NH4OH

79 results

chemistry

solution of 0.1molar NH4OH and 0.1 NH4CL ph=9.25 calculate kb for NH4OH?

chemistry

25mL of tartaric acid solution is titrated against 31mL of NH4OH. What is the normality of the NH4OH? Please explain how to work this problem.

chemistry

25 milliliters of tartaric acid solution is titrated against 31 milliliters of NH4OH. What is the normality of the NH4OH?

Chem Help URGENT

Could someone help me with these molecular formulas, i don't know what im doing wrong. For this example, i did it like this and it says its incorrect. Could you solve the the equations below your way and i match it to mines? Thank you so much Fe (s) + Ni(NO3)2 (aq) =Fe(NO3)2 (...

Chemistry-precipitates

What precipitates form when Cu(NO3)2, CuSO4, NH4OH, and CaCl2 only two of the above added together. I need all combinations. What color are they? Ik Cu reacts with NH4OH. is the precipitate white?? what about the others?

chemistry

what is the equation for C6H12O6+NaOH+Cu(OH)2 C6H12O6+AgNO3+NH4OH AgNO3+NH4OH+ galactose when heated

Chemistry

What is the formula of the precipitate formed from the precipitation reaction of Pb(NO3)2 and NaI? QUESTION 2 When aqueous solutions of (NH4)3PO4 and KOH are mixed, what precipitate(s) will form? K3PO4 NH4OH no precipitate will form NH4OH and K3PO4

Chemistry- Dr.Bob222

Ammonium hydroxide is commonly advertised as an ingredient in some window cleaners. Rank the following in order of decreasing concentrations in these solutions: NH4OH, NH4+, OH-, NH3. Explain your reasoning. (Note that kb for ammonia = 1.8 x 10^-5. So does an unionized ion ...

chemistry

I thought about the syntax of the problem and I have surmised that what I thought were two questions was actually one. I'm slow but not dead yet. 75g of tartaric acid in 1 liter is used in a titration. 25mL of tartaric acid solution is titrated against 31mL of NH4OH. What is ...

chemistry

I have been knocking around this question for what seems to be an eternity. We have not gotten that far in this class so this is for extra credit. I have managed to get myself confused about something that should be easy. 25mLof tartaric acid solution is titrated against 31mL ...

Chemistry

Write a net ionic equation that represents the reaction: 1. ionization of HCl3 in water: My answer: HClO3+H20->H3O+ClO3 2. NH3 functioning as an Arrhenius base: Mine: NH3+(OH)->NH4+O The first one is ok but you need to show the + charge on the H3O^+ and the - charge on ...

Chemistry-titrations

Question: An unknown mass of (NH4)2CO3 is mixed with 4g of NaOH and dissolved in 100cm3 of water,which results a clear solution.Gasses are removed by heating the final solution. 2 parts of 25cm3 of final solution is taken and one is titrated with 0.5 M HCl and under Hph ...

chem--please help me check my answer!!

write an ionic and net ionic equation for the following reaction between Fe3+ and NH4OH. Please check my answer!! Thank you. My answer is: ionic: Fe3+(aq) + NH4OH--> Fe(OH)3 + NH4+ net ionic: Fe3+ +OH- -->Fe(OH)3

chemistry

Product of this reasction? 1. Ag(NH3)2Cl + HCl? 2. AgOH + NaOH? 3. PbCl2 + HCl? 4. Pb(OH)2 + NaOH? 5. PbSO4 + (CH3COO)NH4? 6. Hg^2+ + HCl + H2S? 7. Cu^2+ + HCl + H2S? 8. Cu^2+ + KSCN? 9. Fe^2+ + NH4OH + NH4Cl + H2S? 10. Fe^2+ + NaOH? 11. Fe^2+ + K4Fe(CN)6? 12. Fe^2+ + K3Fe(CN)...

chemistry

Product of this reasction? 1. Ag(NH3)2Cl + HCl? 2. AgOH + NaOH? 3. PbCl2 + HCl? 4. Pb(OH)2 + NaOH? 5. PbSO4 + (CH3COO)NH4? 6. Hg^2+ + HCl + H2S? 7. Cu^2+ + HCl + H2S? 8. Cu^2+ + KSCN? 9. Fe^2+ + NH4OH + NH4Cl + H2S? 10. Fe^2+ + NaOH? 11. Fe^2+ + K4Fe(CN)6? 12. Fe^2+ + K3Fe(CN)...

CHEMISTRY

NH4OH + H2O =

chemistry

what is the disadvantage of nh4oh

Chemistry

Calculate pH of NH4OH which is 1%ionized

Chemistry

What is the molecular equation for HCl(aq) + NH4OH(aq)?

science

is this rigth HC2HO2+NH4OH-->NH4C2H3O2+H2O

chemistry

calculate the ph of a 0.18 M NH4CL and0.18 M NH4OH.(Kb=1.0x10^-5)

Chemistry

When CuCl2 and NH4OH are combined what is the product formed?

Chemistry

When CuCl2 and NH4OH are combined what is the product formed?

Chemistry

When CuCl2 and NH4OH are combined what is the product formed?

MATHS

Chemical equation for tine acetate and nh4oh

Weab base strong acid titration

NH4OH + H20 =

Chemistry

What would be the most likely product(s) when you react CuI with NH4OH?

Science

How many grams of NH3 can be produced if 105g of NH4OH are completey decomposed?

Chemistry

How many grams of NH3 can be produced if 105g of NH4OH are completey decomposed?

science

Calculate the ph of a buffer solution containing 0.2M NH4OH and 0.25M NH4Cl kb=1.8×10

chemistry

Why adding NH4OH to Al3+ , forms Al(OH)3 and not complex ion Al(NH3)3 ? thanks so much

chemistry

Iwish to prepare 3% NH3 from 20ml strong NH4OH and 180ml H2O.Can you help me?

MATH

complex reactions of Co(NO3)2.6H2O+(NH4)2CO3+NH4OH+H2O2

Chemistry

How many grams of NH4Cl must be added to 250ml of .2M NH4OH in order that the solution shall have a pH of 7.2?

chemistry

How do I write these compounds in their "true form" or Ionic State? NaCl, CuSO4, NH4OH How do i find the charges?

College Chem 1010

Which of the following compounds is insoluble? Question 4 options: A) Ca(NO3)2 B) FePO4 C) NH4OH D) Na2SO4 E) NaCl

chemistry

Can CoBr2+ NH4Br + NH4OH ---> Co^2+ (aq) + 2NH3 (l) + H^+ (aq) + H2O (l) + 3Br^- form the complex [Co(NH3)5Br]Br2 if so please explain

Chemistry

What is the chemical equation for: CuI + NH4OH ---> ??? This equation should oxidise Cu+ to Cu2+.

Chemistry

How many grams of NH4Cl do I have to add to 500 mL of 0.100 M NH4OH to have a pH of 9.40? Kb= 1.8 x 10^-5 [OH-]= 2.51 x^-5 M

Chemistry

50.0mL of 1.04moles HA is added to 50.0mL if 0.90moles NH4OH.With a 1:1 stoichiometric ratio. What is the limiting reactant in moles of this reaction.

chemistry

how ti distinguish NH4OH solution from NaOH solution

Chemistry

the task is to determine which liquid is which, two blue solutions and two clear choices: CUSO4 CU(NO3)2 NH4OH CaCl2

chemistry LAST QUESTION FOR TONIGHT

It said name the following compounds containing polyatomic ions a) NaHCO3 i put Sodium Dicarbonates But b and c i had no idea (NH4)3PO4 and NH4OH

Chemistry

Calculate the pH of 100.00 mL of an ammonia buffer (pKb = 4.76), prepared by placing 55.0 mL of concentrated NH4OH (i.e., NH3; 14.5 M) into a volumetric flask, adding 6.76 g of ammonium chloride, and diluting to the mark with DI water.

Chemistry

Calculate the energy changes associated with each of the following reactions. Label each as endothermic or exothermic. A.) 2(C2H2)+5(O2)------->4(CO2)+2(H2O) B.) N2+O2------>2(NO) C.) NH3+H2O----->NH4OH D.) 2(BrCl)----->Br2+Cl2

Chemistry

What is the concentration of HCl when 25.0 mL of HCl completely reacts with 10.0 mL of 0.1M solution of NH4OH (subscript 4)? Solution steps would be helpful so I can solve other similar problems.

Chemistry

Ag2S is an insoluable black solid. Would more solid dissolve, or precipitate once the following are added to the solution. 1. KS-----I know [S] increases, shift to reactants side, precipitate 2. HClO 3. LiOH 4. NH4OH

Chemistry

1.Which of the following is most soluble in water and why ? a.Ag2SO4 b.Hg2SO4 c.MnCO3 d.CaSO4 2.PH of which salt is same for 1M and 5M solution both and why? a.HCOONa b.C6H5NH3^+Cl c.NH4CN d. NaCN 3.NH4OH is highly soluble in and why ? a.CuSO4 b.AgNO3 c.NH4Cl d.Both 1&2

chem

our task is to determine which liquid is which, two blue solutions and two clear choices: CUSO4 CU(NO3)2 NH4OH CaCl2 how do i do this? ik that cooper solutions r blue...

Chemistry

If I have 50.0 mL of HA at a concentration of 1.20M and 50.0 mL of NH4OH at a concentration of 0.92M, how many moles of the limiting reactant are there? I guess I should start with a balanced equation, but I have no idea where to start..

Physical science

What is the formula of magnesium sulfate and ammonia? My work:MgSO4 + 2NH4OH --> (NH4)2SO4 + Mg(OH)2 Correct/Balance the equation below. MgSO4 + NH4OH → (NH4)2SO4 + Mg(OH)2

Chemistry

Classify each of the compounds below as strong or weak acids, strong or weak bases, or salts: A. HCl B. KOH C. NH4NO3 D. H2SO4 E. NH4OH F. H3PO4 G. NaOH H. HClO4 i. Mg(OH)2 J. H2CO3 K. BaSO4 l. HC2H3O2 The numbers are sub(little numbers

Chemistry

calculate the change in ph for 1l of buffer solution containing NH4OH and NH4Cl upon addition of 1) 0.02 moles of HCl 2) 0.02 moles of NaOH I got the initial pH as 9.2504 But now Im stuck cus I dunno what happens when we add HCl and NaOH? Please help! :)

chemistry

H2So4+NH4OH Find the complete ionic equation Find the spectator ions Find the net ionic equation I feel like my answer is wrong i tried CIE: 2H+(aq)+So42-(aq)+2H4+(aq)---> 2NH4+(aq)+So42-(aq)+H2o (l)

chemistry

H2So4+NH4OH Find the complete ionic equation Find the spectator ions Find the net ionic equation I feel like my answer is wrong i tried CIE: 2H+(aq)+So42-(aq)+2H4+(aq)---> 2NH4+(aq)+So42-(aq)+H2o (l)

Inorganic Chemistry

Hello, I am trying to write a chemical equation for a reaction I did and I cannot for the life of me figure out how to do it. I added cobalt chlorid hexahydrate, NH4Cl, NH4OH, H2O2 and HCl. The major product was [Co(NH3)5Cl]Cl2 but I don't know what the other ones would be... ...

Chemistry

AlCl3(aq)+ NH4OH(aq)-> Al(OH)3(s) + NH4Cl(aq) AlCl3(aq)+ 3NH4OH(aq)-> Al(OH)3(s) + 3 NH4Cl(aq)... is balanced-- Now total ioic?? Is this right?? : Al +3Cl+3NH4 +OH --> Al+ 3OH+ 3NH4+ 3Cl Crossing out on both sides I end up with OH --> 3OH I do not know what to do ...

Cemistry

Hi, I've been trying to solve this chemical equation for the last 30 minutes and am only confusing myself. I am wondering if the product I obtained is correct. The question is to write a balanced equation for the below reaction and be sure to indicate the states and if there ...

chemistry

Classify each substance as either arrhenius acid or base: A) HF (aq) B) Ba(OH)2 (aq) C) H2SO4 (aq) D) NH4OH (aq) My work A) arrehenius acid B) arrhenius base C) arrhenius acid D) arrhenius base Am i right

Chemistry

Testing for water hardness using EDTA as a titrant: Suggest a reason why the buffer is good for only a week. The buffer contains disodiumEDTAdihydrate, MgSO47H20 and distilled water. NH4Cl and NH4OH is also added then diluted. I know that after a week, the buffer will be bad ...

Chemistry - Titrations

What volume (mL) of 0.2650 N H3PO4 is required to neutralize: a) 35.25 mL of 0.2300 M KOH b) 19.14 mL of 0.2300 M NH4OH Unfortunately, the teacher didn't get the opportunity to teach us titrations in class today, but this problem (and more) are still due by 11 pm tonight (we ...

DrBob222-Questions

Can you please check these for me. Thank you very much in return:-) For Al2(SO4)3 you gave me Aluminum ion and Sulfate ion. These are the rest: CaCl2 = Calcium ion and Chlorite ion Na2O = Sodium ion and Oxygen ion AgCl = silver ion and chlorine ion Na3PO4 = Sodium ion and ...

chemistry

Show the calculation of (1) the expected grams of urea (CH4N2O) formed in the reaction of 6.5 grams of lead cyanate (Pb(CNO)2) with excess ammonium hydroxide and then show the calculation of (2) the % yield if the actual yield of urea is 1.89 grams. Reaction is shown below: Pb...

Chemistry URGENT

I need someone to check to make sure that I balanced my equations correctly. I have to add a (g) or (s) to indicate gases and precipitates. I am having a hard time figuring out the ions and how to add them, if any of these reactions need a ion could you explain it to me as ...

Chemistry Help Please!!!

Find Net Ionic equation for hydrolysis , Expression for equilibrium constant (Ka or Kb) and Value of (Ka or Kb) Net Ionic equations I've got NaC2H3O2 == CH3COO^-+H2O -->CH3COOH+OH^- Na2CO3 ==== CO3 + 2H2O → H2CO3 + 2-OH Kb = [H2CO3] [-OH]2 / [CO3]. Kb = 1/Ka1Ka2 = 7....

Physical Science

Materials: Epsom salts (MgSO4), ammonia (NH4OH) small jar or cup measuring cup Procedures 1. Dissolve 1 teaspoon of Epsom salts in a half cup of water. 2. Add 2 teaspoons of ammonia to the Epsom salts solution and stir thoroughly. Record your observations. 3. Allow the mixture...

Chemistry

Calculate the end point pH, when 25 mL of 0.01 mol/L HCl solution reacts exactly with 25 mL of 0.1 mol/L NH4OH solution. NH3 Kb = 1.8 x 10^-5 This will be the pH of NH4Cl solution. NH4+ + HOH ==> NH3 + H3O^+ Ka = Kw/Kb = (NH3)(H3O^+)/(NH4^+). Solve for H3O^+, then pH = - ...

chemistry

Why does the equivalence point occur at different pH values for the four titration studied? the four titrations were: 1. HCL with NaOH 2.HC2H3O2 with NaOH 3. HCl with NH4OH 4. HC2H3O2 with NHOH Okay so equivalence point is when the number of moles of acids and bases are equal...

Chemistry

Given the reactant side of the total ionic equation for the neutralization reaction of ammonium hydroxide (NH4OH) with hydrochloric acid (HCl), write the total ionic equation (also known as the complete ionic equation) by entering both the reactant and the product species, ...

Ionic compounds Scinece

3. What happens to the change on individual ions when they form ions? 11. Write the names of the two ions in each of the following compounds. (C) Na2O (E) Na3PO4 (G) NH4OH (H) Ca (NO3)2 8. Use the tables of metals, non-metals, and polyatomic ions and the Periodic table to name...

Chemistry

Given the reactant side of the total ionic equation for the neutralization reaction of ammonium hydroxide (NH4OH) with hydrochloric acid (HCl), write the total ionic equation (also known as the complete ionic equation) by entering both the reactant and the product species, ...

chemistry

The equivalent weights of X and Y are _________ g/equiv. H+ and g/equiv. –OH, respectively, for the following reaction: Z (Note: Report your answer with 4 significant figures.) X Y Z Answer #1 Answer #2 benzoic acid calcium hydroxide 2 C6H5COOH + Ca(OH)2 2 H2O +Ca(C6H5COO)2 ...

Chemistry-Experiment

I did an experiment where I had 5 ml of MgCl2, then 5 ml NH4 solution (NH4OH (aq)) was added and it was observed that a precipitate formed; cloudy solution. After I added 1g of NH4Cl(s), the solution clears up (transparent). 2nd experiment: There was 5ml Lead (II) Nitrate in a...

Chemistry

My question is basically to find out what these reactants yield: CuCl2(aq) + NH3(aq) --> ? my best guess here is... CuCl2(aq) + 6NH3(aq)-->[Cu(NH3)4(H2O)2]2+ + N2(g) + 2HCl Im pretty sure about the [Cu(NH3)4(H2O)2]+2 part but not sure about the rest. The primary product ...

chemistry lab (college level)

So, this is going to be more like 2 or 3 questions. Here goes. First, what is the net-ionic reaction for Fe (III) + K4Fe(CN)6 be? I've been agonizing over this for HOURS with no answer in sight. (I don't even know what to put down as a product!) Second, what would the net-...

Chemistry

IN my experiment, I was doing a qualitative analysis of Group I and II anions using a flowchart. IN the chart I added 5 drops of 0.1M AgNO3 and several drops of 3M HNO3 to 5 drops of solution and found that a precipitate was formed. Thus it was classified as a Group I anion. ...

Chemistry 12

9. According to Arrhenius, which of the following groups contain: i)only acids ii)only bases a. NaOH, H2CO3, KCl b. MgCl2, H2SO4, HCl c. HNO3, HCl, H3PO4 d. Mg(OH)2, AgBr, HF e. KOH, NH4OH, Ba(OH)2 10. Enough water is added to 100 g of sodium hydroxide in order to obtain a one...

science( chem)

Basically what color is yellow when they say "Yellow"? The titrations I have done are light yellow when approaching the end point but whatever color you see is what you get, I suppose. So titrate to a very light color. Would the extra 5ml of starch indicator have any effect on...

chemistry

Which of the following pairs of molecules have the same oxidation number for carbon? CO and CO2 CH4 and CCl4 C6H12O6 and C(s) H2CO and COCl2 Carbon always has an oxidation number of +4 What mass of CuSO4.5H2O would you need to prepare 250.0 mL of a 0.250 M solution? [MW of ...

Pages

  1. 1