Calculate the molar solubility of calcium phosphate [Ca3(PO4)2 in a solution which is 0.10M in sodium phosphate (Na3PO4). Ksp for calcium phosphate is 1.1x10^-26

57,021 results
  1. chemistry

    The Ksp of Ag2CrO4(s) is 1.12 x 10^-12. Calculate the molar solubility of AgCrO4(s) a)in pure water b) in a solution of 0.10 mol/L sodium chromate, Na2CrO4(s)

  2. Chemistry

    Write the net ionic equation for this reaction occurring in water: Sodium phosphate and calcium chloride are mixed to form sodium chloride and calcium phosphate. 1. No reaction occurs. 2. 2Na3PO4 + 3Ca2+ -> 6Na+ + Ca3(PO4)2 3. 2 PO3−4 + 3Ca2+ ->

  3. Chemistry

    Identify the precipitate in this reaction: calcium nitrate reacts with sodium phosphate. 2Na3PO4 + 3Ca(NO3)2--->6NaNO3 + Ca3(PO4)2 is that right ?

  4. Chemistry

    Write the following into a balanced equation. a) When a mixture of copper (II) oxide and carbon is heated, elemental copper forms and carbon monoxide evolves into the atmosphere. b) When a concentrated solution of sodium hydroxide is added to an aqueous

  5. CHEM MOLES !@@!

    Mole Calculation Worksheet 1) How many moles are in 15 grams of lithium? 2) How many grams are in 2.4 moles of sulfur? 3) How many moles are in 22 grams of argon? 4) How many grams are in 88.1 moles of magnesium? 5) How many moles are in 2.3 grams of

  6. Chemistry

    (Ksp= 5.0*10^-13) 1) Calculate the molar solubility of AgBr in 3.0×10^−2 M AgNO3 solution. 2) calculate the molar solubility of AgBr in 0.10 M NaBr solution. I tried solving using this the quadratic formula, but it didn't work. I started with these

  7. Chemistry

    1.What is the pH of a solution containing 0.042 M NaH2PO4 and 0.058 M Na2HPO4 ? The pKa of sodium phosphate is 6.86. pH = 6.86 + log [0.058] / [0.042]; pH = 6.86 + 0.14; pH = 7.00 That is my answer to the above question. The following question is what I am

  8. chemistry

    the question reads: a) balance the equation: H3PO4 + Ca(OH)2 --> Ca3(PO4)2 + H2O b)what mass of each product results if 750 mL of 6.00 M H3PO4 reacts according to the equation? i balanced it with: 2H3PO4 + 3Ca(OH)2 --> Ca3(PO4)2 + 6H2O but i'm not sure

  9. Chemistry

    A solution of 100.00mL of 0.2000mol/L sodium carbonate and 200.00mL of 0.1000mol/L calcium nitrate solutions are mixed together according to the reaction: sodium carbonate + calcium nitrate→ calcium carbonate + sodium nitrate. how would you calculate the

  10. Chemistry

    One mole of each of the following compounds is added to water in separate flasks to make 1.0 L of solution. Which solution has the largest total ion concentration? a. aluminum hydroxide b. silver chloride c. sodium chloride d. calcium carbonate e.

  11. AP Chem

    A solution of potassium phosphate is mixed with a solution of calcium acetate. I am supposed to write a net ionic equation. Doesn't need to be balanced. Here is what I did: K3PO4(aq) + Ca(C2H3O2)2 --> KC2H3O2 + Ca3PO4 3K+ + PO4-3 + Ca+2 2(C2H3O2-) --> K+ +

  12. Science

    Phosphate (PO4)3– is a polyatomic ion with a 3– charge. What is the chemical formula for the ionic compound lithium phosphate? Li3PO4 LiPO4 Li(PO4)3 Li2PO4 would it be Li(PO4)3?

  13. chemistry

    what volume of 0.250 M calcium chloride needs to be added to sodium phosphate to produce 35.0 g of calcium phosphate ?

  14. chemistry

    The solubility of Na3(PO4) is 0.025 M. What is the Ksp of sodium phosphate?

  15. Chemistry

    Calculate the molar solubility of calcium phosphate [Ca3(PO4)2 in a solution which is 0.10M in sodium phosphate (Na3PO4). Ksp for calcium phosphate is 1.1x10^-26

  16. chemistry

    Calcium carbonate reacts with phosphoric acid to produce calcium phosphate, carbon dioxide, and water. 3 CaCO3(s) + 2 H3PO4(aq) Ca3(PO4)2(aq) + 3 CO2(g) + 3 H2O(l) How many grams of phosphoric acid react with excess calcium carbonate to produce 3.29 g

  17. CHemistry....Please help

    1.SOLUBILITY: At 25C, the molar solubility of calcium phosphate in water is 1.1*10^{-7}M. Calculate the solubility in grams per liter. I m not sure how to convert M to g/L MOLAR MASS OF COLLIGATIVE PROPERTIES: 2.tert-Butyl alcohol is a solvent with a Kf of

  18. Chemistry

    The solubility of insoluble substances changes depending on the nature of the solution. Below are two solutions in which Cu(OH)2 is dissolved; in each case, the solubility of Cu(OH)2 in those solutions is not the same as it is in pure water. (a) For each

  19. Chemistry-Dr.Bob222

    Calculate the molar solubility of calcium hydroxide in a solution buffered at each pH. a. pH=4 b. pH= 7 c. pH=9

  20. chemistry

    When calcium chloride and ammonium phosphate are mixed, an insoluble precipitate of calcium phosphate forms and falls out of solution. After careful analysis of the purified precipitate, 8.16 * 10^25 atoms of calcium are found in the solid. How many other

  21. Chemistry

    calculate the molar solubility of BaCO3 in a 0.10M solution of NaCo3 (aq). (ksp(BaCO3)=8.1x10^-9)

  22. Chemistry

    Teeth and bones are composed, to a first approximation, of calcium phosphate, Ca3(PO4)2(s). The Ksp for this salt is 1.3 10-32 at 25°C. Calculate the concentration of calcium ion in a saturated solution of Ca3(PO4)2. Please, help!

  23. chemistry

    Ca3(PO4)2 has a Ksp = 2.0 x 10-29. What is its molar solubility in 0.1 M H3PO4?

  24. Chemistry

    Ca3(PO4)2 + 3 H2SO4 -> 3 CaSO4 + 2 H3PO4 What masses of calcium sulfate and phosphoric acid can be produced from the reaction of 1.0 kg calcium phosphate with 1.0 kg concentrated sulfuric acid (98% H2SO4 by mass)?

  25. chem

    The solubility product of nickel (II) hydroxide at 25°C is 1.6 x 10-16. a) Calculate the molar solubility of nickel (II) hydroxide in pure water at 25°C. b) Calculate the molar solubility of nickel (II) hydroxide in 0.100 M sodium hydroxide. This is a

  26. chemistry

    3ca(s) + 2H3PO4(aq) -> Ca3(PO4)2(aq)+3H2(g) 1)a reaction between calcium and a solution of 1.2moldm-3 phosphoric acid produced 3 mol of H2 gas. a) Minimum volume of phosphoric acid would have been needed for reaction: I got 1.6cm3 b)Mass of calcium added

  27. chemistry

    A precipitate of calcium phosphate is formed when aqueous solutions of sodium phosphate and excess calcium chloride are mixed. If 100.0 mL of 1.5 M sodium phosphate solution is the limiting reactant, how many grams of calcium phosphate can be expected?

  28. chemistry

    3CaCO3+2FePO4-->Ca3(PO4)2+Fe2(CO3)3 We start with 100g. of calcium carbonate and 45g. iron (III) phosphate. What is the maximum amount of Ca3(PO4)2 and Fe2(CO3)3 ??

  29. CHEMISTRY

    What substances will increase the molar solubility of nickel(II) phosphate in a saturated solution?

  30. Chem

    Sodium phosphate reacts with copper (II) chloride in a precipitation reaction. What mass (in grams) of the precipitate will form when 325 mL of 0.5000 molar sodium phosphate reacts with 41.5 cL of 0.6000 molar copper (II) chloride.

  31. Chemistry

    Teeth and bones are composed, to a first approximation, of calcium phosphate, Ca3(PO4)2(s). The Ksp for this salt is 1.3*10^-32 at 25°C. Calculate the concentration of calcium ion in a saturated solution of Ca3(PO4)2.

  32. Biochemistry

    How would you prepare 250ml of 0.2M sodium phosphate buffer of PH 6.4 if the following chemicals are available :dibasic sodium phosphate,monobasic sodium phosphate and 0.129M solution of NaOH. Assume that the pka1 pka2 pka3 of phosphoric acid are 2.12, 6.8

  33. Chemistry

    This is a mulit step problem How many grams of barium phosphate are produced from the reaction of 3.50g of sodium phosphate and 6.4g of barium nitrate? The other product is sodium nitrate. 1. Write the balanced equation for the reaction 2. How many grams

  34. Chemistry

    What is the molar concentration of sodium in a 200ml solution prepared from 1.223g of sodium phosphate?

  35. Chem

    (a) The molar solubility of Ag2CrO4(s) at 35°C is 1.3 10-4 mol/L. Calculate Ksp. (b) If 0.0490 g of AgIO3 dissolves per liter of solution, calculate the solubility-product constant. (c) Using the appropriate Ksp value from Appendix D, calculate the

  36. Chemistry

    What mass of calcium phosphate form by the reaction of 50 mL of 0.2 M H3PO4 with 80 mL of 0.1 M Ca(OH)2? 2 H2PO4 + 3 Ca(OH)2 --> Ca3(PO4)2 + 6 H20

  37. Chemistry

    Consider the following chemical equation. Na3PO4(aq) + Ca(OH)2(aq) → Ca3(PO4)2(s) + NaOH(aq) How many grams of calcium hydroxide must react to give 2.81 g of Ca3(PO4)2? please explain step by step

  38. Chemistry

    If a solution of sodium phosphate, Na3PO4, is poured into seawater, precipitates of calcium phosphate and magnesium phosphate are formed. (Magnesium and calcium ions are among the principle ions found in seawater.) Write net ionic reactions for the

  39. Chemistry

    3Ca(NO3)2(aq)+2Na3PO4(aq)->Ca3(PO4)2(s)+6NaNO3(aq) A.)the moles Na3PO4 required to react with 2.03 L of 0.891 M Ca(NO3)2 B.)the grams of Ca3(PO4)2 that can be obtained from 136 mL of 0.627 M Ca(NO3)2 C.)the volume of 0.76 M Na3PO4 needed to react with 25

  40. Chemistry

    Human bodies maintain their balance (homeostasis) through a series of equilibria. An important equilibrium involves calcium ion because Ca2+ is important for muscle contractions in the heart as well as for strong bones. Bone is a complex tissue consisting

  41. Chemistry

    A 500.0 mL sample of saturated nickel(II) phosphate solution was analyzed spectrophotometrically and found to contain 1.88 × 10-5 g of nickel. (a) Determine the molarity of the nickel(II) phosphate solution. (b) Calculate the solubility product constant,

  42. Chemistry quick question

    Ok so a quick question. I have the equation Ca3(PO4)2 --> 3Ca+2 + 2PO4-3 Sorr its confusing, int he first part the 3 4 and too are all little numbers at the bottom, for the second part the +2 and -3 are small numbers at the top to show the charges. Ok so

  43. chemistry

    Hard Water often contains calcium chloride. The calcium ion in solution can be detected using a solution of sodium phosphate. When a solution of calcium chloride is mixed with a solution of sodium phosphate, a precipitate forms. a. What is the chemical

  44. Chemistry(Please help)

    What is the molar solubility of barium phosphate in a 0.282M barium acetate solution? If I set up and ice table I would have 0.282M - X = ? Would I use the molar mass of barium acetate to complete the equation to find X? Ba3(PO4)2 ==> 3Ba^2+ + 2PO4^3-

  45. Chemistry

    1) When aqueous solutions of cupric chloride and sodium phosphate are mixed, solid cupric phosphate separates from a solution of sodium chloride. 2) When heated in an aqueous solution of ammonium acetate, calcium oxide reacts to form calcium acetate,

  46. Chemistry (stoichiometry)

    18.5 grams of calcium chloride reacts with 25.7 grams of sodium phosphate and produces calcium phosphate and sodium chloride. What is the limiting reactant? (show work)

  47. Chem

    The solubility of Mn(OH)2 is 3.04 x 10^-4 gram per 100 ml of solution . A) write the balanced chem equation for Mn(OH)2 in aqueous solution B) calculate the molar solubility of Mn(OH)2 at 25 degrees celcius C) calculate the value of the solubility product

  48. Chemistry

    Calcium carbonate reacts with phosphoric acid to produce calcium phosphate, carbon dioxide, and water. 3 CaCO3(s) + 2 H3PO4(aq) Ca3(PO4)2(aq) + 3 CO2(g) + 3 H2O(l) How many grams of phosphoric acid react with excess calcium carbonate to produce 3.47 g

  49. chemistry; acids and bases

    A common constituent of kidney stones is Ca3(PO4)2, calcium phosphate. Are kidney stones containing Ca3(PO4)2 more likely to form when the urine is acidic or when it is basic? Explain.

  50. AP Chem

    Consider the following unbalanced equation: Ca3(Po4)2+H2SO-->CaSO4+H3PO What masses of calcium sulfate and phosphoric acid can be produced from the reaction of 1.0 kg calcium phosphate with 1.0 kg concentrated sulfuric acid (98% H2SO4 by mass)? I'm so

  51. chemistry

    #2) Consider the preciditation reaction of a solution containing 3.50 grams of sodium phosphate mixed with a solution containing 6.40 grams of barium nitrate. How many grams of Barium phosphate can form? Ba(NO3 )2 + Na3 PO4 yields Ba3 (PO 4 )2 + NaNO3 #2b)

  52. Chemistry

    If 0.0142 M aqueous Cl- is produced stoichiometrically according to the balanced equation in a reaction solution with a total volume of 1480 mL, how many mol of solid Ca3(PO4)2 are produced? 3 CaCl2(aq) + 2 Na3PO4(aq) → Ca3(PO4)2(s) + 6 NaCl(aq)

  53. Chemistry

    3Ca(NO3)2(aq)+2Na3PO4(aq)->Ca3(PO4)2(s)+6NaNO3(aq) (a) the grams of Ca3(PO4)2 that can be obtained from 126 mL of 0.750 M Ca(NO3)2 (b) the volume of 0.10 M Na3PO4 needed to react with 13 mL of 0.30 M Ca3(NO3)2 (c) the molarity (M) of the Ca(NO3)2 solution

  54. Chemistry

    Convert the information described below into balanced equation: (a) When a mixture of copper(II) oxide and carbon is heated, elemental copper forms and carbon monoxide evolves into the atmosphere. (b) When a concentrated solution of sodium hydroxide is

  55. Chemistry

    Tooth enamel is made up of hydroxyapatite, Ca_10(PO_4)_6(OH)_2 or the empirical formula, Ca_5(PO_4)_3(OH). Use the empirical formula for all calculations because stoichiometry plays two significant roles. A. Print the balanced chemical equation for the

  56. chemistry

    Write the balanced equation of the reaction described below. Include the states (s, l, aq, g) for the reactants and products. When aqueous calcium chloride and sodium phosphate are mixed, solid calcium phosphate and acqueous sodium chloride are produced.

  57. Chemistry

    Superphosphate, a water soluble fertilizer, is sometimes marked as a "triple phosphate". It is a mixture of Ca(H2PO4)2 + 2CaSO4. Ca3(PO4)2 + 2H2SO4 --> Ca(H2PO4)2 + 2CaSO4 If you treat 400g of calcium phosphate with 267g of sulfuric acid, how many g of

  58. chemistry

    ARe these chemical formulas correct? monocalcium phosphate: CaPO4 sodium phosphate: Na3PO4 calcium carbonate: CaPO4 Calcium Chloride: CaCl2 Magnesium Sulfate:MgSO4 monopotassium phosphate:KPO4

  59. Chemistry check and help

    what is ... Sodium bisulphate hydroiodic acid ammonium dihydrogen phosphate Zn(HCrO4)2 Calcium metal ferrous bromide sodium carbide phosphate radical Check... sodium bicarbonate NaHCO3

  60. Chemistry

    58% Ca3 (PO4) 2 how many phosphorus are in 10 kg bones? Ca3(po4)2+SiO2+C=CaSiO3+P4

  61. chemisty

    What volume of 0.250 M calcium chloride needs to be added to sodium phosphate to produce 35.0g of calcium phosphate?

  62. science

    Ca3(PO4)2 + 2H2SO4 = 2CASO4 + Ca(H2PO4)2 How many moles of CaSO4 can be produced by the reaction of 0.39 moles of Ca3(PO4)2 with excess H2 SO4?

  63. Chemistry

    # moles of Ca3(PO4)2 produced from 3100g Ca3(PO4)2

  64. chemistry

    I have no idea how to solve this problem, please help me out.... thanks a) A liter of a solution saturated at 25degree with calcium oxalate, CaC2O4, is evaporated to dryness, giving a 0.0061gm residue of CaC2O4. calculate the concentrations of the ions,

  65. chemistry

    A) A solution was prepared by dissolving 1.113 g of MgCl2 into water and made up to 50.0 ml, calculate the molar concentration of the solution. B) A 250.0 ml of 0.50 M solution of Na3PO2 solution was prepared by diluting 2.5 M of stock solution. Calculate

  66. Chemistry

    35 grams of sodium phosphate are mixed with enough water to make 3.5L of solution having a densityof 1.045g/mol. Find the concentration of sodium phosphate in ppm. Using the same information, find the molarity of the sodium and phosphate ions.

  67. Chemistry

    How many grams of Ca3(PO4)2 can be formed from 206 g of calcium nitrate and 140 g of phosphoric acid?

  68. chemistry

    What is the molar concentration of sodium in a 200mL solution prepared from 1.359 grams of sodium phosphate?

  69. Chemistry

    Equation: 3CaCl2 (aq) + 2 Na3PO4 (aq) → Ca3(PO4)2 (s) + 6 NaCl (aq) How many grams of Ca3(PO4)2 are formed when 450.0 g NaCl are formed in the reaction? please show steps, please

  70. Chemistry

    Sodium chloride dissolves in water (solubility in water is 361g/1L), but copper (II) phosphate does not dissolve in water (insoluble). A. Describe in a stepwise fashion how the solid sodium chloride dissolves in the water to form a solution. (name the

  71. chemistry

    The Ksp of Ag2CrO4(s) is 1.12 x 10^-12. Calculate the molar solubility of AgCrO4(s) a) in pure water b)in a solution of 0.10 mol/L sodium chromate, Na2CrO4(s)

  72. Chemistry !

    The solubility of Mn(OH)2 is 3.04 x 10^-4 gram per 100 ml of solution . A) write the balanced chem equation for Mn(OH)2 in aqueous solution B) calculate the molar solubility of Mn(OH)2 at 25 degrees celcius C) calculate the value of the solubility product

  73. High school AP chem

    The solubility of Mn(OH)2 is 3.04 x 10^-4 gram per 100 ml of solution . A) write the balanced chem equation for Mn(OH)2 in aqueous solution B) calculate the molar solubility of Mn(OH)2 at 25 degrees celcius C) calculate the value of the solubility product

  74. chemistry

    Calculate the molar concentrations of all phosphate species in H3PO4 in a solution with pH = 2.25, given that the concentration of all four forms of phosphate total 15 mM.

  75. chemistry

    Calculate the volume (mL) of 2.06 M magnesium phosphate solution require to prepare 46.20 mL of 2.3998 %w/v solution of Mg3(PO4)2

  76. chemistry

    Calculate the solubility of silver chloride in a 0.1 mol/L solution of sodium chloride at 25°C.? At SATP, Ksp AgCl(s) = 1.8 x 10^-10 What did I do wrong? AgCl Ag+ + Cl- [Ag+] = x [Cl-] = x + 0.1 Ksp = [Ag+] [Cl-] 1.8 x 10^-10 = (x) ( x + 0.1) x = molar

  77. Chemistry

    Write as a chemical reaction Sodium phosphate + calcium chloride yield calcium + sodium chloride My child has. Na3PO4 + CaCl -> Ca3Po4 + NaCl

  78. science

    1. what weight in grams of magnesium oxide will produce from burning 96 grams of magnesium? 2. a solution containing 252g of calcium sulfate will produce from 165lbs of phosphate rocks containing 82.5 % pure calcium phosphate treated with sulfuric acid? 3.

  79. chemistry

    how do i calculate the molar solubility of AgBr in .10M NaBr?

  80. Chemistry

    Calculate the boiling tempature for a solution which contains 0.325 mol of calcium phosphate (Ca3(PO4)2) dissolved into 240.0 g of water.

  81. chemistry

    Stoichiometrics: a 36 grams sample of calcium hydroxide is allowed to react with 40.5 grams of phosphoric acid according to the following reaction. 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O how many grams of calcium phosphate are produced? how many moles of

  82. Chemistry

    Calcium can also be precipitated out of the solution by adding sodium phosphate (Na3PO4) to form solid calcium phosphate. A.) write a net ionic equation for this process B.)calculate the mass of this precipitate you would generate from treating 1.000 L of

  83. chemistry

    As a result of mineral erosion and biological activity, phosphate ion is common in natural waters, where it often precipitates as insoluble salts, such as Ca3(PO4)2. Calculate Qsp when [Ca2+]init = [PO43-]init = 2.161 10-6 M in a given river. Ksp of

  84. chem

    . (a) A solution was prepared by dissolving 1.4295 g of magnesium chloride (MgCl2) into water and made up to 25.0 mL, calculate the molar concentration of the solution. (3 marks) (b) A 250.0 mL of 0.50 M solution of sodium phosphate (Na3PO4) solution was

  85. Chemistry

    In the qualitative analysis scheme, magnesium and nickel precipitate from solution upon the addition of sodium hydroxide. Once separated from the remaining cations by filtration or decanting, the solid mixture is acidified and warmed to dissolve magnesium

  86. Chem

    Am I doing this right? Find the concentration of the phosphate ion. 1.00 mL 210 micro molar. DI water added to 25 ml line. 1.00 mL phosphate solution * 1L/1000mL * 210 mol phosphate solution/1L solution * 1.0 *10^-6 mol/ 1 micromol * 1 mol PO4 3- / 1 mol

  87. Chemistry

    A student prepared 200mL of 0.01M solution of calcium phosphate, Can(PO4)2. What is the concentration of calcium in parts per million? Relative atomic masses Can =40, P =31, O =16

  88. Chem11

    25.0 ml of a sodium phosphate solution reacts with 31.6 ml of a 0.33 mol/L lead (II) nitrate solution. What is the molar concentration of the sodium phosphate solution? Please and thank you!

  89. Chemistry

    Calculate the mass of calcium phosphate that forms when 5.50 x 10 -2 mol of solid calcium chlorate is dissolved in 600.0 mL of 1.00 x 10 -2 M lithium phosphate solution.

  90. chemistry

    What is the solubility of Ca3(PO4)2 in 0.06 M of K3PO4

  91. Chemistry

    What is the solubility of Ca3(PO4)2 in 0.045 M of CaCl2

  92. Science

    Given the solubility of calcium hydroxide is 0.0000064 at 25 degree celcius.calculate its solubility at this temperature in I) water II) 0.1M calcium chloride solution

  93. Chemistry 101

    A solution containing 83.100 g of sodium hydroxide [molar mass = 40.0 g/mol] was neutralised using phosphoric acid. Calculate the moles of sodium phosphate formed (assuming that the reaction goes to completion). Give your answer to three significant

  94. chemistry

    H3PO4+3Ca(OH)2=Ca3(PO4)2=6H2O If 44.6g of Ca3(PO4)2 are formed in the above reaction, how many moles of H3PO4 must have been consumed?

  95. Chemistry

    what is the solubility in mol/L of insoluble Ca3(PO4)2 (Ksp=1.00x10^-26)in a solution containing .00100 M Na3PO4? a. 2.15x10^-7 b. 7.18x10^-8 c. 7.18x10^-9 d. 1.00x10^-23 e. answer not given

  96. Analytical chemistry

    0.6140 grams of sodium phosphate (Na3PO4) was dissolved in 2 L of water to make a stock solution. 34 mL of this solution is then diluted to 100mL volumetrically to prepare the final solution. Calculate the molarity of phosphate ions in this solution.

  97. chemistry

    I collected questions from my book which I don't understand plz help me I am stuck plzz.!!!!!!!! Three different solutions containing the same solute at the same temperature are made to be saturated. Beaker 1 has 200.0 mL, beaker 2 has 500.0 mL and beaker

  98. Chemistry

    You are given a solution that is supposed to contain calcium phosphate. What test can you perform to confirm the presence of this calcium phosphate? Provide a brief procedure including any observation you are likely to make.

  99. Biochemistry

    You are asked to prepare 2 L of 50 mM sodium phosphate pH 7.0. The pK2 of phosphate is 6.8. What are the amounts of sodium phosphate mono basic monohydrate (NaH2PO4 • 1H2O, MW=137.99 Da) and anhydrous sodium phosphate dibasic (Na2HPO4, MW=141.96 Da) that

  100. Chemistry

    1. Ca(OH)2(aq) + H3PO4(aq) à Ca3(PO4)2(aq) + H2O(l) a. If you have 13.7mol of Ca(OH)2, how many grams of H2O are produced? b. How many grams of H3PO4 are required to produce 102.3g Ca3(PO4)2? c. How many moles of Ca(OH)2 are needed to produce 82.9g of

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20