a certain reaction has the following generaln form

73,786 results, page 13

chemistry

In the fifth reaction of Glycolosis, G3P dehydrogenase converts glyceraldehydes-3-phosphate into glycerate-1,3-bisphosphate. In order to make the reaction spontaneous at biological conditions it must be coupled to the reduction of NAD+. a) DG° for the reaction of just G-3-P, ...

Chem

In a coffee cup calorimeter, 50.0 mL of 0.100 M AgNO3 and 50.0 mL of 0.100 M HCl are mixed to yield the following reaction: Ag+ (aq) + Cl- (aq) -----------------> AgCl (s) The two solutions were initially at 22.60 °C, and the final temperature is 23.40 °C. Calculate the ...

chemistry

Zinc reacts with sulphur to form zinc sulphuric 16.2g.Sample of zinc is reacted with log of sulphur(Zn=65,S=32,o=16) A)Write a chemical reaction for the reaction b)Calculate the number of moles of zinc atoms that reacted. c)Number of moles of sulphur atoms that reacted

chemistry

The initial state of a reaction is A2 +B2 –> 2AB. In the initial state of the reaction there are 6 A2’s present and 6 B2’s present. Suppose the reaction is carried out at two temperatures.Which of these situations represents the result at the higher temperature?(The ...

science

A chemist mixes two liquids together. The reaction produces a gas and a solid. According to the law of conservation of mass, what should the chemist observe when she compares the total masses of the substances before and after the reaction?  (1 point) A.The masses are equal...

Chemistry

1. The value of ΔH° for the reaction below is -6535 kJ. _________ kJ of heat are released in the combustion of 16.0 g C6H6 (l). 2C6H6 (l) + 15O2 (g) --> 12CO2 (g) + 6H20 (l) 3. Given the following reactions CaCO3 (s) --> CaO (s) + CO2 (g) ΔH = 178.1 kJ C (s,graphite...

Science

Ms. Lewis is a chemist mixing two solutions together. A chemical reaction takes place, and the solution becomes warm. Which statement best describes what has happened? A. Energy has been created in the form of thermal energy B. Energy has been transformed from one form to ...

Pre-Calc/Trig...

standard form: y=x^2-4x-5 vertex form: ? intercept form: ?

college chemistry

a) Is the reaction shown below spontaneous under standard conditions at 25⁰C? CH3OH (g) ----> CO (g) + 2H2 (g) b) Will this reaction be spontaneous at 25⁰C given the following amounts of materials? CH3OH at 1.20 atm CO at 0.080 atm H2 at 0.020 atm

Chemistry

An aqueous solution of 0.25 M silver nitrate, AgNO3, and 0.25 M iron(II) nitrate, Fe(NO3)2, are allowed to come to equilibrium in the following chemical reaction:
Ag+(aq) + Fe2+(aq) Fe3 + (aq) + Ag(s)
If the equilibrium constant, Kc, for the reaction is 3.0 × 10-3...

Science - Chemistry

If the rate law of a chemical reaction is k[NH4+]2[NO2–], what is the order of the reaction? 1. The order of the reaction cannot be determined. 2. 3 3. 1 4. 2

English

1.All of the balloons on the string (popped) except two. 2.Do you (want) to buy those books? 3.Daniel's dog is (following) the trail to the river's edge. 4.For thirty years the noon whistle has (blown) exactly on time. 5.The players have (challenged) their parents to a game of...

Pre-Calc.

Write the standard form of the ellipse x^2+4y^2+6x-8y+9=0 I'm not sure how to start it, I think I need to set it equal to one because eventually it needs to end up equal to one but I'm not certain. I know the answer is (x+3)^2/4 + (y-1)^2/1=1 but have no idea how to get there...

ORGANIC CHEM LAB

In a hypochlorite oxidation reaction, cyclohexanol plus NaOCL & aq HOAc results in cyclohexanone. The intermediate in this reaction in ROCl where R = cyclohexyl. a.) Show how this intermediate decomposes to product in a E2-like reaction even at pH = 4-5; consider what the ...

Chemistry

The reaction describing the formation of ozone from oxygen is shown below. 3 O2(g) <--> 2 O3(g) Calculate Grxn at 288 K for this reaction in a flask where [O2] = 3.419 x 10-2 M and [O3] = 5.783 x 10-4 M. Assume G° = 326 kJ. Use molarity to construct the reaction ...

thermochemistry

A chemical reaction takes place in a container of cross-sectional area 100 cm2 . As a result of the reaction, a piston is pushed out through 19 cm against an external pressure of 596 torr. What is the value for w for this reaction?

Chemistry

Use the data in the table to calculate the equilibrium constant for the following reaction. HCOOH(aq)+ OH −(aq) equilibrium reaction arrow HCOO−(aq)+ H2O(l) HCOO is 5.9e-11 (Kb) HCOOH is 1.7e-4 (Ka) Not sure how to find the equilibrium constant given this information

Chemistry ASAP

3. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...

Chemistry

Answer check: Define a catalyst and explain a catalyst's role in a chemical reaction. A catalyst is a substance that speeds a chemical reaction without being permanently changed itself. It works by providing a convenient surface for the reaction to occur. The reacting ...

Chemistry

Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Science

Hydrogen peroxide can be prepared in several ways. One method is the reaction between hydrogen and oxygen, another method is the reaction between water and oxygen. Calculate the ΔG°rxn of each reaction below? 1) H2(g) + O2(g) <==> H2O2(l) ΔG°rxn=? (in kJ) 2) ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? I think the answer is B but not sure. a) That there is no reaction force-the net force on the object is ...

Math Urgent

To form a certain sequence, the rules are: 1)If a number is even, divide by 2 to get the next number 2)If a number is odd, multiply by 3, then add 1 to the the next number. Starting with 12,the 1000th term would be... a.1 b.2 c.3 d.4 THANKS

statistics

Sixty-four students in an introductory college economics class were askd how many credits they had earned in college, and how certain they were about their choice of major. At a = .01, is the degree of certainty independent of credits earned? Credits Very Somewhat Very Row ...

chemistry

. Classify the reaction between zinc and acetic acid and explain, in general terms, what happens during this type of reaction. would the type of reaction be a single replacement ??

chemistry

Classify the reaction between zinc and acetic acid and explain, in general terms, what happens during this type of reaction. would the type of reaction be a single replacement ??

Chemistry

The standard free energy of activation of a reaction A is 88.6 kJ mol–1 (21.2 kcal mol–1) at 298 K. Reaction B is one hundred million times faster than reaction A at the same temperature. The products of each reaction are 10.0 kJ mol–1 (2.39 kcal mol–1) more stable ...

chemistry

Which of the following reactions will be spontaneous at standard state? Not all the reactions are balanced, so make sure they are balanced first. The ΔG of formation data can be found in an appendix in your text book. You may select multiple answers. Any reaction with ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? Is A the correct answer? a) That there is no reaction force-the net force on the object is zero, so the ...

Algebra

I have an assignment to write an equation to point-slope form, then to standard form, and then to slope-intercept form. I have used the points (-2,-1) or (1,2), but I used (-2,-1). Now, I have the point-slope form of y + 1= 1(x + 2) and the standard form of y – 1x = -1. When...

Chemistry

What is the order of the reaction for the following reaction and for each reagent given? A + 2B + C --> productions Experiment / A / B / C / rate 1 / 0.002 / 0.15 / 0.132 / 0.0057 2 / 0.002 / 0.25 / 0.132 / 0.0158 3 / 0.003 / 0.15 / 0.132 / 0.0114 4 / 0.003 / 0.15 / 0.264...

math

A hypothesis test is conducted with respect to the mean weight (in ounces) of potato chip bags form a certain manufacturer. The hypotheses are: H0:  = 0.8 and Ha:  ≠ 0.8. Which confidence level would support the conclusion that there is insufficient ...

Physical Science

I don't quite understand Actions and Reactions. [For every action, there is an opposite and equal reaction.]Can someone let me know if I am correct on this question or not? Identify the action and reaction forces in the following situations: 1. You kick a soccer ball and the ...

chem

Predict the direction of the net reaction in each of the following system, as a result of increasing the temperature. Delta H is an indicator or whether the reaction releases heat delta H(-), or heat is absorb delta H(+). Write where the direction shifts. a)3O2(g)=2O3(g) H=+...

Chemisty

When the gases dihydrogen sulfi and oxygen react, they form the gases sulfu dioxid and water vapor. How od you write a balanced equation for the reaction?

Intro Chem

4Al(s) + 3O2(g)2Al2O3(s) Delta H reaction = -3351.4 kJ How much energy is transferred when 42.6 g of aluminum reacts to form aluminum oxide? Thanks

chemistry

gaseous hydrogen and fluorine combine in the reaction above to form hydrogen fluoride with an enthalpy change of -540kJ. What is the value of the heat of formation of HF(g)

Adv AP Honors Chemistry

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

English

1.All of the balloons on the string (popped) except two. 2.Do you (want) to buy those books? 3.Daniel's dog is (following) the trail to the river's edge. 4.For thirty years the noon whistle has (blown)exactly on time. 5.The players have (challenged) their parents to a game of ...

EdTech

1) what is an example of bias in media A. A website that presents a controversial opinion as though it were fact. B. A television news program that presents both sides of a particular issue**** C. A podcast expressing an authors opinion D. A blog about the history of the civil...

science

3. Hydrobromic acid dissolves solid iron according to the following reaction: Fe(s) + 2HBr(aq) ---> FeBr2(aq) + H2(g) What mass of HBr (in g) would you need to dissolve a 3.2 gram pure iron bar on a padlock? What mass of H2 would be produced by the complete reaction of the ...

Pre-Calculus

The treatment of a certain viral disease requires a combination dose of drugs D1 and D2. Each unit of D1 contains 1 milligram of factor X and 2 milligrams of factor Y, and each unit of D2 contains 2 milligrams of factor X and 3 milligrams of factor Y. If the most effective ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...

physics

An object in the vacuum of space orbits the earth at a fixed speed in a circular orbit several hundred miles above the earth. What can we conclude about the reaction force? a) That there is no reaction force-the net force on the object is zero, so the reaction force is zero ...

Chemistry

At body temperature (37C), K of an enzyme-catalyzed reaction is 2.3x10^14 times greater than k of the uncatalyzed reaction. Assuming that the frequency factor A is the same for both reaction, by how much does the enzyme the E^a?

Inorganic chemistry

Calculate the standard reduction potential for the following reaction at 25 degrees Celsius Ag(NH3)2^+(aq) +e^- ==> Ag(s) + 2 NH3(aq) given the following thermodynamic information Ag^+(aq) + e^- ==>Ag(s) E naught = 0.799V Ag^+(aq) + 2NH3(aq) ==> Ag(NH3)2^+(aq) Kf = 1....

Chemistry

Methane reacts with water to form CO and H2 as follows: CH4(g)+H2O(g)=CO9g)+3H2(g) The value of Kp at 298 k for the reaction is 7.7 *10^24, calculate Kc. If you can please show the steps I would greatly appreciate it. Thank you

Ochem

For the reaction between chloroacetic acid and 4-chlorophenolate to synthesize 4-chlorophenoxyacetic acid, why is this reaction a sn2 reaction?

chemistry

In a zero order reaction ,20% of the reaction complete in 10s .How much time it will take to complete 50% of the reaction?

Social Studies

"We hold these truths to be self evident, that all Men are created equal, that they are endowed by their Creator with certain unaliable rights,..." -The Unanimous Declaration of the Thirteen United States of America Which of the following best paraphrases this statement? A. ...

Math

How can I get help with certain math problems? I am homebound right now due to a medical condition.So I can't listen on how to do certain things.

math

If it has been determined that the probability of an earthquake occurring on a certain day in a certain area is 0.05, what are the odds against an earthquake

Chemistry

Magnesium oxide can be made by heating magnesium metal in the presence of oxygen. The balanced equation for the reaction is: 2Mg(s)+O2(g)→2MgO(s) When 10.1 g of Mg are allowed to react with 10.5 g of O2, 14.5 g of MgO are collected. a) Determine the limiting reactant for...

Chemistry

The chemical reaction N2(g)+ 3H2(g)<--> 2NH3(g) is at equilibrium. An expirimenter increases the volume of the reaction chamber by 10%. Explain what happens to bith the forward and reverse reaction rates from the moment the volume is changed until equilibrium is ...

Zero and Negative Exponents- Algebra

I need help with the following: What is the simplified form of 3a^4b^-2c^3? (1 point) What is –a^-2 if a=-5? (1 point) What is the simplified form of –(14x)^0y^-7z? (1 point) What is (-m)^-3n if m=2 and n=-24? (1 point)

Chemistry;HELP

Volume Problems Answer the following questions. Scan and upload your questions and answers to your student section labeled Volume Volume Problems. Identify the following chemical equations by type. 1. If an electric discharge produces 500 cm3 of ozone (O3), how many cm3 of ...

chemistry

The decomposition of N2O5 proceeds according to the following equation 2 N2O5(g) → 4 NO2(g) + O2(g). The rate constant, k, for the reaction at 298 K is 2.20 x 10-3 min-1. If a reaction is set up in a vessel at 298 K, with an initial concentration of 0.343 mol L-1; what ...

Chemistry

Question: A certain sample of phosphate rock contains 26.26% P2O5. A .5428 gram sample is analyzed by percipitating MgNH4PO4*6H2O and heating it strongly to form Mg2P2O7. compute the mass of Mg2P2O7. I'm not entirly sure what to do. Do you set up an equation?

Chemistry

Assuming that the gases are ideal, calculate the amount of work done (in joules) in the following reaction. Is work done on or by the system? A reaction in the Mond process for purfying nickel(0) tetracarbonyl at 50-100 degrees Celsius. Assume one mole of nickel is used and a ...

chemistry

At a certain temperature, Keq is 4.13 x 10^-5 for the equilibrium: 2IBr(g) ↔ I2(g) + Br2(g) Assume that the equilibrium is established at the above temperature by adding only the reactant to the reaction flask. What are the concentrations of I2 and Br2 in equilibrium ...

Chemistry

Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the following reaction. C2H4O(g) + H2O(l) → HOCH2CH2OH(l) Use Hess's law to obtain the enthalpy change for this reaction from the following enthalpy changes. 2 C2H4O(g) + 5 ...

chemistry

Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the following reaction. C2H4O(g) + H2O(l) → HOCH2CH2OH(l) Use Hess's law to obtain the enthalpy change for this reaction from the following enthalpy changes. 2 C2H4O(g) + 5 ...

Chemistry

Recall the reactions for this lab: S2O82- + 2I- → 2SO42- + I2 (slow) Reaction 1 The one that delays the solution turning blue: I2 + 2S2O32- → 2I- + S4O62- (fast) Reaction 2 b. All the S2O32 is consumed when the color change occurs. Therefore, Δ[S2O32] = c. Use the ...

Chemistry

Recall the reactions for this lab: S2O82- + 2I- → 2SO42- + I2 (slow) Reaction 1 The one that delays the solution turning blue: I2 + 2S2O32- → 2I- + S4O62- (fast) Reaction 2 b. All the S2O32 is consumed when the color change occurs. Therefore, Δ[S2O32] = c. Use the ...

math

Suppose P is the experimental probability of a certain event occurring, based on 100 trials. Which of the following is the correct formula for calculating P?

Corrected Temperature Problem

Q: The activation energy of a certain reaction is 32.9 kJ/mol At 25 degrees C the rate constant is 0.0160 units s-1 units. At what temperature in degrees Celsius would this reaction go twice as fast? My work: ln(0.0160/0.032) = (32,900/8.314)(1/T2 - 1/298.15) -0.6931 = 3,957....

math

If it has been determined that the probability of an earthquake occurring on a certain day in a certain area is 0.05, what are the odds against an earthquake? multiple choice A) 20 : 1 B) 1 : 20 C) 18 : 1 D) 19 : 1 3

EARTH SCIENCE

What is the relationship of climate to weathering (both chemical and mechanical)? Are certain climates more susceptible to certain types of weathering? Why or why not?

Chemistry

1) The rate expression for the reaction 2 SO2 + O --> 2 SO3 is given by rate = k [SO2]2[O2]. The overall order of this reaction is: first order 2)The rate reaction between A and B is expressed as rate = k [A][B]. To produce the greatest increase in the reaction rate: double...

general chemistry

A reaction involves fictional reagents A & B is begun with the inital concentration of 0.05M A and 0.01M B. The reaction reaches completion in 16 seconds. What is the initial rate of the reaction in respect to A? and what is the order in respect to B

Chemistry

For the reaction given, the value of the equilibrium of the constant at 400 K is 7.0. Br2(g)+ Cl2(g)=2BrCl(g) Does the: Reaction proceed to the left? Reaction proceed to the right? Partial pressure represent a system in an equation?

Chemistry

Calculate the molar enthalpy of reaction per mole of carbon in the following reaction: 3 C(s) + 2 Fe2O3(s) + 466 kJ c12-u3_files/i0210000.jpg 4 Fe(s) + 3 CO2(g) a. +466 kJ/mol C b. +155 kJ/mol C c. +117 kJ/mol C d. –466 kJ/mol C e. –155 kJ/mol C

Chemistry

In the gas phase reaction CH4 + H2O → CO + 3 H2 At T = 1500 K , Kp = 11000 Calculate Kp, T = 1500 K , for the following reaction 3 CO + 9 H2 → 3 CH4 + 3 H2O .

Physical Science

24. What happens when a solution of nitric acid (HNO3) is added to a solution of potassium hydroxide (KOH)? What are the products? 25. Which of the following compounds can react with H2SO4 to form a salt: NaCl, Ca(OH)2, HF, AlCl3, H2O, Mg(OH)2? Name the salt(s) that would form...

chemistry

I want to know if someone could let me know if I have written my balanced equations correct for the following questions. Write a balanced equation for the reaction of zinc with sulfuric acid. Zn + H2SO4 >>> Zn(S04) +H2 Write a balanced equation for the reaction of ...

chem

The following equilibrium pressures were observed at a certain temperature for the reaction. N2(g) + 3 H2(g) <==> 2 NH3(g) partial pressure of NH3 = 3.2 ✕ 10−1 atm partial pressure of N2 = 1.6 ✕ 10−2 atm partial pressure ...

Chemistry

For the reaction 2 NO (g) + Cl2 (g) → 2 NOCl (g) If the concentration of NO is tripled, the rate of the reaction increases by a factor of nine. If the concentration of Cl2 is cut in half, the rate of the reaction is decreased to half the original rate. Find the order of ...

Probablity

What are the odds against an earthquake occuring on a certain day in a certain area if the odds of it occurring is 0.05?

chemistry

Write and balance the chemical reaction when gaseous carbon monoxide reacts with hydrogen gas to form gaseous methane (CH4) & liquid water

chemistry

Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation. Identify all of the phases in your answer. ...

Physical Science Just One Question PLEASE HELP!

In an exothermic reaction, the amount of energy required to break the attractions among the solute particles and among the solvent particles is A) greater than the energy released as attractions form between solute and solvent particles. B) less than the energy released as ...

criminal justice

The study of why certain people are victims of crime is known as victimology. It also includes the study of how lifestyle makes certain people more susceptible to be victims. Author Susan Sontag wrote the following quotation on victims: “Victims suggest innocence. And ...

Science

which of the following is an example of a chemical change? A)Iron changes when heated B)Gas bubbles form in boiling water C) Balls of wax form when melted wax is poured into ice water. D)A gas forms when vinegar and baking soda are mixed My Choice D

prepositional calculus

Convert the following formula to conjunctive normal form (clause form). a) a ≡ (b ≡ c) is the answer (a כ(( b כ c) ^ (c כ b))) ^ ((( b כ c) ^ (c כ b)) כ a) unsure thanks

American Government

The city council of Smallton has just chosen a new chief administrator. She will carry out the policies of the council and hire department heads. If the council is not pleased with her work, it has the ability to dismiss her at any time. Which form of city government does ...

Math

Exponent Form: 1/4^3 Factor Form: 1/4 * 1/4 * 1/4? Standard Form: The answer?

Chemistry

Write and balance equations for the following reactions. A)Iron metal and Chlorine gas react to form solid iron(III) chloride. B)Solid aluminum carbonate decomposes to form solid aluminum oxide and carbon dioxide gas. C)Solid magnesium reacts with aqueous silver nitrate to ...

Mathamatics

If it has been determined that the probability of an earthquake occurring on a certain day in a certain area is 1 over 20 , what are the odds against an earthquake? Would the answer be 19:1?

English

Which if the following sentences is punctuated correctly? a) A carpenter must use certain tools, hammers, saws, chisels, to finish a job. b) A carpenter must use certain tools- hammers, saws, chisels to finish a job. c) A carpenter must use certain tools hammers, saws, chisels...

English

Which of the following sentences is punctuated correctly? A carpenter must use certain tools, hammers, saws, chisels, to finish a job. A carpenter must use certain tools hammers, saws, chisels -to finish a job. A carpenter must use certain tools – hammers, saws, chisels to ...

Chemistry

Given the two reactions 1.PbCl2 <--->Pb^2+ + 2 Cl^-, K1= 1.82×10^−10 2. AgCl <----> Ag^+ + Cl^-, K2 = 1.15×10−4 what is the equilibrium constant Kfinal for the following reaction? PbCl2+ 2 Ag^+ <---> 2AgCl+ Pb^2+ This is what i have soo far: ...

Chemistry

For the chemical reaction CH3Br + OH- CH3OH + Br-, which of the following would speed up the reaction? increasing the CH3Br concentration reducing the OH concentration cooling the reactant mixture Please help with this question. I appreciate it. Thank you. reducing the ...

chemistry

Examine the unbalanced equation. CH4 + O2 → CO2 + H2O What is the best classification for the unbalanced equation's reaction, and why? It is a combustion reaction because carbon dioxide (CO2) is emitted as a product. It is a synthesis reaction because O2 displaces carbon (C...

Chemistry

What will happen when 100 ml of diethyl ether are added to 100 ml of water and thoroughly mixed? a.) Water will form a separate layer on top of the ether layer. b.)The temperature of the mixture will significantly increase. c.)There will be a chemical reaction between ether ...

lab chem

If toluene (density 0.87) wre used to extract ethylene bromohydrin (density 2.41) from an aqueous solution, a. Could you be certain that the organic solution would form the upper layer? b. by what test could you identify the nonaqueous layer.

Income tax

Interest payers (banks, savings and loans, insurance companies, etc.) report interest earnings to taxpayers on a: A. Form W-2-INT. B. Form 1099-INT. C. Form 1099-INC. D. Form 4070. is it A

chm

The equilibrium constant for the equation 2 H2(g) + CO(g) CH3OH(g) Is 19 at a certain temperature. If there are 3.11 x 10-2 moles of H2 and 5.79 x 10-3 moles of CH3OH at equilibrium in a 6.75 L flask. What is the concentration of CO? What is the Kp at 1439 °C for the reaction...

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100