a certain reaction has the following generaln form

74,738 results, page 22

  1. organic chemistry

    A methyl ether (SN2 product) can form as a byproduct in the sodium methoxide reaction. What is its structure? Provide the mechanism for the formation of the methyl ether product, in addition to answering the question.
  2. chemistry

    (AAAAA)The standard reduction potentials of lithium metal and chlorine gas are as follows: (for Li, reduction potential is -3.04, for Cl it is 1.36) In a galvanic cell, the two half-reactions combine to 2Li{+](s) + Cl{-}2(g) --> 2Li{+}Cl{-}(aq) Calculate the cell potential ...
  3. Chemistry

    Implants carbon dioxide combined with water and energy to form glucose and oxygen gas. Right off the balance equation for this reaction. Glucose =C6H12O6. Given 78g of water. How many grams of glucose can be formed?
  4. Math

    Determine whether each event is impossible, unlikely, as likely as not, likely or certain. Then tell whether the probability is 0, close to 0, 1/2, close to 1, or 1. Spinning a spinner that has 5 equal sections marked 1 through 5 and landing on an even number. I am a bit ...
  5. Chemistry

    2. Solid ammonium iodide decomposes to yield ammonia gas(NH3) and hydrogen iodide gas at 400oF. The equilibrium constant for this reaction is 0.215. Ten grams of ammonium iodide are sealed in a 10.0 L flask at equilibrium. Complete the following: a. Write a balanced reaction b...
  6. Gen Chem

    What is n, the number of moles of electrons transferred, in the following reaction? 2 MnO4-(aq) + 16 H+(aq) + 10 Cl-(aq) ===> 2 Mn2+(aq) + 5 Cl2(g) + 8 H2O(l).
  7. Chemistry

    Predict the product(s) and write a balanced equation for the following redox reaction: pentane (C5H12) + oxygen ---->
  8. chemistry

    consider the following reaction: Mg(s)+ 2HCl(aq) --> MgCl2 (aq)+H2 (g) What minimum amount of 1.75 M HCl is necessary to produce 27.5 L of H2 at STP?
  9. CHEMISTRYYY

    consider the following reaction: Mg(s)+ 2HCl(aq) --> MgCl2 (aq)+H2 (g) What minimum amount of 1.75 M HCl is necessary to produce 27.5 L of H2 at STP?
  10. chemistry

    Na3PO4(aq) + AlCl3(aq) produces? Complete and balance each of the following equations. If no reaction occurs, write NOREACTION.
  11. Chem 11

    How many grams of O2 are required to produce 255grams of SO2 in following reaction? 4FeS2+11O2===> 2Fe2O3+8SO2
  12. PHYSICS

    What is the reaction effect of the following action effects? a) Earth orbits the sun b) Ball accelerates downward Thank YOu.
  13. PHYSICS

    What is the reaction effect of the following action effects? a) Earth orbits the sun b) Ball accelerates downward Thank YOu.
  14. chemistry

    How many moles of oxygen can be obtained by the decomposition of 7.5 mol of reactant in the following reaction? 2KClO3 -> 2KCl + 3O2
  15. Chemistry

    Use the data in Table 15.3 to calculate the equilibrium constant for the following reaction: HCOOH(aq) + OH(aq) <-->HCOO(aq) + H2O(l)
  16. Chemistry

    2C2H6 +7O2 --> 4CO2 + 6H2O If 6 moles of O2 are used in the following reaction, how many grams of CO2 will be produced?
  17. physics

    Determine the stopping distances for a car with an initial speed of 93 km/h and human reaction time of 3.0 s for the following accelerations: -4.00 m/s^2 -8.00 m/s^2
  18. chemistry

    what is the coefficients on Oxygen in the balanced equation for the following hydrocarbon combusion reaction C7H14 + O2 = CO2 + H2O
  19. Chemistry

    At 319K the decomposition of dinitrogen tetroxide occurs with the following Kp: 2NO2(g)<>2NO(g)+O2(g) Kp=.700 What is the value of Kc for this reaction?
  20. Chemistry

    When the equation for the following reaction in basic solution is balance, what is the sum of the coefficients? MnO2 + HO2^1-.....>MnO4^1- A=11 B=31 C=14 D=9
  21. Chemistry

    Complete the following chemical reaction. Label any precipitate that forms. KCl(aq) + AgNO3 (aq) ¨KNO3 (aq)+AgCl(s)
  22. Chemistry

    Calclte the number of moles of ethane needed to produce 10.0 grams of water according to the following reaction.
  23. Chemistry

    Complete and Balance the following equation using the half-reaction method; (MnO4^-) + (CH3OH) --> (Mn^2+) + (HCO2H)
  24. Chemistry

    Complete and Balance the following equation using the half-reaction method; (MnO4^-) + (CH3OH) --> (Mn^2+) + (HCO2H)
  25. Chemistry

    In the following unbalanced reaction, which atom is oxidized? HNO3 + HBr -> NO + Br2 + H2O Is the answer bromine?
  26. chemistry

    5. Identify whether the following reaction is an oxidation or a reduction. a. Ni2+ + 2e- ¨ Ni b. 2Br- ¨ Br2 + 2e- c. O2 + 4e- ¨ 2O2- d. Zn ¨ 2e- + Zn2+ e. H2 ¨ 2H+ + 2e-
  27. chem

    How many grams of NH3 are required to make 52.7g H2O in the following reaction : 4NH3+6NO->5N2+6H2O
  28. Chemistry

    For the following reaction, identify the substance oxidized, reduced and the oxidizing and reducing agents. 2SO2 + O2 ----> 2SO3
  29. chemistry

    For the following reaction, identify the substances oxidized, reduced and the oxidizing and reducing agents? 2SO2 + O2 --> 2SO3
  30. chemistry

    For the following reaction, identify the substances oxidized, reduced and the oxidizing and reducing agents? 2SO2 + O2 --> 2SO3
  31. chemistry

    What volume of chlorine gas at 42.0 oC and 1.30 atm is required to react completely with 34.2 g of phosphorus (P4) according to the following reaction?
  32. Chemistry

    Identify the Bronsted-Lowry acid in the following reaction. H2O (l) + HCO31- (aq) → H3O+ (aq) + CO32- (aq)
  33. Science

    Given the following balanced equation, determine the rate of reaction with respect to [O2]. 2 SO2(g) + O2(g) → 2 SO3(g)
  34. Chemistry 1002

    Calculate the standard entropy change for the following reaction at 25 °C. 2 Al (s) + 3 ZnO (s) --> Al2O3 (s) + Zn (s) answer is in J/K mol
  35. AP Chemistry

    For each of the following pairs of half-cells, determine the overall electrochemical reaction that proceeds spontaneously. Na+ | Na, Ni2+ | Ni
  36. Chemistry

    All the following are necessary parts of a neutralization reaction except A) an acid B) an indicator C) water D) a salt.
  37. Chemistry

    Complete and balance the following equation. If no reaction occurs, write noreaction . NaOH(aq)+FeBr3(aq)→
  38. physics hw

    Determine the stopping distances for a car with an initial speed of 87 km/h and human reaction time of 2.0 s for the following accelerations. (a) a = -4.0 m/s2 (b) a = -8.0 m/s2
  39. Chemistry please help!

    Calculate (triangle)H for the following gas-phase reaction: 2 H-C (3dashes) C-H + 5 O=O --> 4 O=C=O = 2 H-O-H -Using bond energies
  40. chemiste-ry

    Consider the following equation: CO + 2 H 2 → CH 3 OH △H rxn = -128 kJ Calculate the amount of heat (in kJ) associated with complete reaction of 8.08 g H 2 .
  41. Chem 1

    Use oxidation states to identify the element that is being oxidized in the following redox reaction: Cu(s)+2 H 2 S O 4 (aq) → CuS O 4 (aq)+S O 2 (g)+2 H 2 O(l)
  42. Chemistry

    Write an equilibrium reaction equation for each of the following buffer mixtures: a)NH3(aq) and NH4Cl(aq) b)HC7H5O2(aq) and NaC7H5O2(aq)
  43. Chemistry

    A proposed mechanism for a reaction is: (i) A + B2 = AB2 Ea1 = 12 kJ/mol ƒ´H1 = 3 kJ/mol (ii) AB2 + C2 = ABC + BC Ea2 = 30 kJ/mol ƒ´H2 = 5.2 kJ/mol (iii) ABC + B2 = AB2 + BC Ea3 = 10 kJ/mol ƒ´H3 = -7.8 kJ/mol a) Which is the rate determining step? Explain why. (2 marks) ...
  44. Chemistry

    Consider the hypothetical reaction between A2 and AB pictured below. (picture of eight AB molecules and four A2 molecules in one box -> eight molecules of A2B molecules in another box) What is the balanced equation? If 2.50 mol A2 is reacted with excess AB, what amount (...
  45. Chemistry

    Sulfur trioxide gas, one of the causes of acid rain, is produced in the upper atmosphere when oxygen reacts with sulfur dioxide gas in the reaction shown below: 2SO2(g) + O2(g) <--> 2SO3(g) deltaH0 = -197kJ The gases are placed in a reaction vessel and allowed to come to...
  46. chemistry

    Magnesium reacts with HCl(aq) to form MgCl2 and H2(g) ____ Mg(s) + ____ HCl(aq) -----> ____ MgCl2(aq) + ____ H2(g) The following data was collected for the above reaction: Mg (g) 5% (m/v) HCl (ml) H2 gas produced (ml) 0.50 10 167 0.50 20 333 0.50 30 500 0.50 40 500 0.50 50 ...
  47. oxidation

    In the reaction of hydrogen peroxide with iron (II) ion in acidic solution to form iron (III) ion and water, the oxidizing agent is... ? Fe(II) ==> Fe(III) H2O2 ==> H2O. Fe goes from +2 to +3, that is a loss of electrons, so it is oxidized (by definition, oxidation is ...
  48. Math

    Which of the following is a measure of an obtuse angle? A. 40 degrees B. 100 degrees C. 90 degrees*** D. 180 degrees I am most certain it is C?
  49. Chemistry

    Methanol, CH3OH, is produced on an industrial scale from carbon monoxide and hydrogen. At the temperatures used, gaseous methanol is formed according to the following thermochemical equation: CO(g)+ 2H2(g) <---> CH3OH(g) £H = -90Kj 1. State Le Chateliers principle and...
  50. Chemistry

    Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the production of one mole...
  51. Chemistry

    Sodium azide (NaN3) yields N2 gas when heated to 300 degrees Celsius , a reaction used in automobile airbags. If 1.00 mol of N2 has a volume of 47.0 liters under the reaction conditions , how many liters of gas can be formed by heating 35g of NaN3? The reaction is 2Nan3------&...
  52. Chemistry

    When 0.13 g of H2 and 0.18 g of I2 are confined to a 150. mL reaction vessel and heated to 700. K, they react by a second-order process (first order in each reactant), with k = 0.063 L·mol-1s-1 in the rate law (for the rate of formation of HI). (a) What is the initial ...
  53. tax

    The educator's expense deduction is taken: A. on Form 2106. B. on Schedule C. C. above the line on the Form 1040. D. on the educator's expense form. it it C
  54. MATH

    Fraction form 1/3 if changed Decimal form it is 1/3=0.331/3 if changed to Percent form it is 1/3=331/3% Is this correct? I just want make sure.
  55. Science

    An investigation was conducted to study the effect of the concentration of a reactant on the (trial) time need to complete a chemical reaction. Four trials of the same reaction were performed.In each trial the initial concertration of the reactant was different. The time ...
  56. Math

    Please help with the following questions: 1. write 12 million in scientific notation 2. Write 17,600 in scientific notation 3. write 1.2 * 10 to the fourth power in standard form 4. write 5 * 10 to the sixth power in standard form
  57. Chemistry

    The equilibrium constant based on concentration is Kc = 190 for the reaction of carbon monoxide with hydrogen gas at 1000K. What can you infer about the relative rates of the forward and reverse reactions when the gases have the following concentrations at this temperature? [...
  58. chemistry

    1. The bombardier beetle uses an explosive discharge as a defensive measure. The chemical reaction involved is the oxidation of hydroquinone by hydrogen peroxide to produce quinine and water: C6H4(OH)2 (aq) + H2O2 (aq) �� C6H4O2 (aq) + 2 H2O (l) ...
  59. Chemistry

    As an environmental chemist, you want to find the Kc for the following reaction: 2 NO2 (g) ⇌ N2 (g) + O2 (g) Kc = ? Use the following data to find the unknown Kc : ½ N2(g) + ½ O2(g) ⇌ NO (g) Kc = 4.8 x 10-10 2 NO2(g) ⇌ 2 NO (g) + O2 (g) Kc = 1.1 x 10-5
  60. chemistry

    I don't understand this zwitterion form . Here is the question. write the zwitterion form of the amino acid cysteins shown in the follwing figure. If the pI for cysteine is 5.1 at what pH will the zwitterions be the predominant form? Can you please show me step by step on how ...
  61. chemistry

    3. When a mixture of 10.0 grams of acetylene (C2H2) and 10.0 grams of oxygen (O2) is ignited, the resulting combustion reaction produces CO2 and H2O. A) Write a balanced equation for this reaction. B) What is the limiting reactant? C) How many grams of C2, H2, O2, CO2, and H2O...
  62. Chemistry

    25cm^3 of a gas containing only nitrogen and oxygen decomposed to form 25cm^3 of nitrogen and 50cm^3 of oxygen. All the volumes were measured at the same temperature and pressure. Write an equation for the reaction.
  63. chemistry

    ogen and oxygen react to form nitrous oxide as: 2 N2 (g) + O2 (g) ⇌ 2 N2O (g) Of a mixture of 0.482 mol N2 and 0.933 mol O2 is placed in a reaction vessel of 10.0 L and allowed to from N2O at a temperature for which Kc = 2.0 X 10-37, what will be the composition of the ...
  64. chemistry

    Substance A and substance B react to form substance C as described by the equation: A + B ↔ C If only substance A and substance B are placed in an enclosed vessel and allowed to react what would the reaction be?
  65. Chemistry :(

    Question text Given the following exothermic, equilibrium reaction: 3 H2(g) + N2(g) <--> 2NH3(g) Using Le Chatelier's Principle, which of the following changes would shift the equilibrium toward more production of NH3? Select one: a. Adding a catalyst b. Adding heat c. ...
  66. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...
  67. ET1210-Dc/Ac Circuits

    if a certain number of equal resistors are wired in series across a certain voltage source, determine how much voltage is across each resistors.
  68. chemistry

    A mixture of hydrogen peroxide, H2O2, and hydrazine, N2H4, can be used as a rocket propellant. The reaction is: 7 H2O2(g) + N2H4(l) ® 2 HNO3(aq) + 8 H2O(l) a) How many moles of H2O2 react with 0.477 mol N2H4? [1] ___________ b) How many grams of HNO3 can be produced in a ...
  69. Chemistry

    3. An electrochemical reaction occurs between an unknown element and zinc. The half-cell reaction for the zinc is: Zn(s) → Zn2+(aq) + 2e− The cell potential for the reaction is Eºcell = 1.83 V. a. Is the reaction spontaneous or nonspontaneous? Explain. (1 point) b...
  70. Chemistry

    Nitrogen and oxygen can react directly with one anotheer to produce nitrogen dioxide according to N2(g) + 2O2(g) --> 2NO2(g) The reaction may also be imagined to take place by first producing nitrogen oxide N2(g) + O2(g) --> 2NO(g) which then produces NO2 2NO(g) + O2(g...
  71. Algebra Answer Check

    What is the algebraic expression for the following word phrase: the quotient of 6 and the sum of 5 and y? 6 a. ----- 5-y 6 b. ----- (?) 5+y c. 6(5+y) d. 6/5 + 6y What is the algebraic expression for the following word phrase: the quotient of j and 8? a. j-8 b. j+8 c. j...
  72. biology

    30. Enzymes function most efficiently at the temperature of a typical cell, which is 37 degrees Celsius. Increases or decreases in temperature can significantly lower the reaction rate. What does this suggest about the importance of temperature-regulating mechanisms in ...
  73. statistics

    Suppose that the certain lifetimes of a certain light bulb are normally distributed with μ=1500 hours and σ=200. Find the probability that a light bulb will burn out in less than 1200 hours.
  74. Chemistry

    K=1.6x10^-5 mol/L for the following reaction 2NOCl(g).... 2 NO(g) + Cl2(g) Calculate the concentrations of all species at equilibrium for each of the following original mixtures E) 2.4 mol of NOCl, 2.4 mol of NO, and 1.2 mol Cl2 in a 1.0 L flask F)1.9 mol/L concentration of ...
  75. chem

    For the reaction shown, calculate how many grams of oxygen form when each quantity of reactant completely reacts. 2HgO(s)¨2Hg(l)+O 2 (g) 2\;{\rm{HgO}}\left( s \right)\; \rightarrow \;2\;{\rm{Hg}}\left( l \right) + {\rm{O}}_2 \left(1.40 kgHgO g \right)
  76. chemistry

    an ezyme -catalysed reaction was carried out in a solution buffered with 0.05 M phosphate ph 7.2 . As a result of the reaction ,0.06M of acid was formed. (phosphoric acid has three pka values. The one required for this calculation is pka2=7.2). 1) what was the pH at the end of...
  77. Chemistry

    A student titrated 1.852 g of a mixture containing potassium hydrogen phthalate, KHP....? A student titrated 1.852 g of a mixture containing potassium hydrogen phthalate, KHP, with 0.163 M NaOH solution. She recorded an initial buret reading of 0.84 mL and a final buret ...
  78. chemistry

    Identify the species oxidized, the species reduced, the oxidizing agent and the reducing agent in the following electron transfer reaction. 2Fe3+ + Sn2Fe2+ + Sn2+ species oxidized species reduced oxidizing agent reducing agent As the reaction proceeds, electrons are ...
  79. Chemistry

    Design an electrochemical cell using Pb(s) and Mn(s) and their solutions to answer the following questions. I just want to see if my answers are correct. I drew the cell already. Thanks 1. Give the line notation for this electrochemical cell. Mn(s) ∣ Mn2+(aq) ∥ Pb2...
  80. physics

    two stones are dropped simultaneously into a calm pool of water. The crests of the resulting waves form equally spaced concentric cicles, as shown in the figures. The waves interact with each other to create certain interference patterns. explain why the red dots lie on an ...
  81. accounting

    6. Which of the following is not a processing control? A) Record counts B) Control totals C) Hash totals D) Check digits I think it should be C but am not certain. Can anyone assist?
  82. AP Chemistry

    Calculate ΔHrxn for the following reaction: C(s)+H2O(g)→CO(g)+H2(g) Use the following reactions and given ΔH values: C(s)+O2(g)→CO2(g), ΔH= -393.5 kJ 2CO(g)+O2(g)→2CO2(g), ΔH= -566.0 kJ 2H2(g)+O2(g)→2H2O(g), ΔH= -483.6 kJ
  83. chemistry

    Equilibrium is established in a reversible reaction when: A)the [product] = [reactants] B)rate of reaction of products = rate of reaction of reactants C)all the reactants dissolve or dissociate D)products are no longer produced
  84. Chemistry

    if you could just help me set them up the would do me some good. Thanx A. In the single reaction of chlorine and potassium bromide, how many grams of potassium chloride can be produced from 200.g each of chlorine and potassium bromide? Identify the limiting reactants. B. In ...
  85. Chemistry2

    WO3 (s) + 3 H2 (g) -> W (s) + 3 H20 (g) Tungsten is obtained commercially by the reduction of WO3 with hydrogen according to the equation above. The following data related to this reaction are available. DeltaH(kilojoules/mole) for WO3 is -839.5. DeltaH for H20(g) is -241.6...
  86. chemistry

    2. What is the reduction half-reaction for the following unbalanced redox equation? Cr2O72– + NH4+ Cr2O3 + N2 A.) Cr2O3 -> Cr2O7^2– *B.) Cr2O72– -> Cr2O3 C.) NH4+ -> N2 D.) N2 -> NH4+ 3. Which oxidation-reduction reactions are best balanced by the half-...
  87. Chemistry

    2. What is the reduction half-reaction for the following unbalanced redox equation? Cr2O72– + NH4+ Cr2O3 + N2 A.) Cr2O3 -> Cr2O7^2– *B.) Cr2O72– -> Cr2O3 C.) NH4+ -> N2 D.) N2 -> NH4+ 3. Which oxidation-reduction reactions are best balanced by the half-...
  88. Geometry

    write the following reversible statement as a biconditional: If two perpendicular lines intersect, they form four 90 degree angles. -Two intersecting lines are perpendicular if and only if they form four angles. -Two intersecting, perpendicular lines do not form four angles. -...
  89. Chem

    When an aqueous solution of lithium chloride is mixed with an aqueous solution of ammonium sulfate ______. A. a precipitate form B. a new salf is formed C. a gas is evolved D. an acid and base are formed E. no reaction occurs
  90. CHEMISTRY..

    *What are the products after a single replacement rxn? *Determine the spectator ion(s) and the net ionic equation. F2(g) + AlBr3(aq)--->? After single replacement....Br2 is a liquid, not a solid so ppt will not form..hence, there is no reaction?
  91. conditional sentence

    1. If the sound system hadn't failed, last night's show would have been better. a. this is a correct sentence using the 2nd conditional form b. this is a sentence using the 3rd conditional form Answer a. 3. if the club's manager agrees, they'll play a few more original songs ...
  92. Math

    Use the point-slope form linear equation given to complete the following problems. y-3=3(x+1) 1. What is the slope of the given line? Here's what I did: y-3=3(x+1) y-3+3=3x+3 y=3x+6 m=3 Correct so far? 2. What point does this line pass through, which is the basis of this ...
  93. Chemistry

    At 1200 K, the approximate temperature of vehicle exhaust gases, Kp for the reaction <- 2CO2(g) -> 2CO(g) + O2(g) is about 1*10E-13. Assuming that the exhaust gas (total pressure 1 bar) contains 0.2% CO, 12% CO2 and 3% O2 by volume, is the system at equilibrium with ...
  94. Chemistry

    At 1200 K, the approximate temperature of vehicle exhaust gases, Kp for the reaction 2CO2(g)⇄2CO(g) + O2(g) is about 1*E-13. Assuming that the exhaust gas (total pressure 1 bar) contains 0.2% CO, 12% CO2 and 3% O2 by volume, is the system at equilibrium with respect to ...
  95. chemistry

    Using the activity series, write a balanced chemical equation for the following reactions: 1. iron metal is added to a solution of copper (II) nitrate 2. zinc metal is added to a solution of magnesium sulfate 3. hydrobromic acid is added to tin metal 4. hydrogen gas is bubbled...
  96. chemistry

    when x gram of carbon is completely burnt in certain amount of oxygen y gram of carbondioxide is form.what mass of Co2 will be produced when 2x gram of carbon is burnt in z gram of oxygen. which law of chemistry will help me to find the answer
  97. Chemistry

    A 1.0 mL volume of 0.010 M H2SO4 is added to a mixture of 6 drops of 0.010 M HIO3, 14 drops of deionized water, and 1 drop of starch solution. A color change in the reaction mixture occurred after 56 seconds. a. Assuming 20 drops per milliliter for all solutions, determine the...
  98. French

    I want to know what are the Ils/Elles form for the following verb. S'appeler Avoir Adorer Vouloir
  99. math

    Write a proportion that is a different form of the following but will still yield the same solution: 3/4 = x/2
  100. trig

    Write the following equation in standard form and identify the type of conic: 9y^2 - 4x^2 + 8x + 18y + 41 = 0
  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. 16
  18. 17
  19. 18
  20. 19
  21. 20
  22. 21
  23. 22
  24. 23
  25. 24
  26. 25
  27. 26
  28. 27
  29. 28
  30. 29
  31. 30
  32. 31
  33. 32
  34. 33
  35. 34
  36. 35
  37. 36
  38. 37
  39. 38
  40. 39
  41. 40
  42. 41
  43. 42
  44. 43
  45. 44
  46. 45
  47. 46
  48. 47
  49. 48
  50. 49
  51. 50
  52. 51
  53. 52
  54. 53
  55. 54
  56. 55
  57. 56
  58. 57
  59. 58
  60. 59
  61. 60
  62. 61
  63. 62
  64. 63
  65. 64
  66. 65
  67. 66
  68. 67
  69. 68
  70. 69
  71. 70
  72. 71
  73. 72
  74. 73
  75. 74
  76. 75
  77. 76
  78. 77
  79. 78
  80. 79
  81. 80
  82. 81
  83. 82
  84. 83
  85. 84
  86. 85
  87. 86
  88. 87
  89. 88
  90. 89
  91. 90
  92. 91
  93. 92
  94. 93
  95. 94
  96. 95
  97. 96
  98. 97
  99. 98
  100. 99
  101. 100