a certain reaction has the following generaln form

72,980 results, page 13


In a hypochlorite oxidation reaction, cyclohexanol plus NaOCL & aq HOAc results in cyclohexanone. The intermediate in this reaction in ROCl where R = cyclohexyl. a.) Show how this intermediate decomposes to product in a E2-like reaction even at pH = 4-5; consider what the ...


Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Math Urgent

To form a certain sequence, the rules are: 1)If a number is even, divide by 2 to get the next number 2)If a number is odd, multiply by 3, then add 1 to the the next number. Starting with 12,the 1000th term would be... a.1 b.2 c.3 d.4 THANKS


The reaction describing the formation of ozone from oxygen is shown below. 3 O2(g) <--> 2 O3(g) Calculate Grxn at 288 K for this reaction in a flask where [O2] = 3.419 x 10-2 M and [O3] = 5.783 x 10-4 M. Assume G° = 326 kJ. Use molarity to construct the reaction ...


A chemical reaction takes place in a container of cross-sectional area 100 cm2 . As a result of the reaction, a piston is pushed out through 19 cm against an external pressure of 596 torr. What is the value for w for this reaction?


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...


Answer check: Define a catalyst and explain a catalyst's role in a chemical reaction. A catalyst is a substance that speeds a chemical reaction without being permanently changed itself. It works by providing a convenient surface for the reaction to occur. The reacting ...


Hydrogen peroxide can be prepared in several ways. One method is the reaction between hydrogen and oxygen, another method is the reaction between water and oxygen. Calculate the ΔG°rxn of each reaction below? 1) H2(g) + O2(g) <==> H2O2(l) ΔG°rxn=? (in kJ) 2) ...


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? I think the answer is B but not sure. a) That there is no reaction force-the net force on the object is ...


I have an assignment to write an equation to point-slope form, then to standard form, and then to slope-intercept form. I have used the points (-2,-1) or (1,2), but I used (-2,-1). Now, I have the point-slope form of y + 1= 1(x + 2) and the standard form of y – 1x = -1. When...


Sixty-four students in an introductory college economics class were askd how many credits they had earned in college, and how certain they were about their choice of major. At a = .01, is the degree of certainty independent of credits earned? Credits Very Somewhat Very Row ...


Which of the following reactions will be spontaneous at standard state? Not all the reactions are balanced, so make sure they are balanced first. The ΔG of formation data can be found in an appendix in your text book. You may select multiple answers. Any reaction with ...


The standard free energy of activation of a reaction A is 88.6 kJ mol–1 (21.2 kcal mol–1) at 298 K. Reaction B is one hundred million times faster than reaction A at the same temperature. The products of each reaction are 10.0 kJ mol–1 (2.39 kcal mol–1) more stable ...


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? Is A the correct answer? a) That there is no reaction force-the net force on the object is zero, so the ...


What is the order of the reaction for the following reaction and for each reagent given? A + 2B + C --> productions Experiment / A / B / C / rate 1 / 0.002 / 0.15 / 0.132 / 0.0057 2 / 0.002 / 0.25 / 0.132 / 0.0158 3 / 0.003 / 0.15 / 0.132 / 0.0114 4 / 0.003 / 0.15 / 0.264...


A hypothesis test is conducted with respect to the mean weight (in ounces) of potato chip bags form a certain manufacturer. The hypotheses are: H0:  = 0.8 and Ha:  ≠ 0.8. Which confidence level would support the conclusion that there is insufficient ...


When the gases dihydrogen sulfi and oxygen react, they form the gases sulfu dioxid and water vapor. How od you write a balanced equation for the reaction?

Intro Chem

4Al(s) + 3O2(g)2Al2O3(s) Delta H reaction = -3351.4 kJ How much energy is transferred when 42.6 g of aluminum reacts to form aluminum oxide? Thanks


gaseous hydrogen and fluorine combine in the reaction above to form hydrogen fluoride with an enthalpy change of -540kJ. What is the value of the heat of formation of HF(g)

Adv AP Honors Chemistry

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...


1.All of the balloons on the string (popped) except two. 2.Do you (want) to buy those books? 3.Daniel's dog is (following) the trail to the river's edge. 4.For thirty years the noon whistle has (blown)exactly on time. 5.The players have (challenged) their parents to a game of ...

Physical Science

I don't quite understand Actions and Reactions. [For every action, there is an opposite and equal reaction.]Can someone let me know if I am correct on this question or not? Identify the action and reaction forces in the following situations: 1. You kick a soccer ball and the ...


Predict the direction of the net reaction in each of the following system, as a result of increasing the temperature. Delta H is an indicator or whether the reaction releases heat delta H(-), or heat is absorb delta H(+). Write where the direction shifts. a)3O2(g)=2O3(g) H=+...


1) what is an example of bias in media A. A website that presents a controversial opinion as though it were fact. B. A television news program that presents both sides of a particular issue**** C. A podcast expressing an authors opinion D. A blog about the history of the civil...


The treatment of a certain viral disease requires a combination dose of drugs D1 and D2. Each unit of D1 contains 1 milligram of factor X and 2 milligrams of factor Y, and each unit of D2 contains 2 milligrams of factor X and 3 milligrams of factor Y. If the most effective ...


3. Hydrobromic acid dissolves solid iron according to the following reaction: Fe(s) + 2HBr(aq) ---> FeBr2(aq) + H2(g) What mass of HBr (in g) would you need to dissolve a 3.2 gram pure iron bar on a padlock? What mass of H2 would be produced by the complete reaction of the ...


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...


An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...

Inorganic chemistry

Calculate the standard reduction potential for the following reaction at 25 degrees Celsius Ag(NH3)2^+(aq) +e^- ==> Ag(s) + 2 NH3(aq) given the following thermodynamic information Ag^+(aq) + e^- ==>Ag(s) E naught = 0.799V Ag^+(aq) + 2NH3(aq) ==> Ag(NH3)2^+(aq) Kf = 1....


At body temperature (37C), K of an enzyme-catalyzed reaction is 2.3x10^14 times greater than k of the uncatalyzed reaction. Assuming that the frequency factor A is the same for both reaction, by how much does the enzyme the E^a?

Zero and Negative Exponents- Algebra

I need help with the following: What is the simplified form of 3a^4b^-2c^3? (1 point) What is –a^-2 if a=-5? (1 point) What is the simplified form of –(14x)^0y^-7z? (1 point) What is (-m)^-3n if m=2 and n=-24? (1 point)


Methane reacts with water to form CO and H2 as follows: CH4(g)+H2O(g)=CO9g)+3H2(g) The value of Kp at 298 k for the reaction is 7.7 *10^24, calculate Kc. If you can please show the steps I would greatly appreciate it. Thank you

Social Studies

"We hold these truths to be self evident, that all Men are created equal, that they are endowed by their Creator with certain unaliable rights,..." -The Unanimous Declaration of the Thirteen United States of America Which of the following best paraphrases this statement? A. ...


How can I get help with certain math problems? I am homebound right now due to a medical condition.So I can't listen on how to do certain things.


If it has been determined that the probability of an earthquake occurring on a certain day in a certain area is 0.05, what are the odds against an earthquake


For the reaction between chloroacetic acid and 4-chlorophenolate to synthesize 4-chlorophenoxyacetic acid, why is this reaction a sn2 reaction?


In a zero order reaction ,20% of the reaction complete in 10s .How much time it will take to complete 50% of the reaction?


Question: A certain sample of phosphate rock contains 26.26% P2O5. A .5428 gram sample is analyzed by percipitating MgNH4PO4*6H2O and heating it strongly to form Mg2P2O7. compute the mass of Mg2P2O7. I'm not entirly sure what to do. Do you set up an equation?


Magnesium oxide can be made by heating magnesium metal in the presence of oxygen. The balanced equation for the reaction is: 2Mg(s)+O2(g)→2MgO(s) When 10.1 g of Mg are allowed to react with 10.5 g of O2, 14.5 g of MgO are collected. a) Determine the limiting reactant for...


The chemical reaction N2(g)+ 3H2(g)<--> 2NH3(g) is at equilibrium. An expirimenter increases the volume of the reaction chamber by 10%. Explain what happens to bith the forward and reverse reaction rates from the moment the volume is changed until equilibrium is ...


Volume Problems Answer the following questions. Scan and upload your questions and answers to your student section labeled Volume Volume Problems. Identify the following chemical equations by type. 1. If an electric discharge produces 500 cm3 of ozone (O3), how many cm3 of ...


The decomposition of N2O5 proceeds according to the following equation 2 N2O5(g) → 4 NO2(g) + O2(g). The rate constant, k, for the reaction at 298 K is 2.20 x 10-3 min-1. If a reaction is set up in a vessel at 298 K, with an initial concentration of 0.343 mol L-1; what ...


Assuming that the gases are ideal, calculate the amount of work done (in joules) in the following reaction. Is work done on or by the system? A reaction in the Mond process for purfying nickel(0) tetracarbonyl at 50-100 degrees Celsius. Assume one mole of nickel is used and a ...


Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the following reaction. C2H4O(g) + H2O(l) → HOCH2CH2OH(l) Use Hess's law to obtain the enthalpy change for this reaction from the following enthalpy changes. 2 C2H4O(g) + 5 ...


Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the following reaction. C2H4O(g) + H2O(l) → HOCH2CH2OH(l) Use Hess's law to obtain the enthalpy change for this reaction from the following enthalpy changes. 2 C2H4O(g) + 5 ...


Suppose P is the experimental probability of a certain event occurring, based on 100 trials. Which of the following is the correct formula for calculating P?


At a certain temperature, Keq is 4.13 x 10^-5 for the equilibrium: 2IBr(g) ↔ I2(g) + Br2(g) Assume that the equilibrium is established at the above temperature by adding only the reactant to the reaction flask. What are the concentrations of I2 and Br2 in equilibrium ...

Physical Science

24. What happens when a solution of nitric acid (HNO3) is added to a solution of potassium hydroxide (KOH)? What are the products? 25. Which of the following compounds can react with H2SO4 to form a salt: NaCl, Ca(OH)2, HF, AlCl3, H2O, Mg(OH)2? Name the salt(s) that would form...


Recall the reactions for this lab: S2O82- + 2I- → 2SO42- + I2 (slow) Reaction 1 The one that delays the solution turning blue: I2 + 2S2O32- → 2I- + S4O62- (fast) Reaction 2 b. All the S2O32 is consumed when the color change occurs. Therefore, Δ[S2O32] = c. Use the ...


Recall the reactions for this lab: S2O82- + 2I- → 2SO42- + I2 (slow) Reaction 1 The one that delays the solution turning blue: I2 + 2S2O32- → 2I- + S4O62- (fast) Reaction 2 b. All the S2O32 is consumed when the color change occurs. Therefore, Δ[S2O32] = c. Use the ...


If it has been determined that the probability of an earthquake occurring on a certain day in a certain area is 0.05, what are the odds against an earthquake? multiple choice A) 20 : 1 B) 1 : 20 C) 18 : 1 D) 19 : 1 3


What is the relationship of climate to weathering (both chemical and mechanical)? Are certain climates more susceptible to certain types of weathering? Why or why not?

Corrected Temperature Problem

Q: The activation energy of a certain reaction is 32.9 kJ/mol At 25 degrees C the rate constant is 0.0160 units s-1 units. At what temperature in degrees Celsius would this reaction go twice as fast? My work: ln(0.0160/0.032) = (32,900/8.314)(1/T2 - 1/298.15) -0.6931 = 3,957....


1) The rate expression for the reaction 2 SO2 + O --> 2 SO3 is given by rate = k [SO2]2[O2]. The overall order of this reaction is: first order 2)The rate reaction between A and B is expressed as rate = k [A][B]. To produce the greatest increase in the reaction rate: double...

general chemistry

A reaction involves fictional reagents A & B is begun with the inital concentration of 0.05M A and 0.01M B. The reaction reaches completion in 16 seconds. What is the initial rate of the reaction in respect to A? and what is the order in respect to B


For the reaction given, the value of the equilibrium of the constant at 400 K is 7.0. Br2(g)+ Cl2(g)=2BrCl(g) Does the: Reaction proceed to the left? Reaction proceed to the right? Partial pressure represent a system in an equation?


In the gas phase reaction CH4 + H2O → CO + 3 H2 At T = 1500 K , Kp = 11000 Calculate Kp, T = 1500 K , for the following reaction 3 CO + 9 H2 → 3 CH4 + 3 H2O .


which of the following is an example of a chemical change? A)Iron changes when heated B)Gas bubbles form in boiling water C) Balls of wax form when melted wax is poured into ice water. D)A gas forms when vinegar and baking soda are mixed My Choice D

prepositional calculus

Convert the following formula to conjunctive normal form (clause form). a) a ≡ (b ≡ c) is the answer (a כ(( b כ c) ^ (c כ b))) ^ ((( b כ c) ^ (c כ b)) כ a) unsure thanks


I want to know if someone could let me know if I have written my balanced equations correct for the following questions. Write a balanced equation for the reaction of zinc with sulfuric acid. Zn + H2SO4 >>> Zn(S04) +H2 Write a balanced equation for the reaction of ...

Physical Science Just One Question PLEASE HELP!

In an exothermic reaction, the amount of energy required to break the attractions among the solute particles and among the solvent particles is A) greater than the energy released as attractions form between solute and solvent particles. B) less than the energy released as ...


The following equilibrium pressures were observed at a certain temperature for the reaction. N2(g) + 3 H2(g) <==> 2 NH3(g) partial pressure of NH3 = 3.2 ✕ 10−1 atm partial pressure of N2 = 1.6 ✕ 10−2 atm partial pressure ...

American Government

The city council of Smallton has just chosen a new chief administrator. She will carry out the policies of the council and hire department heads. If the council is not pleased with her work, it has the ability to dismiss her at any time. Which form of city government does ...


Write and balance the chemical reaction when gaseous carbon monoxide reacts with hydrogen gas to form gaseous methane (CH4) & liquid water


What are the odds against an earthquake occuring on a certain day in a certain area if the odds of it occurring is 0.05?


Exponent Form: 1/4^3 Factor Form: 1/4 * 1/4 * 1/4? Standard Form: The answer?


For the reaction 2 NO (g) + Cl2 (g) → 2 NOCl (g) If the concentration of NO is tripled, the rate of the reaction increases by a factor of nine. If the concentration of Cl2 is cut in half, the rate of the reaction is decreased to half the original rate. Find the order of ...

criminal justice

The study of why certain people are victims of crime is known as victimology. It also includes the study of how lifestyle makes certain people more susceptible to be victims. Author Susan Sontag wrote the following quotation on victims: “Victims suggest innocence. And ...


Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation. Identify all of the phases in your answer. ...


Write and balance equations for the following reactions. A)Iron metal and Chlorine gas react to form solid iron(III) chloride. B)Solid aluminum carbonate decomposes to form solid aluminum oxide and carbon dioxide gas. C)Solid magnesium reacts with aqueous silver nitrate to ...

Income tax

Interest payers (banks, savings and loans, insurance companies, etc.) report interest earnings to taxpayers on a: A. Form W-2-INT. B. Form 1099-INT. C. Form 1099-INC. D. Form 4070. is it A


Which if the following sentences is punctuated correctly? a) A carpenter must use certain tools, hammers, saws, chisels, to finish a job. b) A carpenter must use certain tools- hammers, saws, chisels to finish a job. c) A carpenter must use certain tools hammers, saws, chisels...


Which of the following sentences is punctuated correctly? A carpenter must use certain tools, hammers, saws, chisels, to finish a job. A carpenter must use certain tools hammers, saws, chisels -to finish a job. A carpenter must use certain tools – hammers, saws, chisels to ...

Music, Form.

AB form and verse/refrain form are the same, aren't they? Thank you for using the Jiskha Homework Help Forum. Since you are obviously studying music, you may appreciate the following website with a glossary of musical terminology. The AB form is at the beginning: http://www....


If it has been determined that the probability of an earthquake occurring on a certain day in a certain area is 1 over 20 , what are the odds against an earthquake? Would the answer be 19:1?


What will happen when 100 ml of diethyl ether are added to 100 ml of water and thoroughly mixed? a.) Water will form a separate layer on top of the ether layer. b.)The temperature of the mixture will significantly increase. c.)There will be a chemical reaction between ether ...

lab chem

If toluene (density 0.87) wre used to extract ethylene bromohydrin (density 2.41) from an aqueous solution, a. Could you be certain that the organic solution would form the upper layer? b. by what test could you identify the nonaqueous layer.


For the chemical reaction CH3Br + OH- CH3OH + Br-, which of the following would speed up the reaction? increasing the CH3Br concentration reducing the OH concentration cooling the reactant mixture Please help with this question. I appreciate it. Thank you. reducing the ...


Given the two reactions 1.PbCl2 <--->Pb^2+ + 2 Cl^-, K1= 1.82×10^−10 2. AgCl <----> Ag^+ + Cl^-, K2 = 1.15×10−4 what is the equilibrium constant Kfinal for the following reaction? PbCl2+ 2 Ag^+ <---> 2AgCl+ Pb^2+ This is what i have soo far: ...


Examine the unbalanced equation. CH4 + O2 → CO2 + H2O What is the best classification for the unbalanced equation's reaction, and why? It is a combustion reaction because carbon dioxide (CO2) is emitted as a product. It is a synthesis reaction because O2 displaces carbon (C...


The equilibrium constant for the equation 2 H2(g) + CO(g) CH3OH(g) Is 19 at a certain temperature. If there are 3.11 x 10-2 moles of H2 and 5.79 x 10-3 moles of CH3OH at equilibrium in a 6.75 L flask. What is the concentration of CO? What is the Kp at 1439 °C for the reaction...


The reaction between potassium metal and chlorine gas is described by the following thermochemical equation K(s) + ½C_l2(g) = KCl(s) ÄH =–437 kJ mol–1 What will be the enthalpy change (to 2 significant figures) for the reaction when 6.0 g of potassium metal reacts with ...


Consider the following reaction: CO(g)+2H2(g)⇌CH3OH(g) This reaction is carried out at a specific temperature with initial concentrations of [CO] = 0.27 M and [H2] = 0.49 M. At equilibrium, the concentration of CH3OH is 0.11 M. Find the equilibrium constant at this ...


At a certain temperature, the Equilibrium constant, Kc, for this reaction is 53.3. At this temperature, 0.500 mol of H2 and 0.500 mol of I2 were placed in a 1.00-L container to react. What concentration of HI is present at Equilibrium? equation: H2 + I2 = 2HI


NH4HS(s) <-> NH3(g) + H2S(g) An equilibrium mixture of this reaction at a certain temperature was found to have (NH3)=.268 and (H2S)=.360 What is the value of the equilibrium constant at this temperature?


NH4HS(s) <-> NH3(g) + H2S(g) An equilibrium mixture of this reaction at a certain temperature was found to have (NH3)=.268 and (H2S)=.360 What is the value of the equilibrium constant at this temperature?


1.equillibrium constant only changes for change in temp? not for change in pressure etc. 2. rate of reaction can be measure by measuring how long it takes for products to form or how long it takes for reactants to be consumed? so is the rate of consumption of products = to ...

science very urgent help?

Susan has heard that taking an over-the-counter ‘energy’ pill, which contains as much caffeine as a strong cup of coffee, makes people feel alert and ‘speedy’. She wonders if taking this pill will make a difference to the reaction times of people doing an online ...


A voltaic cell employs the following redox reaction: Sn^2+(aq)+ Mn(s)--> Sn(s) + Mn^2+(aq) Calculate the cell potential at 25 under each of the following conditions. a.)[Sn]= 1.51E-2 M [Mn]= 2.52M b.)[Sn]= 2.52 [Mn]= 1.51E-2 M


The following reation has the following standard thermodynamic parameters: delta H= -33.6 kJ/mol delta S= -59.8 J/(mol*K). C(g) + D(g) --> E(g) Calculate the temperature at which the reaction becomes nonspontaneous.


Using the following thermochemical data, what is the change in enthalpy for the following reaction? Ca(OH)¿(aq) + HCl(aq) d CaCl¿(aq) + H¿O(l) CaO(s) + 2HCl(aq) d CaCl¿(aq) + H¿O(l),  DH = -186 kJ CaO(s) + H¿O(l) d Ca(OH)¿(s),  DH = -65.1 kJ


4. Write the balanced equation for CH4+Cl2„_CH2Cl2+HCl 4a. For the reaction in problem 4, ƒ´H = -118.3 kcal/mol. Identify whether this is an exothermic or endothermic reaction. Calculate the ƒ´H when 6.00 g of Cl2 are used in the reaction


I want to have the details of the experiment title: Determine the equilibrium constant of a reversible reaction involving the iodine and the tri iodate ion reaction and also determine the gibbs free energy of the reaction.


1-Dinitrogen tetroxide (N2O4) dissociates according to the equation: N2O4 ⇌ 2NO2 An equilibrium reaction mixture at 25 ºC was found to have the partial pressure of N2O4 as 72 kPa whilst the partial pressure of nitrogen dioxide (NO2) was 29 kPa. Calculate Kp for the ...


At a certain temperature, the equilibrium constant, Kc, for this reaction is 53.3. H2(g)+I2(g) <-> 2HI(g) At this temperature, 0.300 mol of H2 and 0.300 mol of I2 were placed in a 1.00-L container to react. What concentration of HI is present at equilibrium?


Tetraphosphorus trisulphide (P4S3) is used in the match heads of some matches. It is produced in the reaction 8P4+3S8 --> 8P4S3. Determine which of the following statements are incorrect, and rewrite the incorrect statements to make them correct. a. 4 mol P4 reacts with 1.5...


If .002 L of .650 M NaOH are added to 1.0 L of 0.9 M CaCl2 what is the value of the reaction quotient and will a precipitate form? I keep getting 0.0011 because I thought the answer was [Ca+][OH-] but that's not correct, I think I'm missing a final step


A .500g unknown sample is titrated with 40mL of .187M KMno4 by the following reaction: 5Fe{2+} + MnO4{-1} + 8H{+1} -> 5Fe{3+} + Mn{2+} + 4H2O. What is the percentage of iron in the following sample


  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100