a certain reaction has the following generaln form

72,487 results, page 21

Chemistry

I posted before about designing a procedure to determine two unknowns (1 solid, 1 solution). The possible solutions were: NaCl, CaCl2, CuSO4, NaOH,Ba(OH)2, HCl, HNO3, or H2O. The reagents given are: NaOH, HCl, AgNO3, Zn metal, Na2SO4, and H2O. The procedure I've designed so ...

Science

Hydrochloric acid and sodium hydroxide are mixed together to form salt and water. During the reaction, the temperature of the solution increases. Which of these best explains why this is considered to be a chemical change? No energy was destroyed. Heat was given off. It ...

Chemistry

Why is energy released in order to react two atoms to form a compound? For instance the reaction between sodium metal and chlorine gas is highly exothermic and produces NaCl(s). Meanwhile when an atom loses an electron, it will be endothermic. Can someone try to explain this ...

History

How should I start my reaction essay off? I looked up examples online and most sources say to state the title and the author but I'm not sure how to "form" the first paragraph. This is what I have so far.. After reading the article Survivors, I felt horrified, disgusted and ...

Chemistry

Consider the following reaction: CH4 +2O2 -> CO2 + 2H2O. Delta H = -891 kJ Calculate the enthalpy change for each of the following cases: a. 1.00 g methane is burned in excess oxygen b. 1.00 x 10^3 L methane gas at 740. torr and 25 *C is burned in excess oxygen

algebra

write the following where possible as a single number in index form: 2^3x2^4

Math

For which real values of x do the following vectors form a linearly dependent set in R3? v1= (x, -1/9, -1/9) v2= (-1/9, x, -1/9) v3= (-1/9, -1/9, x)

math

Write each of the following in the form a sqrt b where a and b are intergers and b has the least value possible

math

write the following in simplified radical form sqrt 48 t^5 w^6 would it be 2sqrt24 t^5 /w^6?

math

Convert each of the following repeating decimals to a/b form, where a, b are integers and b ≠ 0. #2a ¯ 0.4 #2c ¯ 1.396 #2e ¯ -2.34

math

Convert each of the following repeating decimals to a/b form, where a, b are integers and b ≠ 0. #2a ¯ 0.4 #2c ¯ 1.396 #2e ¯ -2.34

Math

Write the following logarithmic equation in exponential form? 1- log0.001 = -3

algebra 209

write the following in simplified radical form 3 sqrt 250

intermediate algebra

Simplify the following quotient of complex numbers into the form a+bi 1+8i ---- -6+i

math

Convert eat of the following repeating decimal to a/b form, where a and b are integers and b doesn't equal 0. a. 0.7 c. 2.37 e. -4.34

chemistry

arrange the following subshells in order form lowest to highest energy: 4s 4p 4d 4f

algebra

what is the equation in standard form of a parabola that contain the following points? (-2,-20),(0,-4),(4,-20) Please Help

maths

A circle x^2 + y^ + 2x - 2y -1 = 0 expressed in the following form (x-h)^2 + (y-k)^2 = r^2 where h, k are the coordinates of the centre. How is r the radius given?

maths

A circle x^2 + y^ + 2x - 2y -1 = 0 expressed in the following form (x-h)^2 + (y-k)^2 = r^2 where h, k are the coordinates of the centre. How is r the radius given?

math

Calculate the following, leaving your answer as a fraction (lowest) or in decimal form. 4(2+1)² -------- 3(1)²

Math

A quartic graph has the following coordinates: (-4,0),(-2,0),(0,0),(1,0) find the equation in expanded form.

Math

write the following equation in slope intercept form 3x+4y=12 I'm lost on this question

Algebra 2 (Math)

What is the equation, in standard form, of a parabola that contains the following points? (-2, -20), (0, -4), (4, -20)

algebra

Please show the following numbers in standard form. 6.548*10^-3 5.854*10^1 2.25*10^6 Thank you for your help.

Math

1. What is the simplified form of the following expression? 12[6^2/(5^2-4^2)+7] A. 12.6 B. 195 C. 33.8 D. 132 2. What is the value of xy over z if x= -1, y =10 and z=2? A. 5 B. -5 C. 1/5 D. -1/5

Chem

An electrochemical cell based on the decomposition of H2O2 can be constructed based on the half-reactions in the table below. Half-Reaction | Standard Reduction Potential, E° H2O2+ 2e- => 2 OH- | 0.88 V O2+ 2 H2O + 2e- => H2O + 2 OH- | -0.15 V (d) Calculate the value of...

math/Check!

a. An ellipse is formed by stretching the graph of x^2+ y^2=1 horizontally by a factor of 3 and vertically by a factor of 4. Determine the equation of the ellipse in standard form x^2/a^2+y^2/b^2=1 (x/3) ^2+ (y/4) ^2=1 x^2/9 + y^2/16 =1 so the equation is: x^2/9 + y^2/16 =1 b...

Chemistry

Phosphorous trichloride (PCl3) is produced from the reaction of white phosphorous (P4) and chlorine: P4(s) + 6Cl2(g) ! 4 PCl3(g) . A sample of PCl3 ofmass 280.7 g was collected from the reaction of 70.86 g of P4 with excess chlorine. What is the percentage yield of the ...

Organic Chemistry

A methyl ether (SN2 product) can form as a byproduct in the sodium methoxide reaction. What is its structure? Provide the mechanism for the formation of the methyl ether product, in addition to answering the question.

organic chemistry

A methyl ether (SN2 product) can form as a byproduct in the sodium methoxide reaction. What is its structure? Provide the mechanism for the formation of the methyl ether product, in addition to answering the question.

Biology Help

Enzymes: a. increase the amount of energy release in a reaction b. decrease the amount of energy release in a reaction c. catalyze only redox reactions d. reduce the activation energy needed to for a reaction I think its d. or a. Help Please

Chemistry

The reaction of iron and water vapor results in an equilibrium reaction, 3 Fe(s) + 4 H2O(g) ¡ê Fe3O4(s) + 4 H2(g) and an equilibrium constant of 4.6 at 850¡ÆC. What is the concentration of Hydrogen present at equilibrium if the reaction is initiated with 28 g of H2O and ...

Physics

Waves of all wavelengths travel at the same speed v on a given string. Traveling wave velocity and wavelength are related by v=lambda*f,where v is the wave speed, lambda is the wavelength (in meters), and f is the frequency [in hertz]. Since only certain wavelengths fit ...

Gen Chem

What is n, the number of moles of electrons transferred, in the following reaction? 2 MnO4-(aq) + 16 H+(aq) + 10 Cl-(aq) ===> 2 Mn2+(aq) + 5 Cl2(g) + 8 H2O(l).

Chemistry

Predict the product(s) and write a balanced equation for the following redox reaction: pentane (C5H12) + oxygen ---->

chemistry

consider the following reaction: Mg(s)+ 2HCl(aq) --> MgCl2 (aq)+H2 (g) What minimum amount of 1.75 M HCl is necessary to produce 27.5 L of H2 at STP?

CHEMISTRYYY

consider the following reaction: Mg(s)+ 2HCl(aq) --> MgCl2 (aq)+H2 (g) What minimum amount of 1.75 M HCl is necessary to produce 27.5 L of H2 at STP?

chemistry

Na3PO4(aq) + AlCl3(aq) produces? Complete and balance each of the following equations. If no reaction occurs, write NOREACTION.

Chem 11

How many grams of O2 are required to produce 255grams of SO2 in following reaction? 4FeS2+11O2===> 2Fe2O3+8SO2

PHYSICS

What is the reaction effect of the following action effects? a) Earth orbits the sun b) Ball accelerates downward Thank YOu.

PHYSICS

What is the reaction effect of the following action effects? a) Earth orbits the sun b) Ball accelerates downward Thank YOu.

chemistry

How many moles of oxygen can be obtained by the decomposition of 7.5 mol of reactant in the following reaction? 2KClO3 -> 2KCl + 3O2

Chemistry

Use the data in Table 15.3 to calculate the equilibrium constant for the following reaction: HCOOH(aq) + OH(aq) <-->HCOO(aq) + H2O(l)

Chemistry

2C2H6 +7O2 --> 4CO2 + 6H2O If 6 moles of O2 are used in the following reaction, how many grams of CO2 will be produced?

physics

Determine the stopping distances for a car with an initial speed of 93 km/h and human reaction time of 3.0 s for the following accelerations: -4.00 m/s^2 -8.00 m/s^2

chemistry

what is the coefficients on Oxygen in the balanced equation for the following hydrocarbon combusion reaction C7H14 + O2 = CO2 + H2O

Chemistry

At 319K the decomposition of dinitrogen tetroxide occurs with the following Kp: 2NO2(g)<>2NO(g)+O2(g) Kp=.700 What is the value of Kc for this reaction?

Chemistry

When the equation for the following reaction in basic solution is balance, what is the sum of the coefficients? MnO2 + HO2^1-.....>MnO4^1- A=11 B=31 C=14 D=9

Chemistry

Complete the following chemical reaction. Label any precipitate that forms. KCl(aq) + AgNO3 (aq) ¨KNO3 (aq)+AgCl(s)

Chemistry

Calclte the number of moles of ethane needed to produce 10.0 grams of water according to the following reaction.

Chemistry

Complete and Balance the following equation using the half-reaction method; (MnO4^-) + (CH3OH) --> (Mn^2+) + (HCO2H)

Chemistry

Complete and Balance the following equation using the half-reaction method; (MnO4^-) + (CH3OH) --> (Mn^2+) + (HCO2H)

Chemistry

In the following unbalanced reaction, which atom is oxidized? HNO3 + HBr -> NO + Br2 + H2O Is the answer bromine?

chemistry

5. Identify whether the following reaction is an oxidation or a reduction. a. Ni2+ + 2e- ¨ Ni b. 2Br- ¨ Br2 + 2e- c. O2 + 4e- ¨ 2O2- d. Zn ¨ 2e- + Zn2+ e. H2 ¨ 2H+ + 2e-

chem

How many grams of NH3 are required to make 52.7g H2O in the following reaction : 4NH3+6NO->5N2+6H2O

Chemistry

For the following reaction, identify the substance oxidized, reduced and the oxidizing and reducing agents. 2SO2 + O2 ----> 2SO3

chemistry

For the following reaction, identify the substances oxidized, reduced and the oxidizing and reducing agents? 2SO2 + O2 --> 2SO3

chemistry

For the following reaction, identify the substances oxidized, reduced and the oxidizing and reducing agents? 2SO2 + O2 --> 2SO3

chemistry

What volume of chlorine gas at 42.0 oC and 1.30 atm is required to react completely with 34.2 g of phosphorus (P4) according to the following reaction?

Chemistry

Identify the Bronsted-Lowry acid in the following reaction. H2O (l) + HCO31- (aq) → H3O+ (aq) + CO32- (aq)

Science

Given the following balanced equation, determine the rate of reaction with respect to [O2]. 2 SO2(g) + O2(g) → 2 SO3(g)

Chemistry 1002

Calculate the standard entropy change for the following reaction at 25 °C. 2 Al (s) + 3 ZnO (s) --> Al2O3 (s) + Zn (s) answer is in J/K mol

AP Chemistry

For each of the following pairs of half-cells, determine the overall electrochemical reaction that proceeds spontaneously. Na+ | Na, Ni2+ | Ni

Chemistry

All the following are necessary parts of a neutralization reaction except A) an acid B) an indicator C) water D) a salt.

Chemistry

Complete and balance the following equation. If no reaction occurs, write noreaction . NaOH(aq)+FeBr3(aq)→

physics hw

Determine the stopping distances for a car with an initial speed of 87 km/h and human reaction time of 2.0 s for the following accelerations. (a) a = -4.0 m/s2 (b) a = -8.0 m/s2

Chemistry please help!

Calculate (triangle)H for the following gas-phase reaction: 2 H-C (3dashes) C-H + 5 O=O --> 4 O=C=O = 2 H-O-H -Using bond energies

chemiste-ry

Consider the following equation: CO + 2 H 2 → CH 3 OH △H rxn = -128 kJ Calculate the amount of heat (in kJ) associated with complete reaction of 8.08 g H 2 .

Chem 1

Use oxidation states to identify the element that is being oxidized in the following redox reaction: Cu(s)+2 H 2 S O 4 (aq) → CuS O 4 (aq)+S O 2 (g)+2 H 2 O(l)

chemistry

(AAAAA)The standard reduction potentials of lithium metal and chlorine gas are as follows: (for Li, reduction potential is -3.04, for Cl it is 1.36) In a galvanic cell, the two half-reactions combine to 2Li{+](s) + Cl{-}2(g) --> 2Li{+}Cl{-}(aq) Calculate the cell potential ...

chemistry

Magnesium reacts with HCl(aq) to form MgCl2 and H2(g) ____ Mg(s) + ____ HCl(aq) -----> ____ MgCl2(aq) + ____ H2(g) The following data was collected for the above reaction: Mg (g) 5% (m/v) HCl (ml) H2 gas produced (ml) 0.50 10 167 0.50 20 333 0.50 30 500 0.50 40 500 0.50 50 ...

Chemistry

Sulfur trioxide gas, one of the causes of acid rain, is produced in the upper atmosphere when oxygen reacts with sulfur dioxide gas in the reaction shown below: 2SO2(g) + O2(g) <--> 2SO3(g) deltaH0 = -197kJ The gases are placed in a reaction vessel and allowed to come to...

Chemistry

Consider the hypothetical reaction between A2 and AB pictured below. (picture of eight AB molecules and four A2 molecules in one box -> eight molecules of A2B molecules in another box) What is the balanced equation? If 2.50 mol A2 is reacted with excess AB, what amount (...

Chemistry

A proposed mechanism for a reaction is: (i) A + B2 = AB2 Ea1 = 12 kJ/mol ƒ´H1 = 3 kJ/mol (ii) AB2 + C2 = ABC + BC Ea2 = 30 kJ/mol ƒ´H2 = 5.2 kJ/mol (iii) ABC + B2 = AB2 + BC Ea3 = 10 kJ/mol ƒ´H3 = -7.8 kJ/mol a) Which is the rate determining step? Explain why. (2 marks) ...

Chemistry

Methanol, CH3OH, is produced on an industrial scale from carbon monoxide and hydrogen. At the temperatures used, gaseous methanol is formed according to the following thermochemical equation: CO(g)+ 2H2(g) <---> CH3OH(g) £H = -90Kj 1. State Le Chateliers principle and...

oxidation

In the reaction of hydrogen peroxide with iron (II) ion in acidic solution to form iron (III) ion and water, the oxidizing agent is... ? Fe(II) ==> Fe(III) H2O2 ==> H2O. Fe goes from +2 to +3, that is a loss of electrons, so it is oxidized (by definition, oxidation is ...

Math

Which of the following is a measure of an obtuse angle? A. 40 degrees B. 100 degrees C. 90 degrees*** D. 180 degrees I am most certain it is C?

tax

The educator's expense deduction is taken: A. on Form 2106. B. on Schedule C. C. above the line on the Form 1040. D. on the educator's expense form. it it C

MATH

Fraction form 1/3 if changed Decimal form it is 1/3=0.331/3 if changed to Percent form it is 1/3=331/3% Is this correct? I just want make sure.

Chemistry

Please show me how to work! Ethane, C2H6(g) can be made by reaction of hydrogen gas with acetylene, C2H2(g). the standard enthalpies of formation of ethane and acetylene are -84.68 and +226.73 kJ mol-1, respectively. what is the reaction enthalpy for the production of one mole...

Math

Please help with the following questions: 1. write 12 million in scientific notation 2. Write 17,600 in scientific notation 3. write 1.2 * 10 to the fourth power in standard form 4. write 5 * 10 to the sixth power in standard form

Chemistry

Sodium azide (NaN3) yields N2 gas when heated to 300 degrees Celsius , a reaction used in automobile airbags. If 1.00 mol of N2 has a volume of 47.0 liters under the reaction conditions , how many liters of gas can be formed by heating 35g of NaN3? The reaction is 2Nan3------&...

Chemistry

When 0.13 g of H2 and 0.18 g of I2 are confined to a 150. mL reaction vessel and heated to 700. K, they react by a second-order process (first order in each reactant), with k = 0.063 L·mol-1s-1 in the rate law (for the rate of formation of HI). (a) What is the initial ...

Chemistry

As an environmental chemist, you want to find the Kc for the following reaction: 2 NO2 (g) ⇌ N2 (g) + O2 (g) Kc = ? Use the following data to find the unknown Kc : ½ N2(g) + ½ O2(g) ⇌ NO (g) Kc = 4.8 x 10-10 2 NO2(g) ⇌ 2 NO (g) + O2 (g) Kc = 1.1 x 10-5

Science

An investigation was conducted to study the effect of the concentration of a reactant on the (trial) time need to complete a chemical reaction. Four trials of the same reaction were performed.In each trial the initial concertration of the reactant was different. The time ...

chemistry

1. The bombardier beetle uses an explosive discharge as a defensive measure. The chemical reaction involved is the oxidation of hydroquinone by hydrogen peroxide to produce quinine and water: C6H4(OH)2 (aq) + H2O2 (aq) �� C6H4O2 (aq) + 2 H2O (l) ...

chemistry

I don't understand this zwitterion form . Here is the question. write the zwitterion form of the amino acid cysteins shown in the follwing figure. If the pI for cysteine is 5.1 at what pH will the zwitterions be the predominant form? Can you please show me step by step on how ...

Chemistry :(

Question text Given the following exothermic, equilibrium reaction: 3 H2(g) + N2(g) <--> 2NH3(g) Using Le Chatelier's Principle, which of the following changes would shift the equilibrium toward more production of NH3? Select one: a. Adding a catalyst b. Adding heat c. ...

Chemistry

25cm^3 of a gas containing only nitrogen and oxygen decomposed to form 25cm^3 of nitrogen and 50cm^3 of oxygen. All the volumes were measured at the same temperature and pressure. Write an equation for the reaction.

chemistry

ogen and oxygen react to form nitrous oxide as: 2 N2 (g) + O2 (g) ⇌ 2 N2O (g) Of a mixture of 0.482 mol N2 and 0.933 mol O2 is placed in a reaction vessel of 10.0 L and allowed to from N2O at a temperature for which Kc = 2.0 X 10-37, what will be the composition of the ...

Chemistry

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...

chemistry

3. When a mixture of 10.0 grams of acetylene (C2H2) and 10.0 grams of oxygen (O2) is ignited, the resulting combustion reaction produces CO2 and H2O. A) Write a balanced equation for this reaction. B) What is the limiting reactant? C) How many grams of C2, H2, O2, CO2, and H2O...

chemistry

Substance A and substance B react to form substance C as described by the equation: A + B ↔ C If only substance A and substance B are placed in an enclosed vessel and allowed to react what would the reaction be?

Algebra Answer Check

What is the algebraic expression for the following word phrase: the quotient of 6 and the sum of 5 and y? 6 a. ----- 5-y 6 b. ----- (?) 5+y c. 6(5+y) d. 6/5 + 6y What is the algebraic expression for the following word phrase: the quotient of j and 8? a. j-8 b. j+8 c. j...

ET1210-Dc/Ac Circuits

if a certain number of equal resistors are wired in series across a certain voltage source, determine how much voltage is across each resistors.

Chemistry

K=1.6x10^-5 mol/L for the following reaction 2NOCl(g).... 2 NO(g) + Cl2(g) Calculate the concentrations of all species at equilibrium for each of the following original mixtures E) 2.4 mol of NOCl, 2.4 mol of NO, and 1.2 mol Cl2 in a 1.0 L flask F)1.9 mol/L concentration of ...

chemistry

A mixture of hydrogen peroxide, H2O2, and hydrazine, N2H4, can be used as a rocket propellant. The reaction is: 7 H2O2(g) + N2H4(l) ® 2 HNO3(aq) + 8 H2O(l) a) How many moles of H2O2 react with 0.477 mol N2H4? [1] ___________ b) How many grams of HNO3 can be produced in a ...

Chemistry

3. An electrochemical reaction occurs between an unknown element and zinc. The half-cell reaction for the zinc is: Zn(s) → Zn2+(aq) + 2e− The cell potential for the reaction is Eºcell = 1.83 V. a. Is the reaction spontaneous or nonspontaneous? Explain. (1 point) b...

Chemistry

Nitrogen and oxygen can react directly with one anotheer to produce nitrogen dioxide according to N2(g) + 2O2(g) --> 2NO2(g) The reaction may also be imagined to take place by first producing nitrogen oxide N2(g) + O2(g) --> 2NO(g) which then produces NO2 2NO(g) + O2(g...

chem

For the reaction shown, calculate how many grams of oxygen form when each quantity of reactant completely reacts. 2HgO(s)¨2Hg(l)+O 2 (g) 2\;{\rm{HgO}}\left( s \right)\; \rightarrow \;2\;{\rm{Hg}}\left( l \right) + {\rm{O}}_2 \left(1.40 kgHgO g \right)

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100