1. Chemistry

    Which of the following is a condensation reaction? Two monomers combine when one adds to the double bond of another. Two monomers break away when one forms a double bond. Two monomers break away with the addition of a water molecule. Two monomers form a new bond with the loss ...
  2. Chemistry

    Consider a one step reaction. Which of the following does not describe the activation energy of the process? The minimum amount of energy needed for a reaction to occur The energy difference between the starting point and the transition state The energy difference between the ...
  3. calculus maths

    Hi can some one help, explain the following please. I seem to have issues with this: 1- Find the corresponding particular solution (in implicit form) that satisfies the initial; condition y = when x = 0. 2- Find the explicit form of this particular solution. 3- What is the ...
  4. math

    Month J F M A M J J A S O N D TOTAL 0 0 0 0 1 21 27 16 12 2 0 0 The chart above represents the monthly rainfall in inches in Calcutta in a certain year. Calculate and explain the significance of the following measures based on this data.
  5. chemistry

    what can we say about the EA for an exothermic reaction? a...must be <0 b...greater for reverse reaction c...greater for forward reaction d...can't say anything
  6. Chemistry

    2A + 3B + C ⟶ D + E The rate constant for this reaction is 0.25, and the reaction is second order in A and is first order in B and C. Which option correctly gives the rate of the reaction if [A] is 0.4 M, [B] is 0.1 M and [C] is 0.2 M?
  7. why will no one answer? chem

    The decomposition of hydrogen peroxide in solution and in the presence of iodide ion was studied in laboratory, and the following mechanism proposed based on the experimental data. H2O2 + I - = H2O + IO - (slow) H2O2 + IO - = H2O + O2 + I - (fast) Which one of the following ...
  8. Chemistry

    1) Consider the following substance: V3N5. What is the oxidation number of vanadium and nitrogen? 2) Consider the following substance: Mn2O7. What is the oxadation number of manganese and oxygen? 3) Consider the following reaction: Al2(SO4)3. What is the oxidation number of ...
  9. Chemistry!!!!

    1. For a reaction mechanism to be plausible, what 2 criteria must be met? 2. The reaction between CO and NO2 to produce NO and CO2 is thought to occur in 2 steps. NO2 + NO2 ====> NO + NO3 NO3 + CO =====> NO2 + CO2 The experimental rate law is, R=k[NO2]2 Write the ...
  10. Chemistry!!!!

    1. For a reaction mechanism to be plausible, what 2 criteria must be met? 2. The reaction between CO and NO2 to produce NO and CO2 is thought to occur in 2 steps. NO2 + NO2 ====> NO + NO3 NO3 + CO =====> NO2 + CO2 The experimental rate law is, R=k[NO2]2 Write the ...
  11. HISTORY HELP plsssssssss

    Use this image to answer the following question: The picture shows an Aztec calendar, which is circular. The whole surface is covered with intricate designs that are too small for the reader to identify. At the center of the circle is a the face of the sun god, with its tongue...
  12. chemistry ASAP please!!

    One reaction that destroys O3 molecules in the stratosphere is NO + O3  NO2 + O2 When this reaction was studied in the laboratory, it was found to be first order with respect to both NO and O3 with a rate constant of 1.9 x 104 mol L-1S-1. If [NO] = 1.2 x 10-5 mol L-1 ...
  13. "le Chat. Principle" #2

    Hi, there are 5 questions and I was wondering if you could check them for me. Thanks! 3. The hypothetical equilibrium reaction represented by the equation that follows. QA(s) + 2 X(g)>>>Q(l) + X2A(g) + energy This reaction can be shifted to increase the yield of ...
  14. reversible reaction

    A+B <-> C+D You mix some of A and B in a closed container and the reaction begins. As time passes, what happens to the amounts of A & B? As time goes on, what will happen to the rate at which A & B turn into C + D? Was there any C & D present when the reaction first ...
  15. probability

    tell whether the outcome is impossible, unlikely, as likely as not, likely, or certain. Then write the probability in simplest form. choosing a red crayon from a box of 24 different colored crayons, including red crayons. please help. I don't get this. thank you very much, God...
  16. chemistry

    What is the sum of the coefficients (including “1”) of the balanced equation? __CaCO3 + __NaF __ CaF2 + __Na2CO3 4 5 6 7 8 If you start with 20.0 grams CaCO3, how many moles of CaCO3 do you have? 20.0 2.00 .200 .0200 .0386 If you start with .500 moles of NaF, how many ...
  17. chemistry

    Hey Guys so I have this problem with ICE tables that is extremely confusing for me so I would love some help on it! At a Certain Temperature, the equilibrium constant for the reaction of NO with Cl2 is 6250. If the initial concentration of NOCl is 1.0M and that of NO 0.10M ...
  18. Chemistry

    According to the following reaction, how many moles of hydrogen iodide will be formed upon the complete reaction of 30.0 grams of hydrogen gas with excess iodine? hydrogen (g) + iodine (s) hydrogen iodide (g) moles hydrogen iodide
  19. chemistry

    A chemist wishes to determine the rate of reaction of zinc with hydrochloric acid. The equation for the reaction is: Zn(s) + 2HCl(aq) ---> H2(g) + ZnCl2(aq) A piece of zinc is dropped into 1.00 L of 0.100 M HCl and the following data were obtained: Time/Mass of Zinc 0 s/0....
  20. Chemistry

    The problem is: Calculate the standard free-energy change for the following reaction at 25 degrees Celsius. 2Au^+3(aq) + 3Cr(s)-> 2Au(s) + 3Cr^+2(aq) I worked it out, getting half reaction: Au^3+ + 3e- -> Au; E = 1.498 Cr^3+ + 3e- -> Cr; E = -0.74 Ecell = 1.498 - (-0....
  21. Chemistry (URGENT)

    Suppose a reaction involved a finely ground powder reacting with a concentrated acid. Suggest three methods of decreasing the reaction rate. 1. By placing the reactants in cold water. 2. ? 3. ? Can someone please help? I can't think of what else I can do to slow down the ...
  22. Chemistry (urgent)

    Suppose a reaction involved a finely ground powder reacting with a concentrated acid. Suggest three methods of decreasing the reaction rate. 1. By placing the reactants in cold water. 2. ? 3. ? Can someone please help? I can't think of what else I can do to slow down the ...
  23. Chem (electron transfer)

    KMnO4 + HCl → MnCl2 + Cl2 + H2O + KCl If the reaction occurs in an acidic solution where water and H+ ions are added to the half-reactions to balance the overall reaction, how many electrons are transferred in the balanced reduction half-reaction? The answer I got is 5*2 ...
  24. chem

    At hihg temperatures Sodium chlorate decomposes to form Sodium Chloride and Oxygen gas. A 0.8765 gram sample of sodium chlorate was heated until the reaction ended when Oxygen gas production was ceased. The Oxygen gas collected over water occupied 57.2 ml at temperature of 295...
  25. chemistry

    MnO4–(aq) + Cl–(aq) Mn2+ + Cl2(g) (unbalanced) i. Write the reduction and oxidation half-reactions (without electrons). (.5 point) ii. Balance the equations for atoms (except O and H). (.5 point) iii. Balance the equations for atoms O and H using H2O and H+. (.5 point) iv...
  26. chemistry

    MnO4–(aq) + Cl–(aq) Mn2+ + Cl2(g) (unbalanced) i. Write the reduction and oxidation half-reactions (without electrons). (.5 point) ii. Balance the equations for atoms (except O and H). (.5 point) iii. Balance the equations for atoms O and H using H2O and H+. (.5 point) iv...
  27. BIOLOGY

    Table Sugar can react with water to form 2 other compounds, glucose & fructose. But, when you add sugar to a glass of water the reaction is very slow - WHY? What would it need to speed it up?
  28. Chemistry

    64g of oxygen reacts completely with methane gas to form 44g of carbon dioxide gas and 36 g of water vapour. Calculate the amount of methane that takes part in the reaction .
  29. Chemistry

    What is the net ionic equation form the reaction between Na2S(aq) and Pb(HCO3)2(aq)? Just wanting to make sure this correct: 2Na+(aq) + S2-(aq) + Pb2+(aq) + 2HCO3-(aq) --> 2Na+(aq) + 2HCO3-(aq) + PbS(s)
  30. Chemistry

    In a given 1st order reaction A ---> products, the initial concentration of A is 0.40 M. What will be the concentration of A after 15 seconds if the half-life of the reaction is 3 seconds? I found the concentration to be 1.25 x 10-2 M But then how do I find the rate ...
  31. Chemistry

    1. Iron oxide and carbon monoxide react according to the following equation . Identify which reactant is limiting and which is excess if 43.5 grams of Fe2O3 reacts with 43.5 grams of CO Fe2O3 + 3CO2 --> 3CO2 + 2Fe 2. Calculate the percent yield of Carbon dioxide if 20.0 ...
  32. chemistry HELP!!

    Reaction Rate = -(1/2) [d(H2O2)/dt] = [d(O2)/ dt] Using 25 mL of a 0.2 M hydrogen peroxide solution, the following results are obtained from the equation above: 8.62 mL of gas is collected in 120 seconds. (Assume 760 Torr = 1 atm) Room temperature is 25 degrees C and the vapor...
  33. chem

    What mass of ice at 0°C can be melted by the addition of 1670 joules of heat? When the temperature is decreased on the following system at equilibrium: 2 HCl(aq) + Mg(s) <--> MgCl2(aq) + H2(g) + heat a. In order to restore equilibrium, the reaction shifts left, toward ...
  34. Chemistry - Rate Determining Step

    The rate law for the reaction 2NO (g) + Cl2 (g) -> 2NOCl (g) is given by rate = k[NO][Cl2] A mechanism involving the following steps has been proposed for the reaction: NO (g) + Cl2 (g) -> NOCl2 (g) NOCl2 (g) + NO (g) -> 2NOCl (g) If this mechanism is correct, what ...
  35. Chemistry

    What does the symbol ∆H stand for? one Calorie given off by a reaction the heat capacity of a substance*** the heat of a reaction for a chemical reaction the specific heat of a substance
  36. chemistry

    Ammonium nitrate decomposes explosively at high temperatures to form nitrogen, oxygen, and water vapor. 2NH4NO3-->2N2+4H2O+O2. Calculate the number of grams of water formed when 25 L of N2 is produced in this reaction (assume STP)
  37. Chemistry

    Zinc sulfide and oxygen gas react to form oxide and sulfur dioxide. Determine the amount of ZnO that should be produced in a reaction between 46.5 g of ZnS and 13.3 g of oxygen. What is the mass of the xs reactant? Please show work
  38. Chemistry

    write 2-3 sentences describing and identifying the type of chemical reaction that occurs when Fe^2+ reacts with potassium permanganate and specifying the type of solution required for the reaction to occur I don't know what type of reaction this is or what other solution is ...
  39. chemistry

    a) Describe how to determine if a reaction will be thermodynamically favorable. b) Describe what happens to the Gibbs Free Energy term when a chemical reaction is reversed. c) Describe how coupling reactions are used to drive an unfavorable chemical reaction.
  40. chemistry

    What mass of benzoic acid can be made from a reaction where 4.87g benzyl alcohol is combined with 300mL of bleach? The reaction is conducted in water and dichloromethane. Describe a method of separating the benzoic acid from the sodium chloride byproduct after the reaction is ...
  41. chemistry

    What mass of benzoic acid can be made from a reaction where 4.87g benzyl alcohol is combined with 300mL of bleach? The reaction is conducted in water and dichloromethane. Describe a method of separating the benzoic acid from the sodium chloride byproduct after the reaction is ...
  42. chemistry

    According to the following reaction, how many grams of sulfur trioxide will be formed upon the complete reaction of 21.2 grams of oxygen gas with excess sulfur dioxide? sulfur dioxide (g) + oxygen (g) sulfur trioxide (g)
  43. Chemistry

    According to the following reaction, how many grams of nitrogen gas will be formed upon the complete reaction of 22.2 grams of hydrogen gas with excess nitrogen monoxide? nitrogen monoxide (g) + hydrogen (g) nitrogen (g) + water (l)
  44. Chemistry

    I am really confused on this problem pleas help me. N2H4(l)+O2(g)(arrow)N2(g)+2H2O(g) a. How many liters of N2 (at STP) form when 1.0 kg N2H4 react with 1.0 kg O2? b. How many grams of excess reagent remain after the reaction? 1 kg of N2H4 is 1000g/(32g/mol) = 31.25 moles of ...
  45. Chemistry

    Consider the reaction: 2CO(g) + O2(g) equilibrium 2CO2 (g) Write the equilibrium expression for this reaction. Keq = ?? Addition of a catalyst to this reaction would have what effect on the equilbrium? Addition of a catalyst to this reaction would have what effect on the rate?
  46. chemistry

    When N2O5 (g) is heated it dissociates into N2O3 (g) and O2 (g) according to the following reaction: N2O5 (g) <--> N2O3 (g) + O2 (g) Kc=7.75 at a given temperature. The N2O3 (g) dissociates to give N2O (g) and O2 (g) according the following reaction: N2O3 (g) <--> ...
  47. math

    Which of the following fractions is in simplest form? a)5/6 b)6/8 c)8/10 d)2/12. My answer is a.
  48. math

    Change each of the following to simplest form 1 8 /10.is the answer 9/5
  49. math

    Change each of the following to simplest form. 18/8. Is the answer 9/4
  50. math

    Change each of the following to simplest form 5 12/8. Is the answer 13/2
  51. Math HELP HELP

    Express the following in completed square form. x^2+4x-41
  52. Maths

    Write. The following in standard. Form 6120
  53. Calculus

    Which of the following is written in explicit form? A.y=x B.x^2-6xy-9y^2=0 C.y=0 D. y= -√1-x^2
  54. math

    which of the following expressions is expressed in implicit form? A. xy=1 B. y=1/x C. y=x+1 D. y=1
  55. Maths

    Compute the following polynomial in standard form: (1 + x + x^2 + . . . + x^16)(1 - x)
  56. math

    Which of the following fractions is in its simplest form? 16/4 7/8 100/35 3/27
  57. science

    a certain's plant root contain higher concentrations of nitrate than the soil that surrounds them. Which mechanism explains the movement of nitrates form the soil into the plant's roots? a)osmosis b)facilitated diffusion c)active transport d)filtration I chose c) active ...
  58. Chemistry

    Suppose that 0.650 mol of methane, CH4(g), is reacted with 0.800 mol of fluorine, F2(g), forming CF4(g) and HF(g) as sole products. Assuming that the reaction occurs at constant pressure, how much heat is released? Substance & Enthalpy of Form. (kJ/mol) C(g) 718.4 CF4(g) -679....
  59. chem

    Fluorine and krypton react to form binary compounds when a mixture of the two gases is heated to 500C in a nickel reaction vessel. A 100mL nickel container is filled with fluorin and krypton to partial pressures of 1.24 atm and 10.10 atm, respectively at a room temperature of ...
  60. Chemistry

    The following reaction is used to produce tungsten(VI)oxide: WS3(s) + O2(g) ¨ WO3(s) + SO2(g) The WO3 is then heated and undergoes a decomposition reaction produce tungsten and oxygen gas. How many grams of tungsten could be produced if 39.27 grams of WS3 are used
  61. Chemistry

    Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...
  62. Chemistry

    Le Chateleir`s Principle Please check if my answers are right and i dunt know some of them: Consider the following system at equilibrium: A(aq)+B(aq) <---> 2C(aq) Classify each of the following actions by whether it causes a leftward shift, a rightward shift, or no shift...
  63. english

    You need to explain applications: I assumed you were describing visa applications. Should applications from certain countries be given priority? College applications? This is a sensitive subject but in my opinion, yes. I found it extremely valuable to study alongside other ...
  64. phi 103

    Identify the form of the following argument. Either the Pacers or the Kings will win tonight. The Pacers will win. Therefore, the Kings will not win. a. not a valid form b. disjunctive syllogism c. modus ponens d. hypothetical syllogism e. modus tollens
  65. Chemisty

    Fluorine gas can react with ammonia gas to produce dinitrogen tetrafluoride gas and hydrogen fluoride gas. This reaction is described by the following balanced equation: 5 F2 (g) + 2 NH3 (g) N2F4 (g) + 6 HF (g) What mass of hydrogen fluoride gas is produced from 135 g of ...
  66. chemistry

    50.0 mL of a solution of HCl is combined with 100.0 mL of 1.15 M NaOH in a calorimeter. The reaction mixture is initially at 22.4°C and the final temperature after reaction is 31.2°C. What is the molarity of the HCl solution? You may assume that there is an excess of base (...
  67. math

    in math problem.how to change simplified fraction form 2/3 to decimal form and percent form
  68. chem

    What is the sum of the coefficients (including “1”) of the following reaction? Sodium sulfate + calciumhydroxide--> ???
  69. chemistry

    What is the net ionic equation for the following reaction?FeCl3(aq)+3LiOH(aq) -> Fe(OH)3(s)+3LiCl(aq)
  70. chem101

    will the following reaction take place nh3+h2o= nh2 + h3o
  71. Organic Chemistry

    The following reaction would produce a(n) __________. R-OH + R'COOH →
  72. Chemistry

    Explain the effect each of the following has on the rate of a reaction. reactivity of reactants inhibitors
  73. chemistry

    The following reaction consumes 2.40 kg of CO, How many total liters of gas are formed at STP?
  74. Chemistry

    Estimate the enthalpy change for the following reaction OH(g)+CH4(g)==>CH3(g)+H2O(g)
  75. Chemistry

    How do I balance the following into an equation? 10 mL of 2.0 M HCl is react with 8 mL of 1.7 M Ca(OH)2 in a neutralization reaction.
  76. chemistry

    Will the following reaction occur Spontaneously? Show your work and reasoning in each case 1. Ca(s) + Sn^4+ -->
  77. chemistry

    what element is undergoing oxidation in the following reaction Zn(s)+AgNO3(aq) Zn(NO3)2(aq)+2Ag(s)
  78. chemistry

    what element is undergoing oxidation in the following reaction Zn(s)+AgNO3(aq) Zn(NO3)2(aq)+2Ag(s)
  79. Chemistry

    For the following fusion reaction, calculate the change in energy per mole. 2/1 H + 3/2 He -> 4/2 He + 1/1 H
  80. Chemistry

    For the following fusion reaction, calculate the change in energy per mole. 2/1 H + 3/2 He -> 4/2 He + 1/1 H
  81. science

    what substance is being reduced in the following redox reaction? HgCl2 + Sn^2 = Sn^4 + Hg2Cl2 + Cl-
  82. Chemistry

    What element is undergoing oxidation (if any) in the following reaction? CH4(g) + 2 O2(g) ¨ CO2(g) + 2 H2O(g)
  83. Chemistry

    Name the organic product of the following nucleophilic substitution reaction. OH+CH3CH2I
  84. Chemistry

    What is the minimum amount of 5.9M M H 2 SO 4 necessary to produce 26.7g of H 2 (g) according to the following reaction? 2Al(s)+3H 2 SO 4 (aq)¨Al 2 (SO 4 ) 3 (aq)+3H 2 (g)
  85. chemestry

    consider the reaction 2N2O(g) == O2(g)+2N2(g).which of the following will cause a shift in the equilibrium to the left?
  86. Chemistry

    Calculate delta g and Kp for the following equilibrium reaction. Keep getting 7.2E-81 and the answer is 4.5E-81 Why?
  87. Chemistry

    AP Chem - Which element is oxidized in the following reaction: CuO(s) + H2 (g)  Cu(s) + H2O (l)
  88. Chemistry

    Name the organic product of the following nucleophilic substitution reaction OH-+CH3I
  89. English academy.chemistry

    Complete the following reaction 2F2(g) +2H2O(ĺ)=?
  90. kumar

    The addition of a catalyst during a chemial reaction alters which of the following quantities?
  91. chemistry

    How many mL of 0.6 M H2SO4 solution are needed to react completely with 23.62 g of Fe2O3 in the following reaction?
  92. chemistry

    Calculate the standard enthalpy change for the following reaction at 25 °C. H2O+C(graphite)(s) --> H2(g) +CO(g)
  93. chemistry

    estimate the enthalpy change for the following reaction: OF2 + H2O = O2 + 2HF
  94. chemistry

    What is the ∆G for the following reaction under standard conditions (T = 298 K) for the formation of NH4NO3(s)?
  95. Anatomy

    I have a question In a dehydration synthsis reaction which of the following occurs a. hydrogen and oxygen are removed from the reactant b. water is added to the reactants c. water is broken down into hydrgen and oxygen d. both a and c I think it would definitely be a and I ...
  96. Physics

    Consider the following standing wave, (all units are SI) z=0.2sin(0.4y)cos(350t) (a) what is the wavelength? (b) what is the angular frequency ω in radians/sec? (c) what is the frequency (f) in Hz? (d) The values of y where the displacement is always zero, are of the form...
  97. Last Question Plz helppp:((im soo sleepy!!:(

    1)The reaction between solid sodium and iron(III) oxide, Fe2O3(s), is one in a series of reactions that occurs when an automobile air bag inflates. 6Na(s) + Fe2O3(s) -> 3Na2o(s) + 2Fe(s) If 100.0 g of iron(III) oxide are used in this reaction, what mass of solid iron will ...
  98. Chemistry

    Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NOREACTION. Are my answers below correct? I used the textbook 1. sodium chloride and lead (II) acetate 2,potassium sulfate and ...
  99. General Chemistry

    The problem is: Calculate the standard free-energy change for the following reaction at 25 degrees Celsius. 2Au^+3(aq) + 3Cr(s)-> 2Au(s) + 3Cr^+2(aq) I worked it out, getting half reaction: Au^3+ + 3e- -> Au; E = 1.498 Cr^3+ + 3e- -> Cr; E = -0.74 Ecell = 1.498 - (-0....
  100. chemistry

    Please help ~~ Because i don't ever know the reaction in organic compound .. Do anyone has the data bank of the organic chemicals ? I cannot find out what are the compound in the reaction with it ~~ 1. What do butylamine give when it is dissolved in water ? A nearly pH10 ...
  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. 16
  18. 17
  19. 18
  20. 19
  21. 20
  22. 21
  23. 22
  24. 23
  25. 24
  26. 25
  27. 26
  28. 27
  29. 28
  30. 29
  31. 30
  32. 31
  33. 32
  34. 33
  35. 34
  36. 35
  37. 36
  38. 37
  39. 38
  40. 39
  41. 40
  42. 41
  43. 42
  44. 43
  45. 44
  46. 45
  47. 46
  48. 47
  49. 48
  50. 49
  51. 50
  52. 51
  53. 52
  54. 53
  55. 54
  56. 55
  57. 56
  58. 57
  59. 58
  60. 59
  61. 60
  62. 61
  63. 62
  64. 63
  65. 64
  66. 65
  67. 66
  68. 67
  69. 68
  70. 69
  71. 70
  72. 71
  73. 72
  74. 73
  75. 74
  76. 75
  77. 76
  78. 77
  79. 78
  80. 79
  81. 80
  82. 81
  83. 82
  84. 83
  85. 84
  86. 85
  87. 86
  88. 87
  89. 88
  90. 89
  91. 90
  92. 91
  93. 92
  94. 93
  95. 94
  96. 95
  97. 96
  98. 97
  99. 98
  100. 99
  101. 100