a certain reaction has the following generaln form

72,094 results, page 82

science HELP ASAP!!!!!!!

1. in which biome would you find the main types of plants life to be grasses and nonwoody plants? (1 point) 2. Which of the following determines the type of biome classification that will be made for a particular region? (1 point) 3. which of the following do rainforest and ...

Finance

Suppose a new company decides to raise a total of $200 million, with $100 million as common equity and $100 million as long-term debt. The debt can be mortgage bonds or debentures, but by an iron-clad provision in its charter, the company can never raise any additional debt ...

physics

1. A force of 720N stretches a certain spring a distance of 15 cm. What is its force constant? If a 60-kg mass is hung on it, how far will it stretch?

Digital Logic

The input voltage to a certain op-amp inverting amplifier is 10 mV, and the output is 2 V. What is the closed-loop voltage gain?

calculus

Show that the curves (y= √2sinx) and (y=√2cosx) intersect at right angles at a certain point with 0<x<π/2

Physics

Light of wavelength 550 nm in air is found to travel at 1.96 x 10^8 m/s in a certain liquid. Determine the index of refraction of the liquid.

English

I'm writing my english on theme for a certain novel. What would be a good topic sentence to start my introduction off with?

Chemistry

A certain radioactive element has a half life of 1 h. If you start with a 1-g sample of the element at noon, how much is left at 3:00 PM? At 6:00PM? At 10:00 PM?

chemistry

10.0 mg of a certain protein were dissolved in water to make a solution of 3.50 mL at 28.0o C. If the osmotic pressure is 1.30 torr, what is the molar mass of the protein?

physics

The motion of a certain simple harmonic oscillator is described by: x(t) = (12 cm) sin [(1 s ^(-1)) t] What is the earliest time t > 0 or t = 0 at which the oscillator's velocity is zero?

Calc

A certain item sells for $30. If the cost of producing this item is given by C = .05s^3 + 100, find the marginal profit when x = 10.

chemistry

When a certain amount of MgF2 is added to water, the freezing point lowers by 3.5 oC. What was the molality of the magnesium fluoride? (Kf for water = 1.86 oC/m)

Chemistry

A student measures k for a certain blue dye to be 19.4 M^-1 at 560 nm. What is the molarity of the dye in a solution with an absorbance of 0.118 at this wavelength?

maths --plse help ..sumebudy help me to solve this

On a certain sum, Compound interest is Rs41 and Simple interest is Rs 40. for 2 years. What is the rate p.a.?

calculus

In a certain city the temperature (in degrees Fahrenheit) t hours after 9am was approximated by the function: T(t)= 70 + 19sin((pi*t)/12). What is the temperature at 3 pm?

physics

1. A force of 720 N stretches a certain spring a distance of 15 cm. What is its force constant? If a 60-kg mass is hang on it, how far will it stretch?

physics

The half-life of a certain radioactive isotope is 32 hours.What fraction of the sample would remain after 16 hours?(a)0.50(b)0.25(c)0.62(d)0.71

Chemistry

Using atomic masses, If a certain batch of D2O has a purity of 99.75 weight %, what is its purity in atom (actually molecule) %

Chemistry

In certain first order reactions the concentration of the reactant decreases from 0.15 M to 0.11 M in 36 minutes . calculate the time of half reactions

physics

In a certain right triangle, the two sides that are perpendicular to each other are 3.80 m and 8.10 m long. What is the length of the third side of the triangle?

physics-lenses

a certain Galilean telescope has a magnification of 2 times. if the focal length of the objective lens is 60 cm, how long is the telescope? thanks :))

chemistry

equilibrium constant = 55.3 @ certain temperature H2 (g) + I2 (g) <=> 2HI (g) (reversible) If you start with 0.195 M hydrogen iodide, what will the concentrations of H2, I2, and HI be at equilibrium?

chemistry

A 4.70 g sample of a certain gas occupies 530. mL at STP. What mass of the same gas is present in a 1.15 L container at 40.5°C and 785 mm Hg?

physics

a certain hamornic motion has amplitude of 0.7m and a period of 1.3s.find(a)the frequency of oscillation(b)the maximum velocity(c)the maximum acceleration

chemistry

if the average speed of a helium atom at a certain temperature is 1130. m/s, what is the speed in miles per hour? (1 mi =1609m)

maths

A sum of mone becomes 8/5 of itself in 5 years at a certain rate of simple intrest.find the rate ofintrest

Strayer

A certain test is worth 125 points. How many points (rounded to the nearest point) are needed to obtain a score of 85%?

calculus

Cost of a Commodity. The price p, in dollars, of a certain commodity and the quantity x sold. Obey the demand equation. p= -1/5x+200

physics

The length of the B string on a certain guitar is 60.0 cm. It vibrates at a fundamental frequency of 246.0 Hz. What is the speed of the transverse waves on the string?

Math

A certain medicine requires 5 mg per 30 kg of weight.  How much medicine is required for a patient that weighs 271 pounds?

science

A certain conductor has a risestnace of 5 ohms at 0oC. if the temperature coeffiecient is 0.002/0oC, find its resistance at 2000oF?

math

A sum of money becomes 85 of itself in 5 years at a certain rate of interest. The rate percent per annum is :

MATHS

The compound interest on a certain sum for 5/2year at 5%per annum compounded annually is rs416.20.find the sum

AP CHEM

Please help me with thses AP CHEM homework problems and show the steps to how to find the solutions: Solid Liquid Titrations: Determine the concentration of the indicated liquid unknown given the mass of a solid standard and the buret data for the titration. #35) What is the ...

Geography

Which of the following most accurately describes the difference between climate and weather? (1 point) Climate refers to long-terms conditions; weather refers to daily conditions. Climate refers to severe weather events; weather refers to precipitation. Climate refers to land ...

math

in what time a certain sum will become 3 1/4 time at 5%?

Algebra 2

I am trying to factor a 4th degree polynomial that does not have any rational roots. I need to somehow get it factored into two quadratics. Anyone know of a method to use. 3x^4 - 8x^3 - 5x^2 + 16x - 5 Two of the irrational roots are 1.135.. and 0.382.. but that won't help you ...

Language

What is the superlative form of "often"? most often ? I'm not 100% sure but if i can remember i believe that the superlative of often is: amoftesten (the o has the two dots on top) because the comparative would be: ofter (with the o having the two dots on top) if you mean in ...

geometry

If two lines are perpendicular, then the two lines form right angles. If lines Imported Asset and Imported Asset are perpendicular, then they form right angles. If two lines are perpendicular, then the two lines form right angles. Therefore, since lines Imported Asset and ...

Business/Finance

Your credit card: a) Is a form of demand deposit b) Is a form of time deposit c) Is an asset d) Has all the functions of money So from my understanding, credit cards are not an asset, since they do not store value, can't be sold or given away. Hence they also do not have all ...

Chemistry

Aspirin, C9H8O4 , is produced through the following reaction of salicylic acid, C7H6O3, and acetic anhydride, C4H6O3: C7H6O3(s) + C4H6O3(l) ---> C9H8O4(s) + HC2H3O2(l) A. What mass of aspirin (kg) could be produced from 75.0 mol of salicylic acid? B. What mass of acetic ...

chemistry

An indicator has the reaction Hln(aq) ↔ H+(aq) + In-(aq). Explain how the indicator can change color when a strong base is poured into a solution of this indicator. Will a strong base dissociate? Which way will this cause the reaction to shift? Is there more or less HIn...

Chemistry

Help needed with a calorimeter lab. I have to measure the enthalpy of a neutralization reaction between NaOH and HCl as well as find the concentration of NaOH the following ways. - using the mass and volume of NaOH - Using calorimetric data assuming no heat lost to calorimeter...

Psychology

Help is needed! Please help! I said the answer is C Social influence ranges in intensity from the gentlest form _______, which involves changing one's behavior just because other people are nearby, to the strongest form _______, which involves changing one's behavior because ...

Chemistry

Which of the following compounds are soluble? Choose at least one answer. a. BaSO4 b. K2SO4 c. KBr d. NaOH e. Al(OH)3 I originally thought it was the last four, but it isn't, or it isn't only/all of them. Aren't all sulfates and potassium soluble? What are the reactant ions in...

LA - 1 question

Read the following stage directions and dialogue from Billy Elliot: [Billy suddenly sees DAD and freezes. His reaction puzzles Mrs. Wilkinson for a second. The music comes to a standstill. Mrs. Wilkinson turns to see Dad.] DAD: You.Out.Now What do these directions and dialogue...

Geometry Help?

Can anyone check my answers? * = My answer 1. Find the length of the missing side. Leave your answer in simplest radical form (1 point) The triangle is not drawn to scale. Sides 4 on the bottom and 3 on the side a. 25 b. 144 c. 5 d. √5* 2. Find the length of the missing ...

writing

Is there someone who could proofread this? Identify the sentence patterns 1. He followed the map to the treasure. S/V/DO 2. Darcy sang the song slowly. S/V/DO 3. They were certain about the time. S/LV/SC 4. I called him a sucker. S/V/DO 5. I found the puppy a home. S/V/DO 6. ...

enviromental

Completely mixed flow ractor CSTR and plug flow reactor (PFR) may have significantly different efficiencies depending on the reaction order. This problem asks you to compare the relative reactor sizes required to ensure 99.0 % removal of wastewatwer pathogens. Wastewater from ...

math

type of cd/dvd- number ---------------------------------------------------------- rock CD 26 ---------------------------------------------------------- pop CD 17 ---------------------------------------------------------- comedy CD 11...

chemistry

Create balanced equation, given the two compounds in aqueous solution may react with one another. State whether or not a chemical reaction occurs. Make sure to include the state of each reactant and product. If a precipitation reaction occurs, provide the ionic and net ionic ...

Chemistry

I was not the person who wrote that question last night? Chemistry - DrBob222, Wednesday, November 15, 2006 at 7:24pm Yes, it is possible in some cases. For example, CoCl2 is blue in the unhydrated form and pink in the hydrated form. As a kid, I used a water color brush to "...

structural formulae

REACTION 1 IS A CARBON COMPOUND CONTAINING AN ALCOHOL FUNCTION GROUP + REACTION 2 IS A CARBON COMPOUND CONTAINING A CARBOXYLIC GROUP. IM TRYING TO UNDERSTAND THE PRODUCT FORMULAE. CAN YOU TELL ME HOW THESE TWO FUNCTION GROUPS REACT, AND THE RELEVANCY OF CH IN THIS EQUATION ...

Physics

Can you please help me with the following questions? please. 1. how much work do you do on a 25-kg backpack when you walk a horizontal distance of 100 m? -I got 2,500 J 4. if you friend pushes a lawnmower four times as far as you do while exerting only half the force, which ...

CHEMISTRY

Hello, I am having trouble balancing this redox reaction WITHOUT using the half-reaction method. I believe this is because not all of the elements are in (aq). BrO3-(aq) + N2H4(g) --> Br-(aq) + N2(g) Br is reduced by a factor of 6. N is oxidized by a factor of 2. I will ...

Chemistry

Yesterday we combined Hydrochloric Acid HCl with Sodium Hydroxide NaOH in a violent reaction that resulted in water H2O and common table salt NaCl. How many grams of hydrochloric acid should we use so we have exactly enough to react with 40g of sodium hydroxide? You'll need to...

Chem Help Please!!!

Experiment Design You are asked to separate a mixture of toluene and cyclohexane. Assume that they do not form an azeotropic mixture. Design an experiment to do this. You must provide the following information. a) A diagram of the equipment you will be. b) What distillate ...

8th CCA Science

1. Under which of the following conditions would a fossil most likely form? A. A living thing dies and sediment is very slowly deposited on top of its body. B. A living thing dies and sediment quickly covers its body.**** C. A living thing dies and its skeleton is left exposed...

Science

Why is it that milk sours so fast. I had googled it and false imformation has came up. I have to write a 3 page essay about how certain things sour too quickly.

Honors Chemistry

Absorbance spectroscopy relies on the fact that specific molecules can only absorb certain wavelengths. Explain how this could be used in a)microwaves and b) astronomical discoveries/interpretations. Thank you for any help with this... :)

statistics

in a certain survey 1,043 adults, 81% reported having more than one television at home. find the actual number of respondents corresponding to the given percentage?

answer

One of the reasons that certain advertisements are successful is because viewers want to behave like those they observe. What is the general term that psychologists use to describe this type of behavior?

Math

In a certain survey of 1034 adults, 89% reported having more than one television at home. Find the actual number of reespondents corresponding to the given percentage

Physical Science

The string of a certain yo-yo is 80 cm long and will break when the force on it is 10 N. What is the highest speed the 200 g yo-yo can have when it is being whirled in a circle? Ignore the gravitational pull of the earth on the yo-yo.

Physical Science

The string of a certain yo-yo is 80 cm long and will break when the force on it is 10 N. What is the highest speed the 200 g yo-yo can have when it is being whirled in a circle? Ignore the gravitational pull of the earth on the yo-yo.

Calculus-help~

A certain fast food restaurant wants to determine the increase in revenue per cheeseburger if sales are $45,000. Let the function [p=(120000-x)/(30000)] represent the price of x cheeseburgers.

physics

Electrons move through a certain electrical circuit at an average speed of 1.7 x 10-2 m/s. How long (in minutes) does it take an electron to traverse a 1.8 -m light bulb filament coil?

Prob&Stat

If 52% of the customers at a certain grocery store regularly use coupons, what is the approximate standard deviation of the sampling distribution of the proportion for samples of size 240? 2.1% 3.2% 4.7% 10.4%

math

on a certain day the propellers complete 20 revolutions per minute and have a speed at of 45 m/s calculate the radius of a propeller to one decimal place using pie as 3.14 ?

criminal justice

In 1970, the District of Columbia passed the first __________ statute which authorized denial of bail to "dangerous" persons charged with certain offenses for up to 60 days.

Social studies Florida

Cross words: question , when one group chooses not to buy a certain product or service usually a tactic to get a benefit previously decided.

MATH

A certain fast food restaurant wants to determine the increase in revenue per cheeseburger if sales are $45,000. Let the function [p=(120000-x)/(30000)] represent the price of x cheeseburgers.

English

Can you check the adjectives in the following sentences, please? I really don’t know if you can use them in English. I wonder if you could possibly help me make a list of clothes which are “fashionable” at the moment in the USA. Thank you very much in advance. 1)I don’...

Chemistry

Currently studying for an lab exam. Just have a few question about a typical Iodine Clock reaction lab. In an typical Iodine Clock reaction lab what would be the state of effect of an increase in the initial concentration of persulfate ion (S2O3 2-) and the increase in the ...

Chem

At 930 K, Kp = 0.30 for the following reaction. 2 SO2(g) + O2(g)=>2 SO3(g) Calculate the equilibrium partial pressures of SO2, O2, and SO3 produced from an initial mixture in which the partial pressures of SO2 and O2 = 0.51 atm and the partial pressure of SO3 = 0 (exactly...

Algebra

a. Suppose that a market research company finds that at a price of p = $31, they would sell x = 74 boxes of product each month. If they lower the price to p = $25, then more people would purchase the product, and they can expect to sell x = 80 boxes in a month’s time. Find ...

maths - a few questions

Simplify 3(x-2)^2/x-2 Is the answer 3x^2-10x+10? If not then what is? When p= sqrt2 and q= sqrt6 write pq in the form a(sqrt)b where a and b are integers and b is as small as possible. Multiply out these brackets. Give your answer in the simplest form. (x+2y)(2x+y) Is the ...

Chemistry

Difference between hydration and hydrogenation reactions? I have searched everywhere in my book and all I can come up with is: Hydorgenation is when atoms of hydrogen H2 are added to the carbons in a double or triple bond of alkenes or alkynes to form what we call alkanes. ...

Ap Chemistry Help

3.) One method used in the eighteen century to generate hydrogen was to pass steam through red-hot steel tubes. The following reaction takes place: 3Fe(s)+4H20(g)--->Fe3O4(s)+4H2(g) 2. What mass of iraon will react with 500.0 L of steam at 25 degrees C and 1.00 atm pressure...

geometry

A circle with center at (2,0) and a radius of 4 is intersected by a line whose slope is 1 and whose y intercept is 2. Write the equation of the line and write the equation of the circle in standard form. i know that the center-radius form is (x-2)^2 + (y-0)^2=16

Chemistry

Use the Bronsted-Lowry definitions to identify the two conjugate acid-base pairs in the following acid-base reaction: HCO3^- + S^2- <-> HS^- + CO3^2- I got it. HCO3^- is the base in the pair with CO3^2-. S^2- is the acid in the pair with HS^-. Would you believe you have ...

health

How dose lock-and-key mechanism relate to hormones? A. If a hormone fits the receptor site, then there is no reaction. If a hormone and a receptor site do not match, then there will be an effect. B. If a hormone fits the receptor site, then there will be an effect. If a ...

Math for Steve

1. Write the ratio in the simplest form. 45 : 15 a. 9 : 3 b. 3 : 1 c. 1 : 3 d. 4 : 1 4. Jake sold 39 tickets to the school fair, and Jeanne sold 12 tickets. What is the ratio, in simplest form, of the number of tickets Jeanne sold to the number of tickets Jake sold? 5. In 10 ...

science

1. All of the following are parts of the retina except A. rods. C. fovea. B. cones. D. lens. 2. Which of the following are tests of the eye? A. Cephalgia, chondrodynia, sternotomy B. Myelography, photon absorptiometry, thermography C. Rheumatoid arthritis, muscular dystrophy, ...

chemistry

An indicator has the reaction Hln(aq) ¡ê H+(aq) + In-(aq). Explain how the indicator can change color when a strong base is poured into a solution of this indicator. Will a strong base dissociate? Which way will this cause the reaction to shift? Is there more or less HIn? Do...

science ap chemistry

What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D. [CH3COO-][H3O+]/[CH3COOH]

biochemistry

The enzyme alcohol dehydrogenase catalyzes the following reaction: Ethanol + NAD+  acetaldehyde + NADH + H+ You have a 1 ml solution containing 100 µM Ethanol, and 1 mM NAD+. You then add 1 mg of alcohol dehydrogenase. Assume all of the ethanol gets converted to ...

CHEMISTRY

i need help with this pre lab question:| plse help me! teh following data were obained for the reaction 2ClO2(aq)+ 2OH^-(aq) -> ClO3^-(aq) + ClO2^-(aq) +H2O (l) Where rate = delta[ClO2]/ delta t (mol/L) (mol/L) (mol/L*s) [ClO2]0 [OH-]0 Initial rate 0.0500 0.100 5.75*10^-2 0...

chemistry

Which of the following combinations of atomic orbitals can combine to form sigma bonds? s-ss-pp-phybrid orbital - hybrid orbitalhybrid orbital - shybrid orbital - p What is the bond angle (in degrees) resulting from sp hybridization? What is the bond angle (in degrees) ...

chemistry

The reaction between sodium hydroxide and hydrobromic acid is represented in the equation below: OH- + H+ -> H2O A 62.5 mL sample of 1.86 M NaOH at 22.5 deg Celsius was mixed with 62.5 mL sample of 1.86 M of HBr at 22.5 deg Celsius in a coffee cup calorimeter. The ...

Math

A piece of wire is bent to form a square of area 121cm. Calculate: a)the length of each side of the square. b)the perimeter of the square. The piece of wire is now bent to form a circle using π=3.14 Calculate: a)the radius of the circle b)the area of the circle

Chem

Which of the following compounds are soluble? Choose at least one answer. a. BaSO4 b. K2SO4 c. KBr d. NaOH e. Al(OH)3 I originally thought it was the last four, but it isn't, or it isn't only/all of them. Aren't all sulfates and potassium soluble? What are the reactant ions in...

math

Is there anywher i can go for further explanations on how to solve for the following statements on how to solve them: Dividing writing each result in simplest form & adding & subtracting I searched Google under the key words "fractions divide add subtract" to get this source: ...

Math

The bar graph shows the cumulative number of death form AIDS in the US, from 1990 through each of the years 1996-2002. The data in the graph can be modeled by the following polynomials, in which f(x) and g(x) represent the cumulative number of AIDS deaths x years after 1990 F(...

chem

The atmospheric pressure at the summit of Mt. McKinley is 554 mm Hg on a certain day. What is the pressure in atmospheres and in kilopascals? What are the conversions or formulas for this problem??

financial

Two things that are certain in life are death and taxes; we often hear. Do you think it is justified for governments to levy taxes? Why or why not?

Finance

Two things are certain life and death and taxes we often hear. Do you think it is justfied for government to levy taxes why or why not.

Physics

A certain freely failing object requires 1.70 s to travel the last 20.5 m before it hits the ground. From what height above the ground did it fall?

Physics

A certain capacitor stores 360 J of energy when it holds 9.1 10-2 C of charge. (a) What is the capacitance of this capacitor? µC (b) What is the potential difference across the plates? V

3rd grade science

All living things respond in certain ways to ______ in their environment. A.. Changes B.. Respond C.. React

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100