Approximate cos (2π/13) by using a linear approximation with f (x) =cos x. cos (2π/13)≈ f(a) + f ' (a)·h = c, what is h, a, and c? I'm having problems with this one please help

12,137 results
  1. Trig

    Find sin(s+t) and (s-t) if cos(s)= 1/5 and sin(t) = 3/5 and s and t are in quadrant 1. =Sin(s)cos(t) + Cos(s)Sin(t) =Sin(1/5)Cos(3/5) + Cos(-1/5)Sin(3/5) = 0.389418 Sin(s-t) =sin(s)cos(t) - cos(s)sin(t) =sin(-3/5)cos(1/5) - cos(1/5)sin(3/5) =Sin-3/5

  2. linear approximation

    Approximate cos (2π/13) by using a linear approximation with f (x) =cos x. cos (2π/13)≈ f(a) + f ' (a)·h = c, what is h, a, and c? I'm having problems with this one please help

  3. Math

    The graph of f(x), a trigonometric function, and the graph of g(x) = c intersect at n points over the interval 0

  4. math

    if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that cos(B-C)=cos(C-A)=cos(A-B)=-1/2

  5. Calculus 12th grade (double check my work please)

    1.)Find dy/dx when y= Ln (sinh 2x) my answer >> 2coth 2x. 2.)Find dy/dx when sinh 3y=cos 2x A.-2 sin 2x B.-2 sin 2x / sinh 3y C.-2/3tan (2x/3y) D.-2sin2x / 3 cosh 3yz...>> my answer. 2).Find the derivative of y=cos(x^2) with respect to x. A.-sin (2x) B.-2x

  6. Precalculus

    Use one of the identities cos(t + 2πk) = cos t or sin(t + 2πk) = sin t to evaluate each expression. (Enter your answers in exact form.) (a) sin(19π/4) (b) sin(−19π/4) (c) cos(11π) (d) cos(53π/4) (e) tan(−3π/4) (f) cos(π/4) (g) sec(π/6+ 2π)

  7. Math question - plz correct

    Two airplanes leave an airport at the same time. One travels at 355km/h and the other at 450km/h. Two hrs later they are 800km apart. Find the angle between their courses. a^2 = b^2 + c^2 - 2bc Cos A 800^2= 450^2 + 355^2 - 2(450)(355) Cos A 640000= 202 500

  8. Math

    Explain how to do this with steps please. 1. Simplify cos(x-y)+cos(x+y)/cosx I did some of these so far, don't know if it is correct. Formula: cosxcosy= cos(x+y)+cos(x-y)/2 cos(x-y)+cos(x+y)/cosx =cosxcosy/2cosx

  9. self-study calculus

    Sketch the curve with the given vector equation. Indicate with an arrow the direction in which t increases. r(t)=cos(t)I -cos(t)j+sin(t)k I don't know what to do. I let x=cos(t), y=-cos(t) and z= sin(t). Should I let t be any number and get the equal

  10. Trigonometry

    Please review and tell me if i did something wrong. Find the following functions correct to five decimal places: a. sin 22degrees 43' b. cos 44degrees 56' c. sin 49degrees 17' d. tan 11degrees 37' e. sin 79degrees 23'30' f. cot 19degrees 0' 25'' g. tan

  11. another please help me check~calculus maths

    y=3e^(2x)cos(2x-3) verify that d^2y/dx^2-4dy/dx+8y=0 plz help me i tried all i could but it become too complicated for me here set u=3e^(2x) v=cos(2x-3) du/dx=6e^(2x) i used chain rule dv/dx=-2sin(2x-3) dy/dx=-3e^(2x)sin(2x-3)+cos(2x-3)6e^(2x) d^2y/dx^2

  12. Pre-Cal (Trig) Help?

    The following relationship is known to be true for two angles A and B: cos(A)cos(B)-sin(A)sin(B)=0.957269 Express A in terms of the angle B. Work in degrees and report numeric values accurate to 2 decimal places. So I'm pretty lost on how to even begin

  13. Calculus

    Which of the following is the best linear approximation for f(x)=cos(x) near x= π/2 ? a) y= x - π/2 b) y= -x + π/2 c) y= -x + π/2 + 1 d) y= x - π/2 +1

  14. Algebra

    Write an equation for the translation of the function. y = cos x; translated 6 units up A. y = cos x- ­ 6 B. y = cos(x + 6) C. y = cos x + 6 D. y = cos(x ­ 6) I think its B or c..

  15. Math

    Find the exact value of cos 1 degree + cos 2 degrees + cos 3 degrees + ... + cos 357 + cos 358 degrees + cos 359 degrees.

  16. Calculus

    Evaluate (Integral) sin 4x cos^2 4x dx. A. Cos^3(4x)/3 + C B. -Cos^3(4x)/3 + C C. Cos^3(4x)/12 + C D. -Cos^3(4x)/12 + C

  17. math

    Can you please check my work. A particle is moving with the given data. Find the position of the particle. a(t) = cos(t) + sin(t) s(0) = 2 v(0) = 6 a(t) = cos(t) + sin(t) v(t) = sin(t) - cos(t) + C s(t) = -cos(t) - sin(t) + Cx + D 6 = v(0) = sin(0) -cos(0)

  18. calc

    Where do I start to prove this identity: sinx/cosx= 1-cos2x/sin2x please help!! Hint: Fractions are evil. Get rid of them. Well, cos2x = cos2x - sin2x, so 1-coscx = 1 - cos2x - sin2x = 1 - cos2x + sin2x You should be able to simplify this to 2*something

  19. maths

    Find the roots of z^6 + 1 and hence resolve z^6 + 1into read quadratic factors; deduce that cos3x = 4[cos(x) -cos(pi/6)][(cos(x) -cos(pi/2)][(cos(x) -cos(5pi/6)]

  20. Homework Help Calculus

    Find the linear approximation L(x)of the function f(x)=cos(pi/(6)x) at the point x=1 and use it to estimate the value of cos(13pi/72). Here's what I did so far: L(x)=sqrt(3)/2-1/12pi(x-1)+0((x-1)^2) How do I find cos(13pi/72)

  21. tigonometry

    expres the following as sums and differences of sines or cosines cos8t * sin2t sin(a+b) = sin(a)cos(b) + cos(a)sin(b) replacing by by -b and using that cos(-b)= cos(b) sin(-b)= -sin(b) gives: sin(a-b) = sin(a)cos(b) - cos(a)sin(b) Add the two equations:

  22. math- Trigonometry

    If cos degree equals to 0.8641 What is Sin degree? I have no idea how to find this. Please help me. I got help from two people, but I'm not getting the answer and how they got the numbers either. Someone says: cos^2+sin^2=1 sinDegree=sqrt(1-cos^2degree)

  23. Physics

    What should be the angle between two vectors of magnitudes 3.20 and 5.70 units, so that their resultant has a magnitude of 6.10 units? Cos x = (b^2 + c^2 - a^2) / 2bc Cos x = (3.2^2 + 5.7^2 - 6.1^2) / (2 * 3.2 * 5.7) Cos x = 5.52/36.48 Cos x = 0.15 x =

  24. Math

    cos(tan + cot) = csc only simplify one side to equal csc so far I got this far: [((cos)(sin))/(cos)] + [((cos)(cos))/(sin)] = csc I don't know what to do next

  25. Calculus

    Find the velocity, v(t), for an object moving along the x-axis in the acceleration, a(t), is a(t)=cos(t)-sin(t) and v(0)=3 a) v(t)=sin(t) + cos(t) +3 b) v(t)=sin(t) + cos(t) +2 c) v(t)= sin(t) - cos(t) +3 d) v(t)= sin(t) - cos(t) +4

  26. Calc.

    Differentiate. y= (cos x)^x u= cos x du= -sin x dx ln y = ln(cos x)^x ln y = x ln(cos x) (dy/dx)/(y)= ln(cos x) (dy/dx)= y ln(cos x) = (cos x)^x * (ln cos x) (dx/du)= x(cos x)^(x-1) * (-sin x) = - x sin(x)cos^(x-1)(x) (dy/dx)-(dx/du)=

  27. Math - Solving Trig Equations

    What am I doing wrong? Equation: sin2x = 2cos2x Answers: 90 and 270 .... My Work: 2sin(x)cos(x) = 2cos(2x) sin(x) cos(x) = cos(2x) sin(x) cos(x) = 2cos^2(x) - 1 cos(x) (+/-)\sqrt{1 - cos^2(x)} = 2cos^2(x) - 1 cos^2(x)(1 - cos^2(x)) = 4cos^4(x) - 4cos^2(x)

  28. Trigonometry

    There is an arbitrary triangle with angles A, B, and C and sides of lengths a, b, and c. Angle A is opposite side a. How do I get the formulas: b * cos C + c * cos B = a c * cos A + a * cos C = b a * cos B + b * cos A = c Are these standard trig formulas?

  29. Mathematics - Trigonometric Identities - Reiny

    Mathematics - Trigonometric Identities - Reiny, Friday, November 9, 2007 at 10:30pm (sinx - 1 -cos^2x) (sinx + 1 - cos^2x) should have been (sinx - 1 + cos^2x) (sinx + 1 - cos^2x) and then the next line should be sin^2x + sinx - cos^2xsinx - sinx - 1 +

  30. Trigonometry

    Write equivalent equations in the form of inverse functions for a.)x=y+cos è b.)cosy=x^2 (can you show how you would solve) a.) x= y+ cos è cos è = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2)

  31. Maths

    How do I do this Need details solution to follow up prove that cos(a)+cos(a+b)+cos(a+2b)+....+cos(a+(n-1)b)={cos(a+((n-1)/2)bsin(nB/2)}/½sinb for all N£N

  32. Maths:Trigonometry

    How do I do this Need details solution to follow up prove that cos(a)+cos(a+b)+cos(a+2b)+....+cos(a+(n-1)b)={cos(a+((n-1)/2)bsin(nB/2)}/½sinb for all N£N ???

  33. trig

    Show that 1-cos2A/Cos^2*A = tan^2*A 1-cos2A/Cos^2*A = [Cos^2(A) - Cos(2A)]/Cos^2(A). Substitute: Cos(2A) = 2Cos^2(A) - 1: [1 - Cos^2(A)]/Cos^2(A)= Sin^2(A)/Cos^2(A) = tan^2(A)

  34. Mathematics - Trigonometric Identities

    Let y represent theta Prove: 1 + 1/tan^2y = 1/sin^2y My Answer: LS: = 1 + 1/tan^2y = (sin^2y + cos^2y) + 1 /(sin^2y/cos^2y) = (sin^2y + cos^2y) + 1 x (cos^2y/sin^2y) = (sin^2y + cos^2y) + (sin^2y + cos^2y) (cos^2y/sin^2y) = (sin^2y + cos^2y) + (sin^2y +

  35. Studying for Pre Cal exam

    Find the fourth roots of − 1/2 + (square root)3/2 i Write the roots in trigonometric form. A - w 1=cos(35°)+isin(35°) w2 =cos(125°)+isin(125°) w3 =cos(215°)+isin(215°) w4 =cos(305°)+isin(305°) B - w1 =cos(40°)+isin(40°) w2

  36. Math

    Solve this equation algebraically: (1-sin x)/cos x = cos x/(1+sin x) --- I know the answer is an identity, and when graphed, it looks like cot x. I just don't know how to get there. I tried multiplying each side by its conjugate, but I still feel stuck.

  37. Trigonometry - LONESTAR

    Simplifying steps without using the calculator for: tan(cos^-1(-1/10)) cos(sin^−1(1/x)) Assume x is positive tan(cos^−1(12/13)) cos^−1(cos 150°) This is pretty much the entire section we are doing. My teacher is a robot and has us self teach

  38. trig

    2sin(x)cos(x)+cos(x)=0 I'm looking for exact value solutions in [0, 3π] So I need to find general solutions to solve the equation. But do I eliminate cos(x), like this... 2sin(x)cos(x)+cos(x)=0 2sin(x)cos(x)= -cos(x) 2sin(x) = -1 sin(x) = -1/2 at 4pi/3

  39. Math

    Explain how to do this with steps please. 1. Simplify cos(x-y)+cos(x+y)/cosx Formula: cosxcosy= cos(x+y)+cos(x-y)/2 cos(x-y)+cos(x+y)/cosx =cosxcosy/2cosx

  40. Math (Trigonometry [Polar Form])

    Let z be a complex number such that z = 2(cos 8∘ + i cos 82∘).Then z^5 can be expressed as r(sin α∘+ i cos α∘), where r is a real number and 0 ≤ α ≤ 90. What is the value of r+α? Hint to solve: Example Question: Let z be a complex number

  41. precalc

    Find the exact value of each expression, if it exists: the -1 are representing the inverse functions! (a) sin -1 (-√2/2) (b) cos−1 (−1) (c) sin( 􏰀sin−1 (π)􏰁) (d) cos−1􏰀(cos􏰀(−4π􏰁􏰁/ 3)) (e) tan−1 (tan(0.6)) (f) cos−1(

  42. math

    A trigonmetric polynomial of order n is t(x) = c0 + c1 * cos x + c2 * cos 2x + ... + cn * cos nx + d1 * sin x + d2 * sin 2x + ... + dn * sin nx The output vector space of such a function has the vector basis: { 1, cos x, cos 2x, ..., cos nx, sin x, sin 2x,

  43. Math Help Please

    What are the ratios for sin A and cos A? The diagram is not drawn to scale. Triangle Description- AB = 29 AC = 20 BC - 21 A. sin A = 20/29, cos A = 21/29 B. sin A = 21/29, cos A = 20/21 C. sin A = 21/29, cos A = 20/29****? D. sin A = 21/20, cos A = 20/21

  44. Math Trig

    13. What is the equation of a cosine function with amplitude 3, transition point (−1, 1), and period p? A. y = p cos [3(x − 1)] − 1 B. y = 3 cos [2(x − 1)] + 1 C. y = 3 cos [p (x + 1)] − 1 D. y = 3 cos [2(x + 1)] + 1 16. What is the transition

  45. Calculus problem

    Evaulate: integral 3x (sinx/cos^4x) dx I think it's sec3 x , but that from using a piece of software, so you'll have to verify that. Using uppercase 's' for the integral sign we have S 3sin(x)/cos4dx or S cos-4(x)*3sin(x)dx If you let u = cos(x) then du =

  46. Calculus

    Find the velocity, v(t), for an object moving along the x-axis if the acceleration, a(t), is a(t) = cos(t) − sin(t) and v(0) = 3. a) v(t) = sin(t) + cos(t) +3 b) v(t) = sin(t) + cos(t) +2 c) v(t) = sin(t) - cos(t) +3 d) v(t) = sin(t) - cos(t) +4

  47. Trigonometry

    I need to prove that the following is true. Thanks. csc^2(A/2)=2secA/secA-1 Right Side=(2/cosA)/(1/cosA - 1) = (2/cosA)/[(1-cosA)/cosA] =2/cosA x (cosA)/(1-cosA) =2/(1-cosA) now recall cos 2X = cos^2 X - sin^2 X and we could say cos A = cos^2 A/2 - sin^2

  48. TRIG!

    Posted by hayden on Monday, February 23, 2009 at 4:05pm. sin^6 x + cos^6 x=1 - (3/4)sin^2 2x work on one side only! Responses Trig please help! - Reiny, Monday, February 23, 2009 at 4:27pm LS looks like the sum of cubes sin^6 x + cos^6 x = (sin^2x)^3 +

  49. pre-cal

    Simplify the given expression........? (2sin2x)(cos6x) sin 2x and cos 6x can be expressed as a series of terms that involve sin x or cos x only, but the end result is not a simplification. sin 2x = 2 sinx cosx cos 6x = 32 cos^6 x -48 cos^4 x + 18 cos^2 x -

  50. math

    Determine exact value of cos(cos^-1(19 pi)). is this the cos (a+b)= cos a cos b- sina sin b? or is it something different. When plugging it in the calculator, do we enter it with cos and then the (cos^-1(19 pi)).

  51. math

    Find the exact value of cos 300 degrees. thanks guys cos 300 = 1/2 = 0.500 how do you know? I am supposed to show my work. You ought to know the rule on 30-60-90 triangles. If the hyp is 2, the shorter side is 1, and the longer side is sqrt3. what does

  52. Precalculus

    Solve Cos^2(x)+cos(x)=cos(2x). Give exact answers within the interval [0,2π) Ive got the equation down to -cos^2(x)+cos(x)+1=0 or and it can be simplified too sin^2(x)+cos(x)=0 If you could tell me where to go from either of these two, it would be great

  53. maths

    Find the roots of z^6 + 1 and hence resolve z^6 + 1into read quadratic factors; deduce that cos3x = 4[cos(x) -cos(pi/6)][(cos(x) -cos(pi/2)][(cos(x) -cos(5pi/6)]

  54. calculus

    Differentiate. y= (cos x)^x u= cos x du= -sin x dx ln y = ln(cos x)^x ln y = x ln(cos x) (dy/dx)/(y)= ln(cos x) (dy/dx)= y ln(cos x) = (cos x)^x * (ln cos x) (dx/du)= x(cos x)^(x-1) * (-sin x) = - x sin(x)cos^(x-1)(x) (dy/dx)-(dx/du)=

  55. trig

    Reduce the following to the sine or cosine of one angle: (i) sin145*cos75 - cos145*sin75 (ii) cos35*cos15 - sin35*sin15 Use the formulae: sin(a+b)= sin(a) cos(b) + cos(a)sin(b) and cos(a+b)= cos(a)cos(b) - sin(a)sin)(b) (1)The quantity = sin(145-75) = sin

  56. calculus

    pleaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaasw help can you pleaaaaase help me find the area between y=cos(4x) and y=1-cos(4x) 0

  57. Trig. Law of Cosines

    Show that any triangle with standard labeling... a^2+b^2+c^2/2abc = cos(alpha)/a + cos(beta)/b + cos(gamma)/c I don't get it. Can someone please help me. Start here with the law of cosines: a^2 = b^2 + c^2 -2bc Cos A b^2 = a^2 + c^2 -2ac Cos B c^2 = a^2 +

  58. algebra

    Can someone please help me do this problem? That would be great! Simplify the expression: sin theta + cos theta * cot theta I'll use A for theta. Cot A = sin A / cos A Therefore: sin A + (cos A * sin A / cos A) = sin A + sin A = 2 sin A I hope this will

  59. Precal

    I do not understand how to do this problem ((sin^3 A + cos^3 A)/(sin A + cos A) ) = 1 - sin A cos A note that all the trig terms are closed right after there A's example sin A cos A = sin (A) cos (A) I wrote it out like this 0 = - sin^6 A - cos^6 A +

  60. Trig Help!

    Question: Trying to find cos π/12, if cos π/6 = square root 3 over 2, how to find cos π/12 using DOUBLE angle formula? This is what I got so far.. cos 2(π/6) = cos (π/6 + π/6) = (cos π/6)(cos π/6) - (sin π/6)(sin π/6) = cos^2 π/6 - sin^2 π/6 Is

  61. MATH

    Hi, I really need help with these questions. I did some of them halfway, but then I got stuck. Would you please help me? Thank you so much. Prove the identity.... 1. sec x + tan x(1-sin x/cos x)=1 1/cos x + sin x/cos x(cos^2 x/cos x)=1 1+sin x/cos

  62. Math - Solving Trig Equations

    Solve each equation for o is less than and/or equal to theta is less than and/or equal to 360 -- sin^2x = 1 = cos^2x -- Work: cos^2x - cos^2x = 0 0 = 0 -- Textbook Answers: 90 and 270 -- Btw, how would you isolate for cos^2x = 0? Would it be... x = cos^-1

  63. Math - Solving for Trig Equations

    Solve the following equation for 0 less than and/or equal to "x" less than and/or equal to 360 -- cos^2x - 1 = sin^2x -- Attempt: cos^2x - 1 - sin^2x = 0 cos^2x - 1 - (1 - cos^2x) = 0 cos^2x - 1 - 1 + cos^2x = 0 2cos^2x - 2 = 0 (2cos^2x/2)= (-2/2) cos^2x =

  64. Math, derivatives

    Let g(x) = sin (cos x^3) Find g ' (x): The choices are a) -3x^2sinx^3cos(cos x^3) b) -3x^2sinx^3sin(cos x^3) c) -3x^2cosx^3sin(cos x^3) d) 3x^2sin^2(cos x^3) I'm not exactly sure where I should start. Should I begin with d/dx of sin? Or do the inside

  65. Calculus - MathMate Please help

    ok, i tried to do what you told me but i cant solve it for c because they cancel each others out! the integral for the first one i got is [sin(c)cos(x)-cos(c)sin(x)+sin(x)+c] and the integral for the 2nd one i got is [-sin(c)cos(x)+cos(c)sin(x)-sin(x)+c] I

  66. Calculus

    which of the following integrals results from making the substitution u=x^3 in orer to find (squiggly vertical line)x^2cos(x^3)dx ~cos u du ~u^2 cos u du ~u^(2/3) cos u du1/3 os u du ~3 cos u du

  67. Math(Please check)

    Use the fundamental identities to simplify the expression. tan^2 Q / sec^2 Q sin^2/cos^2 / 1/cos^2 = sin^2 / cos^2 times cos^2 / 1 = The cos^2 cancels out so sin^2 is left. Is this correct?

  68. trigonomentry out of ideal help ah!crying

    compute.. Cos(1degree)+cos(3degree)+cos(5degree)+...+Cos(179degree) plz show working even an hint can,t help me.Have been do maths alday my brain is fried..Ah thanks

  69. calc.- trig substitution

    s- integral s 1/ [ (x^4) sq.rt(x^2+9)] i know x=3tanx sq.rt(x^2+9)= 3 secx dx= 3/[cos^2(x)] so far i know: = 1/ (3tan^4(x)) 3secx cos^2(x)) dx =1/ 81 [ (sin^4 (x)/cos^4 (x)) (1/cosx) (cos^2(x))] then i'm not really sure what to do next

  70. trig

    it says to verify the following identity, working only on one side: cotx+tanx=cscx*secx Work the left side. cot x + tan x = cos x/sin x + sin x/cos x = (cos^2 x +sin^2x)/(sin x cos x) = 1/(sin x cos x) = 1/sin x * 1/cos x You're almost there. thanks so

  71. Trig

    Given: cos u = 3/5; 0 < u < pi/2 cos v = 5/13; 3pi/2 < v < 2pi Find: sin (v + u) cos (v - u) tan (v + u) First compute or list the cosine and sine of both u and v. Then use the combination rules sin (v + u) = sin u cos v + cos v sin u. cos (v - u) = cos u

  72. Trigonometry (repost Reiny)

    at 1:35am I posted ; Write equivalent equations in the form of inverse functions for a.)x=y+cos theta b.)cosy=x^2 my answers were a.) x= y+ cos theta cos theta = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2) your post confused me a

  73. precalculus

    I don't understand this problem: (Tanө + cos ө)/ (sec ө + cot ө) so I start off like this: ={(sinө / cos ө)+cosө}{cos ө + (sinө/cosө)} =[(sin ө +cos^2ө) (cos^2ө +sin ө)]/ cos ө but what comes next?

  74. Trig/Precalc

    So I have two questions that have been puzzling me for quite some time and would really appreciate any help with either of them! (a) There are four positive intergers a, b, c, and d such that 4cos(x)cos(2x)cos(4x)=cos(ax)+cos(bx)+cos(cx)+cos(dx) for all

  75. Trigonometry(please Clarify)

    I posted before ; Write equivalent equations in the form of inverse functions for a.)x=y+cos theta b.)cosy=x^2 my answers were a.) x= y+ cos theta cos theta = x-y theta = cos^-1(x-y) b.) cosy=x^2 cos(y) = x^2 y = Cos^-1(x^2) your post confused me a little.

  76. trig

    how would you verify this trig identity (1+cos(x) / 1-cos(x)) - (1-cos(x) / 1+cos(x)) = 4cot(x)csc(x) ? help please!

  77. math

    Prove that for all real values of a, b, t (theta): (a * cos t + b * sin t)^2

  78. Math

    Prove each identity: a) 1-cos^2x=tan^2xcos^2x b) cos^2x + 2sin^2x-1 = sin^2x I also tried a question on my own: tan^2x = (1 – cos^2x)/cos^2x R.S.= sin^2x/cos^2x I know that the Pythagorean for that is sin^2x + cos^2x That's all I could do.

  79. Math

    Write the expression in terms of costheta and then simplify. cos^4theta - sin^4theta + sin^2theta Ans: cos^4 θ - 1 - cos^4 θ + 1 - cos^2 θ = -cos^2 θ

  80. Math

    Eliminate the parameter and write the corresponding rectangular equation whose graph represents the curve. x = sec Q y = cos Q x^2 + y^2 = 1/cos^2 + sin^2/cos^2 = x^2(1 +sin^2) = x^2(2-cos^2) x^2(2-1/x^2) = 2x^2 - 1 x^2 - y^2 = 1 My teacher said to use

  81. Calculus AP

    Use the table of integrals to find int cos^4 3x dx I found the table: ∫cos^n u du = (1/n)cos^(n-1)u sinu + (n-1/n)∫sin^(n-2)u du = 1/4 cos^(4-1)u sinu + (4-1/4)∫sin^(4-2) u du so what i did the problem: let u=3x then du=3dx =1/4*1/3 cos^3u sinu +

  82. Calculus

    Find F '(x) for F(x) = integral[x^3 to 1](cos(t^4)dt) a. cos(x^7) b. -cos(x^12) c. -3x^2cos(x^12) d. cos(1) - cos(x^12)

  83. Calculus

    Evaluate the integral sin4x cos^2 4x dx A. cos^3 4x/3 +C B. - cos^3 4x/3 +C C. cos^3 4x/12 +C D. -cos^3 4x/12 +C

  84. Calculus

    what is the limit n to infinite of cos1*cos(1/2)*cos(1/4)*cos(1/8)*cos(1/16)*...*cos(1/2^n)

  85. Math

    Can someone please check my answers! 2. Find value of cos(255degrees)cos(105degrees) root3 - 2 / 4 3. cos(pi/12) - cos(5pi/12) Is it root3/4? 4. Use the appropriate sum-to-product formula to rewrite the expression sin6x - sin9x I don't really understand

  86. math

    How would you establish this identity: (1+sec(beta))/(sec(beta))=(sin^2(beta))/(1-cos(beta)) on the right, sin^2 = 1-cos^2, that factor to 1-cos * `1+cos, then the denominator makes the entire right side 1+cosB which is 1+1/sec which is 1/sec (sec+1) qed

  87. Calculus

    how do you solve this trig identity? i don't get it at all! cos(a+b)cos(a-b)=cos^2a-cos^2b-1

  88. PRECALC

    solve the equation 1. cos(θ) − sin(θ) = 1 2.2 cos(θ) tan(θ) + tan(θ) = 1 + 2 cos(θ) 3. sin(θ) cos(3θ) + cos(θ) sin(3θ) = 0 4. sin(2θ) cos(θ) − cos(2θ) sin(θ) = 1/2 5. cos(2θ) + cos(θ) = 2 6. cos(2θ) + sin2(θ) = 0

  89. Calculus re-post

    Does anybody know how to solve this question? a) Find the arc length function for the curve measured from the point P in the direction of increasing t from P and then reparametrize the curve with respect to arc length starting from P. b) Find the point 4

  90. Calculus

    Which of the following is the best linear approximation for f(x)=cos(x) near x= π/2 ? a) y= x - π/2 b) y= -x + π/2 c) y= -x + π/2 + 1 d) y= x - π/2 +1

  91. Pre-Cal

    1) Verify the identity cos^2 B - sin^2 B = 2 cos^2 B -1 I know that cos^2 B - sin^2 B = 2 cos^2 B -1 by the double angle formula but I do not know how to show this.

  92. Engineering

    -From the following two linear homogeneous algebraic equations:(sqr= square root) (1) B*sin(kl/sqr2) = D*sin(kl) (2) (k/sqr2)*B*cos(kl/sqr2) = (k)*D*cos(kl) -Form matrix of these 2 equations and solving the determinant=0 will lead to:

  93. Math - Trigonometry

    Let f(x) be a polynomial such that f(cos theta) = cos(4 theta) for all \theta. Find f(x). (This is essentially the same as finding cos(4 theta) in terms of cos theta; we structure the problem this way so that you can answer as a polynomial. Be sure to

  94. Pre-Calculus

    I don't understand,please be clear! Prove that each equation is an identity. I tried to do the problems, but I am stuck. 1. cos^4 t-sin^4 t=1-2sin^2 t 2. 1/cos s= csc^2 s - csc s cot s 3. (cos x/ sec x -1)- (cos x/ tan^2x)=cot^2 x 4. sin^3 z cos^2 z= sin^3

  95. trigonometry (please double check this)

    Solve the following trig equations. give all the positive values of the angle between 0 degrees and 360 degrees that will satisfy each. give any approximate value to the nearest minute only. 1. sin2Į = (sqrt 3)/2 2. sin^2Į = cos^2Į + 1/2 3. sin 2x

  96. Trigonometry

    Okay, I have been given a trigonometric equation to solve (sin^2(theta) + cos(theta) = 2). So far, I have been able to use the Pythagorean identity to get (-cos^2(theta) + cos(theta) - 1 = 0), which I then multiplied by -1 on both sides to get:

  97. AP Calculus

    Find the velocity, v(t), for an object moving along the x-axis if the acceleration, a(t), is a(t) = cos(t) - sin(t) and v(0) = 3 v(t) = sin(t) + cos(t) + 3 v(t) = sin(t) + cos(t) + 2 v(t) = sin(t) - cos(t) + 3 v(t) = sin(t) - cos(t) + 4

  98. calc

    find the area between the x-axis and the graph of the given function over the given interval: y = sqrt(9-x^2) over [-3,3] you need to do integration from -3 to 3. First you find the anti-derivative when you find the anti-derivative you plug in -3 to the

  99. Physics

    A basketball player shoots a free throw at a 50 degree angle. Assume the ball is released at a height of 1.8 meters, the hoop is 3 meters off of the floor and 4.6 meters away from the shooter. With what velocity should the player release the ball to hit

  100. Trig

    If cosx = 10/19 an pi < x < 2pi, find the exact value of cos x/2 Use the double angle formula. Cos 2Y= sin^2 Y - cos^2Y = 1-2Cos^2 Y. let y= x/2, and 2Y=x

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20