a certain reaction has the following generaln form

72,877 results, page 12

Chemistry

Consider the reaction: 2 H2S(g)--><-- 2H2(g) + S2 Kp= 2.4 x 10^-4 at 1073k A reaction mixture contains .112 atm of H2,.055 atm of S2, and .445 atm of H2S. Is the reaction mixture at equlibrium? If not, in what direction will the reaction proceed?

Chemistry

If the acetylene were burned to form water and carbon dioxide, how many kilojoules of energy would be produced from the complete reaction of 20 of calcium carbide? CaC2(s)+2H2O(l) --> C2H2(g)+Ca(OH)2(s)

Chemistry

If the acetylene were burned to form water and carbon dioxide, how many kilojoules of energy would be produced from the complete reaction of 20 of calcium carbide? CaC2(s)+2H2O(l) --> C2H2(g)+Ca(OH)2(s)

Science

When sodiun is placed in water,it reacts violent to produce hydrogen gas and form sodium hydroxide solution. write a balanced chemical equation for this reaction

General Chemistry

Balance the following redox reaction in acidic and basic solutions: Fe(OH)2(s) + O2(g) --> Fe(OH)3(s) These are the steps my instructor gave us to balance redox reactions: 1. Divide into 1/2 rxns (reduction & oxidation) 2. Balance atoms other than H & O 3. Balance O with ...

Science

Part 1 Which of the following is a redox reaction? a. H2CO3 (aq) + 2NH3 (aq) → 2NH4+ (aq) + CO32- (aq) b. 2VO3- (aq) + Zn (s) + 8H+ (aq) → 2VO2+ (aq) + Zn2+ (aq) + 4H2O (l) d. Zn(NO) (aq) + 2NaOH (aq) → Zn(OH) (s) + 2NaNO (aq) part 2 For the redox reaction in...

Chemistry

Consider the following reaction and select the false statement below. NaI + 3HOCl → NaIO3 + 3HCl A. HOCl is the oxidizing agent B. Cl is reduced C. NaI is the reducing agent D. If ΔG° for the reaction is < 0, then NaI is a stronger reducing agent than HCl E. If...

Algebra Answer Check

What is the simplified form of the following expression? 7m^2 + 6.5n - 4n + 2.5m^2 - n a. 9.5m^2 + 1.5n (?) b. 4.5m^2 + 1.5n c. 1.5m^2 - 4.2n d. 9.5m^2 - 1.5n Simplify the following expression. 1/3(21m + 27) a. 7m + 27 b. 7m + 9 (?) c. 63m + 9 d. 7m + 81 What is the sum? 7/4...

Chemistry

Asprin, c9h804, is produced through the following reaction of salicyclic acid, c7h6o3, and acetic anhydride, c4h6o3. chemical equation: c7h6o3 + c4h6o3 yields c9h8o4 + hc2h3o2 (all numbers in this equation are subscripts) At 20 degrees Celsius. how many liters of acetic acid, ...

chemistry

Liquid Nitrogen tetroxide, N2O4(l), was used as a fuel in Apollo missions to the moon. In a closed container the gas N2O4(g) decomposes to nitrogen dioxide, NO2(g). The equilibrium constant,k, for this reaction is 0.87 at 55 degrees Celsius. A vessel filled with N2O4(g) at ...

chem

which of the following is a chemical reaction? A) propane forms a flame and emits heat as it burns. B) Acetone feels cold as it evaporates from the skin. C) Bubbling is observed when potassium carbonate and hydrochloric acid solutions are mixed. D) Heat is felt when a warm ...

chemistry

Question: When a pink aqueous solution of potassium permanganate, faintly acidified with dilute sulfuric acid was treated with 10% aq. hydrogen peroxide, the reaction took place with the evolution of gas bubbles, and the pink solution was turned colorless. Further chemical ...

Math

1.) Write the standard form equation for the following Ellipse. Use the information given below. Foci: (0,0) and (4,0) 2.) Write the standard form equation for the following Hyperbola. Use the information below. Vertices (-2,1) and (2,1) Foci: (-3,1) and (3,1)

Chemistry

For the reaction below at a certain temperature, it is found that the equilibrium concentrations in a 5.00 L rigid container are [H2] = 0.0500 M, [F2] = 0.0100 M, and [HF] = 0.400 M. If 0.340 mol of F2 is added to this equilibrium mixture, calculate the concentrations of all ...

chemistry

For the reaction below at a certain temperature, it is found that the equilibrium concentrations in a 4.87-L rigid container are [H2] = 0.0496 M [F2] = 0.0116 M [HF] = 0.429 M. H2(g) + F2(g) <==> 2 HF(g) If 0.185 mol of F2 is added to this equilibrium mixture, calculate ...

chemistry

The following reaction can be written as the sum of two reactions, one of which relates to ionization energy and one of which relates to electron affinity: Li(g)+F(g)→Li+(g)+F−(g) What is the reaction that corresponds to the first ionization energy of lithium, Li? ...

Chemistry 12

9. According to Arrhenius, which of the following groups contain: i)only acids ii)only bases a. NaOH, H2CO3, KCl b. MgCl2, H2SO4, HCl c. HNO3, HCl, H3PO4 d. Mg(OH)2, AgBr, HF e. KOH, NH4OH, Ba(OH)2 10. Enough water is added to 100 g of sodium hydroxide in order to obtain a one...

algebra

A simple random sample is drawn from a normally distributed population. The value of which of the following will not be known for certain but can be inferred?

math

A simple random sample is drawn from a normally distributed population. The value of which of the following will not be known for certain but can be inferred?

chemsitry

home / study / questions and answers / science / chemistry / make sure to answer both parts: 1)balance the following ... Your question has been posted. We'll notify you when a Chegg Expert has answered. Post another question. . Question Edit question make sure to answer both ...

chemistry

I am given the following reaction: 2NH3(g) -------> N2(g) + 3H2(g) My question is: 6.4 mols of ammonia gas has been put into a 1.7 L flask and has been permitted to reach equilibrium in accordance to the reaction listed above. If the equilibrium mixture has 4.2 mols of ...

chemistry

I am given the following reaction: 2NH3(g) -------> N2(g) + 3H2(g) My question is: 6.4 mols of ammonia gas has been put into a 1.7 L flask and has been permitted to reach equilibrium in accordance to the reaction listed above. If the equilibrium mixture has 4.2 mols of ...

Science

Consider the following reaction, 4 PH3(g) + 8 O2(g) → P4O10(s) + 6 H2O(g) If a container were to have 32 molecules of PH3 and 32 molecules of O2 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to ...

chemistry

Uranium metal can be produced by reaction of uranium tetrafluoride (UF4) with calcium metal (Ca). The by-product of this reaction is calcium fluoride (CaF2). The reactor is charged with 292.0 kg of UF4 and 47.0 kg of calcium. Assume that the reaction goes to completion. The ...

English

I urgently need you to check these sentences. Thank you. 1) As our students we'll probably have to learn science in English in their last year of high school, we would rather they used English as the lingua franca for their Comenius project. 2) I think either your school or ...

chemistry

A piece of iron(10)moles was dissolved in contrated Hcl.the reaction was form H2 and Fecl2. determine the amout of Fecl2 formed.

chemistry

given the reaction 4NH3 + 3O2 =2N2 + 6H20 how many moles of N2 would form if 2.77 moles of NH3 reacted completely?

chemistry

given the reaction 4NH3 + 3O2 =2N2 + 6H20 how many moles of N2 would form if 2.77 moles of NH3 reacted completely?

Chemistry

what volume of oxygen is needed to react with solid sulfur to form 6.20 L of sulfur dioxide according to the reaction S(s) + O2(g) yield SO2(g)

chemistry

Nitrogen (N2) and hydrogen (H2) react to form ammonia (NH3). Consider a mixture of six nitrogen molecules and six hydrogen molecules in a closed container. Assuming the reaction goes to completion, what will the final product mixture be? number of NH3 molecules? number of N2 ...

physics

Gamma rays (γ-rays) are high-energy photons. In a certain nuclear reaction, a γ-ray of energy 0.306 MeV (million electronvolts) is produced. Compute the frequency of such a photon.

physics

Gamma rays (γ-rays) are high-energy photons. In a certain nuclear reaction, a γ-ray of energy 0.306 MeV (million electronvolts) is produced. Compute the frequency of such a photon

Physical chemistry

At a certain temperature 0.1moles of hydrogen gas and 0.1 moles of iodine gas were placed in 1 litre flask. It was found that the concentration of iodine decreased to 0.02moles per litre. Calculate the value of the Kc for the reaction

chemistry

I am a freshman in college, and am taking a placement test soon, but haven't seen chemistry since 10th grade. I'd appreciate any help I can get from anyone here to help me solve this problem: Hydrogen and sulfur chemically combine to form the gas hydrogen sulfide, according to...

Please help me!!!!

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

math

write each decimal in standard form, expanded form, and word form. 12+0.2+0.005

Pre-Calc/Trig...

Help me please Standard form: y=x^2-2x-3 Vertex form: ??? Intercept form: ???

chemistry

you work for a company that makes ammonia,NH3, which is an important compund needed in the manufacture of fertilizers. Ammonia is produced by the following reaction: N2 + 3H2 -----------> 2NH3(g) on the basis of what you have discovered in this experiment, how would your ...

Chemistry

Write the balanced half reaction for the reduction and oxidation reactions for the redox reaction: 2 Mg (s) + O2 (g) -> 2 MgO (s) Notice: for this question you do not have to include a charge of zero and you do not have to include the states. Below is an example of the form...

phisic

(a) One such reaction fuses two nuclei of carbon-12 (12/6C ) to form an atom of neon (20/10Ne ) with the emission of an α-particle. Write an equation for this process, indicating the atomic number and mass number of each of the products in the usual way. (b) Another ...

Chemistry

Increasing the surface area will increase the reaction rate in: 1. N2(g) + O2(g) -> 2NO(g) 2. 2Mg(s) + O2(g) -> 2MgO(s) 3. CaCO3(s) + 2H+(aq) -> Ca2+(aq) + H2O(l) + CO2(g) MY WORK: I think it is 2 & possibly 3. 1 is a homogeneous reaction but is 3 a heterogeneous ...

chemistry HELP

Use the following information to identify element A and compound B, then answer questions a and b. An empty glass container has a mass of 658.572 g. It has a mass of 659.452 g after it has been filled with nitrogen gas at a pressure of 790. torr and a temperature of 15°C. ...

Chemistry

NaCl [Symbol] Na + Cl2 Type of reaction: synthesis KOH + HNO3 [Symbol] HOH + KNO3 Type of reaction: double replacement Ca + S [Symbol] CaS Type of reaction: synthesis BaBr2 + Cl2 [Symbol] BaCl2 + Br2 Type of reaction: Cs2 + H2O [Symbol] CsOH + H2 Type of reaction: Na2CO [...

Chemistry

23. In a chemical reaction, dynamic equilibrium occurs when the rate of the forward reaction becomes precisely equal to the rate of the reverse reaction. All of the following statements are true EXCEPT A. A dynamic equilibrium occurs when the reaction is more than 50 percent ...

Chemistry

How could the following transformation could be carried out. C6H5C=CH --> C6H5CH2CH20H I don't know how you would get a primary alcohol because I thought that following Markovnikov's rule any reaction would involve addition onto the other carbon.

Chem Help please!!!!!

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Genetics

A certain form of albinism in humans is recessive and autosomal. Assume that 1% of the individuals in a given population are albino. Assuming that the population is in Hardy-Weinberg equilibrium, what percentage of the individuals in this population is expected to be ...

Genetics

A certain form of albinism in humans is recessive and autosomal. Assume that 1% of the individuals in a given population are albino. Assuming that the population is in Hardy-Weinberg equilibrium, what percentage of the individuals in this population is expected to be ...

Chemistry.

Predict these reaction products. If a reaction takes place, balance the reaction if needed. If no reaction takes place then write no reaction. Cu+FeCl3--->CuCl3 + Fe Double replacement Al+HBr----> AgNO3 + KCL--->AgClKnO3 Double replacement Ba(NO3)2+MgSO4---->BaSO4(...

chemistry

a reaction is first order and it takes 324 minutes for the reaction to be 50% complete. How long will it take for the reaction to be 85% complete at the same temperature?

Chemistry

A reaction is first order in A. If the rate constant of the reaction is 3.45x10^-3 s-1, what is the half life of the reaction? a. 4.98x10^-3 s b. 200 s c. 3.45x10^-3 s d. 100 s e. 1.73x10^-3 s

chemistry

Distinguish clearly between ▲G for a reaction and ▲S of the same reaction. Which of the two is used to predict whether a reaction is spontaneous? why? (4 marks)

Chemistry

The equilibrium constant Kc for the following reaction is equal to 0.20 at 250°C. Calculate the equilibrium constant Kp for the reverse reaction at the same temperature. COCl2 (g) = CO (g) + Cl2 (g) I'm sorry.. English is a second language for me. After solving for K'c and ...

Chemistry

In the reaction 2HgO(s) --> 2Hg(l) + O2(g) we measure the evolution of gas to determine the rate of reaction. At the beginning of the reaction (at 0 minutes), 0.02 L of O2 is present. After 20 minutes the volume of O2 is 0.36 L. What is the rate of reaction? Question 4 ...

Chemistry

Reaction of gaseous fluorine with compound x yields a single product y, whose mass percent composition is 61.7% F and 38.3%Cl. (a) What is a probable molecular formula for product Y, and what is a probable molecular formula for X? (b) Draw an electron-dot structure for Y, and ...

Chemistry

The following reaction exhibits the rate law: Rate = k[NO2]^2[Cl2]. 2NO(g)+Cl2(g)---->2NOCl (g) (a) Explain why the following mechanism is not plausible for this reaction. Fast: NO + Cl2<-->NOCl + Cl Slow: NO + Cl---->NOCl (b) Propose a two-step mechanism involving...

Chemistry

The combustion reaction of Mg +1/2 O2-->MgO produces a very bright white flame and high heat. Verify that the following reactions produce the same overall reaction: a) MgO+2HCl-->MgCl2+H2O b) Mg+2HCl-->MgCl2+H2 c) H2+1/2O2-->H2O ΔH°= -285.8 KJ/mol

Anatomy

A number of antibiotics act by binding to certain essential enzymes in the target bacteria. How might these antibiotics influence the chemical reaction controlled by the enzyme? What might be the effect on the bacteria? On the person taking the antibiotic prescription?

Chemistry

The thiosulfate ion (S2O32-) is oxidized by iodine as follows: 2S2O32-(aq) + I2(aq) → S4O62-(aq) + 2I-(aq) In a certain experiment, 4.41×10-3 mol/L of S2O32- is consumed in the first 11.0 seconds of the reaction. Calculate the rate of production of iodide ion in mol/L/s

science help?

(a) One such reaction fuses two nuclei of carbon-12 ( 6 12C ) to form an atom of neon ( 10 20Ne ) with the emission of an α-particle. Write an equation for this process, indicating the atomic number and mass number of each of the products in the usual way. (b) Another ...

Chemistry

Write the dissociation reaction and the corresponding Ka equilibrium expression for each of the following acids in water. (Use the lowest possible coefficients. Include states-of-matter under SATP conditions in your answer. Omit water in your answer.) (a) HC_2H_3O_2 (b) Co(H2O...

Chem

Which of the following elements can form chemical compounds. CHECK ALL THAT APPLY. Xe Rn Kr Ne H He Is this a trick question...can't all of them form chemical compounds?

Chemistry

2. Aluminum metal reacts with zinc(II) ion in an aqueous solution by the following half-cell reactions: Al(s) → Al3+(aq) + 3e− Zn2+(aq) + 2e− → Zn(s) a. Predict the potential of the cell under standard conditions. (4 points) b. Predict whether the ...

chemistry

carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= 4.5 x 10^-7). Ignoring Ka2, estimate (K) ...

Chemistry

carbon dioxide dissolves in water to form carbonic acid. Estimate the thermodynamic equilibrium constanst (K) for this reaction (delta Gf values: H2CO3= - 616.1, H2O= - 237.1, CO2= - 394.4) . Carbonic acid then ionizes in water (Ka1= 4.5 x 10^-7). Ignoring Ka2, estimate (K) ...

Chemistry

Which of the following is the best definition of Hess' Law? A. Heat is always released by the decomposition of 1 mole of a compound into its constitute elements. B. The enthalpy of a process is the difference between the enthalpy of the products and the enthalpy of the ...

Chemistry - Kinetics

When a reaction is catalyzed: a) Is the catalyst involved in the reaction? (State your evidence) b) Has the catalyst been consumed when the reaction is complete?

ap chemistry

What is the activation energy Ea for this reaction? Answer in units of kJ The deltaH is 160 kJ X is at 160 (beginning of reaction) Y is at 300 (end of reaction)

chemistry

I need an example of an elementary reaction to go with the definition An elementary reaction is a reaction in which reactants are converted to products in a single step.

Chemistry

Write and balance an equation for a reaction in which iron (Fe) and hydrochloric acid (HCL) reacto to form iron chloride (FeCl2) and hydrogen (H2)

chemistry

Aluminum metal generates H2 gas when dropped into 6.00 M HCl. Calculate the mass of H2 that will form from the complete reaction of 0.365 g Al with 8.40 mL of 6.00 M HCl.

chemistry

How many grams of Cu (s) are needed to form 6.00g Ag from a solution of AgNO3? The reaction is Cu (s)+2Ag^+(ag)--> Cu^2+(aq)+2Ag (s) the molar masses are: Ag=107.868 and Cu=63.546g

Chemistry-Stoichiometry

A 1.146g mixture of the solid salts NaS)4 and PB(NO3)2 forms an aqueous solution with the precipitation of PbSO4. How would I write the molecular form of the equation for the reaction?

Physics!

Consider someone in a rotating space habitat. The outward force felt by the person A.has no reaction counterpart B.is an interaction with Earth C.is a form of gravity D.is real in the traditional sense

Mathematics

if 8; 2x; 2y form an arithmetic sequence and 2x; 2y; 36 form a geometric sequence determine the values of x and y I feel like I am going around in circles on this problem. For the AP i have the following formulas: (1) d=(2y-8)/2 (2) d=2x-8 (3.1) (2y-8)/2=2x-8 or (3.2) (2y-8)/2...

Chemistry

I am wondering about a conceptual question: In an acid/base reaction is there a way to know for sure when an H2O is going to stay with the larger molecule or break off and form water? here are my two examples: R=cyclohexane R-C=-(triple bonded to)CH + KOH <---> ...

Chemistry

I have this question in front of me concerning Methanol (CH3OH) & how geseous methanol is formed via the following thermochemical equation: CO(g)+2H2(g)¡êCH3OH(g)∆H=-90kJ . Now, it asks me (explanations should show a clear understanding of how Le Chatelier¡¯s ...

CHEMISTRY> HELP QUICK! pls

Use the following thermodynamic data at 298 K to determine the equilibrium constant at this temperature for the reaction of iron in steam to form hydrogen and iron(III) oxide. 2Fe(s) + 3H2O(g) 3H2(g) + Fe2O3(s) Substance Fe(s) H2O(g) H2(g) Fe2O3(s) ÄH°f (kJ/mol) 0 -242 -0 -...

Chem- REALLY URGENT!!!

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Chemistry

The decomposition of hydrogen peroxide in solution and in the presence of iodide ion was studied in laboratory, and the following mechanism proposed based on the experimental data. H2O2 + I - = H2O + IO - (slow) H2O2 + IO - = H2O + O2 + I - (fast) Which one of the following ...

Chemistry

The standard free energy of activation of a reaction A is 73.4 kJ mol–1 (17.5 kcal mol–1) at 298 K. Reaction B is one million times faster than reaction A at the same temperature. The products of each reaction are 10.0 kJ mol–1 (2.39 kcal mol–1) more stable than the ...

Chem

In a coffee cup calorimeter, 50.0 mL of 0.100 M AgNO3 and 50.0 mL of 0.100 M HCl are mixed to yield the following reaction: Ag+ (aq) + Cl- (aq) -----------------> AgCl (s) The two solutions were initially at 22.60 °C, and the final temperature is 23.40 °C. Calculate the ...

chemistry

Zinc reacts with sulphur to form zinc sulphuric 16.2g.Sample of zinc is reacted with log of sulphur(Zn=65,S=32,o=16) A)Write a chemical reaction for the reaction b)Calculate the number of moles of zinc atoms that reacted. c)Number of moles of sulphur atoms that reacted

chemistry

If a particular reaction absorbs 252 kJ of heat while doing 105 kJ of work at constant pressure. What are the ΔE and ΔH for values for the reaction? Is the reaction endothermic or exothermic?

science

explain the progress of the reaction in terms of kinetic energy. explain how various factor affect the rate of reaction. btw reaction is from the collisions of molecules in the chemical. any help thanks

chemistry

In the fifth reaction of Glycolosis, G3P dehydrogenase converts glyceraldehydes-3-phosphate into glycerate-1,3-bisphosphate. In order to make the reaction spontaneous at biological conditions it must be coupled to the reduction of NAD+. a) DG° for the reaction of just G-3-P, ...

Pre-Calc/Trig...

standard form: y=x^2-4x-5 vertex form: ? intercept form: ?

chemistry

The initial state of a reaction is A2 +B2 –> 2AB. In the initial state of the reaction there are 6 A2’s present and 6 B2’s present. Suppose the reaction is carried out at two temperatures.Which of these situations represents the result at the higher temperature?(The ...

science

A chemist mixes two liquids together. The reaction produces a gas and a solid. According to the law of conservation of mass, what should the chemist observe when she compares the total masses of the substances before and after the reaction?  (1 point) A.The masses are equal...

English

1.All of the balloons on the string (popped) except two. 2.Do you (want) to buy those books? 3.Daniel's dog is (following) the trail to the river's edge. 4.For thirty years the noon whistle has (blown) exactly on time. 5.The players have (challenged) their parents to a game of...

Chemistry

1. The value of ΔH° for the reaction below is -6535 kJ. _________ kJ of heat are released in the combustion of 16.0 g C6H6 (l). 2C6H6 (l) + 15O2 (g) --> 12CO2 (g) + 6H20 (l) 3. Given the following reactions CaCO3 (s) --> CaO (s) + CO2 (g) ΔH = 178.1 kJ C (s,graphite...

Science

Ms. Lewis is a chemist mixing two solutions together. A chemical reaction takes place, and the solution becomes warm. Which statement best describes what has happened? A. Energy has been created in the form of thermal energy B. Energy has been transformed from one form to ...

college chemistry

a) Is the reaction shown below spontaneous under standard conditions at 25⁰C? CH3OH (g) ----> CO (g) + 2H2 (g) b) Will this reaction be spontaneous at 25⁰C given the following amounts of materials? CH3OH at 1.20 atm CO at 0.080 atm H2 at 0.020 atm

Chemistry

An aqueous solution of 0.25 M silver nitrate, AgNO3, and 0.25 M iron(II) nitrate, Fe(NO3)2, are allowed to come to equilibrium in the following chemical reaction:
Ag+(aq) + Fe2+(aq) Fe3 + (aq) + Ag(s)
If the equilibrium constant, Kc, for the reaction is 3.0 × 10-3...

Pre-Calc.

Write the standard form of the ellipse x^2+4y^2+6x-8y+9=0 I'm not sure how to start it, I think I need to set it equal to one because eventually it needs to end up equal to one but I'm not certain. I know the answer is (x+3)^2/4 + (y-1)^2/1=1 but have no idea how to get there...

Chemistry ASAP

3. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Science - Chemistry

If the rate law of a chemical reaction is k[NH4+]2[NO2–], what is the order of the reaction? 1. The order of the reaction cannot be determined. 2. 3 3. 1 4. 2

Chemistry

Use the data in the table to calculate the equilibrium constant for the following reaction. HCOOH(aq)+ OH −(aq) equilibrium reaction arrow HCOO−(aq)+ H2O(l) HCOO is 5.9e-11 (Kb) HCOOH is 1.7e-4 (Ka) Not sure how to find the equilibrium constant given this information

ORGANIC CHEM LAB

In a hypochlorite oxidation reaction, cyclohexanol plus NaOCL & aq HOAc results in cyclohexanone. The intermediate in this reaction in ROCl where R = cyclohexyl. a.) Show how this intermediate decomposes to product in a E2-like reaction even at pH = 4-5; consider what the ...

Chemistry

Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100