oxygen to produce carbon dioxide and water vapor. I know that cellulose is C6H10O5 but I don't understand how to balance. Thanking you in advance for your help.
  17. Chemistry

    In an experiment, a mixture of two gases occupies a volume of 3.00 L at a temperature of 22.5 degree centigrade. The mixture contains 14.0 g of water, 11.5 g of oxygen, and 37.3 g of nitrogen. Calculate the total pressure and the partial pressure of each
  18. chemistry

    8750 g of a compound which contains only carbon, hydrogen, and nitrogen were burned in oxygen to produce, 2.1930 g of N2O4 , and 2.2900 g of water. What is the empirical formula of the compound? (Hint: do carbon by difference)
  19. stoiciometry (chemistry)

    calculate the theoretical yield of Cu when 53.2g Cu2S react with oxygen. (balanced equation is CU2S+02>2Cu+S02) Please help me figure this homework out. I just dnt get how to get the theoretical yeild. I want to know to be able to do the rest right.
  20. Chemistry I

    A scuba diver's tank contains 0.23 kg of O2 compressed into a volume of 3.5 L. (a) Calculate the gas pressure inside the tank at 11°C. ________atm (b) What volume would this oxygen occupy at 20°C and 0.92 atm? ________L what are the formulas for this
  21. Chemistry

    A 5.00 g mixture of methane (CH4) and ethane (C2H6) is combusted in oxygen gas to produce carbon dioxide and water. If 14.09 g of CO2 is produced, how many grams of methane was in the original 5.00 g mixture ?
  22. Science

    If oxygen, Carbon dioxide, and xenon gases are heated at 500k with a probable particle speed of 1094 and an average particle speed of 1234, what id the mass of an atom or molcule for each?
  23. Chemistry

    Gasohol contains ethanol (C2H4OH)(l), which when burned reacts with oxygen to produce CO2(g) and H2O(g). How much heat is released when 12.5g of ethanol burns? C2H5OH(l) + 3 O2(g) --> 2 CO2(g) + 3H2O(l) Delta H = -1368kJ
  24. science

    1 litre of coffee at 80oC need to be cooled to 40oC. Assuming that all the ice melts and no heat is lost to the environment. Take the specific heat capacity of coffee to be 4200J/kgK, density of coffee to be 1000kg/m3 and latent heat of fusion of water to
  25. Math

    You have a 7-liter, and an 11-liter container with no markings on them. Both are empty. You may fill up any of them from the water faucet any number of times, you may empty any of them any time, and you may pour water from one container to the other any
  26. Chemistry

    An ideal monatomic gas initially at 298 K and 1 atm pressure is expanded from a volume of 1 liter to 2 liters. Consider separately isobaric, isothermal and adiabatic expansions to accomplish this. In each case, calculate the following: a) The final
  27. Chemistry

    solution of hydrogen peroxide, H2O2 , is titrated with potassium permanganate, KMnO4 , according to the following equation: 5 H2O2 + 2 KMnO4+ 3H2SO4 -> 5O2 + 2 MnSO4 +8H2O + K2SO4 It requires 46.9mL of 0.145 mol/L KMnO4 to titrate 50.0 mL of the
  28. chemistry

    What is the molecular structure around the oxygen in water? What is the molecular structure around all the carbons in ethanol?
  29. chemistry

    The molecular structure around the oxygen in water is ? The molecular structure around all the carbons in ethanol is ?
  30. chemistry

    how much oxygen is produced by heating 20g of mercury (II) oxide if 18.6g of mercury is produced?
  31. Science

    How many grams of oxygen gas would be needed to react with 75 grams of hydrogen gas
  32. Chemistry

    Aluminum oxide contains 53% of Al. How much oxygen combines with 26.5g of aluminium to form aluminium oxide? Thank you
  33. chemistry

    How many grams of magnesium oxide are produced when 40 grams of oxygen react with magnesium
  34. Chemistry

    Determine the oxidation number of V in the V_4O_12^4− ion given that the oxidation number of oxygen is −2
  35. chemistry

    What is reduced and what is oxidized in the reaction? 2Mg+O2=2MgO Oxygen is oxidized Mg is reduced
  36. Chemistry

    Which must be the same when comparing 1 mol of oxygen gas, O2, with 1 mol of carbon monoxide gas, CO?
  37. Chemistry

    How do you balance: iron(II0 oxide+ oxygen--> iron(III) oxide
  38. chemistry

    caesium+water-->caesium hydroxide caesium+oxygen-->caesium oxide are these equation right?
  39. Chemistry

    Potassium chlorate is 75% pure 48 gram of oxygen would be produced from how much potassium chlorate
  40. Chemistry

    The molecular structure around the oxygen in water is ?????? The molecular structure around all the carbons in ethanol is ?????
  41. chemistry

    The molecular structure around the oxygen in water is . The molecular structure around all the carbons in ethanol is .
  42. science

    This is a science question so be prepared. lol How many orbitals does hydrogen (H) have? 1 or 2 or 3 How many orbitals does oxygen (O) have? 1 or 2 or 3
  43. chemistry

    If 75.0 grams of water is decomposed into hydrogen and oxygen, how many grams of hydrogen should be formed?
  44. Math about weight

    Pedro has Abadia back and can only lift 32lbs. He is going hiking and has packed his sleeping bag, two pairs of socks, and 2 bottles with 4 liters of water each. If Pedro is carrying his limit, one pair of socks weighs .8 lbs, and his sleeping bag weighs 3
  45. history

    ( ) around my answer. If nothing is there then i don't know What is one important achievement of the Incas? A. a written language B. a system of democratic government C. a system of roads and bridges D. an accurate calendar What is one way in which the
  46. Chemistry

    Based on the following balanced equation: 2 NH3 + 2 O2 -->N2O + 3 H2O a. How many moles of O2 are required to react completely with 6.00 moles of NH3? b. How many grams of O2 are required to react completely with 6.00 moles of NH3? c. How many moles of
  47. Chemistry

    Ok so reviewing my notes I also got 11,326.6 as the volume in ml. The density of water he wanted us to use was (0.9975) and I went from 1 gal of H2O = 3.785 liters = 3785 grams then multiplied by 3 giving me 11,355g H2O. The only other step I could come up
  48. chem. Combined Gas laws

    A gas takes up a volume of 17 liters, has a pressure of 2.3 atm, and a temperature of 299K. If I raise the temperature to 350K and lower the pressure to 1.5 atm, what is the new volume of the gas? Use the combined gas law here. I will be happy to critique
  49. physics

    Sewage at a certain pumping station is raised vertically by 5.27 m at the rate of 1 930 000 liters each day. The sewage, of density 1 050 kg/m3, enters and leaves the pump at atmospheric pressure and through pipes of equal diameter. (a) Find the output
  50. Physics

    Sewage at a certain pumping station is raised vertically by 5.57 m at the rate of 1 860 000 liters each day. The sewage, of density 1 050 kg/m3, enters and leaves the pump at atmospheric pressure and through pipes of equal diameter. (a) Find the output
  51. Physics

    A rocket whish is in deep space and initially at rest relative to an inertial reference frame, has a mass of 2.55 X 10^5 kg of which 1.81 X10^5 kg is fuel. The rocket engine is then fired for 250 s during which feul is consumed at the rate of 480 kg/s. The
  52. chemistry

    what is the molarity of a solution made by mixing 178.5 of 1.5 M NaCl with 283.4m of 4.3M NaCl Mnacl*L nacle =(1.5)(.001718)=.0026775 moles nacl=(4.3)*(.002834)=.0121862 total moles = .0026775+.0121862=.0148moles final volume = .001785+.002834=.004819 L
  53. Engish

    I'm finding it difficult to write the instructions for a strawberry salad. (Can you say it in English)? Thank you very much for your help. 1) Remember the most common non-reflexive verbs in English through this story. 2) Which are considered as low marks
  54. Chemistry

    What is the percent by mass of C in methyl acetate (C3H6O2)? The molecular weight of carbon is 12.0107 g/mol, of hydrogen 1.00794 g/mol, and of oxygen 15.9994 g/mol. Answer in units of %. Please work it out for me so I totally understand it. Thanks!
  55. Earth Science

    Seismic waves move faster through which of the following media? a.) water b.) steel c.) oxygen d.) oil Please answer my study guide is due Monday and the teacher hasn't gone over this I looked through my notes and everything. It would really help if you
  56. Chemistry

    The reaction describing the formation of ozone from oxygen is shown below. 3 O2(g) <--> 2 O3(g) Calculate Grxn at 288 K for this reaction in a flask where [O2] = 3.419 x 10-2 M and [O3] = 5.783 x 10-4 M. Assume G° = 326 kJ. Use molarity to construct
  57. Chemistry

    How much water would be formed if 3.00 mol NH3 reacted with excess oxygen gas in the following equation? Given the reaction 4NH3+ 5O2 --> 4NO + 6H2O A) 2.00 mol B) 3.00 mol C) 4.50 mol D) 6.00 mol E) None of these
  58. Chemistry

    Hi Im reposting incase my original post doesn't get read. Please see bottom for additional info that I need help getting verified. Many thanks Hi Please help verify my answer to the following question: 0.500g of pure phosphorous was burned in excess pure
  59. Finance

    I have a number of questions for a finance assignment that is meant as a review for our final. However my final is being written earlier than the rest of the class so the answers aren't up yet. I was hoping someone could answer two or three of the
  60. science

    Which of the following substances are homogeneous and which are heterogeneous? Blood, carbon dioxide gas, solid carbon dioxide, rock, steak, iron, rust, concrete, air, oxygen, salt, milk.
  61. CHEMISTRY

    Consider the reaction N2+O2-->2NO with Delta H=43.2kcal. When 50.0g of N2 react with an excess of oxygen, how much heat is generated/consumed? I know that this is an endothermic reaction b/c of the + delta H, is there some sort of formula to use here? I
  62. Chemistry

    A mass of aluminium metal is heated in a such in a such a way that is was exposed to air.(1.751g Al) A compound containing aluminium and oxygen is formed. It has a mass of 3.311 g. What is the empirical formula of aluminum oxide according to this
  63. Chemistry

    Write a balanced equation for the combustion of gaseous ethane (C2H6) a minority component of natural gas, in which it combines with gaseous oxygen to form gaseous carbon dioxide and gaseous water.
  64. Chemistry

    Hydrogen sulfide burns in the presense of oxygen producing sulfiar dioxide and water I got HS + O2 >>> SO2 + H2O Its not balanced yet, but can you check if i wrote the equation right? Does the hydrogen sulfide need charges added to them?
  65. Chemistry

    Write a balanced equation for the combustion of gaseous ethylene (C2H4), an important natural plant hormone, in which it combines with gaseous oxygen to form gaseous carbon dioxide and gaseous water
  66. chemistry ap

    Assuming all volume measurements are made at the same temperature and pressure, what volume of hydrogen gas is needed to react completely with 3.25 L of oxygen gas to produce water vapor? Answer in units of L.
  67. chemistry

    water vapor and nitrogen dioxide gas NO2 are cimbined to manufacture ammonia. a by product of this reaction is oxygen gas. write a balanced equation for this reaction. i do not understand this at all please help me figure it out
  68. chemistry

    A 10.0-L stainless steel container was charged with 2.00 atm of hydrogen gas and 3.00 atm of oxygen gas. A spark ignited the mixture, producing water. What is the pressure in the tank at a constant temperature of 25°C?
  69. Chemistry

    Which of the following is the strongest acid? 1. HNO2 4. H2SO3 2. H2CO3 5. HFO 3. HC1O3 6. H2O I'm really stuck, I know none of these are a "strong acid." I think the strongest might be HClO3 because Cl has the highest oxidation number and it has the most
  70. Chemistry

    A sample of dry air at 28 degress celcius in a sealed flask has a pressure of 90kPa. Which is the most likely the partial pressure of Oxygen, O2(g) in the flask? a) 70kPa b) 19kPa c) 3Pa d) 0.8kPa Can you explain how you got this answer?
  71. Physical Science

    An iron fence is left unpainted, and it reacts with the oxygen in the air, forming rust. The formation of rust is an oxidation-reduction reaction, but it is also an example of a(n) _________ reaction My answer is synthesis
  72. Chemistry

    64g of oxygen reacts completely with methane gas to form 44g of carbon dioxide gas and 36 g of water vapour. Calculate the amount of methane that takes part in the reaction .
  73. Chemistry

    i have to write a balanced equation for the combustion of benzene.. C6H6 + O2 ==> CO2 + H2O Answer: C6H6 + 14O2 --> 6C02 + 4H2O Your answer is incorrect. There are more oxygen on the left, and more hydrogen on the right. try coefficients 2,15,12,6
  74. Chemistry

    How many milimetres of 0.114 M sulphuric acid solution provide the sulfuric acid required to react with the sodium hydroxide in 32.3 ml of 0.122 M NaOH according to the following equation? H2SO4 + 2 NAOH ---> Na2SO4 + 2 H20 A millimeter is a unit of
  75. Chemistry

    For the system, H2(g) + X2(g) <--> 2HX(g), Kc = 24.4 at 300 K. A system was charged with 2.00 moles of HX in a 3.00 liter container. The catalyst was introduced using a remote unit, and the system was allowed to come to equilibrium. How many moles of
  76. Chemistry

    About 50% of U.S. and most Canadian sulfur is produced by the Claus process, in which sulfur is obtained from the H2S(g) that occurs in natural gas deposits or is produced when sulfur is removed from petroleum. The reactions are described by the equations
  77. Chemistry VERY DIFFICULT

    Imagine you have been given a series of materials to react together and the following enthalpy change data has been recorded. Explain the terms exothermic and endothermic, and identify which of the following are exothermic and endothermic reactions. Ensure
  78. Reserves-PLEASE HELP!

    The Norfolk Bank has $18,000 in excess reservces and the reserve ratio is 20 percent. Which level of checkable deposits and reserves might this bank hold? a. $160,000 in checkable-deposit liabilities and $47,000 in reserves. b. $140,00 in checkable-deposit
  79. Chemistry

    1. Which of the following will result in a chemical change? A. Melting ice to obtain water B. Evaporating alcohol into vapor C. Drying wood in a shed D. Burning coal in a furnace(My answer) 2. A salt is obtained as a reaction between A. a nonmetal and a
  80. Marketing (Help Check)

    24.Which of the following is characteristic of the organizational buying process? A)Multiple parties participate in purchase decisions. B)Negotiation between buyers and sellers is commonplace. C)Online buying over the Internet is widespread. D)Buying
  81. Chemistry

    Titration of 25.00 mL of a monoprotic acid solution with 0.2269 M NaOH is: Initial NaOH = 3.96 mL Final NaOH = 38.84 mL (dif is 34.88mL) Based on data what is the molar concentration of acid? I did V x M = 0.03488L NaOH x 0.2269 = 0.079143 Not sure if I
  82. Math

    Byron’s house has a roof with dimensions shown. (Roof: 1m Height, 7m Hypotenuses, 12m length) He knows that the average rainfall in his suburb is 30cm per year. Byron would like to install a cylindrical rainwater tank to hold the water that runs off the
  83. Math

    Byron’s house has a roof with dimensions shown. (Roof: 1m Height, 7m Hypotenuses, 12m length) He knows that the average rainfall in his suburb is 30cm per year. Byron would like to install a cylindrical rainwater tank to hold the water that runs off the
  84. Chemistry (URGENT)

    I have a test soon. If you can help me with these questions, that would be great. 1. Define and describe the following. a)Alkaline - metal - base b)Corrosive - burn/eat away - acid c)Caustic - harsh - both? (acid + base) d)Low pH - 0-6.99 - acid Please
  85. calcium cloride

    we are having a ice cream industry we are using calcium cloride to get -35 degree now we are getting -25 degree density of liquid is 1.210 how many kilo grams of calcium cloride to mix in liquid to get the density of 1.300 the liquid is nearly 3000 liters
  86. chemistry

    Which element has atoms that can form single, double, and triple covalent bonds with atoms of the same element? the choices are florine, oxygen,carbon and hydrogen. i also need a explanation of why its the right answer. thanks for helping :) How do we see
  87. metaphor

    What in this sentence is a metaphor? I have three candles here on the table which I disentangle from plants and light when visitors come. Small usually avoids them, although once she came too close and her tail caught fire; I rubbed it out before she
  88. language arts

    what are simple subjects ang simple predicates help me work due monday The simple subject is the one word that is doing the action. The simple subject in these examples are CAPITALIZED. LASSIE came home. ONE of my brothers plays football. Have YOU ever
  89. English

    Can you check these sentences for me, please? Thank you. 1) I had a terrible pain in my tooth. I went to the dentist and he told me my molar was decayed (or I had a decayed tooth and it needed filling?) 2) The filling has come out of my tooth. 3) You use a
  90. Quick English check

    Please check these sentences and correct me if I'm wrong, thank you! 1. A 'MYRIAD' of people are interested in auditioning for the reality tv show, but only a handful will be afforded the opprutunity. 2. The villain wants the world to tremble at the 'MERE'
  91. language arts

    1. which of the following statements most accurately describes Mr. Lapham and his daughter in law Mrs. Lapham? A. Mr. Lapham is kindly and pious; Mr. Lapham is pragmatic and determined B. Mr. Lapham is concerned about money; Mrs. Lapham is concerned about
  92. Chemistry

    N2(g) + O2(g) → N2O5(g) What volume of oxygen gas reacts to yield 750.0 cm3 of N2O5? The reaction conditions are 350°C and 2.50 atm pressure. I balanced the equation 2N2+2O2 = 2N2O5 BUT I AM NOT GETTING THE CORRECT ANSWER, WHAT AM I DOING WRONG?
  93. chemistry

    Ammonium nitrate decomposes explosively at high temperatures to form nitrogen, oxygen, and water vapor. 2NH4NO3-->2N2+4H2O+O2. Calculate the number of grams of water formed when 25 L of N2 is produced in this reaction (assume STP)
  94. chemistry

    when a student removed the crucible cover afer the first strong heating in creating magnesium oxide, some of the white was knocked from the cover to the floor and was lost. did this loss cause the calculated number of moles of oxygen in the compound to be
  95. Science

    Adam suffers from severe emphysema. Gas exchange in his lungs is not adequate, and he requires supplemental oxygen. But even though his blood carbon dioxide levels are elevated, his blood pH is close to normal. Considering the urinary system, explain how
  96. Chemistry

    Can someone please check if I have written and balanced the reaction properly? 1.In 1774 Joesph Priestley discovered oxygen by decomposing the oxide of mercury. 2HgO = 2 Hg + O2 2. Slaked lime precipitates magnesium ions from hard water. Ca(OH)2 +
  97. Chemistry (Stoichiometry)

    Potassium superoxide (KO2)reacts in the following equation: 4KO2 + 2H2O +4CO2 =4KHCO3 + 3O2 If a person wearing an oxygen mask exhales 0.85 grams of CO2 every minute, how many moles of KO2 are comsumed every 10.0 minutes?
  98. Chemistry

    N2(g) + O2(g) → N2O5(g) What volume of oxygen gas reacts to yield 750.0 cm3 of N2O5? The reaction conditions are 350°C and 2.50 atm pressure. I balanced the equation 2N2+2O2 = 2N2O5 BUT I AM NOT GETTING THE CORRECT ANSWER, WHAT AM I DOING WRONG?
  99. Chem- Dr. Bob!

    Posted by Rachel on Thursday, January 20, 2011 at 3:57pm. Does anyone know where I can get an image of the valence bond model for maleic acid? ie. showing the pi and sigma bonds and indicating the hybridization (sp2, sp3.. ) OR could someone describe these
  100. Finance

    Your company, Martin Industries, Inc., has experienced a higher than expected demand for its new product line. The company plans to expand its operation by 25% by spending $5,000,000 for an additional building. The firm would like to maintain its 40% debt