a certain reaction has the following generaln form

72,094 results, page 17


Ethane, C2H6, forms ·CH3 radicals at 700.°C in a first-order reaction, for which k = 1.98 h-1. (a) What is the half-life for the reaction? (b) Calculate the time needed for the amount of ethane to fall from 1.00 10-3 mol to 2.48 10-4 mol in a 500. mL reaction vessel at 700...


Hello, I'm doing a review sheet for math and a certain question states: "solve: ln(3/4)" What should I take solve to mean? Do I just change it's form to ln(3/4) = ln3 - ln 4 ? Or, perhaps, I need to actually enter in the value into a calculator. How would you take on this ...


The rate of a first-order reaction is followed by spectroscopy, monitoring the absorption of a colored reactant at 520 nm . The reaction occurs in a 1.29-cm sample cell, and the only colored species in the reaction has an extinction coefficient of 5700 cm-1M-1 at 520 nm . a) ...


The rate of a first-order reaction is followed by spectroscopy, monitoring the absorption of a colored reactant at 520 nm . The reaction occurs in a 1.29-cm sample cell, and the only colored species in the reaction has an extinction coefficient of 5700 cm-1M-1 at 520 nm . a) ...


Read the following stage directions and dialouge from billy Elliot: [Billy suddenly sees DAD and freezes. His reaction puzzles Mrs. Wilkinson for a second. The music comes to a standstill. Mrs. Wilkinson turns to see Dad.] DAD: You.Out.Now What most likely motivates Billy's ...

ap chemistry

I have a lot of questions actually. it's electrochemistry (which is obviously a bunch of fun) 2 electrodes Cr(s)/Cr3+ and Sn(s)/Sn2+ are combined to afford a spontaneous electrochemical reaction. the standard reduction potention in V for Cr3+ and Sn2+ are -.74 and -.14 V ...


What element is undergoing reduction in the following reaction? Zn(s) + AgNO3(aq) --> Zn(NO3)2 + 2 Ag(s)


Determine the delta H for the following reaction C3H4(g) + 2H2(g) --> C3H8(g)


the reaction with ammonium hydroxide with the following metals: Fe3+ Mn2+


At 1100 K, Kp = 0.25 for the following reaction. 2 SO2(g) + O2(g) 2 SO3(g) What is the value of K at this temperature?


At 1100 K, Kp = 0.25 for the following reaction. 2 SO2(g) + O2(g) 2 SO3(g) What is the value of K at this temperature?


calculate the value of the equilibrium constant K for this reaction A+B <--> C from the following information 3C <--> D Kc= 7.1*10^-4 D <--> 3A + 3B Kc= 2.9*10^-2


What is ΔGo at 1000 oC for the following reaction? CaCO3 (s) CaO (s) + CO2 (g)


how does an increase in pressure affect the following reaction? C2H2(g)+H2(g) C2H4(g)


Balance the following redox reaction. MnO4 (aq) + Fe (s) --> Mn2+ (aq) +Fe2+ (aq)


Determine the equilibrium constant for the following reaction. 2 Fe3+(aq) + H2(g) 2 Fe2+(aq) + 2 H+(aq)


write a sentence for the following reaction PCl5(s)=PCl3(s)+Cl2(g)


How do I balance the following reaction in acidic conditions? N2O4 + S8 = NO + H2SO3????


Complete the following nuclear reaction: ^16,v8 O + ^4, v2 He → ________ + ^19, v10 Ne 1p 1n 2H 3H


Which one of the following factors would not speed up a chemical reaction


What is the oxidized substance in the following reaction? Fe + 2HCl → FeCl2 + H2


Write the Kc expression for the following reaction: Fe3+ + SCN- = FeSCN2+


When 0.100 mol of carbon is burned in a close vessel with 8.00g of oxygen, how many grams of carbon dioxide can form? Which reactant is in excess, and how many grams of it remain after the reaction?


When 0.100 mol of carbon is burned in a close vessel with 8.00g of oxygen, how many grams of carbon dioxide can form? Which reactant is in excess, and how many grams of it remain after the reaction?


For the reaction between nitrogen and oxygen to form nitric oxide, beginning with 0.067 mol of N2, N2(g) + O2(g)= 2 NO(g) a. how many moles of O2 are required to completely consume the N2? b. how many moles of NO are obtained when the N2 is completely reacted?


9. The reaction of 50 mL of N2 gas with 150 mL H2 gas to form ammonia via the equation: N 2(g) + 3H2 (g) → 2NH3 (g) will produce a total of mL of ammonia if pressure and temperature are kept constant

calculus maths

Hi can some one help, explain the following please. I seem to have issues with this: 1- Find the corresponding particular solution (in implicit form) that satisfies the initial; condition y = when x = 0. 2- Find the explicit form of this particular solution. 3- What is the ...

Criminal Justice

Which one of the following is NOT a method for developing invisible fingerprints during a crime scene search for evidence? A. Powders B. Rolling C. Chemicals D. Fuming is it B 2. Information obtained during an interview and recorded in an investigator's field notes is ...


Which of the following is a condensation reaction? Two monomers combine when one adds to the double bond of another. Two monomers break away when one forms a double bond. Two monomers break away with the addition of a water molecule. Two monomers form a new bond with the loss ...

Chemistry: Answer check please!

1. Reactions follow the law of conservation of mass. a.) True b.) False Answer: True 2. Reactants are the materials used in a chemical reaction. a.) True b.) False Answer: True 3. In a chemical equation, the mass on the left of the arrow equals the mass on the right. a.) True ...


The following reaction is used to produce tungsten(VI)oxide: WS3(s) + O2(g) → WO3(s) + SO2(g) The WO3 is then heated and undergoes a decomposition reaction produce tungsten and oxygen gas. How many grams of tungsten could be produced if 16.91 grams of WS3 are used? How ...

AP Chemistry

Consider the following reaction. CaSO4(s) Ca2+(aq) + SO42-(aq) At 25°C the equilibrium constant is Kc = 2.4 10-5 for this reaction. (a) If excess CaSO4(s) is mixed with water at 25°C to produce a saturated solution of CaSO4, what are the equilibrium concentrations of Ca2+ ...


Consider a one step reaction. Which of the following does not describe the activation energy of the process? The minimum amount of energy needed for a reaction to occur The energy difference between the starting point and the transition state The energy difference between the ...

why will no one answer? chem

The decomposition of hydrogen peroxide in solution and in the presence of iodide ion was studied in laboratory, and the following mechanism proposed based on the experimental data. H2O2 + I - = H2O + IO - (slow) H2O2 + IO - = H2O + O2 + I - (fast) Which one of the following ...


Month J F M A M J J A S O N D TOTAL 0 0 0 0 1 21 27 16 12 2 0 0 The chart above represents the monthly rainfall in inches in Calcutta in a certain year. Calculate and explain the significance of the following measures based on this data.


what can we say about the EA for an exothermic reaction? a...must be <0 b...greater for reverse reaction c...greater for forward reaction d...can't say anything


1) Consider the following substance: V3N5. What is the oxidation number of vanadium and nitrogen? 2) Consider the following substance: Mn2O7. What is the oxadation number of manganese and oxygen? 3) Consider the following reaction: Al2(SO4)3. What is the oxidation number of ...


1. For a reaction mechanism to be plausible, what 2 criteria must be met? 2. The reaction between CO and NO2 to produce NO and CO2 is thought to occur in 2 steps. NO2 + NO2 ====> NO + NO3 NO3 + CO =====> NO2 + CO2 The experimental rate law is, R=k[NO2]2 Write the ...


1. For a reaction mechanism to be plausible, what 2 criteria must be met? 2. The reaction between CO and NO2 to produce NO and CO2 is thought to occur in 2 steps. NO2 + NO2 ====> NO + NO3 NO3 + CO =====> NO2 + CO2 The experimental rate law is, R=k[NO2]2 Write the ...

HISTORY HELP plsssssssss

Use this image to answer the following question: The picture shows an Aztec calendar, which is circular. The whole surface is covered with intricate designs that are too small for the reader to identify. At the center of the circle is a the face of the sun god, with its tongue...

"le Chat. Principle" #2

Hi, there are 5 questions and I was wondering if you could check them for me. Thanks! 3. The hypothetical equilibrium reaction represented by the equation that follows. QA(s) + 2 X(g)>>>Q(l) + X2A(g) + energy This reaction can be shifted to increase the yield of ...

chemistry ASAP please!!

One reaction that destroys O3 molecules in the stratosphere is NO + O3  NO2 + O2 When this reaction was studied in the laboratory, it was found to be first order with respect to both NO and O3 with a rate constant of 1.9 x 104 mol L-1S-1. If [NO] = 1.2 x 10-5 mol L-1 ...

reversible reaction

A+B <-> C+D You mix some of A and B in a closed container and the reaction begins. As time passes, what happens to the amounts of A & B? As time goes on, what will happen to the rate at which A & B turn into C + D? Was there any C & D present when the reaction first ...


What is the sum of the coefficients (including “1”) of the balanced equation? __CaCO3 + __NaF __ CaF2 + __Na2CO3 4 5 6 7 8 If you start with 20.0 grams CaCO3, how many moles of CaCO3 do you have? 20.0 2.00 .200 .0200 .0386 If you start with .500 moles of NaF, how many ...


According to the following reaction, how many moles of hydrogen iodide will be formed upon the complete reaction of 30.0 grams of hydrogen gas with excess iodine? hydrogen (g) + iodine (s) hydrogen iodide (g) moles hydrogen iodide


A chemist wishes to determine the rate of reaction of zinc with hydrochloric acid. The equation for the reaction is: Zn(s) + 2HCl(aq) ---> H2(g) + ZnCl2(aq) A piece of zinc is dropped into 1.00 L of 0.100 M HCl and the following data were obtained: Time/Mass of Zinc 0 s/0....


Hey Guys so I have this problem with ICE tables that is extremely confusing for me so I would love some help on it! At a Certain Temperature, the equilibrium constant for the reaction of NO with Cl2 is 6250. If the initial concentration of NOCl is 1.0M and that of NO 0.10M ...


The problem is: Calculate the standard free-energy change for the following reaction at 25 degrees Celsius. 2Au^+3(aq) + 3Cr(s)-> 2Au(s) + 3Cr^+2(aq) I worked it out, getting half reaction: Au^3+ + 3e- -> Au; E = 1.498 Cr^3+ + 3e- -> Cr; E = -0.74 Ecell = 1.498 - (-0....


At hihg temperatures Sodium chlorate decomposes to form Sodium Chloride and Oxygen gas. A 0.8765 gram sample of sodium chlorate was heated until the reaction ended when Oxygen gas production was ceased. The Oxygen gas collected over water occupied 57.2 ml at temperature of 295...


Table Sugar can react with water to form 2 other compounds, glucose & fructose. But, when you add sugar to a glass of water the reaction is very slow - WHY? What would it need to speed it up?


64g of oxygen reacts completely with methane gas to form 44g of carbon dioxide gas and 36 g of water vapour. Calculate the amount of methane that takes part in the reaction .


What is the net ionic equation form the reaction between Na2S(aq) and Pb(HCO3)2(aq)? Just wanting to make sure this correct: 2Na+(aq) + S2-(aq) + Pb2+(aq) + 2HCO3-(aq) --> 2Na+(aq) + 2HCO3-(aq) + PbS(s)

Chemistry (URGENT)

Suppose a reaction involved a finely ground powder reacting with a concentrated acid. Suggest three methods of decreasing the reaction rate. 1. By placing the reactants in cold water. 2. ? 3. ? Can someone please help? I can't think of what else I can do to slow down the ...

Chemistry (urgent)

Suppose a reaction involved a finely ground powder reacting with a concentrated acid. Suggest three methods of decreasing the reaction rate. 1. By placing the reactants in cold water. 2. ? 3. ? Can someone please help? I can't think of what else I can do to slow down the ...


MnO4–(aq) + Cl–(aq) Mn2+ + Cl2(g) (unbalanced) i. Write the reduction and oxidation half-reactions (without electrons). (.5 point) ii. Balance the equations for atoms (except O and H). (.5 point) iii. Balance the equations for atoms O and H using H2O and H+. (.5 point) iv...


MnO4–(aq) + Cl–(aq) Mn2+ + Cl2(g) (unbalanced) i. Write the reduction and oxidation half-reactions (without electrons). (.5 point) ii. Balance the equations for atoms (except O and H). (.5 point) iii. Balance the equations for atoms O and H using H2O and H+. (.5 point) iv...


1. Iron oxide and carbon monoxide react according to the following equation . Identify which reactant is limiting and which is excess if 43.5 grams of Fe2O3 reacts with 43.5 grams of CO Fe2O3 + 3CO2 --> 3CO2 + 2Fe 2. Calculate the percent yield of Carbon dioxide if 20.0 ...

chemistry HELP!!

Reaction Rate = -(1/2) [d(H2O2)/dt] = [d(O2)/ dt] Using 25 mL of a 0.2 M hydrogen peroxide solution, the following results are obtained from the equation above: 8.62 mL of gas is collected in 120 seconds. (Assume 760 Torr = 1 atm) Room temperature is 25 degrees C and the vapor...


In a given 1st order reaction A ---> products, the initial concentration of A is 0.40 M. What will be the concentration of A after 15 seconds if the half-life of the reaction is 3 seconds? I found the concentration to be 1.25 x 10-2 M But then how do I find the rate ...


What mass of ice at 0°C can be melted by the addition of 1670 joules of heat? When the temperature is decreased on the following system at equilibrium: 2 HCl(aq) + Mg(s) <--> MgCl2(aq) + H2(g) + heat a. In order to restore equilibrium, the reaction shifts left, toward ...

Chemistry - Rate Determining Step

The rate law for the reaction 2NO (g) + Cl2 (g) -> 2NOCl (g) is given by rate = k[NO][Cl2] A mechanism involving the following steps has been proposed for the reaction: NO (g) + Cl2 (g) -> NOCl2 (g) NOCl2 (g) + NO (g) -> 2NOCl (g) If this mechanism is correct, what ...


Ammonium nitrate decomposes explosively at high temperatures to form nitrogen, oxygen, and water vapor. 2NH4NO3-->2N2+4H2O+O2. Calculate the number of grams of water formed when 25 L of N2 is produced in this reaction (assume STP)


Zinc sulfide and oxygen gas react to form oxide and sulfur dioxide. Determine the amount of ZnO that should be produced in a reaction between 46.5 g of ZnS and 13.3 g of oxygen. What is the mass of the xs reactant? Please show work


According to the following reaction, how many grams of sulfur trioxide will be formed upon the complete reaction of 21.2 grams of oxygen gas with excess sulfur dioxide? sulfur dioxide (g) + oxygen (g) sulfur trioxide (g)


According to the following reaction, how many grams of nitrogen gas will be formed upon the complete reaction of 22.2 grams of hydrogen gas with excess nitrogen monoxide? nitrogen monoxide (g) + hydrogen (g) nitrogen (g) + water (l)


What does the symbol ∆H stand for? one Calorie given off by a reaction the heat capacity of a substance*** the heat of a reaction for a chemical reaction the specific heat of a substance


Which of the following fractions is in simplest form? a)5/6 b)6/8 c)8/10 d)2/12. My answer is a.


Change each of the following to simplest form 1 8 /10.is the answer 9/5


Change each of the following to simplest form. 18/8. Is the answer 9/4


Change each of the following to simplest form 5 12/8. Is the answer 13/2


Express the following in completed square form. x^2+4x-41


Write. The following in standard. Form 6120


Which of the following is written in explicit form? A.y=x B.x^2-6xy-9y^2=0 C.y=0 D. y= -√1-x^2


which of the following expressions is expressed in implicit form? A. xy=1 B. y=1/x C. y=x+1 D. y=1


Compute the following polynomial in standard form: (1 + x + x^2 + . . . + x^16)(1 - x)


Which of the following fractions is in its simplest form? 16/4 7/8 100/35 3/27


write 2-3 sentences describing and identifying the type of chemical reaction that occurs when Fe^2+ reacts with potassium permanganate and specifying the type of solution required for the reaction to occur I don't know what type of reaction this is or what other solution is ...


a) Describe how to determine if a reaction will be thermodynamically favorable. b) Describe what happens to the Gibbs Free Energy term when a chemical reaction is reversed. c) Describe how coupling reactions are used to drive an unfavorable chemical reaction.


I am really confused on this problem pleas help me. N2H4(l)+O2(g)(arrow)N2(g)+2H2O(g) a. How many liters of N2 (at STP) form when 1.0 kg N2H4 react with 1.0 kg O2? b. How many grams of excess reagent remain after the reaction? 1 kg of N2H4 is 1000g/(32g/mol) = 31.25 moles of ...


What mass of benzoic acid can be made from a reaction where 4.87g benzyl alcohol is combined with 300mL of bleach? The reaction is conducted in water and dichloromethane. Describe a method of separating the benzoic acid from the sodium chloride byproduct after the reaction is ...


What mass of benzoic acid can be made from a reaction where 4.87g benzyl alcohol is combined with 300mL of bleach? The reaction is conducted in water and dichloromethane. Describe a method of separating the benzoic acid from the sodium chloride byproduct after the reaction is ...


When N2O5 (g) is heated it dissociates into N2O3 (g) and O2 (g) according to the following reaction: N2O5 (g) <--> N2O3 (g) + O2 (g) Kc=7.75 at a given temperature. The N2O3 (g) dissociates to give N2O (g) and O2 (g) according the following reaction: N2O3 (g) <--> ...


Suppose that 0.650 mol of methane, CH4(g), is reacted with 0.800 mol of fluorine, F2(g), forming CF4(g) and HF(g) as sole products. Assuming that the reaction occurs at constant pressure, how much heat is released? Substance & Enthalpy of Form. (kJ/mol) C(g) 718.4 CF4(g) -679....


Consider the reaction: 2CO(g) + O2(g) equilibrium 2CO2 (g) Write the equilibrium expression for this reaction. Keq = ?? Addition of a catalyst to this reaction would have what effect on the equilbrium? Addition of a catalyst to this reaction would have what effect on the rate?

phi 103

Identify the form of the following argument. Either the Pacers or the Kings will win tonight. The Pacers will win. Therefore, the Kings will not win. a. not a valid form b. disjunctive syllogism c. modus ponens d. hypothetical syllogism e. modus tollens


a certain's plant root contain higher concentrations of nitrate than the soil that surrounds them. Which mechanism explains the movement of nitrates form the soil into the plant's roots? a)osmosis b)facilitated diffusion c)active transport d)filtration I chose c) active ...


The following reaction is used to produce tungsten(VI)oxide: WS3(s) + O2(g) ¨ WO3(s) + SO2(g) The WO3 is then heated and undergoes a decomposition reaction produce tungsten and oxygen gas. How many grams of tungsten could be produced if 39.27 grams of WS3 are used


Le Chateleir`s Principle Please check if my answers are right and i dunt know some of them: Consider the following system at equilibrium: A(aq)+B(aq) <---> 2C(aq) Classify each of the following actions by whether it causes a leftward shift, a rightward shift, or no shift...


Fluorine and krypton react to form binary compounds when a mixture of the two gases is heated to 500C in a nickel reaction vessel. A 100mL nickel container is filled with fluorin and krypton to partial pressures of 1.24 atm and 10.10 atm, respectively at a room temperature of ...


Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...


Fluorine gas can react with ammonia gas to produce dinitrogen tetrafluoride gas and hydrogen fluoride gas. This reaction is described by the following balanced equation: 5 F2 (g) + 2 NH3 (g) N2F4 (g) + 6 HF (g) What mass of hydrogen fluoride gas is produced from 135 g of ...


in math problem.how to change simplified fraction form 2/3 to decimal form and percent form


Consider the following standing wave, (all units are SI) z=0.2sin(0.4y)cos(350t) (a) what is the wavelength? (b) what is the angular frequency ω in radians/sec? (c) what is the frequency (f) in Hz? (d) The values of y where the displacement is always zero, are of the form...


50.0 mL of a solution of HCl is combined with 100.0 mL of 1.15 M NaOH in a calorimeter. The reaction mixture is initially at 22.4°C and the final temperature after reaction is 31.2°C. What is the molarity of the HCl solution? You may assume that there is an excess of base (...


What is the sum of the coefficients (including “1”) of the following reaction? Sodium sulfate + calciumhydroxide--> ???


What is the net ionic equation for the following reaction?FeCl3(aq)+3LiOH(aq) -> Fe(OH)3(s)+3LiCl(aq)


will the following reaction take place nh3+h2o= nh2 + h3o

Organic Chemistry

The following reaction would produce a(n) __________. R-OH + R'COOH →


Explain the effect each of the following has on the rate of a reaction. reactivity of reactants inhibitors


The following reaction consumes 2.40 kg of CO, How many total liters of gas are formed at STP?


  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100