a certain reaction has the following generaln form

72,980 results, page 83

chemistry

An indicator has the reaction Hln(aq) ↔ H+(aq) + In-(aq). Explain how the indicator can change color when a strong base is poured into a solution of this indicator. Will a strong base dissociate? Which way will this cause the reaction to shift? Is there more or less HIn...

Chemistry

Help needed with a calorimeter lab. I have to measure the enthalpy of a neutralization reaction between NaOH and HCl as well as find the concentration of NaOH the following ways. - using the mass and volume of NaOH - Using calorimetric data assuming no heat lost to calorimeter...

Chemistry

Which of the following compounds are soluble? Choose at least one answer. a. BaSO4 b. K2SO4 c. KBr d. NaOH e. Al(OH)3 I originally thought it was the last four, but it isn't, or it isn't only/all of them. Aren't all sulfates and potassium soluble? What are the reactant ions in...

LA - 1 question

Read the following stage directions and dialogue from Billy Elliot: [Billy suddenly sees DAD and freezes. His reaction puzzles Mrs. Wilkinson for a second. The music comes to a standstill. Mrs. Wilkinson turns to see Dad.] DAD: You.Out.Now What do these directions and dialogue...

Psychology

Help is needed! Please help! I said the answer is C Social influence ranges in intensity from the gentlest form _______, which involves changing one's behavior just because other people are nearby, to the strongest form _______, which involves changing one's behavior because ...

writing

Is there someone who could proofread this? Identify the sentence patterns 1. He followed the map to the treasure. S/V/DO 2. Darcy sang the song slowly. S/V/DO 3. They were certain about the time. S/LV/SC 4. I called him a sucker. S/V/DO 5. I found the puppy a home. S/V/DO 6. ...

enviromental

Completely mixed flow ractor CSTR and plug flow reactor (PFR) may have significantly different efficiencies depending on the reaction order. This problem asks you to compare the relative reactor sizes required to ensure 99.0 % removal of wastewatwer pathogens. Wastewater from ...

Geometry Help?

Can anyone check my answers? * = My answer 1. Find the length of the missing side. Leave your answer in simplest radical form (1 point) The triangle is not drawn to scale. Sides 4 on the bottom and 3 on the side a. 25 b. 144 c. 5 d. √5* 2. Find the length of the missing ...

math

type of cd/dvd- number ---------------------------------------------------------- rock CD 26 ---------------------------------------------------------- pop CD 17 ---------------------------------------------------------- comedy CD 11...

chemistry

Create balanced equation, given the two compounds in aqueous solution may react with one another. State whether or not a chemical reaction occurs. Make sure to include the state of each reactant and product. If a precipitation reaction occurs, provide the ionic and net ionic ...

structural formulae

REACTION 1 IS A CARBON COMPOUND CONTAINING AN ALCOHOL FUNCTION GROUP + REACTION 2 IS A CARBON COMPOUND CONTAINING A CARBOXYLIC GROUP. IM TRYING TO UNDERSTAND THE PRODUCT FORMULAE. CAN YOU TELL ME HOW THESE TWO FUNCTION GROUPS REACT, AND THE RELEVANCY OF CH IN THIS EQUATION ...

Physics

Can you please help me with the following questions? please. 1. how much work do you do on a 25-kg backpack when you walk a horizontal distance of 100 m? -I got 2,500 J 4. if you friend pushes a lawnmower four times as far as you do while exerting only half the force, which ...

Chemistry

I was not the person who wrote that question last night? Chemistry - DrBob222, Wednesday, November 15, 2006 at 7:24pm Yes, it is possible in some cases. For example, CoCl2 is blue in the unhydrated form and pink in the hydrated form. As a kid, I used a water color brush to "...

CHEMISTRY

Hello, I am having trouble balancing this redox reaction WITHOUT using the half-reaction method. I believe this is because not all of the elements are in (aq). BrO3-(aq) + N2H4(g) --> Br-(aq) + N2(g) Br is reduced by a factor of 6. N is oxidized by a factor of 2. I will ...

Chemistry

Yesterday we combined Hydrochloric Acid HCl with Sodium Hydroxide NaOH in a violent reaction that resulted in water H2O and common table salt NaCl. How many grams of hydrochloric acid should we use so we have exactly enough to react with 40g of sodium hydroxide? You'll need to...

Science

Why is it that milk sours so fast. I had googled it and false imformation has came up. I have to write a 3 page essay about how certain things sour too quickly.

Honors Chemistry

Absorbance spectroscopy relies on the fact that specific molecules can only absorb certain wavelengths. Explain how this could be used in a)microwaves and b) astronomical discoveries/interpretations. Thank you for any help with this... :)

statistics

in a certain survey 1,043 adults, 81% reported having more than one television at home. find the actual number of respondents corresponding to the given percentage?

answer

One of the reasons that certain advertisements are successful is because viewers want to behave like those they observe. What is the general term that psychologists use to describe this type of behavior?

Math

In a certain survey of 1034 adults, 89% reported having more than one television at home. Find the actual number of reespondents corresponding to the given percentage

Physical Science

The string of a certain yo-yo is 80 cm long and will break when the force on it is 10 N. What is the highest speed the 200 g yo-yo can have when it is being whirled in a circle? Ignore the gravitational pull of the earth on the yo-yo.

Physical Science

The string of a certain yo-yo is 80 cm long and will break when the force on it is 10 N. What is the highest speed the 200 g yo-yo can have when it is being whirled in a circle? Ignore the gravitational pull of the earth on the yo-yo.

Calculus-help~

A certain fast food restaurant wants to determine the increase in revenue per cheeseburger if sales are $45,000. Let the function [p=(120000-x)/(30000)] represent the price of x cheeseburgers.

physics

Electrons move through a certain electrical circuit at an average speed of 1.7 x 10-2 m/s. How long (in minutes) does it take an electron to traverse a 1.8 -m light bulb filament coil?

Prob&Stat

If 52% of the customers at a certain grocery store regularly use coupons, what is the approximate standard deviation of the sampling distribution of the proportion for samples of size 240? 2.1% 3.2% 4.7% 10.4%

math

on a certain day the propellers complete 20 revolutions per minute and have a speed at of 45 m/s calculate the radius of a propeller to one decimal place using pie as 3.14 ?

criminal justice

In 1970, the District of Columbia passed the first __________ statute which authorized denial of bail to "dangerous" persons charged with certain offenses for up to 60 days.

Social studies Florida

Cross words: question , when one group chooses not to buy a certain product or service usually a tactic to get a benefit previously decided.

MATH

A certain fast food restaurant wants to determine the increase in revenue per cheeseburger if sales are $45,000. Let the function [p=(120000-x)/(30000)] represent the price of x cheeseburgers.

English

Can you check the adjectives in the following sentences, please? I really don’t know if you can use them in English. I wonder if you could possibly help me make a list of clothes which are “fashionable” at the moment in the USA. Thank you very much in advance. 1)I don’...

Chem Help Please!!!

Experiment Design You are asked to separate a mixture of toluene and cyclohexane. Assume that they do not form an azeotropic mixture. Design an experiment to do this. You must provide the following information. a) A diagram of the equipment you will be. b) What distillate ...

Chemistry

Currently studying for an lab exam. Just have a few question about a typical Iodine Clock reaction lab. In an typical Iodine Clock reaction lab what would be the state of effect of an increase in the initial concentration of persulfate ion (S2O3 2-) and the increase in the ...

Chem

At 930 K, Kp = 0.30 for the following reaction. 2 SO2(g) + O2(g)=>2 SO3(g) Calculate the equilibrium partial pressures of SO2, O2, and SO3 produced from an initial mixture in which the partial pressures of SO2 and O2 = 0.51 atm and the partial pressure of SO3 = 0 (exactly...

Algebra

a. Suppose that a market research company finds that at a price of p = $31, they would sell x = 74 boxes of product each month. If they lower the price to p = $25, then more people would purchase the product, and they can expect to sell x = 80 boxes in a month’s time. Find ...

maths - a few questions

Simplify 3(x-2)^2/x-2 Is the answer 3x^2-10x+10? If not then what is? When p= sqrt2 and q= sqrt6 write pq in the form a(sqrt)b where a and b are integers and b is as small as possible. Multiply out these brackets. Give your answer in the simplest form. (x+2y)(2x+y) Is the ...

Chemistry

Difference between hydration and hydrogenation reactions? I have searched everywhere in my book and all I can come up with is: Hydorgenation is when atoms of hydrogen H2 are added to the carbons in a double or triple bond of alkenes or alkynes to form what we call alkanes. ...

Ap Chemistry Help

3.) One method used in the eighteen century to generate hydrogen was to pass steam through red-hot steel tubes. The following reaction takes place: 3Fe(s)+4H20(g)--->Fe3O4(s)+4H2(g) 2. What mass of iraon will react with 500.0 L of steam at 25 degrees C and 1.00 atm pressure...

Chemistry

Use the Bronsted-Lowry definitions to identify the two conjugate acid-base pairs in the following acid-base reaction: HCO3^- + S^2- <-> HS^- + CO3^2- I got it. HCO3^- is the base in the pair with CO3^2-. S^2- is the acid in the pair with HS^-. Would you believe you have ...

geometry

A circle with center at (2,0) and a radius of 4 is intersected by a line whose slope is 1 and whose y intercept is 2. Write the equation of the line and write the equation of the circle in standard form. i know that the center-radius form is (x-2)^2 + (y-0)^2=16

health

How dose lock-and-key mechanism relate to hormones? A. If a hormone fits the receptor site, then there is no reaction. If a hormone and a receptor site do not match, then there will be an effect. B. If a hormone fits the receptor site, then there will be an effect. If a ...

Math for Steve

1. Write the ratio in the simplest form. 45 : 15 a. 9 : 3 b. 3 : 1 c. 1 : 3 d. 4 : 1 4. Jake sold 39 tickets to the school fair, and Jeanne sold 12 tickets. What is the ratio, in simplest form, of the number of tickets Jeanne sold to the number of tickets Jake sold? 5. In 10 ...

chemistry

An indicator has the reaction Hln(aq) ¡ê H+(aq) + In-(aq). Explain how the indicator can change color when a strong base is poured into a solution of this indicator. Will a strong base dissociate? Which way will this cause the reaction to shift? Is there more or less HIn? Do...

science

1. All of the following are parts of the retina except A. rods. C. fovea. B. cones. D. lens. 2. Which of the following are tests of the eye? A. Cephalgia, chondrodynia, sternotomy B. Myelography, photon absorptiometry, thermography C. Rheumatoid arthritis, muscular dystrophy, ...

science ap chemistry

What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

biochemistry

The enzyme alcohol dehydrogenase catalyzes the following reaction: Ethanol + NAD+  acetaldehyde + NADH + H+ You have a 1 ml solution containing 100 µM Ethanol, and 1 mM NAD+. You then add 1 mg of alcohol dehydrogenase. Assume all of the ethanol gets converted to ...

CHEMISTRY

i need help with this pre lab question:| plse help me! teh following data were obained for the reaction 2ClO2(aq)+ 2OH^-(aq) -> ClO3^-(aq) + ClO2^-(aq) +H2O (l) Where rate = delta[ClO2]/ delta t (mol/L) (mol/L) (mol/L*s) [ClO2]0 [OH-]0 Initial rate 0.0500 0.100 5.75*10^-2 0...

chemistry

The reaction between sodium hydroxide and hydrobromic acid is represented in the equation below: OH- + H+ -> H2O A 62.5 mL sample of 1.86 M NaOH at 22.5 deg Celsius was mixed with 62.5 mL sample of 1.86 M of HBr at 22.5 deg Celsius in a coffee cup calorimeter. The ...

chemistry

Which of the following combinations of atomic orbitals can combine to form sigma bonds? s-ss-pp-phybrid orbital - hybrid orbitalhybrid orbital - shybrid orbital - p What is the bond angle (in degrees) resulting from sp hybridization? What is the bond angle (in degrees) ...

Math

A piece of wire is bent to form a square of area 121cm. Calculate: a)the length of each side of the square. b)the perimeter of the square. The piece of wire is now bent to form a circle using π=3.14 Calculate: a)the radius of the circle b)the area of the circle

Chem

Which of the following compounds are soluble? Choose at least one answer. a. BaSO4 b. K2SO4 c. KBr d. NaOH e. Al(OH)3 I originally thought it was the last four, but it isn't, or it isn't only/all of them. Aren't all sulfates and potassium soluble? What are the reactant ions in...

chem

The atmospheric pressure at the summit of Mt. McKinley is 554 mm Hg on a certain day. What is the pressure in atmospheres and in kilopascals? What are the conversions or formulas for this problem??

financial

Two things that are certain in life are death and taxes; we often hear. Do you think it is justified for governments to levy taxes? Why or why not?

Finance

Two things are certain life and death and taxes we often hear. Do you think it is justfied for government to levy taxes why or why not.

Physics

A certain freely failing object requires 1.70 s to travel the last 20.5 m before it hits the ground. From what height above the ground did it fall?

Physics

A certain capacitor stores 360 J of energy when it holds 9.1 10-2 C of charge. (a) What is the capacitance of this capacitor? µC (b) What is the potential difference across the plates? V

3rd grade science

All living things respond in certain ways to ______ in their environment. A.. Changes B.. Respond C.. React

physics

A certain freely falling object requires 1.25 s to travel the last 35.5 m before it hits the ground. From what height above the ground did it fall?

physics

A certain freely failing object requires 1.70 s to travel the last 39.0 m before it hits the ground. From what height above the ground did it fall?

computer & computer knowledge

how do I over beat a chatroom that has a digit restrainer(meaning it will only let you type a certain amount of words)

calculus

The base of a certain solid is the triangle with vertices at (-10,5), (5,5), and the origin. Cross-sections perpendicular to the y-axis are squares. What is the volume of the solid?

calculus

The base of a certain solid is the triangle with vertices at (-10,5), (5,5), and the origin. Cross-sections perpendicular to the y-axis are squares. What is the volume of the solid?

Chemistry

The Ksp for a certain metal hydroxide, M(OH)2 (molar mass = 127) is 3.5 × 10-19. What is the pH for a saturated solution of this hydroxide? Confused on how to set up this problem...

physics

The sound of heavy automobile traffic, heard at a certain distance, has a sound level of about 75 dB. What is the intensity of the noise there? answer in W/m^2.

calculus

the net monthly profit in dollars, from the sale of a certain item is given by formula p(x)=10^6[1+(x-1)e^-0.001x], where x is a number of item sold

Chemistry

If a certain gas has a density of 2.34 g/L at 27.0C and 742 torr, what is the molar mass of this gas? I am not sure what formula to use to solve this problem.

PC Training & Business College

if 14 accidents can be expected at a certain intersection per week, what is the probability that there will be 3 accident at the intersection on a given day

science

3x10 power 18 photon of certain light radian are found to produce 1.5 j of energy calculate wavelength of light radiation

sdfghj

a certain force acting on a body of mass 2 kg increases it's velocity from 6m/s to 15m/s in 2 seconds . the work done by the force during this interval is ?

statistics

for a certain psychiatric evaluation z scores above 2.18 and below -2.33 are considered abnormal. what is the probability that a person evaluated by this will be considered normal?

statistics

A test has a mean of 104 and a standard deviation of 16. We want to be 98% certain that we are within 4 points of the true mean. Determine the sample size.

Math

The distance of a car from a certain intersection after t seconds is given by d(t) = 12 + 3t - t2. When (that is, for which values of t) is the car 12 units away from the reference point?

algebra

The distance of a car from a certain intersection after t seconds is given by d(t) = 14 + 4t - t2. When (that is, for which values of t) is the car 14 units away from the reference point?

Physics

The nucleus of a certain type of uranium atom contains 92 protons and 143 neutrons. What is the total charge of the nucleus in Coulombs?

Science

A certain isotope has a half-life of 12 hrs. How long will it take for 100 ƒÝgr to decay into only 25 ƒÝgr?

Calculus

The base of a certain solid is the triangle with vertices at (-14,7),(7,7) and the origin. Cross-sections perpendicular to the y-axis are squares. What is the volume of this solid?

physics

An electric field of 210000 N/C points due west at a certain spot. What is the magnitude of the force that acts on a charge of -6.2C at this spot?

physics

The electric potential in a certain region is V = a x2 + b x + c, where a = 14 V/m2, b = −19 V/m, and c = 61 V. Determine the position where the electric field is zero. Answer in units of m Please help!

chemistry

A certain rifle bullet has a mass of 6.45 g. Calculate the de Broglie wavelength of the bullet traveling at 1817 miles per hour.

Math

When it says, "Paulo has a certain amount of money. If he spends six dollars, then he has 1/4 of the original amount left." So would the equation be n-6=1/4?

Chemistry

The speed limit on a certain highway is 72km/h. What is the speed in cm/s? Could you go through each step on how to get the answer? Lots of the questions are like this one, but I don't know how to do them.

physics

A certain car is capable of accelerating at a uniform rate of 0.83 m/s2 . What is the magnitude of the car’s displacement as it accelerates uniformly from a speed of 80 km/h to one of 92 km/h?

physics

A certain car is capable of accelerating at a uniform rate of 0.83 m/s2 . What is the magnitude of the car’s displacement as it accelerates uniformly from a speed of 80 km/h to one of 92 km/h?

maths

If a certain sum doubles itself after 3 yrs kept at simple interest. In how many yrs will it become 5 times of its value?

physics

In a certain right triangle, the two sides that are perpendicular to each other have lengths h = 4.40 m and b = 8.70 m. What is the length of the third side of the triangle?

trig

In a certain right triangle, the two sides that are perpendicular to each other have lengths h = 4.40 m and b = 8.70 m. What is the length of the third side of the triangle?

math algebra

The amount A, of 70 grams of a certain radioactive material remaining after t years can be found by the equation A=70(0.62)^t. When will 10 grams remain?

marian university college

The molar constant-pressure heat capacity of a certain solid at 4.2 K is 0.43 J K−1 mol−1. What is its molar entropy at that temperature?

English

In a certain code TGFYWOAG means SECURITY. In the same code what does GGHHGGJS mean? A) FINANCES B) CARRIAGE C) RETAINER D) FEEDBACK

calculus

The base of a certain solid is the triangle with vertices at (−6,3), (3,3), and the origin. Cross-sections perpendicular to the y-axis are squares. Then the volume of the solid?

math

Is there anywher i can go for further explanations on how to solve for the following statements on how to solve them: Dividing writing each result in simplest form & adding & subtracting I searched Google under the key words "fractions divide add subtract" to get this source: ...

Math

The bar graph shows the cumulative number of death form AIDS in the US, from 1990 through each of the years 1996-2002. The data in the graph can be modeled by the following polynomials, in which f(x) and g(x) represent the cumulative number of AIDS deaths x years after 1990 F(...

chemistry

a.Given the equation: 2CaCO3 + 2SO2 + O2 -> 2CaSO4 + 2CO2 What is the actual yield of CO2 if 7.5 mol of O2 gives a percent yield of 80%? b. The pollutant sulfur dioxide can be removed from the emissions of an industrial plant by the reaction with calcium carbonate and ...

calculus

Evaluate h(x) for the following values of x? Consider the following function. h(x) = (tan(x)-x)/x^3 (a) Evaluate h(x) for the following values of x. (Give your answer correct to six decimal places.) x = a) 1 b) 0.5 c) 0.1 d) 0.05 e) 0.01 f) 0.005 what is f(x) (b) Guess the ...

Algebra

1. Use the Distributive Property to simplify the expression. (-1)(4-c) 2. Use the Distributive Property to simplify the expression. 4(2x -4) 3. Use the Distributive Property to simplify the expression. (10 + 4 y) 1/2 4. To which subsets of real numbers does the number -22 ...

Algebra

1. Use the Distributive Property to simplify the expression. (-1) (4-c) 2. Use the Distributive Property to simplify the expression. 4 (2 x - 4) 3. Use the Distributive Property to simplify the expression (10+4y) 1/2 4. To which subsets of real numbers does the number -22 ...

Chemistry

I need help finding reactions beneficial to society. Here's the assignment quoted. "Your assignment is to research two different chemical reactions that are used to address social/environmental needs or problems. These reactions must clearly be attempting to improve our world...

Chemistry

I need help finding reactions beneficial to society. Here's the assignment quoted. "Your assignment is to research two different chemical reactions that are used to address social/environmental needs or problems. These reactions must clearly be attempting to improve our world...

Chemistry -Dr. Bob

Reacting 1 L of H2(g) with 1 L C2H2(g) (both at STP) results in the formation of 1 L of C2H4(g) if the reaction is maintained at the same conditions (STP) and goes to completion. If this reaction produced 6.3 kJ of heat (absorbed by the surroundings), calculate: a) the PV work...

General Chemistry (Chem101)

A chemist mixes two liquids A and B to form a homogeneous mixture. The densities of the liquids are 2.0514 g/mL for A and 2.6678 g/mL for B. When she drops a small object into the mixture, she finds that the object becomes suspended in the liquid; that is, it neither sinks nor...

Math

1. Find the product in simplest form 2/5 x 3/7 A. 14/15 B. 5/12 C. 6/35 D. 1/5 2. find the product in simplest form 9/10 x 5/7 A. 1 13/50 B. 9/14 C. 14/17 D. 4/7

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100