a certain reaction has the following generaln form

73,810 results, page 18

Chemistry

What does the symbol ∆H stand for? one Calorie given off by a reaction the heat capacity of a substance*** the heat of a reaction for a chemical reaction the specific heat of a substance

Chemistry - Rate Determining Step

The rate law for the reaction 2NO (g) + Cl2 (g) -> 2NOCl (g) is given by rate = k[NO][Cl2] A mechanism involving the following steps has been proposed for the reaction: NO (g) + Cl2 (g) -> NOCl2 (g) NOCl2 (g) + NO (g) -> 2NOCl (g) If this mechanism is correct, what ...

Chemistry

write 2-3 sentences describing and identifying the type of chemical reaction that occurs when Fe^2+ reacts with potassium permanganate and specifying the type of solution required for the reaction to occur I don't know what type of reaction this is or what other solution is ...

chemistry

a) Describe how to determine if a reaction will be thermodynamically favorable. b) Describe what happens to the Gibbs Free Energy term when a chemical reaction is reversed. c) Describe how coupling reactions are used to drive an unfavorable chemical reaction.

chemistry

What mass of benzoic acid can be made from a reaction where 4.87g benzyl alcohol is combined with 300mL of bleach? The reaction is conducted in water and dichloromethane. Describe a method of separating the benzoic acid from the sodium chloride byproduct after the reaction is ...

chemistry

What mass of benzoic acid can be made from a reaction where 4.87g benzyl alcohol is combined with 300mL of bleach? The reaction is conducted in water and dichloromethane. Describe a method of separating the benzoic acid from the sodium chloride byproduct after the reaction is ...

chemistry

Ammonium nitrate decomposes explosively at high temperatures to form nitrogen, oxygen, and water vapor. 2NH4NO3-->2N2+4H2O+O2. Calculate the number of grams of water formed when 25 L of N2 is produced in this reaction (assume STP)

Chemistry

Zinc sulfide and oxygen gas react to form oxide and sulfur dioxide. Determine the amount of ZnO that should be produced in a reaction between 46.5 g of ZnS and 13.3 g of oxygen. What is the mass of the xs reactant? Please show work

chemistry

According to the following reaction, how many grams of sulfur trioxide will be formed upon the complete reaction of 21.2 grams of oxygen gas with excess sulfur dioxide? sulfur dioxide (g) + oxygen (g) sulfur trioxide (g)

Chemistry

According to the following reaction, how many grams of nitrogen gas will be formed upon the complete reaction of 22.2 grams of hydrogen gas with excess nitrogen monoxide? nitrogen monoxide (g) + hydrogen (g) nitrogen (g) + water (l)

Chemistry

I am really confused on this problem pleas help me. N2H4(l)+O2(g)(arrow)N2(g)+2H2O(g) a. How many liters of N2 (at STP) form when 1.0 kg N2H4 react with 1.0 kg O2? b. How many grams of excess reagent remain after the reaction? 1 kg of N2H4 is 1000g/(32g/mol) = 31.25 moles of ...

Chemistry

Consider the reaction: 2CO(g) + O2(g) equilibrium 2CO2 (g) Write the equilibrium expression for this reaction. Keq = ?? Addition of a catalyst to this reaction would have what effect on the equilbrium? Addition of a catalyst to this reaction would have what effect on the rate?

chemistry

When N2O5 (g) is heated it dissociates into N2O3 (g) and O2 (g) according to the following reaction: N2O5 (g) <--> N2O3 (g) + O2 (g) Kc=7.75 at a given temperature. The N2O3 (g) dissociates to give N2O (g) and O2 (g) according the following reaction: N2O3 (g) <--> ...

Chemistry

Suppose that 0.650 mol of methane, CH4(g), is reacted with 0.800 mol of fluorine, F2(g), forming CF4(g) and HF(g) as sole products. Assuming that the reaction occurs at constant pressure, how much heat is released? Substance & Enthalpy of Form. (kJ/mol) C(g) 718.4 CF4(g) -679....

math

Which of the following fractions is in simplest form? a)5/6 b)6/8 c)8/10 d)2/12. My answer is a.

math

Change each of the following to simplest form 1 8 /10.is the answer 9/5

math

Change each of the following to simplest form. 18/8. Is the answer 9/4

math

Change each of the following to simplest form 5 12/8. Is the answer 13/2

Math HELP HELP

Express the following in completed square form. x^2+4x-41

Maths

Write. The following in standard. Form 6120

Calculus

Which of the following is written in explicit form? A.y=x B.x^2-6xy-9y^2=0 C.y=0 D. y= -√1-x^2

math

which of the following expressions is expressed in implicit form? A. xy=1 B. y=1/x C. y=x+1 D. y=1

Maths

Compute the following polynomial in standard form: (1 + x + x^2 + . . . + x^16)(1 - x)

math

Which of the following fractions is in its simplest form? 16/4 7/8 100/35 3/27

Chemistry

The following reaction is used to produce tungsten(VI)oxide: WS3(s) + O2(g) ¨ WO3(s) + SO2(g) The WO3 is then heated and undergoes a decomposition reaction produce tungsten and oxygen gas. How many grams of tungsten could be produced if 39.27 grams of WS3 are used

chem

Fluorine and krypton react to form binary compounds when a mixture of the two gases is heated to 500C in a nickel reaction vessel. A 100mL nickel container is filled with fluorin and krypton to partial pressures of 1.24 atm and 10.10 atm, respectively at a room temperature of ...

science

a certain's plant root contain higher concentrations of nitrate than the soil that surrounds them. Which mechanism explains the movement of nitrates form the soil into the plant's roots? a)osmosis b)facilitated diffusion c)active transport d)filtration I chose c) active ...

Chemistry

Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...

Chemistry

Le Chateleir`s Principle Please check if my answers are right and i dunt know some of them: Consider the following system at equilibrium: A(aq)+B(aq) <---> 2C(aq) Classify each of the following actions by whether it causes a leftward shift, a rightward shift, or no shift...

chemistry

50.0 mL of a solution of HCl is combined with 100.0 mL of 1.15 M NaOH in a calorimeter. The reaction mixture is initially at 22.4°C and the final temperature after reaction is 31.2°C. What is the molarity of the HCl solution? You may assume that there is an excess of base (...

Chemisty

Fluorine gas can react with ammonia gas to produce dinitrogen tetrafluoride gas and hydrogen fluoride gas. This reaction is described by the following balanced equation: 5 F2 (g) + 2 NH3 (g) N2F4 (g) + 6 HF (g) What mass of hydrogen fluoride gas is produced from 135 g of ...

phi 103

Identify the form of the following argument. Either the Pacers or the Kings will win tonight. The Pacers will win. Therefore, the Kings will not win. a. not a valid form b. disjunctive syllogism c. modus ponens d. hypothetical syllogism e. modus tollens

english

You need to explain applications: I assumed you were describing visa applications. Should applications from certain countries be given priority? College applications? This is a sensitive subject but in my opinion, yes. I found it extremely valuable to study alongside other ...

chem

What is the sum of the coefficients (including “1”) of the following reaction? Sodium sulfate + calciumhydroxide--> ???

chemistry

What is the net ionic equation for the following reaction?FeCl3(aq)+3LiOH(aq) -> Fe(OH)3(s)+3LiCl(aq)

chem101

will the following reaction take place nh3+h2o= nh2 + h3o

Organic Chemistry

The following reaction would produce a(n) __________. R-OH + R'COOH →

Chemistry

Explain the effect each of the following has on the rate of a reaction. reactivity of reactants inhibitors

chemistry

The following reaction consumes 2.40 kg of CO, How many total liters of gas are formed at STP?

Chemistry

Estimate the enthalpy change for the following reaction OH(g)+CH4(g)==>CH3(g)+H2O(g)

Chemistry

How do I balance the following into an equation? 10 mL of 2.0 M HCl is react with 8 mL of 1.7 M Ca(OH)2 in a neutralization reaction.

chemistry

Will the following reaction occur Spontaneously? Show your work and reasoning in each case 1. Ca(s) + Sn^4+ -->

chemistry

what element is undergoing oxidation in the following reaction Zn(s)+AgNO3(aq) Zn(NO3)2(aq)+2Ag(s)

chemistry

what element is undergoing oxidation in the following reaction Zn(s)+AgNO3(aq) Zn(NO3)2(aq)+2Ag(s)

Chemistry

For the following fusion reaction, calculate the change in energy per mole. 2/1 H + 3/2 He -> 4/2 He + 1/1 H

Chemistry

For the following fusion reaction, calculate the change in energy per mole. 2/1 H + 3/2 He -> 4/2 He + 1/1 H

science

what substance is being reduced in the following redox reaction? HgCl2 + Sn^2 = Sn^4 + Hg2Cl2 + Cl-

Chemistry

What element is undergoing oxidation (if any) in the following reaction? CH4(g) + 2 O2(g) ¨ CO2(g) + 2 H2O(g)

Chemistry

Name the organic product of the following nucleophilic substitution reaction. OH+CH3CH2I

Chemistry

What is the minimum amount of 5.9M M H 2 SO 4 necessary to produce 26.7g of H 2 (g) according to the following reaction? 2Al(s)+3H 2 SO 4 (aq)¨Al 2 (SO 4 ) 3 (aq)+3H 2 (g)

chemestry

consider the reaction 2N2O(g) == O2(g)+2N2(g).which of the following will cause a shift in the equilibrium to the left?

Chemistry

Calculate delta g and Kp for the following equilibrium reaction. Keep getting 7.2E-81 and the answer is 4.5E-81 Why?

Chemistry

AP Chem - Which element is oxidized in the following reaction: CuO(s) + H2 (g)  Cu(s) + H2O (l)

Chemistry

Name the organic product of the following nucleophilic substitution reaction OH-+CH3I

English academy.chemistry

Complete the following reaction 2F2(g) +2H2O(ĺ)=?

kumar

The addition of a catalyst during a chemial reaction alters which of the following quantities?

chemistry

How many mL of 0.6 M H2SO4 solution are needed to react completely with 23.62 g of Fe2O3 in the following reaction?

chemistry

Calculate the standard enthalpy change for the following reaction at 25 °C. H2O+C(graphite)(s) --> H2(g) +CO(g)

chemistry

estimate the enthalpy change for the following reaction: OF2 + H2O = O2 + 2HF

chemistry

What is the ∆G for the following reaction under standard conditions (T = 298 K) for the formation of NH4NO3(s)?

Anatomy

I have a question In a dehydration synthsis reaction which of the following occurs a. hydrogen and oxygen are removed from the reactant b. water is added to the reactants c. water is broken down into hydrgen and oxygen d. both a and c I think it would definitely be a and I ...

math

in math problem.how to change simplified fraction form 2/3 to decimal form and percent form

Last Question Plz helppp:((im soo sleepy!!:(

1)The reaction between solid sodium and iron(III) oxide, Fe2O3(s), is one in a series of reactions that occurs when an automobile air bag inflates. 6Na(s) + Fe2O3(s) -> 3Na2o(s) + 2Fe(s) If 100.0 g of iron(III) oxide are used in this reaction, what mass of solid iron will ...

Chemistry

Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NOREACTION. Are my answers below correct? I used the textbook 1. sodium chloride and lead (II) acetate 2,potassium sulfate and ...

General Chemistry

The problem is: Calculate the standard free-energy change for the following reaction at 25 degrees Celsius. 2Au^+3(aq) + 3Cr(s)-> 2Au(s) + 3Cr^+2(aq) I worked it out, getting half reaction: Au^3+ + 3e- -> Au; E = 1.498 Cr^3+ + 3e- -> Cr; E = -0.74 Ecell = 1.498 - (-0....

Physics

Consider the following standing wave, (all units are SI) z=0.2sin(0.4y)cos(350t) (a) what is the wavelength? (b) what is the angular frequency ω in radians/sec? (c) what is the frequency (f) in Hz? (d) The values of y where the displacement is always zero, are of the form...

chemistry

Please help ~~ Because i don't ever know the reaction in organic compound .. Do anyone has the data bank of the organic chemicals ? I cannot find out what are the compound in the reaction with it ~~ 1. What do butylamine give when it is dissolved in water ? A nearly pH10 ...

Urgent chemistry

Given the following reaction: 3 H2(g) + N2(g) <- -> 2NH3(g) + heat If the following changes were to occur what direction shift will it have (left or right) And what will be the reason of the shift Changes/Stress on system: Decreasing the pressure Adding heat Removing N2

chemistry

2H2+1O2=2H2O delta H=-136 kJ A) how many joules are released when 35.0 grams H2O form B)how many grams of hydrogen burn when 278 kJ are released. C) Draw a potential energy diagram of this reaction.

Chemistry

Write the balanced equation for (aq) Pb(ClO3)2 and (aq) NaI. Include phases. What mass of precipitate will form if 1.50 L of concentrated Pb(ClO3)2 is mixed with .250 L of .110 M NaI? Assume the reaction goes to completion.

chemistry

A mixture of 3.00 volumes of H2 and 1.00 volume of N2 reacts at 344 C to form ammonia. The equilibrium mixture at 110.0 atm contains 47.00 % NH3 by volume. Calculate Kp for the reaction, assuming that the gases behave ideally.

Chemistry - thermochemistry

Hydrogen gas (H2) is generated by the following reaction. Ca(s) + 2 HCl(aq) → CaCl2(aq) + H2(g); ΔH = −542.7 kJ/mol When this reaction takes place in a cylinder (fitted with a piston) containing 1.000 mol Ca(s), 542.7 kJ heat is lost to the surroundings. Because a gas is ...

CHEMISTRY

Method for getting correct answer? Thank you! The reaction below is an endothermic reaction. What would one have to do to shift the equilibrium to the right? SO2Cl2(g)↔SO2(g) + Cl2(g) a. Decrease the temperature b. Increase the temperature c. Remove some reactant d. An ...

AP Chemistry

The reaction of sodium oxide with water would form: 1. a neutral solution. 2. a basic solution. 3. an acidic solution. An explanation would be appreciated too!!

chemical equilibrium

At a certain temperature, Kc = 0.914 for the reaction NO2 (g) + NO (g) <----> N2O (g) + O2 (g) Equal amounts of NO and NO2 are to be placed in a 5.00 L container until the N2O concentration at equilibrium is 0.050 M. How many moles of NO and NO2 must be placed in the ...

Chemistry

The decompostion of dinitrogen pentoxide has been studied in carbon tetrachloride (CCl4) at a certain temperature: 2N2O5→4NO2+O2 [N2O5] Inital rate (M/s) 0.92 ...... 0.95x10^-5 1.23 ...... 1.20x10^-5 1.79 ...... 1.93x10^-5 2.00 ...... 2.10x10^-5 2.21 ...... 2.26x10^-5 ...

chemistry hellllllllllllllllllp

Oxidising and reduction- Chemistry? Oxidation and reduction can be described as the loss and/or gain of electrons from an ion or atom (species) in a chemical reaction. For the following aqueous reaction, select the species that is oxidized and similarly the one that is reduced...

Chemistry

Consider the reaction N2(g)+3H2<-->2NH3(g). What is the effect of decreasing the volume on the contained gases The reaction shifts toward the product gas The system reacts by increasing the number of gas molecules*** the pressure on the gases decreases momentarily ...

Chemistry

The efficacy of certain drugs is affected by pH. Many drugs are absorbed into the blood through cells lining the stomach or the small intestine by direct diffusion across the plasma membrane. Since the interior of the plasma membrane is hydrophobic, uncharged molecules cross ...

chemistry

Examine the scenario. Chemical Reaction A and Chemical Reaction B involve the same two reactants. Chemical Reaction A is performed in a hot container, while Chemical Reaction B is performed in a cold container. Which of the answer choices correctly describes which chemical ...

AP Chemistry

Q - An electrochemical reaction occurs between an unknown element and zinc. The half-cell reaction for the zinc is: Zn(s) → Zn2+(aq) + 2e− The cell potential for the reaction is Eºcell = 1.83 V. Is the reaction spontaneous or nonspontaneous? Explain. What is the half-cell...

chemistry

If 7.50 grams 1-butene reacts with 25.0 g oxygen how many grams of carbon dioxide will form? Which reactant is limiting? How many grams of excess reactant will be left at the end of the reaction?

CHE 111-03L

The following system is at equilibrium: 2X(s)+4Y(g)⇌Z(g) Classify each of the following actions by whether it causes a leftward shift, a rightward shift, or no shift in the direction of the net reaction. Half the Volume Remove Some X Double the Volume Add More X

chemistry

1(a) when 25.0ml of 0.500 mol.dm3 H2SO4(AQ) SOLUTION IS added to 0.025dm3 of 1.00 moldm3 KOH SOLUTION , THE TEMPERATURE OF THE REACTION MIXTURE RISES FROM 23.50 CELCIUS TO 30.17 CELCIUS . THE SPECIFIC HEAT CAPACITY AND DENSITY OF WATER 4.20j.g.celcius and 1.00 g.cm. the ...

chem

reaction order I know the form is r=k(A)a(B)b (a, b are exponents) and I know a and b depend on the concentration, but how do i know the number a and b. can you please explain in your own words instead of giving me websites because i look and i'm still confused I also tried to...

ap chem

At a certain temperature, the equilibrium constant Kc is 0.154 for the reaction 2 SO2(g) + O2(g) *) 2 SO3(g) What concentration of SO3 would be in equilibrium with 0.250moles of SO2 and 0.578 moles of O2 in a 1.00 liter container at this temperature? Note: These latter moles ...

ap chemistry

At a certain temperature, the equilibrium constant Kc is 0.154 for the reaction 2 SO2(g) + O2(g) *) 2 SO3(g) What concentration of SO3 would be in equilibrium with 0.250moles of SO2 and 0.853 moles of O2 in a 1.00 liter container at this temperature? Note: These latter moles ...

Chemistry

Nitrogen and hydrogen gases react to form ammonis gas as follows: N2(g)+3H2(g)-->2NH3(g) At a certain temperature and pressure, 1.2L of N2 reacts with 3.6L of H2. If all the N2 and H2 are consumed, what volume of NH3 at the same temperature and pressure will be produced? I'...

Chemistry

1. The reaction of fluorine with ammonia produces dinitrogen tetrafluoride and hydrofluoric acid. F2(g) + NH3(g) „³ N2F4(g) + HF(g) a. If you have 66.5g NH3, how many grams of F2 are required for complete reaction? b. How many grams of NH3 are required to produce 4.65g HF? ...

CHEM

Could you please tell me if these are right? Write an equation for the following reactions. Write the correct formulas of the reactants and products. Then correctly balance each equation. A.) Potassium and oxygen gas react to form potassium oxide. I got K+O2=KO2 B.) Sodium and...

AP Chemistry

in a coffee-cup calorimeter, 50.0 mL of 0.100 M AgNO3 and 50.0 mL of 0.100 M of HCl are mixed to yield the following reaction: Ag+ (aq) + Cl- (aq) >> AgCl (s) the two solutions were initially at 22.60 degree celsius, and the final temperature is 23.40 degree celsius. ...

AP Chemistry

in a coffee-cup calorimeter, 50.0 mL of 0.100 M AgNO3 and 50.0 mL of 0.100 M of HCl are mixed to yield the following reaction: Ag+ (aq) + Cl- (aq) >> AgCl (s) the two solutions were initially at 22.60 degree celsius, and the final temperature is 23.40 degree celsius. ...

Chemistry

HELP! we just started kinetics and i have no clue how to solve this problem. For the reaction between reactants A and B below, if 4.925 moles of A is placed into a flask with excess B it is found that the amount of A remaining after 6.85 seconds is 2.737 moles. 2A (g) + B (g...

Grammar Advisor

I just cannot figure out if these answers are correct or not. Can you please help me? 78. If the sound system hadn’t failed, last night’s show would have been better. This is a correct sentence using the 1st conditional form. x This is a correct sentence using the 2nd ...

Chem II

The equilibrium constant of a reaction is 12.6. If the rate constant of the reverse reaction is 5.1 x 10 -2 the rate constant for the forward reaction is _____ 0.32 0.16 0.64 0.08 I don't even know where to start on this question. Any direction will help

Chemistry

A sample of iron(II) sulfate was heated in an evacuated container to 920 K, where the following reactions occurred. Reaction (a): 2 FeSO4(s)--> Fe2O3(s) + SO3(g) + SO2(g) Reaction (b): SO3(g)--> SO2(g) + 1/2 O2(g) After equilibrium was reached, the total pressure was 0....

chemistry

For which of the reactions listed below will Gibbs free energy always be negative? A. An exothermic reaction that increases in entropy B. An endothermic reaction that decreases in entropy C. An endothermic reaction that increases in entropy D. An exothermic reaction that ...

chemistry

The chemical reaction N2(g) + 3 H2(g) ↔ 2 NH3(g) is at equilibrium. An experimenter injects a small amount of N2 into the reaction chamber. What happens to the forward reaction rate right after the injection of the N2?What happens to the reverse reaction rate right after...

chemistry

The chemical reaction N2(g) + 3 H2(g) ↔ 2 NH3(g) is at equilibrium. An experimenter injects a small amount of N2 into the reaction chamber. What happens to the forward reaction rate right after the injection of the N2? What happens to the reverse reaction rate right ...

Chemistry

The reaction 2NO(g) + 2H2(g) N2(g) + 2H2O(g) goes twice as fast when the concentration of H2 is doubled but four times as fast when the concentration of NO is doubled. What is the overall reaction order? I did it like this: k[NO]^m[H2]^n 2r=[H2]^n, meaning that the order for ...

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100