Find (g 0 f)(x) when f(x) = cos x , and g(x) = x^2

99,916 results
  1. math

    Can you please check my work. A particle is moving with the given data. Find the position of the particle. a(t) = cos(t) + sin(t) s(0) = 2 v(0) = 6 a(t) = cos(t) + sin(t) v(t) = sin(t) - cos(t) + C s(t) = -cos(t) - sin(t) + Cx + D 6 = v(0) = sin(0) -cos(0)

  2. Studying for Pre Cal exam

    Find the fourth roots of − 1/2 + (square root)3/2 i Write the roots in trigonometric form. A - w 1=cos(35°)+isin(35°) w2 =cos(125°)+isin(125°) w3 =cos(215°)+isin(215°) w4 =cos(305°)+isin(305°) B - w1 =cos(40°)+isin(40°) w2

  3. Algebra

    Write an equation for the translation of the function. y = cos x; translated 6 units up A. y = cos x- ­ 6 B. y = cos(x + 6) C. y = cos x + 6 D. y = cos(x ­ 6) I think its B or c..

  4. Trig

    Find sin(s+t) and (s-t) if cos(s)= 1/5 and sin(t) = 3/5 and s and t are in quadrant 1. =Sin(s)cos(t) + Cos(s)Sin(t) =Sin(1/5)Cos(3/5) + Cos(-1/5)Sin(3/5) = 0.389418 Sin(s-t) =sin(s)cos(t) - cos(s)sin(t) =sin(-3/5)cos(1/5) - cos(1/5)sin(3/5) =Sin-3/5

  5. trig

    Find all solutions to the given equation in the interval [0,2π). Give the exact solution, including "pi" for π. For any unused answer boxes, enter DNE in all capital letters. (a) 2cos x=2 so cos x=1 =0..(now what?) (b) 4cos x+2=0 cos x = -1/2 (120) cos

  6. Vector Algebra

    Find the direction angles of the vector given below. Then write each vector in the form v = ||v||[(cos A) i + (cos B) i + (cos Y) k ]. v = -6i + 12j + 4k

  7. Math question - plz correct

    Two airplanes leave an airport at the same time. One travels at 355km/h and the other at 450km/h. Two hrs later they are 800km apart. Find the angle between their courses. a^2 = b^2 + c^2 - 2bc Cos A 800^2= 450^2 + 355^2 - 2(450)(355) Cos A 640000= 202 500

  8. geometry

    Find the measure of the acute angle x, if : sin(x)=0.0175; sin(x)=0.5015; cos(x)=0.06814; cos(x)=0.0670. I know that Sin(x)=opp./hyp. and that cos(x)=adj./hyp. but i have no clue about how to find the xs in these equations

  9. Pre calc

    Find all primary solutions (i.e. 0 ≤ θ < 2π ) of the equation cos(2θ ) = 4 − 3 cos(θ ). Find all primary solutions (i.e. 0 ≤ θ < 2π ) of the equation cos(2θ )cos(θ ) = sin(2θ )sin(θ ). Please can somone help and show all work Thank you

  10. Calculus 12th grade (double check my work please)

    1.)Find dy/dx when y= Ln (sinh 2x) my answer >> 2coth 2x. 2.)Find dy/dx when sinh 3y=cos 2x A.-2 sin 2x B.-2 sin 2x / sinh 3y C.-2/3tan (2x/3y) D.-2sin2x / 3 cosh 3yz...>> my answer. 2).Find the derivative of y=cos(x^2) with respect to x. A.-sin (2x) B.-2x

  11. Maths

    If cos cos A=3/5 and sinB=7/25,where A is acute and B is obtuse,find without using tables the value of Cos(A+B)

  12. math

    3 cos^2 𝛼 + 2 cos^2 𝛽 =4 3 sin 2 𝛼 − 2sin 2 𝛽=0 Find the values of cos 2𝛼 and cos 2𝛽.

  13. math

    if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that cos(B-C)=cos(C-A)=cos(A-B)=-1/2

  14. Calculus

    Find F '(x) for F(x) = integral[x^3 to 1](cos(t^4)dt) a. cos(x^7) b. -cos(x^12) c. -3x^2cos(x^12) d. cos(1) - cos(x^12)

  15. calculus

    Find the points on the curve y= (cos x)/(2 + sin x) at which the tangent is horizontal. I am not sure, but would I find the derivative first: y'= [(2 + sin x)(-sin x) - (cos x)(cos x)]/(2 + sin x)^2 But then I don't know what to do or if that is even

  16. Trigonometry

    Express each of the following in terms of the cosine of another angle between 0 degrees and 180 degrees: a) cos 20 degrees b) cos 85 degrees c) cos 32 degrees d) cos 95 degrees e) cos 147 degrees f) cos 106 degrees My answer: a) - cos 160 degrees b) - cos

  17. precalc

    Find the exact value of each expression, if it exists: the -1 are representing the inverse functions! (a) sin -1 (-√2/2) (b) cos−1 (−1) (c) sin( 􏰀sin−1 (π)􏰁) (d) cos−1􏰀(cos􏰀(−4π􏰁􏰁/ 3)) (e) tan−1 (tan(0.6)) (f) cos−1(

  18. Math/Physics

    My question is this: The potential at the surface of a sphere (radius R) is given by V_0 = k cos 3theta where k is constant. Find the potential inside and outside the sphere as well as the surface charge density (lower case sigma(theta)) on the sphere.

  19. Trig

    Given: cos u = 3/5; 0 < u < pi/2 cos v = 5/13; 3pi/2 < v < 2pi Find: sin (v + u) cos (v - u) tan (v + u) First compute or list the cosine and sine of both u and v. Then use the combination rules sin (v + u) = sin u cos v + cos v sin u. cos (v - u) = cos u

  20. Trigonometric

    Consider the following simultaneous equations: 3 cos^2 𝛼 + 2 cos^2 𝛽 =4 3 sin^2 𝛼 − 2sin^2 𝛽=0 *Find the values of cos 2𝛼 and cos 2𝛽. *Hence solve for 𝛼𝛼 and 𝛽𝛽. Where 0°≤𝛼𝛼≤360° and 0°≤𝛽𝛽≤360°.

  21. CALCULUS

    If cos(t)=–7/9, find the values of the following trigonometric functions. Note: Give exact answers, do not use decimal numbers. The answer should be a fraction or an arithmetic expression. a) cos (2t) b) sin (2t) c) cos(1/2) d) sin (1/2) i don't even

  22. Homework Help Calculus

    Find the linear approximation L(x)of the function f(x)=cos(pi/(6)x) at the point x=1 and use it to estimate the value of cos(13pi/72). Here's what I did so far: L(x)=sqrt(3)/2-1/12pi(x-1)+0((x-1)^2) How do I find cos(13pi/72)

  23. Math

    Find the exact value of cos 1 degree + cos 2 degrees + cos 3 degrees + ... + cos 357 + cos 358 degrees + cos 359 degrees.

  24. Maths:Trigonometry

    How do I do this Need details solution to follow up prove that cos(a)+cos(a+b)+cos(a+2b)+....+cos(a+(n-1)b)={cos(a+((n-1)/2)bsin(nB/2)}/½sinb for all N£N ???

  25. calc

    find the area between the x-axis and the graph of the given function over the given interval: y = sqrt(9-x^2) over [-3,3] you need to do integration from -3 to 3. First you find the anti-derivative when you find the anti-derivative you plug in -3 to the

  26. trig

    2sin(x)cos(x)+cos(x)=0 I'm looking for exact value solutions in [0, 3π] So I need to find general solutions to solve the equation. But do I eliminate cos(x), like this... 2sin(x)cos(x)+cos(x)=0 2sin(x)cos(x)= -cos(x) 2sin(x) = -1 sin(x) = -1/2 at 4pi/3

  27. calculus

    Differentiate. y= (cos x)^x u= cos x du= -sin x dx ln y = ln(cos x)^x ln y = x ln(cos x) (dy/dx)/(y)= ln(cos x) (dy/dx)= y ln(cos x) = (cos x)^x * (ln cos x) (dx/du)= x(cos x)^(x-1) * (-sin x) = - x sin(x)cos^(x-1)(x) (dy/dx)-(dx/du)=

  28. Calculus

    Find the exact value of the slope of the line which is tangent to the curve given by the equation r = 2 + cos θ at theta equals pi over 2 . You must show your work. (10 points) Please check if this is right. I put a lot of work into this please check! x=

  29. Calculus

    Find the equation of the curve that passes through the point (x, y) = (0, 0) and has an arc length on the interval 0⩽x⩽π/4 given by the integral from 0 to π/4 of√(1+cos^2x) dx. a) y= sin(x) ------> My answer. Can you check for me, pleaseeee? b) y=

  30. math

    Find the exact value of cos 300 degrees. thanks guys cos 300 = 1/2 = 0.500 how do you know? I am supposed to show my work. You ought to know the rule on 30-60-90 triangles. If the hyp is 2, the shorter side is 1, and the longer side is sqrt3. what does

  31. Trig Help!

    Question: Trying to find cos π/12, if cos π/6 = square root 3 over 2, how to find cos π/12 using DOUBLE angle formula? This is what I got so far.. cos 2(π/6) = cos (π/6 + π/6) = (cos π/6)(cos π/6) - (sin π/6)(sin π/6) = cos^2 π/6 - sin^2 π/6 Is

  32. TRIG!

    Posted by hayden on Monday, February 23, 2009 at 4:05pm. sin^6 x + cos^6 x=1 - (3/4)sin^2 2x work on one side only! Responses Trig please help! - Reiny, Monday, February 23, 2009 at 4:27pm LS looks like the sum of cubes sin^6 x + cos^6 x = (sin^2x)^3 +

  33. pre-cal

    Simplify the given expression........? (2sin2x)(cos6x) sin 2x and cos 6x can be expressed as a series of terms that involve sin x or cos x only, but the end result is not a simplification. sin 2x = 2 sinx cosx cos 6x = 32 cos^6 x -48 cos^4 x + 18 cos^2 x -

  34. Trig/Precalc

    So I have two questions that have been puzzling me for quite some time and would really appreciate any help with either of them! (a) There are four positive intergers a, b, c, and d such that 4cos(x)cos(2x)cos(4x)=cos(ax)+cos(bx)+cos(cx)+cos(dx) for all

  35. Trigonometry

    There is an arbitrary triangle with angles A, B, and C and sides of lengths a, b, and c. Angle A is opposite side a. How do I get the formulas: b * cos C + c * cos B = a c * cos A + a * cos C = b a * cos B + b * cos A = c Are these standard trig formulas?

  36. Mathematics - Trigonometric Identities - Reiny

    Mathematics - Trigonometric Identities - Reiny, Friday, November 9, 2007 at 10:30pm (sinx - 1 -cos^2x) (sinx + 1 - cos^2x) should have been (sinx - 1 + cos^2x) (sinx + 1 - cos^2x) and then the next line should be sin^2x + sinx - cos^2xsinx - sinx - 1 +

  37. Trigonometric

    Consider the following simultaneous equations: 3 cos^2 𝛼 + 2 cos^2 𝛽 =4 3 sin^2 𝛼 − 2sin^2 𝛽=0 *Find the values of cos 2𝛼 and cos 2𝛽. *Hence solve for 𝛼 and 𝛽. Where 0°≤𝛼≤360° and 0°≤𝛽≤360°.

  38. Trigonometry

    Please review and tell me if i did something wrong. Find the following functions correct to five decimal places: a. sin 22degrees 43' b. cos 44degrees 56' c. sin 49degrees 17' d. tan 11degrees 37' e. sin 79degrees 23'30' f. cot 19degrees 0' 25'' g. tan

  39. Pre-Cal (Trig) Help?

    The following relationship is known to be true for two angles A and B: cos(A)cos(B)-sin(A)sin(B)=0.957269 Express A in terms of the angle B. Work in degrees and report numeric values accurate to 2 decimal places. So I'm pretty lost on how to even begin

  40. Precalc

    If α, β, and γ are direction angles for a vector in three dimensions and cos α = 0.6 and cos β = 0.7, find cos γ

  41. Calculus

    Find the velocity, v(t), for an object moving along the x-axis in the acceleration, a(t), is a(t)=cos(t)-sin(t) and v(0)=3 a) v(t)=sin(t) + cos(t) +3 b) v(t)=sin(t) + cos(t) +2 c) v(t)= sin(t) - cos(t) +3 d) v(t)= sin(t) - cos(t) +4

  42. math

    A trigonmetric polynomial of order n is t(x) = c0 + c1 * cos x + c2 * cos 2x + ... + cn * cos nx + d1 * sin x + d2 * sin 2x + ... + dn * sin nx The output vector space of such a function has the vector basis: { 1, cos x, cos 2x, ..., cos nx, sin x, sin 2x,

  43. Calculus (help Steve plz)

    1) if w = , find ||w||? 2) which expression is equivalent to (sin x+1) (sin x -1)? A. Cos^2x B. -cos^2x C. Cos^2x+1 D. Cos^2x-1 E. -cos^2x-1

  44. calculus

    find max, min and saddle points of the give function f(x,y)=sin(x)+sin(y)+sin(x+y) 0

  45. Math - Solving for Trig Equations

    Solve the following equation for 0 less than and/or equal to "x" less than and/or equal to 360 -- cos^2x - 1 = sin^2x -- Attempt: cos^2x - 1 - sin^2x = 0 cos^2x - 1 - (1 - cos^2x) = 0 cos^2x - 1 - 1 + cos^2x = 0 2cos^2x - 2 = 0 (2cos^2x/2)= (-2/2) cos^2x =

  46. Pre calc

    Given that tanθ = 2 root 10 over 9 and cscθ < 0 , find the exact value of cos(θ − pie over 4) . I solved for the other side and got 11. After this idk what to do I was thinking using cos(a-b)=cos(a)cos(b)-sin(a)sin(b) but idk how to witht the pie/4

  47. Math

    Explain how to do this with steps please. 1. Simplify cos(x-y)+cos(x+y)/cosx I did some of these so far, don't know if it is correct. Formula: cosxcosy= cos(x+y)+cos(x-y)/2 cos(x-y)+cos(x+y)/cosx =cosxcosy/2cosx

  48. math- Trigonometry

    If cos degree equals to 0.8641 What is Sin degree? I have no idea how to find this. Please help me. I got help from two people, but I'm not getting the answer and how they got the numbers either. Someone says: cos^2+sin^2=1 sinDegree=sqrt(1-cos^2degree)

  49. Maths

    Find the exact value of cos^2(15°)-cos^2(30°)+cos^2(45°)-cos^2(60°)+cos^2(75°)

  50. Calculus

    The linear approximation you found using y=cosx at a =pi can be used to find cos(pi+0.05). What is cos(pi+o.o5) equal to? I found -1 for the approximation of y=cos(x) at a=pi, but how would I find cos(pi+0.05)?

  51. maths

    Find the roots of z^6 + 1 and hence resolve z^6 + 1into read quadratic factors; deduce that cos3x = 4[cos(x) -cos(pi/6)][(cos(x) -cos(pi/2)][(cos(x) -cos(5pi/6)]

  52. maths

    Find the roots of z^6 + 1 and hence resolve z^6 + 1into read quadratic factors; deduce that cos3x = 4[cos(x) -cos(pi/6)][(cos(x) -cos(pi/2)][(cos(x) -cos(5pi/6)]

  53. calculus

    pleaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaasw help can you pleaaaaase help me find the area between y=cos(4x) and y=1-cos(4x) 0

  54. Calculus - MathMate Please help

    ok, i tried to do what you told me but i cant solve it for c because they cancel each others out! the integral for the first one i got is [sin(c)cos(x)-cos(c)sin(x)+sin(x)+c] and the integral for the 2nd one i got is [-sin(c)cos(x)+cos(c)sin(x)-sin(x)+c] I

  55. Calculus

    which of the following integrals results from making the substitution u=x^3 in orer to find (squiggly vertical line)x^2cos(x^3)dx ~cos u du ~u^2 cos u du ~u^(2/3) cos u du1/3 os u du ~3 cos u du

  56. Math, derivatives

    Let g(x) = sin (cos x^3) Find g ' (x): The choices are a) -3x^2sinx^3cos(cos x^3) b) -3x^2sinx^3sin(cos x^3) c) -3x^2cosx^3sin(cos x^3) d) 3x^2sin^2(cos x^3) I'm not exactly sure where I should start. Should I begin with d/dx of sin? Or do the inside

  57. Precalculus

    Solve Cos^2(x)+cos(x)=cos(2x). Give exact answers within the interval [0,2π) Ive got the equation down to -cos^2(x)+cos(x)+1=0 or and it can be simplified too sin^2(x)+cos(x)=0 If you could tell me where to go from either of these two, it would be great

  58. Calc.

    Differentiate. y= (cos x)^x u= cos x du= -sin x dx ln y = ln(cos x)^x ln y = x ln(cos x) (dy/dx)/(y)= ln(cos x) (dy/dx)= y ln(cos x) = (cos x)^x * (ln cos x) (dx/du)= x(cos x)^(x-1) * (-sin x) = - x sin(x)cos^(x-1)(x) (dy/dx)-(dx/du)=

  59. Calculus re-post

    Does anybody know how to solve this question? a) Find the arc length function for the curve measured from the point P in the direction of increasing t from P and then reparametrize the curve with respect to arc length starting from P. b) Find the point 4

  60. Math - Solving Trig Equations

    What am I doing wrong? Equation: sin2x = 2cos2x Answers: 90 and 270 .... My Work: 2sin(x)cos(x) = 2cos(2x) sin(x) cos(x) = cos(2x) sin(x) cos(x) = 2cos^2(x) - 1 cos(x) (+/-)\sqrt{1 - cos^2(x)} = 2cos^2(x) - 1 cos^2(x)(1 - cos^2(x)) = 4cos^4(x) - 4cos^2(x)

  61. trig

    Reduce the following to the sine or cosine of one angle: (i) sin145*cos75 - cos145*sin75 (ii) cos35*cos15 - sin35*sin15 Use the formulae: sin(a+b)= sin(a) cos(b) + cos(a)sin(b) and cos(a+b)= cos(a)cos(b) - sin(a)sin)(b) (1)The quantity = sin(145-75) = sin

  62. Math

    Can someone please check my answers! 2. Find value of cos(255degrees)cos(105degrees) root3 - 2 / 4 3. cos(pi/12) - cos(5pi/12) Is it root3/4? 4. Use the appropriate sum-to-product formula to rewrite the expression sin6x - sin9x I don't really understand

  63. Trigonometry

    Write equivalent equations in the form of inverse functions for a.)x=y+cos è b.)cosy=x^2 (can you show how you would solve) a.) x= y+ cos è cos è = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2)

  64. Trig. Law of Cosines

    Show that any triangle with standard labeling... a^2+b^2+c^2/2abc = cos(alpha)/a + cos(beta)/b + cos(gamma)/c I don't get it. Can someone please help me. Start here with the law of cosines: a^2 = b^2 + c^2 -2bc Cos A b^2 = a^2 + c^2 -2ac Cos B c^2 = a^2 +

  65. Calculus AP

    Use the table of integrals to find int cos^4 3x dx I found the table: ∫cos^n u du = (1/n)cos^(n-1)u sinu + (n-1/n)∫sin^(n-2)u du = 1/4 cos^(4-1)u sinu + (4-1/4)∫sin^(4-2) u du so what i did the problem: let u=3x then du=3dx =1/4*1/3 cos^3u sinu +

  66. tigonometry

    expres the following as sums and differences of sines or cosines cos8t * sin2t sin(a+b) = sin(a)cos(b) + cos(a)sin(b) replacing by by -b and using that cos(-b)= cos(b) sin(-b)= -sin(b) gives: sin(a-b) = sin(a)cos(b) - cos(a)sin(b) Add the two equations:

  67. Trig

    If cosx = 10/19 an pi < x < 2pi, find the exact value of cos x/2 Use the double angle formula. Cos 2Y= sin^2 Y - cos^2Y = 1-2Cos^2 Y. let y= x/2, and 2Y=x

  68. Calculus

    Find f'(x) if f(x)=sin^3(4x) A. 4cos^3(4x) B. 3sin^2(4x)cos(4x) C. cos^3(4x) D. 12sin^2(4x)cos(4x) E. None of these I got D using the chain rule?

  69. algebra

    Can someone please help me do this problem? That would be great! Simplify the expression: sin theta + cos theta * cot theta I'll use A for theta. Cot A = sin A / cos A Therefore: sin A + (cos A * sin A / cos A) = sin A + sin A = 2 sin A I hope this will

  70. calc

    1 + x = sin(xy^2) find dy/dx by implicit differentiation 0 + 1 = cos(xy^2). (x)(2y)dy/dx + (y^2)(1) 1/((x)(2y)dy/dx) = cos(xy^2) + (y^2) dy/dx = cos (xy^2) + (y^2).... Can I just divide out the (x)(2y) and leave the dy/dx?

  71. Precal

    I do not understand how to do this problem ((sin^3 A + cos^3 A)/(sin A + cos A) ) = 1 - sin A cos A note that all the trig terms are closed right after there A's example sin A cos A = sin (A) cos (A) I wrote it out like this 0 = - sin^6 A - cos^6 A +

  72. Maths

    How do I do this Need details solution to follow up prove that cos(a)+cos(a+b)+cos(a+2b)+....+cos(a+(n-1)b)={cos(a+((n-1)/2)bsin(nB/2)}/½sinb for all N£N

  73. Please help!!!)

    If sin(x) = /45 and cos(y) = 5/13 with both x and y terminating in quadrant 1 find the exact value of cos(x-y) cos(4/5 - 5/13) Is this what I would do?

  74. Math

    If sin(x) = /45 and cos(y) = 5/13 with both x and y terminating in quadrant 1 find the exact value of cos(x-y) cos(4/5 - 5/13) Is this what I would do?

  75. math

    If sin(x) = /45 and cos(y) = 5/13 with both x and y terminating in quadrant 1 find the exact value of cos(x-y) cos(4/5 - 5/13) Is this what I would do?

  76. Math - Trigonometry

    Let f(x) be a polynomial such that f(cos theta) = cos(4 theta) for all \theta. Find f(x). (This is essentially the same as finding cos(4 theta) in terms of cos theta; we structure the problem this way so that you can answer as a polynomial. Be sure to

  77. trig

    Show that 1-cos2A/Cos^2*A = tan^2*A 1-cos2A/Cos^2*A = [Cos^2(A) - Cos(2A)]/Cos^2(A). Substitute: Cos(2A) = 2Cos^2(A) - 1: [1 - Cos^2(A)]/Cos^2(A)= Sin^2(A)/Cos^2(A) = tan^2(A)

  78. Calculus

    Find the velocity, v(t), for an object moving along the x-axis if the acceleration, a(t), is a(t) = cos(t) − sin(t) and v(0) = 3. a) v(t) = sin(t) + cos(t) +3 b) v(t) = sin(t) + cos(t) +2 c) v(t) = sin(t) - cos(t) +3 d) v(t) = sin(t) - cos(t) +4

  79. Calculus

    Find the velocity, v(t), for an object moving along the x-axis if the acceleration, a(t), is a(t) = cos(t) - sin(t) and v(0) = 3. v(t) = sin(t) + cos(t) + 3 v(t) = sin(t) + cos(t) + 2 v(t) = sin(t) - cos(t) + 3 v(t) = sin(t) - cos(t) + 4

  80. AP Calculus

    Find the velocity, v(t), for an object moving along the x-axis if the acceleration, a(t), is a(t) = cos(t) - sin(t) and v(0) = 3 v(t) = sin(t) + cos(t) + 3 v(t) = sin(t) + cos(t) + 2 v(t) = sin(t) - cos(t) + 3 v(t) = sin(t) - cos(t) + 4

  81. Mathematics - Trigonometric Identities

    Let y represent theta Prove: 1 + 1/tan^2y = 1/sin^2y My Answer: LS: = 1 + 1/tan^2y = (sin^2y + cos^2y) + 1 /(sin^2y/cos^2y) = (sin^2y + cos^2y) + 1 x (cos^2y/sin^2y) = (sin^2y + cos^2y) + (sin^2y + cos^2y) (cos^2y/sin^2y) = (sin^2y + cos^2y) + (sin^2y +

  82. Math - Solving Trig Equations

    Solve each equation for o is less than and/or equal to theta is less than and/or equal to 360 -- sin^2x = 1 = cos^2x -- Work: cos^2x - cos^2x = 0 0 = 0 -- Textbook Answers: 90 and 270 -- Btw, how would you isolate for cos^2x = 0? Would it be... x = cos^-1

  83. Math

    Solve this equation algebraically: (1-sin x)/cos x = cos x/(1+sin x) --- I know the answer is an identity, and when graphed, it looks like cot x. I just don't know how to get there. I tried multiplying each side by its conjugate, but I still feel stuck.

  84. Trig

    If angle A is 45 degrees and angle B is 60 degrees. Find sin(A)cos(B), find cos(A)sin(B), find sin(A)sin(B), and find cos(A)cos(B) The choises for the first are: A. 1/2[sin(105)+sin(345)] B. 1/2[sin(105)-sin(345)] C. 1/2[sin(345)+cos(105)] D.

  85. Climate Physics

    Find the insolation in Wm^-2 at summer solstice for a low obliquity of 22 degrees? I used the following: h_0=cos^-1(-tan(phi)* tan(delta)) cos(theta)=[sin(phi)*sin(delta)+cos(phi)*cos(delta)*cos(h_0)] Result was 397 Wm^-2 This looked like an easy problem,

  86. Quick calc question

    Find the velocity, v(t), for an object moving along the x-axis if the acceleration, a(t), is a(t) = 2t + sin(t) and v(0) = 4. v(t) = t2 + cos(t) + 3 v(t) = 2 + cos(t) + 1

  87. trigonomentry out of ideal help ah!crying

    compute.. Cos(1degree)+cos(3degree)+cos(5degree)+...+Cos(179degree) plz show working even an hint can,t help me.Have been do maths alday my brain is fried..Ah thanks

  88. Pre calc

    Find all primary solutions (i.e. 0 ≤ θ < 2π ) of the equation cos(2θ ) = 4 − 3 cos(θ ). Find all primary solutions (i.e. 0 ≤ θ < 2π ) of the equation cos(2θ )cos(θ ) = sin(2θ )sin(θ ). Please can somone help and show all work Thank you

  89. Calculus

    ∫((cos^3(x)/(1-sin^(2)) What is the derivative of that integral? I have been trying to use trig identities but can't find one to simplify this equation. I can't find one for (cos^3(x) or (1-sin^(2)) My options -sin(x) + C sin(x) + C (1/4)cos^(4)(x) + C

  90. calc.- trig substitution

    s- integral s 1/ [ (x^4) sq.rt(x^2+9)] i know x=3tanx sq.rt(x^2+9)= 3 secx dx= 3/[cos^2(x)] so far i know: = 1/ (3tan^4(x)) 3secx cos^2(x)) dx =1/ 81 [ (sin^4 (x)/cos^4 (x)) (1/cosx) (cos^2(x))] then i'm not really sure what to do next

  91. trig

    it says to verify the following identity, working only on one side: cotx+tanx=cscx*secx Work the left side. cot x + tan x = cos x/sin x + sin x/cos x = (cos^2 x +sin^2x)/(sin x cos x) = 1/(sin x cos x) = 1/sin x * 1/cos x You're almost there. thanks so

  92. Math

    If α and β are two angles in Quadrant II such that tan α= -1/2 and tan β = -2/3, find cos(α+β) Work: cos(α+β) = [ 1 - (tan α)(tan β) ] / [ 1 + (tan α)(tan β)] cos(α+β) = [ 1 - (-1/2)(-2/3) ] / [ 1 + (-1/2)(-2/3)] cos(α+β) = [ 1 - 1/3 ] / [

  93. Trigonometry - LONESTAR

    Simplifying steps without using the calculator for: tan(cos^-1(-1/10)) cos(sin^−1(1/x)) Assume x is positive tan(cos^−1(12/13)) cos^−1(cos 150°) This is pretty much the entire section we are doing. My teacher is a robot and has us self teach

  94. math b

    if sinx=(4/5), where 0 degrees

  95. math

    Determine exact value of cos(cos^-1(19 pi)). is this the cos (a+b)= cos a cos b- sina sin b? or is it something different. When plugging it in the calculator, do we enter it with cos and then the (cos^-1(19 pi)).

  96. trig help much appreciated! :))

    1. Find the complete exact solution of sin x = . 2. Solve cos 2x – 3sin x cos 2x = 0 for the principal value(s) to two decimal places. 3. Solve tan2 x + tan x – 1 = 0 for the principal value(s) to two decimal places. 4. Prove that tan2  – 1 + cos2 

  97. MATH

    Hi, I really need help with these questions. I did some of them halfway, but then I got stuck. Would you please help me? Thank you so much. Prove the identity.... 1. sec x + tan x(1-sin x/cos x)=1 1/cos x + sin x/cos x(cos^2 x/cos x)=1 1+sin x/cos

  98. K

    (a) Find the indefinite integrals of the following functions. (i) f (t) = 6 cos(3t) + 5e^−10t (ii) g(x) = 21-12x^3/ x (x > 0) (iii) h(u) = cos^2( 1/8 u) (b) Evaluate: (this big F sign at the start, 5 at the top and 1 at the bottom) 5 1/4x (7 + 6x^2) dx

  99. Math(Please check)

    Use the fundamental identities to simplify the expression. tan^2 Q / sec^2 Q sin^2/cos^2 / 1/cos^2 = sin^2 / cos^2 times cos^2 / 1 = The cos^2 cancels out so sin^2 is left. Is this correct?

  100. Trigonometry

    1.Solve tan^2x + tan x – 1 = 0 for the principal value(s) to two decimal places. 6.Prove that tan y cos^2 y + sin^2y/sin y = cos y + sin y 10.Prove that 1+tanθ/1-tanθ = sec^2θ+2tanθ/1-tan^2θ 17.Prove that sin^2w-cos^2w/tan w sin w + cos w tan w =

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20