cWhat Is The Structure Of CH3C(CH3)2C(TRIPLE BOND)CCH(CH3)CH2CH3

5,508 results, page 4

chemistry

1. Would Ch3-OH or CH3-CH2-CH2-CH2-CH2-OH have a higher boiling point? Fully explain ypur answer. 2. Explain why a tertiary alcohol will not undergo an oxidation reaction. Give an example. 3. Compare and contyrast similarities/differences of condensation and substitution ...

Chemistry

Why B(CH3)3 cannot be Lewis Base??

Chemistry- HW Check

I have seven homework problems. I did them but I wasn't sure if I did them correctly. Did I do them correct? Thank you! Give the reaction that describes how the hydrazine, N2H4(aq), / hydrazinium ion, N2H51+(aq), buffer reacts with a strong base such as sodium hydroxide. N2H4(...

Chemistry

Does anyone know what CH3CH2CH(OH)COOH or C4H9O(C=O)CH3 is?

chemistry

What is the pH of a .10M (CH3)3N solution? Kb=6.40e-5

Chemistry

Which compound has the formula HC(=O)-O-CH2-CH3?

SyEd

IUPAC name of (CH3)3.C.CH2

Science

Compare the pH of CH3 COOH and Hcl.

science

What is the oxidation number of Si in (CH3)2SiCl2

Chemistry

Formula of (ch3ch2)2chch2ch(ch3)2

chemistry

What is the conjugate base of the following substances: a. (CH3)3NH /(CH3)3N b. H3N-CH2-COOH / H3N-CH2-COO c. H3N-CH2-COO / H2N-CH2-COO d. OOC-CH2-COOH / OOC-CH2-COO e. OOC-CH2-COOH / HOOC-CH2-COOH

cHEMISTRY

How many electrons are in the p-orbital of the methyl radical (CH3^.)

chemistry

Calculate the pH of a 0.35 M solution of dimethylamine, (CH3)2NH.

chemistry

is INH(CH3)3 an acid, base or neutral?

Chemistry

HC2H3O2 + CH3(CH2)4OH (H2SO4)=?

chemistry

Give the shapes of CH3, O3, SnCl3, BrF3, I3

chemistry

Most organic acids can be represented as RCOOH, where COOH is the carboxyl group and R is the rest of the molecule. (For example, R is CH3 in acetic acid, CH3COOH). (a) Draw a Lewis structure for the carboxyl group. (b) Upon ionization, the carboxyl group is converted to the ...

Chem

Is CH(three bonds)C-CH2-CH3 1-butyne? Thanks for checking!

Organic Chem

What orbitals are used to form the C–B bonds in B(CH3)3?

Organic Chemistry

What orbitals are used to form the C–B bonds in B(CH3)3?

Chemistry

what is the sp hybrid orbitals for carbon molecules in CH3-C=C-CH2OH?

Chemistry

What must be the molarity of an aqueous solution of trimethylamine, (CH3)3 N, if it has a PH=11.20?

chemistry

how do you name halogens as a functional group. like CH3-Cl

Chemistry

Calculate the mass of 0.0122 moles of: a) Si3N4 b) (CH3)3 N

Chemistry

addition of conc H2SO4 to Ph-CH(CH3)OH gives product?????

O Chem

if my reactant is 5-hydroxy-3-methylpentanal (which is an aldehyde) and i dilute the rxn with aqueous acid, what product will i get? write out the product in condensed form and name its functional group. P.S: 5-hydroxy-3-methylpentanal is CH2(OH)CH2CH(CH3)CH2CH=O <--where ...

O Chem

if my reactant is 5-hydroxy-3-methylpentanal (which is an aldehyde) and i dilute the rxn with aqueous acid, what product will i get? write out the product in condensed form and name its functional group. P.S: 5-hydroxy-3-methylpentanal is CH2(OH)CH2CH(CH3)CH2CH=O <--where ...

Organic Chemistry

What will happen from the following if H3C-C6H6-N2Cl is treated with Na2CO3? a)CO2 will emit 2)NH3(g) will emit c)N2Cl-C6H6-CH3 will be produced d) NH2-C6H6-CH3 will be produced We get C6H6-NH2 when Sn/conc.HCl are reacted with Nitro Benzene.This become Aniline when excess ...

CHEMISTRY

How many electrons does the p-orbital of a methyl radical carbon CH3^. contain?

Chemistry

Name the following: CH3CH2CH(OH)COOH CH3OCH2CH2CH3 C4H9O(C=O)CH3

Chemistry

Name the following: CH3CH2Ch(OH)COOH CH3OCH2CH2CH3 C4H90(C=O)CH3

Chemistry

What is the empirical formula of a compound that has a carbon-to-hydrogen ratio of 2 to 6? Is it CH3?

chemistry

which of the following is a weak base? Why? a. KOH b. NH4+ c. CH3 2- d. HF e. H3PO4

acids

Which of the following bases is the weakest? (CH3)2NH , Kb = 5.1 x 10–4 ClO–, Kb = 2.9 x 10–7 SO42–, Kb = 8.3 x 10–13

chemistry

how do you identify the base in this reaction? h2o(L) + CH3NH2(aq) yields OH-(aq) + CH3+(aq)

Chem

Some very effective rocket fuels are composed of lightweight liquids. The fuel composed of dimethylhydrazine (CH3)2N2H2 mixed with dinitrogen tetroxide was used to power the Lunar Lander in its missions to the moon. The two components react according to the following equation...

Organic Chemistry (University)

We're supposed to try and figure out the structure of a compound based off the the following information: δ: 2.4 2H triplet δ: 2.1 3H singlet δ: 1.5 2H triplet δ: 1.3 6H singlet δ: 0.9 3H triplet >δ: 2.4 2H triplet This is probably a CH2 group ...

Chemistry

Rank the following Bronsted acids from strongest to weakest: H-SH H-CH3 H-NH2 H-F H-I

college organic chemistry

Give the product of the substitution reactions. (CH3)2CHOSO3CH3 -> ?

chemistry

What has the lowest surface tension and why? CH3CH2CH2CH3, (CH3)2CO, C6H6, H20

Chemistry

Estimate the enthalpy change for the following reaction OH(g)+CH4(g)==>CH3(g)+H2O(g)

chemistry

Give the IUPAC name of thish hydrocarbon ch3ch2c(ch3)2ch2ch2ch2ch3

Chemistry

4-methyl-2-pentyne show tautomerization ? i know tautomerization is done with a double bond but this one has a triple bond

BMB

1.explain the role of the H-bond in the alpha helical structure. 2. explain the role of H-bond in the beta sheet structure.

alkanes!

What is meant when we say that alkanes are saturated? Carbon has four bonds. When all the bonds are occupied with hydrogen atoms(no double or triple bonds), the molecule is said to be saturated. CH4 is saturataed. CH3CH3 or C2H6 is saturated. There is a C-C bond with the other...

Organic Chemistry

When reading an infrared (IR) spectrum for an unknown compound, you check for certain functional groups in a certain order. If C=O is absent, you check for alcohols/phenols (-OH), then for amines (N-H), then for ethers (C-O, & the absence of -OH). So, I was wondering: If you ...

chemistry quick question

I need help with something and can't find this anywhere online. my structure looks like this OH CH2 CH3CH2CH2CHCHCH2CH3 CH3 So that OH looks like it is on a ethyl group. I need to write the IUPAC name and I wrote 3-methyl-4-heptanol but realized my mistake as that would ...

College Chemistry

Estimate the enthalpy change for the following reaction OH(g)+CH4(g)==>CH3(g)+H2O(g)

CHEMISTRY

What is the molality of 22.5 g acetone (CH3)2CO , in 200 g water ? ( the answer is 22.0 m , that I think is wrong .. )

us history 1 ch3 study guide

with an increasing population, the british clonists faced a shortage of what?

chemistry(check my answer)

how do resonance structure related to its real structure? resonance structure is just another way to write the lewis dot with different formal charges and bond order

Chemistry

Explain the difference in bond lengths of N2, O2, and F2. Ans: I assume it's because of bond order (single, double, and triple bonds). Explain the difference in bond lengths of HF, HCl, and HBr. Ans: I'm not sure about this one???

chemistry

What is the molality of a solution composed of 192g of acetone ((CH3)2CO) dissolved in 416g of water

College Chemistry Help Please!

what is the pH of a solution that is 0.200 M in methylamine, CH3 NH2 CH3NH2+ H20<======> CH3NH3+ + OH- Kb= 4.2 x 10 ^-4

Chemistry

The pH of sodium acetate/acetic acid buffer is 4.5 . Calculate the ratio of [CH3 COOH]/[CH3COO-]

chemistry

What is the molality of a solution composed of 2.55g of acetone (CH3)2CO, dissolved in 200.g of water?

chem

How many molecules of (CH3)2NH are needed to react completely with 2.00mg of H2C2O4? Help i don't understand this process!

chem

How many molecules of (CH3)2NH are needed to react completely with 2.00mg of H2C2O4? Help i don't understand this process!

chem

How many molecules of (CH3)2NH are needed to react completely with 2.00mg of H2C2O4? Help i don't understand this process!

chem

How many molecules of (CH3)2NH are needed to react completely with 2.00mg of H2C2O4? Help i don't understand this process!

Organic Chemistry

Rank the given compounds based on their relative Brønsted acidities. H-CH3 H-OH H-Cl H-F H-NH2

chemistry

Which of the following bases is the weakest? 1)(CH3)2NH , Kb = 5.1 x 10–4 2)ClO–, Kb = 2.9 x 10–7 3)SO42–, Kb = 8.3 x 10–13 Im thinking the answer is 2, but im not100%

Chemistry

SO2 can be drawn as a molecule which satisfies the octet rule (using one double bond and a single bond) or as an expanded octet (using two double bonds). A measurement of the S-O bond distance demonstrates that the two bond lengths are identical. Does this clarify which Lewis ...

Chemistry

Which of the following would be the best solvent for NH3 and why? CH3(CH2)4CH3, CCl4, CH3OH, BrCH2CH2CH3.

chemistry

1.) What must be the molarity of an aqueous solution of trimethylamine (CH3)3N if it has a Ph of 11.04? Kb = 6.3*10^-5 if someone can show the mechanics of doing this, will be appreciated much.

chemistry

which of the following molecules can have optical isomers? a. CH2Cl2 b. H2NCH(CH3)COOH c. ClCH(OH)CH2Cl is b and c

Chemistry

Rank the following in order by increasing boiling point and explain why? CH3Cl Rn CH4 CH3-CH2-OH

chemisry

8. Write the structural formula of organic product that would result from the reaction: CH3—CH=CH2 + H2O->.

chemistry

list the numbers and types of atoms represented by these chemical formulas. a.Fe2O3 b.KMnO4 c.CH3 d.NH4NO3

Chemisty

Classify the following: 1)CH3CHCH2COOH ! CH3 I think this is a carboxylic acid because of the COOH attached. Would you agree?

Chemistry

Write an equation for the reaction that takes place when each base is added to water. A) LiOH B) (CH3)2NH.

Chemistry

Rank these from lowest boiling point to highest. CH4 CH3CH2CO2CH2CH3 CH3(CH2)2C=ONH2 CH3COOH

complete and balnces theses reactions

how do i complete and balnces theses reactions???? CH3-CH2-CH3 (g) + Br2 (l) --> like how in the world????? do i do this? lol aint got a clue wish i would have listened at school now. Alkanes usually react with a halogen to form one of several halides. The simplest reaction...

Chemistry

Select the true statements regarding the resonance structures of formate. HCO2 Check all that apply: Each oxygen atom has a double bond 50% of the time. The actual structure of formate is an average of the two resonance forms. Each carbon-oyxgen bond is somewhere between a ...

Chemistry

C2H2(g) + 2 H2(g)--> C2H6(g) Information about the substances involved in the reaction represented above is summarized in the following tables. Substance So (J/mol∙K) ∆Hºf (kJ/mol) C2H2(g) 200.9 226.7 H2(g) 130.7 0 C2H6(g) - - -84.7 Bond Bond Energy (kJ/mol) C-...

Chemistry

C2H2(g) + 2 H2(g)--> C2H6(g) Information about the substances involved in the reaction represented above is summarized in the following tables. Substance/ So (J/mol∙K) /∆Hºf (kJ/mol) C2H2(g) / 200.9 / 226.7 H2(g)/ 130.7 / 0 C2H6(g)/ ?? / -84.7 Bond Bond Energy...

Chemistry

C2H2(g) + 2 H2(g)--> C2H6(g) Information about the substances involved in the reaction represented above is summarized in the following tables. Substance/ So (J/mol∙K) /∆Hºf (kJ/mol) C2H2(g) / 200.9 / 226.7 H2(g) / 130.7 / 0 C2H6(g)/ ?? / -84.7 Bond Bond Energy...

Chemistry

C2H2(g) + 2 H2(g)--> C2H6(g) Information about the substances involved in the reaction represented above is summarized in the following tables. Substance/ So (J/mol∙K) /∆Hºf (kJ/mol) C2H2(g) / 200.9 / 226.7 H2(g) / 130.7 / 0 C2H6(g)/ ?? / -84.7 Bond Bond Energy...

chemistry

I have a chart and I have to draw the structure,name the shape snd lable the bond angle of some compounds. I've done most of them but im stuck on a few so heres what I need.Please and thank you structure of NF3 structure,shape and bond angle of TeCl2 bond angle of CCl4 CCl4 is...

chem

Arrange the following amines in order of decreasing base strength. NH3, NH2Br, CH3NH2, (CH3)2NH

Chemistry

Calculate the number of grams of the indicated element in the compound. a) lead in 63.8 g PbO2 b) carbon in 1.664 g (CH3)2CO

CHEMISTRY

C12H20(Y)--> 22CH2=O+ 2CH3C(=O)CH2C(=O)CH3 The reagents used are ozone, Zn and H20 Give condensed formula of C12H20Y

chemistry

According to the IUPAC system what is the following compound: CH=C-CH-CH-CH3 (It is not an equal sign but has three dashes up and down instead of two)

chem

What are the IUPAC names of the following alkane. CH3CHCH3 I CH3CH2CH2CHCH2CHCH3 I CH3 i thought it was 2-methyl-4-propylheptane but aparently that is wrong. does anyone know the answer?

chemistry

Please i tried to give this answer on a quiz but it was not accepted. To name this alkane: CH3CH2CH2CHCH3 with a substituent of CH3 on 2nd carbon.

CHEMISTRY

Ch3CN(CH3)C2H5 is my kekule drawing ok? I drew it and uploaded a picture. oi61. tinypic . com/2vmztir.jpg

Chemistry

If you place 1.26 g of solid silicon in a 6.54 L flask that contains CH3Cl with a pressure of 634 mm Hg at 25°C, what mass of dimethyldichlorosilane, (CH3)2SiCl2(g), can be formed?

cch

y-abs(-2x/3x+1)

chemistry

I have to draw the QMM of CL2C2. For the Lewis structure i think that the two C ayoms form a triple bond and the Cl atoms form single bonds. Therefore i think that the central C atom hybridizes into sp. if this is correct, my question is how do i know which p orbital on C to ...

Chemistry (lewis structure/bond)

Example: Sulfur Trioxide Chemical formula: SO3 Valence e-: ? Needed e-: ? Difference/Bond: ?? Please help me!

chemistry

what does this mean: is (a molecule) sigma or pi in symmetry? the molecule in question is c triple bond c. ....it has 2 pi bonds and 1 sigma bond....which is symmetrical?

Chemisty

Describe the bond length and bond energy of carbon-carbon bonds in single, double, and triple bonds.

Chemistry

Describe what a chemical bond is in terms of electron density between two atoms. What are the bond angles for an octahedral structure and how many? Predict the formal bond angles about the central atom for the following molecules: TeBr4 Express your answers using three ...

Science

Why is the energy released to break a triple bond not three times the energy to break a single bond?

science

if two carbon atoms are joined by a triple bond how many other atoms can each carbon atom bond with

science

if two carbon atoms are joined by a triple bond how many other atoms can each carbon atom bond with

Chemistry

Complete the reaction: Methanol and propanoic acid are mixed. Okay, I got the two formulas: CH3OH + CH3CH2COOH ---> ??? ...now I don't know what to do. Lots of CH3's and CH2's. Help? Thanks!

Chemistry

It says to draw the structural formula CH3CH(OH)CH3 on my hw. What's the parenthesis in the formula?

High School

What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?

organic chemistry

on a newman projection, what does it mean when there is a blank where a substituent should be? does that mean H or CH3?

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56