a certain reaction has the following generaln form

73,377 results, page 22


Sulfur trioxide gas, one of the causes of acid rain, is produced in the upper atmosphere when oxygen reacts with sulfur dioxide gas in the reaction shown below: 2SO2(g) + O2(g) <--> 2SO3(g) deltaH0 = -197kJ The gases are placed in a reaction vessel and allowed to come to...


Magnesium reacts with HCl(aq) to form MgCl2 and H2(g) ____ Mg(s) + ____ HCl(aq) -----> ____ MgCl2(aq) + ____ H2(g) The following data was collected for the above reaction: Mg (g) 5% (m/v) HCl (ml) H2 gas produced (ml) 0.50 10 167 0.50 20 333 0.50 30 500 0.50 40 500 0.50 50 ...


A proposed mechanism for a reaction is: (i) A + B2 = AB2 Ea1 = 12 kJ/mol ƒ´H1 = 3 kJ/mol (ii) AB2 + C2 = ABC + BC Ea2 = 30 kJ/mol ƒ´H2 = 5.2 kJ/mol (iii) ABC + B2 = AB2 + BC Ea3 = 10 kJ/mol ƒ´H3 = -7.8 kJ/mol a) Which is the rate determining step? Explain why. (2 marks) ...


Consider the hypothetical reaction between A2 and AB pictured below. (picture of eight AB molecules and four A2 molecules in one box -> eight molecules of A2B molecules in another box) What is the balanced equation? If 2.50 mol A2 is reacted with excess AB, what amount (...


Which of the following is a measure of an obtuse angle? A. 40 degrees B. 100 degrees C. 90 degrees*** D. 180 degrees I am most certain it is C?


Methanol, CH3OH, is produced on an industrial scale from carbon monoxide and hydrogen. At the temperatures used, gaseous methanol is formed according to the following thermochemical equation: CO(g)+ 2H2(g) <---> CH3OH(g) £H = -90Kj 1. State Le Chateliers principle and...


In the reaction of hydrogen peroxide with iron (II) ion in acidic solution to form iron (III) ion and water, the oxidizing agent is... ? Fe(II) ==> Fe(III) H2O2 ==> H2O. Fe goes from +2 to +3, that is a loss of electrons, so it is oxidized (by definition, oxidation is ...


Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the production of one mole...


Sodium azide (NaN3) yields N2 gas when heated to 300 degrees Celsius , a reaction used in automobile airbags. If 1.00 mol of N2 has a volume of 47.0 liters under the reaction conditions , how many liters of gas can be formed by heating 35g of NaN3? The reaction is 2Nan3------&...


When 0.13 g of H2 and 0.18 g of I2 are confined to a 150. mL reaction vessel and heated to 700. K, they react by a second-order process (first order in each reactant), with k = 0.063 L·mol-1s-1 in the rate law (for the rate of formation of HI). (a) What is the initial ...


The educator's expense deduction is taken: A. on Form 2106. B. on Schedule C. C. above the line on the Form 1040. D. on the educator's expense form. it it C


Fraction form 1/3 if changed Decimal form it is 1/3=0.331/3 if changed to Percent form it is 1/3=331/3% Is this correct? I just want make sure.


An investigation was conducted to study the effect of the concentration of a reactant on the (trial) time need to complete a chemical reaction. Four trials of the same reaction were performed.In each trial the initial concertration of the reactant was different. The time ...


Please help with the following questions: 1. write 12 million in scientific notation 2. Write 17,600 in scientific notation 3. write 1.2 * 10 to the fourth power in standard form 4. write 5 * 10 to the sixth power in standard form


As an environmental chemist, you want to find the Kc for the following reaction: 2 NO2 (g) ⇌ N2 (g) + O2 (g) Kc = ? Use the following data to find the unknown Kc : ½ N2(g) + ½ O2(g) ⇌ NO (g) Kc = 4.8 x 10-10 2 NO2(g) ⇌ 2 NO (g) + O2 (g) Kc = 1.1 x 10-5


1. The bombardier beetle uses an explosive discharge as a defensive measure. The chemical reaction involved is the oxidation of hydroquinone by hydrogen peroxide to produce quinine and water: C6H4(OH)2 (aq) + H2O2 (aq) �� C6H4O2 (aq) + 2 H2O (l) ...

Chemistry :(

Question text Given the following exothermic, equilibrium reaction: 3 H2(g) + N2(g) <--> 2NH3(g) Using Le Chatelier's Principle, which of the following changes would shift the equilibrium toward more production of NH3? Select one: a. Adding a catalyst b. Adding heat c. ...


I don't understand this zwitterion form . Here is the question. write the zwitterion form of the amino acid cysteins shown in the follwing figure. If the pI for cysteine is 5.1 at what pH will the zwitterions be the predominant form? Can you please show me step by step on how ...


3. When a mixture of 10.0 grams of acetylene (C2H2) and 10.0 grams of oxygen (O2) is ignited, the resulting combustion reaction produces CO2 and H2O. A) Write a balanced equation for this reaction. B) What is the limiting reactant? C) How many grams of C2, H2, O2, CO2, and H2O...


write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...


25cm^3 of a gas containing only nitrogen and oxygen decomposed to form 25cm^3 of nitrogen and 50cm^3 of oxygen. All the volumes were measured at the same temperature and pressure. Write an equation for the reaction.


ogen and oxygen react to form nitrous oxide as: 2 N2 (g) + O2 (g) ⇌ 2 N2O (g) Of a mixture of 0.482 mol N2 and 0.933 mol O2 is placed in a reaction vessel of 10.0 L and allowed to from N2O at a temperature for which Kc = 2.0 X 10-37, what will be the composition of the ...


Substance A and substance B react to form substance C as described by the equation: A + B ↔ C If only substance A and substance B are placed in an enclosed vessel and allowed to react what would the reaction be?

ET1210-Dc/Ac Circuits

if a certain number of equal resistors are wired in series across a certain voltage source, determine how much voltage is across each resistors.

Algebra Answer Check

What is the algebraic expression for the following word phrase: the quotient of 6 and the sum of 5 and y? 6 a. ----- 5-y 6 b. ----- (?) 5+y c. 6(5+y) d. 6/5 + 6y What is the algebraic expression for the following word phrase: the quotient of j and 8? a. j-8 b. j+8 c. j...


A mixture of hydrogen peroxide, H2O2, and hydrazine, N2H4, can be used as a rocket propellant. The reaction is: 7 H2O2(g) + N2H4(l) ® 2 HNO3(aq) + 8 H2O(l) a) How many moles of H2O2 react with 0.477 mol N2H4? [1] ___________ b) How many grams of HNO3 can be produced in a ...


K=1.6x10^-5 mol/L for the following reaction 2NOCl(g).... 2 NO(g) + Cl2(g) Calculate the concentrations of all species at equilibrium for each of the following original mixtures E) 2.4 mol of NOCl, 2.4 mol of NO, and 1.2 mol Cl2 in a 1.0 L flask F)1.9 mol/L concentration of ...


3. An electrochemical reaction occurs between an unknown element and zinc. The half-cell reaction for the zinc is: Zn(s) → Zn2+(aq) + 2e− The cell potential for the reaction is Eºcell = 1.83 V. a. Is the reaction spontaneous or nonspontaneous? Explain. (1 point) b...


Nitrogen and oxygen can react directly with one anotheer to produce nitrogen dioxide according to N2(g) + 2O2(g) --> 2NO2(g) The reaction may also be imagined to take place by first producing nitrogen oxide N2(g) + O2(g) --> 2NO(g) which then produces NO2 2NO(g) + O2(g...


Suppose that the certain lifetimes of a certain light bulb are normally distributed with μ=1500 hours and σ=200. Find the probability that a light bulb will burn out in less than 1200 hours.


30. Enzymes function most efficiently at the temperature of a typical cell, which is 37 degrees Celsius. Increases or decreases in temperature can significantly lower the reaction rate. What does this suggest about the importance of temperature-regulating mechanisms in ...


Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in the following electron transfer reaction. 2Fe3+ + Sn2Fe2+ + Sn2+ species oxidized species reduced oxidizing agent reducing agent As the reaction proceeds, electrons are ...


an ezyme -catalysed reaction was carried out in a solution buffered with 0.05 M phosphate ph 7.2 . As a result of the reaction ,0.06M of acid was formed. (phosphoric acid has three pka values. The one required for this calculation is pka2=7.2). 1) what was the pH at the end of...


For the reaction shown, calculate how many grams of oxygen form when each quantity of reactant completely reacts. 2HgO(s)¨2Hg(l)+O 2 (g) 2\;{\rm{HgO}}\left( s \right)\; \rightarrow \;2\;{\rm{Hg}}\left( l \right) + {\rm{O}}_2 \left(1.40 kgHgO g \right)


A student titrated 1.852 g of a mixture containing potassium hydrogen phthalate, KHP....? A student titrated 1.852 g of a mixture containing potassium hydrogen phthalate, KHP, with 0.163 M NaOH solution. She recorded an initial buret reading of 0.84 mL and a final buret ...

AP Chemistry

Calculate ΔHrxn for the following reaction: C(s)+H2O(g)→CO(g)+H2(g) Use the following reactions and given ΔH values: C(s)+O2(g)→CO2(g), ΔH= -393.5 kJ 2CO(g)+O2(g)→2CO2(g), ΔH= -566.0 kJ 2H2(g)+O2(g)→2H2O(g), ΔH= -483.6 kJ


6. Which of the following is not a processing control? A) Record counts B) Control totals C) Hash totals D) Check digits I think it should be C but am not certain. Can anyone assist?


Design an electrochemical cell using Pb(s) and Mn(s) and their solutions to answer the following questions. I just want to see if my answers are correct. I drew the cell already. Thanks 1. Give the line notation for this electrochemical cell. Mn(s) ∣ Mn2+(aq) ∥ Pb2...


two stones are dropped simultaneously into a calm pool of water. The crests of the resulting waves form equally spaced concentric cicles, as shown in the figures. The waves interact with each other to create certain interference patterns. explain why the red dots lie on an ...


Equilibrium is established in a reversible reaction when: A)the [product] = [reactants] B)rate of reaction of products = rate of reaction of reactants C)all the reactants dissolve or dissociate D)products are no longer produced


if you could just help me set them up the would do me some good. Thanx A. In the single reaction of chlorine and potassium bromide, how many grams of potassium chloride can be produced from 200.g each of chlorine and potassium bromide? Identify the limiting reactants. B. In ...


WO3 (s) + 3 H2 (g) -> W (s) + 3 H20 (g) Tungsten is obtained commercially by the reduction of WO3 with hydrogen according to the equation above. The following data related to this reaction are available. DeltaH(kilojoules/mole) for WO3 is -839.5. DeltaH for H20(g) is -241.6...


2. What is the reduction half-reaction for the following unbalanced redox equation? Cr2O72– + NH4+ Cr2O3 + N2 A.) Cr2O3 -> Cr2O7^2– *B.) Cr2O72– -> Cr2O3 C.) NH4+ -> N2 D.) N2 -> NH4+ 3. Which oxidation-reduction reactions are best balanced by the half-...


2. What is the reduction half-reaction for the following unbalanced redox equation? Cr2O72– + NH4+ Cr2O3 + N2 A.) Cr2O3 -> Cr2O7^2– *B.) Cr2O72– -> Cr2O3 C.) NH4+ -> N2 D.) N2 -> NH4+ 3. Which oxidation-reduction reactions are best balanced by the half-...


write the following reversible statement as a biconditional: If two perpendicular lines intersect, they form four 90 degree angles. -Two intersecting lines are perpendicular if and only if they form four angles. -Two intersecting, perpendicular lines do not form four angles. -...


Use the point-slope form linear equation given to complete the following problems. y-3=3(x+1) 1. What is the slope of the given line? Here's what I did: y-3=3(x+1) y-3+3=3x+3 y=3x+6 m=3 Correct so far? 2. What point does this line pass through, which is the basis of this ...


When an aqueous solution of lithium chloride is mixed with an aqueous solution of ammonium sulfate ______. A. a precipitate form B. a new salf is formed C. a gas is evolved D. an acid and base are formed E. no reaction occurs


*What are the products after a single replacement rxn? *Determine the spectator ion(s) and the net ionic equation. F2(g) + AlBr3(aq)--->? After single replacement....Br2 is a liquid, not a solid so ppt will not form..hence, there is no reaction?

conditional sentence

1. If the sound system hadn't failed, last night's show would have been better. a. this is a correct sentence using the 2nd conditional form b. this is a sentence using the 3rd conditional form Answer a. 3. if the club's manager agrees, they'll play a few more original songs ...


Using the activity series, write a balanced chemical equation for the following reactions: 1. iron metal is added to a solution of copper (II) nitrate 2. zinc metal is added to a solution of magnesium sulfate 3. hydrobromic acid is added to tin metal 4. hydrogen gas is bubbled...


At 1200 K, the approximate temperature of vehicle exhaust gases, Kp for the reaction <- 2CO2(g) -> 2CO(g) + O2(g) is about 1*10E-13. Assuming that the exhaust gas (total pressure 1 bar) contains 0.2% CO, 12% CO2 and 3% O2 by volume, is the system at equilibrium with ...


At 1200 K, the approximate temperature of vehicle exhaust gases, Kp for the reaction 2CO2(g)⇄2CO(g) + O2(g) is about 1*E-13. Assuming that the exhaust gas (total pressure 1 bar) contains 0.2% CO, 12% CO2 and 3% O2 by volume, is the system at equilibrium with respect to ...


I want to know what are the Ils/Elles form for the following verb. S'appeler Avoir Adorer Vouloir


Write a proportion that is a different form of the following but will still yield the same solution: 3/4 = x/2


Write the following equation in standard form and identify the type of conic: 9y^2 - 4x^2 + 8x + 18y + 41 = 0

Algebra one :)

How do I write these following equations into standard form? Which I know is AX+BY=C 1) 5y-6=2x+3 Do I subtract? What do I do? could someone help me? Thanks!!


Rewrite the following in simplified radical form. (sqrt24w^8) I got 4w^2sqrt6w is that right?


find the slope-intercept form of the straight lines,given by the following equations: (a) -4x + 2y =4 (b) 2x = 1-4y


How many moles of O are needed to combine with 0.223 mole of C to form the following compounds? CO CO2


Express each of the following in the form Rsin(x+a), where r>0 and 0< a <2pi (a) 5cosx + 12sinx (b) 12cosx + 5sinx


can you put the following nmbers in order form least to greatest? 17.11; 17.107; 17; 17.001


If A =4 B=8, calculate the following (show your answer either as a fraction (lowest) or in decimal form): a) A+B ---- A


If A =4 B=8, calculate the following (show your answer either as a fraction (lowest) or in decimal form): (A+B)² ------- A


If A=4 and B=8, calculate the following (show your answer either as a fraction (lowest) or in decimal form A² + B² -------- A²


Without adding ,write the following in standard form 70+400+2+3000+80000=


Which of the following elements is not likely to form bonds? gold oxygen neon mercury


find a polynomial f(x) of degree 4 that has the following zeros: 0,7,-4,5 Leave your answer in factored form


Solve the following system of equations. Then, write the final answer in (x, y, z) form. -12x+y-x=-20 -2x-4y+2z=10 x+2y+2z=25


write the following equation in slope intercept form 3x+4y=12 Could someone explain how to do this problem?


Write the equation in standard form, given the following information. vertex(-2,4), directrix y=1


What is the equation, in standard form, of a parabola that contains the following points? (-2,-20),(0,-4),(4,-20) 1- y=-2.5x^2+5x 2-y=-x^2+4x-4 3- y=-2x^2+4x-4 4-y=-2.25xx^2+4.5x-2 My answer is 3


when x gram of carbon is completely burnt in certain amount of oxygen y gram of carbondioxide is form.what mass of Co2 will be produced when 2x gram of carbon is burnt in z gram of oxygen. which law of chemistry will help me to find the answer


A 1.0 mL volume of 0.010 M H2SO4 is added to a mixture of 6 drops of 0.010 M HIO3, 14 drops of deionized water, and 1 drop of starch solution. A color change in the reaction mixture occurred after 56 seconds. a. Assuming 20 drops per milliliter for all solutions, determine the...

chemistry 101

Consider the following reaction. CaO (s) + CO2 (g) = CaCO3 (s) A chemist allows 14.4 g of CaO and 13.8 g of CO2 to react. When the reaction is finished, the chemist collects 19.4 g of CaCO3. Determine the limiting reactant, theoretical yield, and percent yield for the reactio ...


Balance the following oxidation-reduction reaction in acid solution: SO32- + MnO4- --> SO42- + Mn2+ + H2O


Write a reaction showing what happens to the following in water and identify te conjugate pairs. C6H5NH3 CO3_-2 HCOOh


The following reaction consumes 2.15 kg of Co(g): Co(g) + H2O(g) --> CO2(g) + H2(g) How many total liters of gas are formed if the products are collected at STP?


The following reaction consumes 2.15 kg of CO(g): CO(g) + H2O(g) --> CO2(g) + H2(g) How many total liters of gas are formed if the products are collected at STP?


Hydrofluoric acid etches glass by reacting with the silica in it according to the following equation. H° = 54.5 kJ and S° = 436.5 J/K Calculate G° at 25°C for this reaction.


Which of the following is true for the gas phase reaction shown below? 4NH3(g) + 5O2(g) ¨ 4NO(g) + 6H2O(g), ƒ¢H = -0.905 kJ


In the following reaction, it 13g of sodium are reacted how many grams of copper(solid) can be obtained? 2Na(s)+ Cu(NO3) 2 - - > 2NaNO3 + Cu(s)


What is the concentration of the Mg2 ion in solution when [CO3-2] = 0.25M given that the Ksp= 6.82 x 10-6 for the following reaction MgCO3-------->Mg +. CO32-


How much heat is associated with the burning of 2.27 g of methane in the following unbalanced reaction: CH4(g) + O2(g) →CO2(g) + H2O(g)?


given the following data: S(s)+3/2 O2(g)->SO3(g) H=-395.2 kj 2SO2(g)+ O2(g)->2SO3(g) H=-198.2kj calculate H for the reaction S(s)+ O2(g)->SO2(g)


Balance the following redox reactions in acidic solution by the half-reaction method Br–(aq) + I–(aq) + HClO(aq) = Br2(l) + IO3 + Cl–(aq)


Balance the following equation for a half reaction that occurs in acidic solution. Use e– as the symbol for an electron. Mo^3+ -> MoO2^2+


For the following reaction in acidic solution. Cr2O7^2- + I- ---> Cr^3+ + IO3- Give the total balanced net ionic equation.


For the following chemical reaction write the net ionic equation, including the phases. 2HBr (aq) +Ba(OH)2(aq) --> 2H2O(l) +BaBr2 (aq)


Write the total and net ionic equations for the following molecular reaction: HgNO3 (aq) + NaCl (aq) -> HgCl (s) + 2 NaNO3 (aq)


Based on the oxidation numbers which compound is the oxidizing agent in the following reaction? 8Al + 3KClO4 ¨ 4Al2O3 + 3KCl


Which atom has a change in oxidation number of –3 in the following redox reaction? K2Cr2O7 + H2O + S - - > KOH + Cr2O3 + SO2 K Cr*** O S


What is the ∆G for the following reaction between O3 and O2? 3O2(g) 2O3(g) Given: O3: ∆H = 285.4 kJ ∆S = -137.14 J/K) 109.5 kJ 208.3 kJ 300.2 kJ 326.3 kJ


the absolute value of a certain integer is greater than 3 and less than 6. which of the following could not be 2 less than the integer? A)-7 B)-6 C) 2 D) 3 E) 4


Ethylamine, CH3CH2NH2, is an organic base with pKb = 3.367 at 298 K. In an experiment, a 40.0 mL sample of 0.105 mol L-1 CH3CH2NH2 (aq) is titrated with 0.150 mol L-1 HI(aq) solution at 298 K. (a) Write a balanced chemical equation for the neutralization reaction upon which ...


Ethylamine, CH3CH2NH2, is an organic base with pKb = 3.367 at 298 K. In an experiment, a 40.0 mL sample of 0.105 mol L-1 CH3CH2NH2 (aq) is titrated with 0.150 mol L-1 HI(aq) solution at 298 K. (a) Write a balanced chemical equation for the neutralization reaction upon which ...


Ethylamine, CH3CH2NH2, is an organic base with pKb = 3.367 at 298 K. In an experiment, a 40.0 mL sample of 0.105 mol L-1 CH3CH2NH2 (aq) is titrated with 0.150 mol L-1 HI(aq) solution at 298 K. (a) Write a balanced chemical equation for the neutralization reaction upon which ...


Ethylamine, CH3CH2NH2, is an organic base with pKb = 3.367 at 298 K. In an experiment, a 40.0 mL sample of 0.105 mol L-1 CH3CH2NH2 (aq) is titrated with 0.150 mol L-1 HI(aq) solution at 298 K. (1a) Write a balanced chemical equation for the neutralization reaction upon which ...


Ethylamine, CH3CH2NH2, is an organic base with pKb = 3.367 at 298 K. In an experiment, a 40.0 mL sample of 0.105 mol L-1 CH3CH2NH2 (aq) is titrated with 0.150 mol L-1 HI(aq) solution at 298 K. (1a) Write a balanced chemical equation for the neutralization reaction upon which ...


3) The following set of data was obtained by the method of initial rates for the reaction: 2 HgCl2(aq) + C2O42-(aq) 􀀏 2 Cl-(aq) + 2 CO2(g) + Hg2Cl2(s) What is the rate law for the reaction? [HgCl2], M [C2O42-], M Rate, M/s 0.10 0.10 1.3 × 10-7 0.10 0.20 5.2 × 10-7 0...

Chemistry+balancing equation tips

We are on combustion reaction at the moment in chemistry, and I have to say, these reactions are like extremely hard to balance(well, just alot of erasing). It takes me a while to balance combustion reactions and I want to know if theres any tips in balancing them? Should I ...


  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100