What orbitals are used to form the C–B bonds in B(CH3)3?

35,463 results

Organic Chem

What orbitals are used to form the C–B bonds in B(CH3)3?

Organic Chemistry

What orbitals are used to form the C–B bonds in B(CH3)3?

chemistry

which of the structures are impossible ,give the numbers of bonds that various atoms can form? (a)CH3CH3 CH3 (b)CH3CH=CH2CH2CH3 (c)CH3NHCH3 (d)CH3CCl=CCH2CH3 (e)(CH3)3 CHCH(CH3)2 (f)CH3CHO

Chemistry

Anthracene is a yellow, crystalline solid found in coal tar. Complete this structure for anthracene, C14H10, by adding bonds and hydrogen atoms as necessary. What type of hybrid orbitals are utilized by carbon in anthracene? >>sp3 How many σ bonds and π bonds ...

Chem

Hey in class we learned that pi molecular orbitals come from overlapping p atomic orbitals...this occurs in a conjugated system or aromatic rings ( contains sp2 carbons with one remaining p orbital which can can overlap to form double bonds)...my question is why does it have ...

chemistry

what are structural formulas?? also is this correct hybridization is the setting aside of p orbitals in order to form bonds (pi bonds)

Chemistry

I would appeciate any help with identifying the chiral carbons, if any, in each of the following compounds: OCH3 2. CH3--CH--CH3 OH O 11. CH3--CH--C--CH3 OH 12. CH3--C--CH3 OH CH3 O 15.CH3--CH--C--CH3 Br CH3--C--CH2--CH3 OH thank you.

Chemistry

It is difficult to type these but I'll do my best. This is the first question and I just don't get it. My professor is out of the country so any help would be appreciated. Give the IUPAC name for each of the following alkanes: CH3 I a. CH3--CH--CH2--CH2--CH3 b. CH3 CH3 CH3--CH...

Chemistry

(1) Which of the following clusters of orbitals would form the shape trigonal bipyramidal and would also be possible within the valence shell of an atom? a.) one d orbital b.) five d orbitals c.) five sp^3 orbitals d.) five sp^3d orbitals e.) five sp^3d^2 orbitals f.) two sp ...

chemistry

How does Carbon hybridize it's S and P orbitals and what effect does this have on the 3D structure and chemical behavior? Your answer must include 1) diagrams of SP, SP2, and SP3 bonds as well as any left over Py or Pz orbitals; 2) a discussion with diagrams of how the sigma (...

Chemistry

Hi! I have a question about Pi-Bonds: a. ) are the only kind of bonds present in double bonds b. ) have very little electron density along the internuclear axis c. ) are formed by endwise overlap of p-orbits d. ) are formed from hybrid orbitals e. ) are formed from s-orbitals ...

chemistry

I have a compound ch3 = ch- ch - oh ch3 the ch3 is under the first ch from the left, i have to identify the monomer unit and draw a structure showing three monomer unit any help i have a compound CH3= CH - CH - OH and another CH3 under the first CH from the left , I have to ...

Chemistry

I was asked this question for homework but I don't even know where to begin. It has 3 parts to answer. 1) add all lone pairs and make multiple bonds with the framework shown to satisfy the octets and make the best Lewis structure. 2) For the C-N bond(s) in each molecule ...

Chemistry

Ignore the dots, just put them in to line things up. 1. What is the asymmetric carbon 5...4...3..2..1 CH3-CH2-CH-CH-CH3 ........|..| CH3.CH3 2. which of the following compounds have an asymmetric carbon? A. CH3-CH-CH-CH3 ........|..| ........OH.CH3 B. CH3-CH-CH3...

Chemistry

Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?

Chemistry

Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?

Chemistry

Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 I think its A?

Chemistry

Please tell me how many bonds are in cucl2.4h2o and in CuSO4.5h20 and how cu+2 forms bonds in orbitals 4s,3d with cl2,so4. also please tell me 4h2o and 5h2o attachment in orbitals.

Chemistry

1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to determine which is the highest?

organic chem

Which are enatiomers? optically active?identical? diastereomers? A.)...CH3 .....| ...H-C-Cl .....| .....Ch2Cl B.).....H .......| ...H3C-C-CH2CL .......| .......CL C.)...CH3 .......| ....CL-C-H ......| ......CH2CL D.)....CH2CL .........| ......CL-C-H .........| .........CH3 E...

Chemistry

How do orbitals on individual atoms interact and change when covalent bonds form in molecules?

Chemistry

How does the 3D structure of SP3 bonds of Carbon, Oxygen and Nitrogen cause them to form polar molecules? How does the three dimensional structure of SP3 bonds of Carbon, Oxygen and Nitrogen cause them to form polar or non-polar molecules? The answer must include a 3d diagram ...

CHEMISTRY

WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3 10. CH3C(triple bond)CCH3

Chemistry

Are hybridized orbitals used to explain the fact that the four bonds in methane are equivalent? If not, what is?

Chemisty Help!!!!!!!!

show how you would obtain (the orbitals used) and the possible types (the orbitals produced) for hybridization of a carbon atom. you must report the shape and the number of orbitals of each type used and produced for each type of hybridization.

Chemistry

I am rewriting this question and using dots to make sure that everything lines up correctly so please ignore the dots. 1. name this hydrocarbon .......CH3...CH3 .......|.....| CH3-CH-C-CH2-C-CH2-CH3 ....|..|.....| ....CH3CH2..CH2 .......| ........CH3 I have come up with normal...

Chemistry

an exothermic reaction involves a. breaking weak bonds to form weak bonds. b. breaking weaker bonds to form stronger bonds c. breaking srtong bonds to form strong bonds. d. breaking stronger bonds to form weaker bonds. I think that it is a.

Chem - IUPAC naming system

I don't know how to name this. Help? You'll have to write out what I'm describing because I can't set it up in this. In a straight line, there is (1)CH3 - (2)C - (3)CH2 - (4)C - (5)CH - (6)CH3. On #2, there is CH3 and CH3. On #4, there is CH3 CH3 and CH3. On #5, there is CH2 ...

chem

what is the appropriate hybridization for the carbon atom in CO2? the explanation I was given is 2 electron groups around the center atom carbon suggest sp hybridization. the 2 unhibridized p orbitals on carbon form the 2 pi bonds. My question is why pi bonds? Isn't it ...

Chemistry

How would I draw the abbreviated structural formulae of the products of the complete hydrolosis of this compound, CH3 O (=) N - C - CH - NH2 (-) (-) H CH3 CH3 Sorry about the drawing, the bonds in brackets should be vertical, thanks. We simply can't draw structures on the ...

Chemistry

Name the following compounds 1. CH3-CH=CH-CH2 l Cl 2. CH3-CH-C=(tripple bond)C-CH3 l CH3 3. Cl Cl l l CH = C-CH3 4. Complete the following reactions and name the products a. CH2-CH=CH3+Cl2>>>> b. CH3-C=C-CH3+Br2 >>> Please help!

chem

what is the balanced equation for ozone gas reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Chemistry

Please help! Complete equation by drawing structural formula(e) of the product(s). CH2=CH-CH-OH + CH3-CH-CH2-C =O CH3 CH3 -OH You will have to imagine the bonds as I can't draw vertical or diagonal lines! There are too many possibilities to imagine what you are trying to draw...

chemistry

if 2 atoms combined their 4f orbitals, what type of orbitals should form?

Chemistry

When you're naming organic compounds, is there more than one name that's acceptable for each compound? For example Ch3-CH2-CH2 CH3 1 1 CH3-CH-CH-CH 1 1 CH3-CH2 CH3 Hopefully this appeared alright once I typed it. The ones represent bonds. In the answer key, the name is 3 ethyl...

chemistry 101

What alcohol(s) could be used to produce each of the following compounds? Enter the IUPAC names of the alcohol(s). If there are more than one alcohol, enter them separated with commas. 1.CH3-CH2-O-CH2-CH3 2.CH3-CH2-C=CH-CH3 ..........| ..........CH3. 3.pentagon with a double ...

Chemistry

what is the sp hybrid orbitals for carbon molecules in CH3-C=C-CH2OH?

CHEMISTRY PLEASE HELP

Write an isomer of structure for a), b) and c) and name them. *(N.B- ! rep. a bond) a) CH3 ! CH3-CH2-C-CH2-CH3 ! CH3 CH3 ! b) CH3-CH2-CH-CH-C(TRIPLE BOND)CH ! CH2 ! CH3 c) 3,3,4-trimethyl-1-pentene

Chemistry

Select the most likely rate law for the following: (CH3)3C-Br + OH- > (CH3)3C-OH + Br- a. Rate=k[(CH3)3C-Br] b. Rate=k[(CH3)3C-Br][OH-] c. Rate=k[(CH3)3C-Br][OH-]2 d. Rate=k[(CH3)3C-Br]2[OH-]2 e. Rate=k[(CH3)3C-Br]2[OH-] The correct is answer is "a" but I'm not sure why its...

Chemistry

what is the asymmetric carbon 5 4 3 2 1 CH3-CH2-CH-CH-CH3 | | CH3 CH3 which of the following has an asymmetric carbon CH3-CH-CH-CH3 | | OH CH3 CH3-CH-CH3 | CH3 CH3-CH-F | OH

Chem

COMPOUND 1 CH2 = CH-CH-OH with CH3 under the second CH Plus CH3-CH-CH2-C (double bond O off C and -OH off C) also a CH3 under CH i) complete the equation for this reaction ii) Indentify any new functional groups in the organic product(s)name them iii)State the type of reaction...

Chem

What type of orbitals are used to form the N–N bond in hydrazine, N2H4?

chemistry

Which have the following have an asymmetric carbon A. CH3-CH-CH-CH3 | | OH CH3 B. CH3-CH-CH3 | CH3 C. CH3-CH-F | OH

chemistry

I am totally lost on this one. 1,2,2-trimethylcyclopentane I think I have to draw the cyclopentane shape with the single bond going straight CH3 and I am lost from there. Draw the cyclopentane as a 5-cornered box. C-C |  | C  C  \  /   C Start numbering...

chemistry

Although no currently known elements contain electron in g orbitals in the ground state, it is possible that these elements will be found or that electrons in excited states or known elements could be in g orbitals. For g orbitals, the value of L(lowercase) is 4. What is the ...

Chemistry

Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

chemistry

please name this compound CH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3

chemistry

CH3 CH3-C-CH3 CH3CH2CH2-C-CH2CH2CH2CH3 CH3 give the IUPAc name for this compound? is it 4-methyl-4-tert-methyloctane?

Chem.

Is the number of branches or carbons more important when determining the boiling point of a substance? I have CH3-CH3 and C3-CH (with a branch leading upward to CH3)-CH3. Thanks for your help.

Orgnic chemistry

Some molecules w/ non polar bonds like C-S and C-I when exposed to a highly polar environment may assume polarity -Due to vacant d orbitals of S (i don't get this. So if it has a lot of vacant orbitals it will be polar?) -big atomic radius of I (please explain this to me) S ...

Chemistry

Can pi bonds be made from d-orbitals?

Chemistry

Can pi bonds be made from d-orbitals?

Chemistry

All of the following are true EXCEPT; A. the n=4 energy level has no f orbitals B. the 2p orbitals can have a maximum if 6 electrons C. the s orbital has a spherical shape D. there are 5 orbitals in a set E. the n=3 energy level has a set of d orbitals.

chemistry

Indicate the number of covalent bonds that each nonmetal atom is expected to form. a. Se is expected to form 2 covalent bonds. b. H is expected to form 1 covalent bonds. c. Br is expected to form 1 covalent bonds. d. N is expected to form 3 covalent bonds.

Chemistry

I need help naming these compounds. I CL H H | | | | CH3-CH-CH-C=C-CH3 F CH3 O | | || CH3-CH-CH-CH2-CH-C-OH | CH2-CH3 CH3-CH2-CH2 | CH3-CH2-C-C-CH-CH3 | || | Br O CH3

physical science

Which electron cannot occurr? a) 1s^22s^1 b) 1s^2 2s^2 2p^6 3s^2 c) 1s^2 1p^6 2s^2 2p^6 d) all can occurr How do I figure this out? s orbitals can contain 2 electrons maximum and p orbitals can contain 6. I do not see this condition being violated in any of the configurations ...

Chemistry

Can someone help me identify the functional groups and what the chiral carbons are? NOTE: THE LAST C HAS A DOUBLE BOND POINTED UPWARDS CONNECTED TO O. SORRY I TRIED MAKING IT AS CLEAN AS I CAN. STARTING FROM LEFT TO RIGHT THE 2ND C HAS A NH3 ATTACHED. THEN NUMBER 3 HAS A CH2-O...

chemistry

What is the asymmetric carbon in this compound 5 4 3 2 1 CH3-CH2-CH-CH-CH3 | | CH3 CH3

chemistry

I can't seem to figure out the name of this organic molecule. I know it's an amine, but that's it. There are two methyls (CH3) attached to a CH, followed by (in order) NH, CH2, CH2, CH2, and CH3. (ignore the ^^^, I had to use them so the atoms would line up) ^^^^^^^H ^^^^^^^| ...

chemistry

Carbon is able to form large numbers of organic compounds because carbon can A.form 4 bonds B.form single, double and triple bonds C.form chains, rings, spheres and sheets D.the carbon-carbon bond is very stable E.all answers are correct

Chem

CH2 = CH - CH - OH ............| ...........CH3 Draw the structure of this polymer and identify the monomer unit. Should show three monomer unit State the type of polymerization involved in forming this polymer Hi Lacey, do you know the answers for part a, of question 5 at all...

Chemistry

If a sample of C6H4(CH3)2 is found to contain 3.54 * 10^26 CH3 groups how many moles of C6H4(CH3)2 molecules are present? C6H4(CH3)2 - 106.17 CH3 group - 15.035 C6H4 Group - 76.098 Please explain steps

Chem

Lewis structure of [(CH3)3O]+. Be sure to show all atoms, bonds, lone pairs, and formal charges. Convert CH3CH(Cl)CH(OH)CH3 into a skeletal structure. If you could explain it, it would help. Or somehow do some of it here and explain. Im having a lot of trouble with this ...

chemistry

what is the best synthesis of 2-methyl-2-pentene (CH3)2C=CHCH2CH3? 1.(CH3)2CHCH2CH2CH3+F2,heat 2. KOC(CH3)2 1.(CH3)2CHCH2CH2CH3+Cl2,heat2.NaOCH2CH3 1.(CH3)2CHCH2CH2CH3+Br2,heat2.NaOCH3 1.(CH3)2CHCh2CH2CH3+I2,heat2.NaOCH2CH3

Chemistry

Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3. CH3-C-C-CH3 with a CH3 attached to the top and ...

Chemistry

A solution of hexane in the solvent (CH3)2CO has a mole fraction of CH3(CH2)4CH3 of 0.114. What mass (g) of the solution must be taken if 1690 g of hexane is needed? Molar Mass (g/mol) CH3(CH2)4CH3 100.21 (CH3)2CO 58.05 Density (kg/L): CH3(CH2)4CH3 0.6838 (CH3)2CO 0.7899 Name/...

Chemistry

Name these compounds, according to the IUPAC system H H \ / C=C / \ CH3 CH2CH3 and CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3 Thank you

Chemistry

How many pi bonds and sigma bonds are in ritalin molecule? I counted 4 pi bonds and 18 sigma bonds is that correct? I know double bonds are pi bonds and single bonds are pi bonds

Chemistry

IGNORE MY FIRST POST. I CORRECTED THIS ONE Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2-dimethylpentane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-dimethylheptane? 3. CH3-C-C...

chemistry question

this is considered to have asymmetrical carbons :ch3ch2ch(chlorine group is connected on bottom)Ch3 why isn't this one: ch3ch2ch (methyl group attach to it) ch3? By convention, we look at the carbon chains, and carbon sidechains when discussing symettry. If the second were ...

chemistry

the diagram below shows a structural formulae of 3 cabon compounds labelled 1 2 and 3 and the eaction between compounds 1 and 2. The equation for this reaction is incomplete only the reactants are shown, the missing products being indicatedby a? :o ch2 =ch-ch -oh + ch3 - ch - ...

Chemistry

Which of the following combinations of atomic orbitals can combine to form sigma bonds? s-s s-p p-p hybrid orbital - hybrid orbital hybrid orbital - s hybrid orbital - p

science

Which of the following combinations of atomic orbitals can combine to form sigma bonds? s-s s-p p-p hybrid orbital - hybrid orbital hybrid orbital - s hybrid orbital - p

chemistry

Which of the following combinations of atomic orbitals can combine to form sigma bonds? s-s ,s-p, p-p ,hybrid orbital - hybrid orbital ,hybrid orbital - s ,hybrid orbital - p

Chemistry

................CH3 ..................| CH3-CH2-N-CH2-CH2-CH3 Hoping this turns out okay, but it's an amine and branching off of the N (on top) is a CH3. The name is N-ethyl-N-methylpropanamine but I don't get why. How do you know which ones to treat as branches? I mean the ...

Chemistry

Show the steps necessary to transform acid on left to compound on right... Make sure you use SOCl3.................. (CH3)3CCH2C(=O)OH ----------> (CH3)3CCH2C(=O)OCH2CH=CH2 (CH3)3CCH2C(=O)OH-----------> (CH3)3CHC(=O)N(CH2CH3)2

CHEMISTRY

Predict the products of the following reactions. a)CH3-CH2-CH2-CH3+O2----> B)CH3-CH2-CH2-CH2-CH3+Br2----> c)CH3-CH=CH-CH3+Br3----> D) HEXENE+KMnO4--> E) HEXENE+Br2---->

Chemistry

So I thought i finally had figured out how to balance these equations but now this one with the formula in it has confused me again. Can you help with the next steps in balancing this equation? Maybe if I can get the answer to this one I can complete my other questions. O3 + H...

Organic Chemistry 2

Arrange these in the correct order of their reactivity during nucleophillic substitution by SN2 and SN1 conditions, Ch3-CH=CH-CH2-Cl, Ch3-CCl-Ch-Ch3, and Ch3-Ch2-Ch2-Ch2-Cl

Chemistry

Considering only the molecular orbitals formed by combinations of the s atomic orbitals in the valence shell, how many molecular orbitals can be formed by 5000 sodium atoms?

Chemistry

For a Sc atom in ground electronic state: 1. how many electrons are there in 4s orbitals? 2. how many electrons are there in 3d orbitals? 3. how many electrons are there in 4p orbitals? 4. how many unpaired electrons are there? 5. to what block does Sc belong to in the ...

Chemistry

What is energy difference between staggered and eclipsed conformations of 2,2,3,3-tetramethylbutane? Is it 2k/J/mol? Interaction Energy Cost (kJ/mol) H/H Eclipsed 4 CH3/H Eclipsed 6 CH3/CH3 Eclipsed 11 CH3/CH3 Gauche 3.8

chemistry

How would the 2s and 3p orbitals differ from the 1s and 2p orbitals? Check all that apply. possible answers The and orbitals would have more nodes than and orbitals. The orbital would be the same shape as the orbital but would be smaller in size. The and orbitals would have ...

Chemistry

In the condensed structure CH3CH2CHCH double bonded to CHCH(CH3)2 ! CH3 What does it mean when the CH3 is in () followed by the 2?

Chemistry

(CH3)2CHCH2CH(CH2CH2CH2CH3)CH2CH(CH3)CH((CH3)2) Looking for skeletal diagram and name of formula.

Chemistry

What is basic like NaOH,from the following? 1)CH3NH2 2)(CH3)2NH 3)(CH3)3N 4)[N(CH3)4]^-(OH^-) 5) 2,4,6-aniline What is the reason?

chemisrty

Is this the stuctual formula for hydolosis of tocainide CH3 NHCOCH^2N(C^2H^3)^2 CH3 WITH THE HEXAGON LINKING THE 2 X CH3

chemistry

I have to draw the QMM of CL2C2. For the Lewis structure i think that the two C ayoms form a triple bond and the Cl atoms form single bonds. Therefore i think that the central C atom hybridizes into sp. if this is correct, my question is how do i know which p orbital on C to ...

Chem

Is CH(three bonds)C-CH2-CH3 1-butyne? Thanks for checking!

Science

How two neutral objects may become positively and negatively charges? How is atomic mass established? Which atoms will form covalent bonds and which atoms will form ionic bonds?

Chemistry

Sorry...it came through funny. O3 + H-C=C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 -> CO2 + H2O All of the numbers above are supposed to be subscript but keep coming out the same size as the letters. So this is the equation that i am trying to balance. In my question where there the ...

Chemistry

I am suppose to name alkanes, but I don't know how to do it, if possible to give me an example on how to do it, but here is one of the questions I have to do. CH3-CH-CH2-CH3 | CH3

Organic Chemistry

Place these in order of decreasing priority according to the R-S convention a) H, CL, Br, CH3 B) OH, CH3, CH2CL, CH3CH2 C) CH3, CH2CH3, CL, c6H5

Chemistry

I am really stuck on these so will try and explain further and use dots. 1. I have come up with normal heptane on this but not sure .......CH3...CH3 .......|.....| CH3-CH-C-CH2-C-CH2-CH3 ....|....|...| ....CH3..CH2.CH2 .........| .........CH3 In the first row CH3 and CH3 are ...

Chemistry

I will try these again, as I am really struggling with these compounds. Hard going back to school after all these years. 1. I will list the longest chain and then tell when items are placed above and below CH3-C=CH-CH-CH3 above C is CH3 Below the second CH is CH2 and below ...

Chemistry

Name this compound according to the IUPAC system CH3 | CH=C-CH-CH-CH3 | CH3 Thank you.

Chemistry

How many pi bonds and sigma bonds are in ritalin. I counted 4 pi bonds(double bonds), and 18 sigma bonds(single bonds> I want to make sure I didn't miss count anything.

Chemistry

How many pi bonds and sigma bonds are in ritalin. I counted 4 pi bonds(double bonds), and 18 sigma bonds(single bonds> I want to make sure I didn't miss count anything.

Chemistry

Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2-dimethylpentane? Wouldn't it look like this: CH3-C-CH2-CH2-CH3 with a CH3 on the top and bottom of the C, which would be the 2nd carbon... right? I don't understand why it would be the ...

ap chem

Show how a hydrogen 1s atomic orbital and a fluorine 2p atomic orbital overlap to form bonding and antibonding molecular orbitals in the hydrogen fluoride. Are these molecules sigma or pi molecular orbitals?

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100