What is the empirical of compound (X) going through the following decomposition reaction?

77,997 results, page 6

Chemistry

Please check the following. 1. What compound is sodium sulfite? My answer:Na2SO3 2. Which element is a noble gas? a. N2 b. Cl2 c. Xe d. I2 My answer: c 3. Which element is most likely to form a cation with a 2+ charge? a. S b. P c. Be d. Al My answer: c 4. Which species ...

Chemistry

A student tested the effect of temperature on the decomposition of N2O5. He found that the rate of the reaction at a lower temperature was 4.2 x 10–3 s–1 and the rate at a higher temperature was 1.6 x 101 s–1. What is wrong with the student's data? A. Nothing. Rate ...

Chem

3.297 g of a substance (containing only C, H, and O) is burned in a combustion analysis apparatus. The mass of CO2 produced is 3.626 g, and the mass of H2O produced is 9.897×10-1 g. What is the empirical formula of the compound?

chemistry

Combustion analysis of 1.0g of a compound containing carbon , hydrogen and oxygen gives 2.3 g of carbon dioxide and 0.93g of water . If The relative molecular mass is 58. Calculate The empirical and molecular formula

Chemistry

Ascorbic acid is a compound containing of three element C,H, and O when a 0.214g sample is burned in oxyzen 0.320g of CO2 and 0.0874g H2O are formed. What is the Empirical formula of ascorbic acid?

physical science

give one word/term for each of the following descriptions. 1.A substance that donates electrons in chemical reaction. 2.The formula showing the simplest whole number ratio in which the atoms combine to form a compound.

chemistry

Write the equation for the decomposition of HI, knowing that the reaction requires 9.4 kj/mol of hydrogen forming. If 100.0 kj of energy are added, how many grams of iodine will form.

chemistry

If the half-life of a first-order decomposition reaction is 24.2 minutes, how long will it take for 10.0 moles of the reactant to decompose so that only 2.5 mol remains?

Chemistry

What is the empirical formula of a molecule containing 65.5% carbon, 5.5% hydrogen, and 29.0% oxygen? -I found this to be C3H3O and WebAssign says it's right. I need help with part b. If the molar mass of the above compound is 110 grams/mole, what is the molecular formula?

Chemistry- Dr. Bob

Please check the following. 1. What compound is sodium sulfite? My answer:Na2SO3 2. Which element is a noble gas? a. N2 b. Cl2 c. Xe d. I2 My answer: c 3. Which element is most likely to form a cation with a 2+ charge? a. S b. P c. Be d. Al My answer: c 4. Which species ...

Chemistry

Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...

Chemistry

Explain using electron-pushing arguments why glycolysis must go through G6P to F6P step (C1 aldehyde to C1 ketone). Focus on the subsequent aldolase-catalysed reaction and explain why glucose 1,6 bisphosphate would not be able to go through the aldolase reaction.

Chemistry

Explain using electron-pushing arguments why glycolysis must go through G6P to F6P step (C1 aldehyde to C1 ketone). Focus on the subsequent aldolase-catalysed reaction and explain why glucose 1,6 bisphosphate would not be able to go through the aldolase reaction.

chemistry

a compound with the molecular weight of 276 grams was determined to be 39.10% carbon, 8.77% hydrogen, and 52.13% oxygen. what is the empiricial formula and the molecular formula for the compound? i do not know where to start! i worked it out and i got 276/100=2.76 do i round ...

Science

A compound is made up of two elementsA and B,has A=70%,B=30%.The relative number of moles of Aand B in the compound are 1.25 and 1.88 respectivily.If the molecular mass of the compound is 160g.Find the molecular formula of the compound?

chem

a 2.747g sample of manganese metal is reacted with excess HCl gas to produce 3.24L of H2 at 366K and .927atm and a manganese chloride compound(MnCl0. What is the formula of the manganese chloride compound produced in the reaction?

chem

ive tried the ice method but i keep on getting it wrong please help. If the initial pressure of NH3(g) is 3.168 atm, calculate the % decomposition of NH3(g) when the reaction comes to equilibrium according to the balanced equation. The value of Kp at 427.0 °C is 12800.00. The...

chemistry

State whether each of the following will increase,decrease or unchange when catalyst is added to the reaction and give an explanation for your answer please a) rate of reaction b)activation energy c)reaction enthalpy d)equilibrium of reaction

chemistry-stoichiometry

how many grams of chlorine can be liberated from the decomposition of 64.0g of AuCl3 by this reaction 2 AuCl3----> 2 Au + 3cl2

Chemistry

If you begin with 34.4 grams of ammonia how many grams of hydrogen and nitrogen can you produce in a decomposition reaction

Chemistry

What is the empirical formula for a compound of sodium and oxygen that contains 59% by mass? I am guessing it would be NaO because the molar mass of Na is 22.99 g/mol and 22.99 g/mol Na / 22.99 + 16 is approx 59%. Just wanted to make sure that is correct.

chemistry

Heterogenous equilibrium of ammonium bisulfide. Ammonium bisulfide NH4HS forms ammonia NH3 and hydrogen sulfide H2S through the reaction NH4HS(s) arrows + H2S(g). This reaction has a kp value of 0.120 at 25 C. A 5.0-L flask is charged with .400g of pure H2S(g) at 25 C. ...

chemistry

Answer the following questions about Fe(NO3)3. a. What is the mass percent of iron in this compound? b. A different iron compound is 34.43% by mass iron. What mass of this compound is needed to get 125g of pure iron?

thermochemistry

A chemical reaction takes place in a container of cross-sectional area 100 cm2 . As a result of the reaction, a piston is pushed out through 19 cm against an external pressure of 596 torr. What is the value for w for this reaction?

English

If you are in line early, youll be sure to get the best tickets. A. Compound-complex B. complex C. Compound D. SImple 2. Heather is in charge of decorations, and Enrique is bringing snacks. A. simple B. Compound C. Complex D. Compound-complex 3. My two dogs are named Hannah ...

chemistry

what type of reaction is this Li + H2O --> LiOH A. Combination B. Combustion C. Decomposition Im thinking combination but the H2 is confusing me

IPC

Element A and element B have bonded and formed compound AB. Which of the following statements is true? A) Compound AB has chemical and physical properties that are completely different from those of A and B. B) Compound AB has chemical and physical properties that are a blend ...

chemistry.

An organic compound A contain 62.0% by mass of carbon, 21.1% by mass of nitrogen, the reminder being hydrogen. Determine the percentage by mass of hydrogen and the empirical formula A.....Can any one help me on that?????

Math

1. Ashlyn took out a loan for $700 to buy a new Tv. The bank to going to charge her 3% compound interest. What amount will Ashlyn owe the bank after 3 years 2. Determine the value of a $100 investment earning 10% compound interest over 2 years.

chemistry

Calculate the mass of NO2 produced from the decomposition of copper nitrate if .462mol of oxygen are formed. The equation for the reaction is 2Cu(no3)2 - 2CuO + 4NO2 +O2

Chem

When 5.49 g of platinum reacts with an excess of fluorine, 7.65 g of platinum(_) fluoride forms. a. What is the mass of fluorine in the compound? b. Find the number of moles of platinum that reacted. c. Find the number of moles of fluorine that reacted. d. Calculate the ratio ...

college Chemistry

After subtracting the weight of the container, the Vanadium metal inside is found to weigh 8.34 grams. After reacting with Oxygen the newly formed compound weighs 21.43 grams. What is the empirical formula?

Chemistry (30s)

I need help on this question. I can't seem to understand it. Find the molecular formula of a compound with a gram molecular mass of 30 g and an empirical formula of CH3. Please show your work! and briefly explain how you got it!

math

Zeb is going to deposit $3370 into an account that earns 14% APR compounded annually for 37 weeks. What is the "n" in the compound interest formula? n= What is the "t" in the compound interest formula? Enter as a fraction. years What is the "nt" in the compound interest ...

Chemistry

In the decomposition reaction 2 KCIO3 (s) --> 2KCI (s)+3O2(g),what volume of O2 gas at STP would be produced from 3.66 of KCIO3 ?

Chemistry

In the decomposition reaction 2 KCIO3 (s) --> 2KCI (s)+3O2(g),what volume of O2 gas at STP would be produced from 3.66 of KCIO3 ?

Chemistry

How many liters of oxygen gas at 153 degrees celsius and 0.820 atm can be produced by the decomposition of 22.4 g of solid KClO3? (The other decomposition product is solid potassium chloride)

Chemistry

Thank you for your help. I did want to clarify why you are only calculating the Molar Mass for H2 and not the molar mass for H2O (or even H2O2). I'm not sure why you did this. Please clarify. See below: The following reaction represents the decomposition of hydrogen peroxide ...

Chemistry

Consider the following decomposition reaction of ammonium carbonate ((NH4)2CO3): (NH4)2CO3 (s)  2 NH3 (g) + CO2 (g) + H2O (g) In one experiment at 25.0°C, a sample of pure (NH4)2CO3 is placed in an evacuated 2.00 L vessel. At equilibrium, the total pressure is found to be ...

Chemistry

Do the reaction rate depends on the concentration of catalyst? I googled this and found that the decomposition of H2O2 stops of we add excess MnO2. Are there any other examples like this? Or does this happens with every catalyst when they are in excess or they are in very ...

chemistry - 3.1.6

At a high temperature, the equilibrium constant for the decomposition of hydrogen iodide is 65.0. If the initial concentration of HI is 1.60 M, what is the concentration of hydrogen at equilibrium? 2Hl(g) H2(g) + I2(g) A. 1.42 M B. 0.753 M C. 0.240 M D. 0.802 M I'm actually ...

chemistry

While trace impurities of iron and chromium in natural corundum form the gemstones ruby and sapphire, they are basically a binary compound of aluminum and oxygen, with 52.9% Al. Find the empirical formula and give the chemical name for corundum. the answer is Al2O2 but i don't...

chemistry

How many grams of sodium were isolated from the decomposition of 0.0292 moles of Na2O, if the reaction occurred with a 44.9% percent yeild? 2 Na2O(s) --> 4 Na(s) + O2(g)

Chemistry

If I have 0.17g of Mg and 0.10g of O, and I am asked to find the empirical formula for magnesium oxide, is the following the right way to go about it? Convert g-> mol 0.17g=0.01mol Mg 0.10g=0.01mol O Divide by smallest mole amt. (0.01mol) 0.01mol/0.01mol=1 0.01mol/0.01mol=1...

chemistry

Suppose you do not know the enthalpy of decomposition of the process: CaCO3 = CaO + CO2 Explain in terms of thermodynamic parameters why heating to a high temperature might turn this decomposition to a spontaneous process.

math

On a straight line graph, if the line is going this way \ and it goes through 5 on the x axis and 4 on the y axis then what is it's gradient? How do I work this out? Thanks xx You also have to specify a point that the line goes through. Does it pass through the origin (x=0, y=...

science

Which of the following has a boiling point which does not fit the general trend. NH3 PH3 SbH3 AsH3 I am going with NH3 as i think its to do with "the larger the compound the greater the boiling point"(Vander waals forces) Am I correct?

Chemistry

If the specific rotation of Compound X is (-) 123.8º, what would be the observed rotation of its enantiomer, Compound Y, assuming the concentration and cell path length is the same? b. If a racemic mixture of Compound X and Compound Y were analyzed, what would be the observed...

chemistry

Choose all of the following statements about the equilibrium constant K that are true: (a) If the K value for a reaction is > 1 then Go must be negative for this reaction (b) A large value for K implies there is a strong driver for the reaction to proceed in the forward ...

Honors Chemistry (check answers)

On a worksheet we got, we have to balance out chemical reaction equations then define what kind of reaction it is (synthesis, decomposition, single/double-replacement). Would someone be willing to check my answers, please? Thanks!! 1. c) BaO + H2O ==> ________ (synthesis...

chemistry

I need help with this lab. Write the equation for the decomposition of the hydrate, CuSO4*XH2O. Mass of crucible and hydrate: 93.000g Mass of crucible and pure salt: 91.196g I need to calculate the following: 1. mass of water in hydrate sample(g) 2. number of moles of water in...

Chemistry

Compound 1 Compound 2 O || CH2=CH-CH-OH + CH3-CH-CH2-C | | | CH3 CH3 OH | | ? (i) identify any functional groups in compounds 1 & 2 by circling them and naming them clearly. (ii) complete the equation for reaction 1 by drawing the abbreviated structural formula(e) of the ...

chemistry

you are given an unknown gaseous binary compound. when 10.0g of the compound isburned in excess oxygen, 16.3g of water is produced. the compound has 1.38 times that of oxygen gas at the same conditions of temperature and pressure. give a possible identity for the compound.

smk lutong

A compound consists only of carbon, hydrogen, nitrogen, and oxygen.  Combustion of 10.68 g of the compound  produced 16.01 g carbon dioxide and 4.37 g of water.  the molsr mass of the compound is 176.1 g/mol. what are the empiricaland molecular ...

Minoxidil

So, I'm doing a research project for my chemistry class, and one of the parts that I have to answer is the chemical reaction of the substance that I'm researching. But there's a problem. I've searched every single website regarding minoxidil, but I cannot find a chemical ...

biochem

4)You are informed that a compound secreted from a frog found in the Amazon basin has been showed to inhibit ATP synthesis. Without knowledge of specific details could you speculate on potential mechanisms through which this discovered compound be inhibiting ATP synthesis?

chemistry

From the following Information, calculate the standard change of enthalpy for the combustion of coal. SHOW WORK AND BALANCED REACTION!!! Compound DeltaHf (kj/mol) Coal 0.0 Carbon dioxide -393.5 Water (l) -285.9 Oxygen 0.0

chemistry

From the following Information, calculate the standard change of enthalpy for the combustion of coal. SHOW WORK AND BALANCED REACTION!!! Compound DeltaHf (kj/mol) Coal 0.0 Carbon dioxide -393.5 Water (l) -285.9 Oxygen 0.0

Chemistry

For the unbalanced reaction: FeSO4 (s) → Fe 2O3 (s) + SO2 (g) + O2 (g) ; how many total moles of gas are produced from the decomposition of 9.98 mol FeSO4 (s)?

science chemistry

Given 4K + O2 → 2K2O, what is the reaction type? Single Replacement Double Replacement Synthesis (formation) Decomposition

Chemistry

The decomposition reaction of A to B has a rate constant of 0.00923 M-1s-1: A → 2B If the initial concentration of A is 0.160 M, how long will it take for the concentration of A to decrease by 68.2%?

Chemistry

The equation Ba(s) + HCl(aq)→BaCl2(aq) + H2(g) is an example of which type of reaction? A. double-replacement B. combustion C. single-replacement D. decomposition C?

chemistry

For each of the following chemical reactions: a.)classify the reaction as combination, decomposition,single replacement, or double replacement. b.)complete the word equation. c.)using the formulas for both reactants and products, balance the chemical equation. 1. tin(IV)...

Biology

Okay so if i have two enzyme catalyzed reactions: 1) delta g of the ES = -22kJ/mol 2) delta g od the ES = 42 kJ/mol Is this first reaction going to have a higher reaction rate because the of the negative delta g, because doesnt a negative delta g give you a spontaneous ...

Chemistry

A sample of a compound of mercury and bromide with a mass of .389 was found to contain .111g bromine. Its molar mass was found to be 561 g mol-1. What are its empirical and molecular formula. Please detail each step in the process. Thanks in advance!

Chemistry

The ¡°air¡± that fills the air-bags installed in automobiles is actually nitrogen gas produced by the decomposition of sodium azide, NaN3. Assuming that the decomposition of sodium azide produces both nitrogen and sodium metal (Na), what volume, in litres, of nitrogen gas ...

Chemistry

What is the value of the rate constant for a reaction in which 75.0 percent of the compound in a given sample decomposes in 80.0 min? Assume first order kinetics. Use the integrated rate law for a first order reaction. Remember at 75 percent reaction, 25 percent of the ...

Chemistry

What is the value of the rate constant for a reaction in which 75.0 percent of the compound in a given sample decomposes in 80.0 min? Assume first order kinetics. Use the integrated rate law for a first order reaction. Remember at 75 percent reaction, 25 percent of the ...

Physical science

1. Nicotine,a poisonous compound found in tobacco leaves,is 74% carbon,8,65% hydrogen and 17,35% nitrogen (a)calculate the empirical formula of nicotine (b)what is the molecular formula of nicotine if it has a molar mass of 165 g.mol^-1

AS ORGANIC CHEM

An organic compound, X, will react with an excess of calcium metal to produce a salt with the empirical formula CaC4H6O4. What could be the identity of X? 1 ethanoic acid 2 butanedioic acid 3 methylpropanedioic acid With explanation please!

chemistry

While trace impurities of iron and chromium in natural corundum form the gemstones ruby and sapphire, they are basically a binary compound of aluminum and oxygen, with 52.9% Al. Find the empirical formula and give the chemical name for corundum. i really need help fast

College Chemistry 3

Find the empirical Formula of a compound that is 30.4% nitrogen by mass, and consists of only nitrogen and oxygen. What is its molecular formula if its molar mass is 92g/mol?

chemistry

Analysis of a compound gave 39.50% C, 2.20% H, and 58.30% Cl. When 0.855 g of this solid was dissolved in 7.50 g of napthalene, the solution had a freezing point of 78.0° C. The pure solvent freezes at 80.0° C; its molal freezing point constant is 6.8° C/m. What is the ...

physical scince

answer the following question: QUESTION 4: What does it mean if a compound has a solubility of 15g in 100g of water at 0 degrees Celcius? A) 100 g of the compound will dissolve in 15 g of water at 0 degrees celcius B)15 g of the compound will dissolve in 100g of water at 0 ...

Chem

Suppose that a stable element with atomic number 119, symbol Wr, has been discovered. (d) What would be the most likely charge of the Wr ion in stable ionic compounds? (e) Write a balanced equation that would represent the reaction of Wr with water. (f) Assume that Wr reacts ...

English

Which of the following is a simple sentence? A. Many are called, but few are chosen B. A penny saved is a penny earned C. Fools rush in where angels fear to tread D. If at first you don’t succeed, try, try again 2. Which of the following is a compound sentence? A. I have not...

Science

7. Which of the following changes gives no evidence that a chemical reaction has taken place? A cube of solid forms a puddle of liquid. A certain liquid is added to a solid, and bubbles of gas form. Two liquids are mixed, and a precipitate forms. Heating a blue solid turns the...

structural formulae

REACTION 1 IS A CARBON COMPOUND CONTAINING AN ALCOHOL FUNCTION GROUP + REACTION 2 IS A CARBON COMPOUND CONTAINING A CARBOXYLIC GROUP. IM TRYING TO UNDERSTAND THE PRODUCT FORMULAE. CAN YOU TELL ME HOW THESE TWO FUNCTION GROUPS REACT, AND THE RELEVANCY OF CH IN THIS EQUATION ...

chemistry-redox

Can two elements both be oxidized in a reaction? 2FeS + 4.5O2 +2H2O==> Fe2O3 + 2H2SO4 I see Fe is oxidized, going from Fe+2 to Fe+3 However, Isn't S going from S-2 to S+6? making sulfur ixidized too, and not reduced?

Chemistry

The decomposition of ozone is believed to occur in two steps O3 <==> O2 + O O3 + O ---> 2O2 Identify any reaction intermediate. What is the overall reacion? I got O3 + O3 --> O2 + 2O2

Chemistry

The decomposition of ozone is believed to occur in two steps O3 <==> O2 + O O3 + O ---> 2O2 Identify any reaction intermediate. What is the overall reacion? I got O3 + O3 --> O2 + 2O2

Science

Steel wool [iron] is burned in the presence of oxygen in the air and makes iron oxide: is this a combination, decomposition, or replacement reaction?

Chemistry

how can two clear solutions mix and produce a cloudy precipitate- what is going on? Is this good or can I add something else? When two clear solutions mix together and produce a cloudy precipitate, it means that the compound that was created, was insoluble, causing a full ...

Chemistry

4.760 g of a substance (containing only C, H, and O) is burned in a combustion analysis apparatus. The mass of CO2 produced is 1.276×101 g, and the mass of H2O produced is 3.134 g. What is the empirical formula of the compound? I keep getting CH5O2, which is incorrect!

math

calculate the effective yield, then rank them from highest yield to lowest yield: 12% compound annually 11.8% compound quarterly 11.9% compound semiannually 11.7% compound daily

CHEM HELP! (Check work)

H3CA is a vitally important intemediate in the metabolism of carbohydrates. The compound is widely distributed in plant and animal tissues and fluids. H3CA is a tiprotric acid, ie, it requires three moles of NaOH to fully neutralize one mole of H3CA. a.) If it requires 19.41 ...

chem

Maleic acid is an organic compound composed of 41.39% C, 3.47% H, and the rest oxygen. If 0.250 mol of maleic acid has a mass of 29.0 g, what are the empirical and molecular formulas of maleic acid?

General Chemistry

I have been going at part B of this problem for a few hours. I've completed an ice table and calculated the total number of moles based off pressure but am still unable to come up with the partial pressures. If someone could provide the steps for solving I would appreciate it...

chemistry

If you need to multiply the following reaction by 2 to be an intermediate reaction in a Hess's law problem, what would be the final value for the enthalpy of reaction you use for this intermediate reaction? C2H4 + 3 O2 2 CO2 + 2 H2O, H = -1410 kJ

CHEMISTRY

Suppose you are studying coordination compounds of Co(II) with the ligand pyridine (py, C5H5N, molar mass=79.10). You isolate a crystalline compound, and because the only available anions are Cl- and NO3-, you hypothesize that the empirical formula of the coordination compound...

Chemistry

I need help with this lab. Write the equation for the decomposition of the hydrate, CuSO4*XH2O. Mass of crucible and hydrate: 93.000g Mass of crucible and pure salt: 91.196g I need to calculate the following: 1. mass of water in hydrate sample(g) 2. number of moles of water in...

chemestry

A compound contains only carbon, hydrogen, nitrogen, and oxygen. Combustion of 0.157g of the compound produced 0.123g carbon dioxide and 0.0310g water. In another experiment, it is found that 0.103g of the compound produces 0.0230g ammonia. What is the expirical formula of the...

Chemistry

A chemical reaction takes place in a container of cross-sectional area 100 cm2. As a result of the reaction, a piston is pushed out through 19 cm against an external pressure of 630 torr. What is the value for w for this reaction? (Sign does matter.) Answer in units of J

AP Chemistry

The heat of reaction for burning 1 mole of a certain compound X is known to be -477.7 kJ. The calorimeter constant of the bomb being used is 2500 j/degree celsius and the initial temperature of the water is 23.2 degrees celsius. a) if 22.54 g of compound X (MM=46.0) is burned ...

in-organic chemistry

provide balanced equations that represent the thermal decomposition of sodium nitrate and calcium nitrate; compare and comment on the products of each reaction.

S103 - Discovering Science

Is anyone Studying S103-Discovering Science. On TMA 6 blocks 7-8, having a little trouble can anyone Help Rather than using abbreviations, could you give us more details about your problem? This would help us to help you. I hope this helps a little. Thanks for asking. a) ...

(11) Chemistry - Science (Dr. Bob222)

In the following hypothetical reaction A + B → C + D, the equilibrium constant, Keq is less than 1.0 at 25°C and decreases by 35% on changing the temperature to 45°C. What must be true according to this information? A. The ΔH° for the reaction is negative. B. The...

Chemistry

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...

English

Identify the following sentences as simple,compound,complex, or compound-complex I saved money so that I could buy either a house or a car

English

Identify the structure used in each of the sentences below. 1. The hamburger came from Hamburg, Germany, and the hot dog came from Frankfurt. simple compound complex compound-complex 2. The idea of placing meat on a bun, however, came from the United States. simple compound ...

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100