Rank the crystal lattice structures in order of decreasing efficiency of space in the structure.

20,691 results, page 38

organic

what will the structure look like if a tetrahedral intermediate is formed during the reaction of an ester with an amine?

Business

Y = $10x + 0 Describe the cost structure indicated in the equation above, using full sentences.

body structure/terminology

Which is not considered a complication of peptic ulcers? A. Hemorrhage C. Perforation B. Obstruction D. Gangrene D

Business Communication

In what ways do audience, purpose, tone, and structure affect the formatting of the memo and the paper?

com 140

in what ways do audience, purpose, tone, and structure affect the memo and paper’s formatting?

com 140

In what ways do audience, purpose, tone, and structure affect the memo and paper’s formatting?

biology

Can someone please help me with this question? Thanks! What organic molecules make up the structure that surrounds the DNA molecule?

chemistry

the lewis structure for each of the following species except ____ contains a triple bond? N3- O2 2+ N2 NO+ HCCH

chemistry

How do I draw the lewis structure for [PF5Cl]- i'm getting confused on this one!! Please explain answer Thanks =))

Science

Different species of plants have structure/characteristics that allow them to adapt to their environment. What is this called?

Science

Different species of plants have structure/characteristics that allow them to adapt to their environment. What is this called

chemistry

can someone tell me how to draw the condensed structure for 4-ethyl-3,3,4-trimethyloctane and 2-methyl-5-(2-methylpropyl)nonane

chemistry

What is the chemical structure, its principle source, its legals uses (if any) and its relative addictiveness on scale 1-10 : CAFFEINE

Management

I need a diagram for Wal-Mart Divisional Structure. I search and google it. I can not find one.

question

But critical writing like argumentative essays have structure. (can you tell me what is wrong with this message?)

Chemistry

How do you find the number of bond angles for an octahedral structure? I believe it's more than one answer

organic chemistry

Determine the structure of the compound by using the IR and 1H NMR of a spectra that has the molecular formula:C4H7ClO2

organic chemistry

Give the product of the structure formed when 2-methyl-2-butene reacts with bromine in water

business

Can somebody explain what organizational structure of a company means? I read the definitions, but I still do not understand it.

grammar

i expect a friend to be both honest and a loyal person is this using correct parallel structure

chemistry

If the boron nitride molecule,BN, were to form, what would its structure look like? pls. need help

Chemistry

Complete the electron dot structure below to show how beryllium flouride (BeF2) is formed. F F Be+ -> Be F F

Chemistry

Complete the electron dot structure below to show how beryllium flouride (BeF2) is formed. F F Be+ -> Be F F

design of rc structure

1. Discuss the salient feature of working stress methods and ultimate load method?

Structure

no one would have attended the lecture if you told truth about the guest speaker

Calculus

The volume of the 3-dimensional structure formed by rotating the circle x^2 + (y-5)^2 = 1 around the x-axis can be expressed as V = a\pi^2. What is the value of a?

Calculus

The volume of the 3-dimensional structure formed by rotating the circle x^2 + (y-5)^2 = 1 around the x-axis can be expressed as V = a\pi^2. What is the value of a?

Literature

Fallacies are errors in: emotional appeal organizational structure logical thinking choice of details

chemistry

How many different N-O bond lengths would you expect to observe in the actual structure of NO3− and why?

chemistry

Describe how the structure of polyethylene impacts its function in terms of chemical bonding and intermolecular forces

Science

Q1. Why is the shape of the nerves important in the nervous system? Q2. Which structure is more complex, a tissue or an organ? How do you know?

Chemistry

What are the pros and cons of using the lewis structure? What I have so far is that it shows the shape of the compound.

chemistry

Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3

Physical science 7th grade

What is the internal structure of the cavefish and the minnow suggest common ancestry?

science

a structure holds a baby. TRUE or FALSE. Explain. Show your work. Doublecheck and be patient.

Chemistry

I need to draw a line angle structure of ibuprofen that shows hydrogen bonding and I am stuck. Can anyone help?

English

Balancing a sentence through using words or phrases that have the same grammatical structure is known as

Writing

If I put this way how can I start doing it..for example: how does racism relate to culure structure and power of society

english

true or false: william shakespeare followed the elizabethan structure of a four act play

Physics

Describe the structure of an atom, the quantised shell model and how it produces absorption and emission spectra.

math

A store sold 64 sweatshirts one day. Of these, 12 were gray. The store manager plans to order 400 more sweatshirts. Based on the data, how many gary sweatshirts should the manager order?

Math

A craft store needs 5,126 yards of special order ribbon and 2,654 yards of a velvet ribbon. The ribbons come pre-packaged on rolls of 30 yards each. How many rolls will be in the order?

Art

I left out the following statements. Thank you, Writeacher. 1) He believes that many adults censor the television because they fear losing (is "to lose" wrong?) control over their children. 2) He makes advances to her but his social rank hinders him from proposing marriage to ...

Stats....how do i do this??

SAT I scores around the nation tend to have a mean scale score around 500, a standard deviation of about 100 points, and are approximately normally distributed. What SAT I score within the population would have a percentile rank of approximately 16? Im not sure how to do this...

Science- Ms. Sue

What evidence was found from soft tissue samples of a remarkable well-preserved Tyrannosaurus Rex that provided molecular evidence linking T.Rex to a chicken? A. Antibodies that react in a specific way with chicken proteins reacted in the same way with T. Rex proteins. B. ...

english

Axia College Material Appendix B Sentence Structure Review Each of the following sentences has one grammatical error. The errors are in one of the following four categories: subject–verb agreement, run-on sentence, verb form and tense, or sentence fragment. Identify which of...

business communication 1

crystal agreed to serve on a company's advisory board and now has to contact them to say she cannot attend a scheduled meeting where she was to be one of the several key speakers. what should she do? a. Let the company knows she cannot attend and that they will have to make ...

Business Communication

Crystal agreed to serve on a company's advisory board and now has to contact them to say she cannot attend a scheduled meeting where she was to be one of several key speakers. What should she do? a. Let the company know she cannot attend and that they will have to make ...

simple machines

A box with a force of 100N is pushed up an inclined plane. It takes a force os 75N to push it to the top. What is the efficiency of the inclined plane?

sciences

what would be maximum efficiency of engine that can be had between the temperature of 1150 CELCIUS degree and27 CELCIUS degree (use temperature in K)

economics

Discuss the effects on efficient behavior of different liability rules, including comparative negligence. Include in your discussion an analysis of the efficiency of the various rules and discuss the differing costs of administering the rules.

Math

A river does 6,500 J of work on a water wheel every second. The wheel's efficiency is 12%. a. How much work in joules can the axle of the wheel do? b. What is the power output of the wheel in 1 s?

physics

You use an inclined plane to move furniture into a truck. You perform 224 kJ of work, but only do 91 kJ of useful work. What is the efficiency of the inclined plane?

Physics

A system of pulleys is used to lift a load of 1000kg.if the efficiency of pulley system is 80%and velocity ratio is 20,find effort required to lift the load...............??

economics

When policymakers set prices by legal decree, they a. improve the organization of economic activity. b. obscure the signals that normally guide the allocation of society’s resources. c. are usually following the advice of mainstream economists. d. are demonstrating a ...

Economics

When policymakers set prices by legal decree, they...? a. obscure the signals that normally guide the allocation of society’s resources. b. are usually following the advice of mainstream economists. c. improve the organization of economic activity. d. are demonstrating a ...

Physics

The oven draws 1100W of power, and you have determined that it heats with an efficiency of 51%. Using this information, determine the time t it would take to bring 240mL of water from 25C to 100C . Note that 4.2 J of energy is required to raise the temperature of 1.0mL of ...

biology

what is the space surrounding the nucleus of an atom contain?

Sciece

How do scientist on earth communicate with a space probe?

space

why we don't see comets until they are mear the sun?

space

in this century what has been the solar cycle number

7th grade

what science project can i do in the category of space?

science

why a necked human body bursts in space

Science

How do astronauts fix things in a space station?

Science HELLLP!!

How do astronauts fix parts in space?

space

What is the color of the star HD 217107 in the constellation Pisces?

science

how does air pressure affects the outer space

space

uummm i want to know how can telescope cxan see so far????

physics

does the international space station have gravitational pe

2nd grade

Why does the sun always shine in space?

space

what is the day and nigh time temp. on jupiter

MATH

what would be the space figure of a shoe box?

Science

How is solar energy used in space? (for what purpose?)

space

what is the difference between the atmosphere on earth and venus

space

If the diameter of a galaxy is 243.3 kpc, how many meters is that?

science

Is volume the amount of space an object takes up?

real analysis

How to find the perpendicular to the victor space R^k

analysis

What is meant by the sample space for a random experiment?

English

The space shuttle was both a marvel and huge.

geometry

What do you do to figure out space in irregular shapes?

Quantum M.

Why "In Hilbert Space noone can hear you scream"?

Earth Space

Why is oxygen an imporant variable gas?

english

The space shuttle was both a marvel and huge.

ENGLISH

The space shuttle was both a marvel and huge.

Finance

Crystal Lake, Inc., has a total debt ratio of 0.24. Its debt-equity ratio is therefore times and its equity multiplier is times. How do you figure out the number you divide 0.24 by to get the DE ratio? I have a sample of this problem that just shows the number used in the ...

Chemistry

You found an unknown metal sample shaped as a cube with each side measuring 2.00 cm. The cube's mass is 48.0 . Your colleague examined the mystery cube with X-ray diffraction and told you that it contains just one element arranged in a body-centered-cubic -lattice, and that ...

bio

Determine the number of colonies counted on the LB plate in the following transformation experiment. The amount of plasmid on the plate being counted was 0.04 micrograms. The transformation efficiency was calculated to be 4 x 10^3.

Physics

Water is lifted out of a well 30.0m deep by a motor rated at 1.00hp. Assuming 90% efficiency, how many kilograms of water can be lifted in 1 min? Answer is 137kg but can not figure it out.

physical science

A river does 6,500 j of work on a water wheel every second. The wheel efficiency is 12%. A. How much work in joules can the axle of the wheel do? B. What is the power output of the wheel in 1 s?

Chemistry

If 682000 kJ could be transferred with 100% efficiency to water, what volume of water, in liters, could be heated from 8.6 degrees Celsius to 60.0 degrees Celsius as a result?

english

I need to write a sentence using the words: fingernails,trees, when,fill,for,homework.The words HAVE to stay in th same order,and you can't change thier tenses. Also a sentence with these words in this order:Laughed,teeth,fighting,to, still,not, grow,elephant.I neeed them for ...

ashford

Royal Hotel Inc. verbally orders 100 sets of sheets and pillowcases, each to be embroidered with the chain’s coronet logo, for $1,000, from Textile Inc. Textile starts on the order and has completed 45 sets when Royal calls back and cancels the order. Which of the following ...

sinking fund math

in order to invest 236,281.61 at age 65 you need to start saving at the age of 25 How much money would we need to put away monthly into an ordinary annuity that earns 12% compounded monthly in order to get to our goal?

English

How does the author of The Johnstown Flood make the order of the story understandable? by using time order signal words so the reader can follow the events by listing the actual time of events he provided a timeline at the end of the story he uses flashbacks through the history A

physics

Assuming Earth behaves as a perfect sphere with a radius of 6380 km, the standard gravitational acceleration,g, at sea level has a value of 9.80 m/s^2. a.) As Earth rotates on its axis, objects at the equator experience a slightly different value of g due to additional ...

Maths

An equilateral triangle with side length 33 is divided into 33^2 smaller unit equilateral triangles each with side 1, forming a triangular lattice. We color each segment of length 1 either Red, Blue or Green, subject to the condition that each small unit equilateral triangle ...

Calculus

A spotlight on the ground is shining on a wall 12m away. If a woman 2m tall walks from the spotlight toward the building at a speed of 0.6m/s, how fast is the length of her shadow on the building decreasing when she is 2m from the building?

calculus

A spotlight on the ground is shining on a wall 24m away. If a woman 2m tall walks from the spotlight toward the building at a speed of 1.2m/s, how fast is the length of her shadow on the building decreasing when she is 4m from the building?

Health

5. Using _______ helps some smokers quit by gradually decreasing their dependence on nicotine. Answers: A. Stimulants B. Nicotine Substitutes C. Inhalers D. Nicotine Inhibitors My answer: C- Inhalers

PHYSICS PLEASE HELP

An astronaut in his space suit and with a propulsion unit (empty of its gas propellant) strapped to his back has a mass of 134 kg. During a space-walk, the unit, which has been completely filled with propellant gas, ejects some gas with a velocity of +32 m/s. As a result, the ...

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100