Hi! Thanks for checking my question out! ____ 1. Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction?

147,151 results

Physical Science

Hi! Thanks for checking my question out! ____ 1. Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction? (1 point) a) CH4 + O --> H2O + CO2 b) CH4 + 4O --> 2H2O + CO2 c) CH4 + O2 --> H2O + ...

help

Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction? A. CH4 + O → H2O + CO2 B. CH4 + 4O → 2H2O + CO2 C. CH4 + O2 → H2O + CO2 D. CH4 + 2O2 → 2H2O + CO2

chemisy

Methane (CH4) burns in oxygen to produce carbon dioxide and water vapor. The balanced equation is: CH4 + 2 O2 -> CO2 + 2 H2O What volume of carbon dioxide is produced when 3.2 L of oxygen are consumed?

chemistry

Methane (CH4) burns in oxygen to produce carbon dioxide and water vapor. The balanced equation is: CH4 + 2 O2 -> CO2 + 2 H2O What volume of carbon dioxide is produced when 3.2 L of oxygen are consumed?

chemistry.

Methane, CH4 burns in oxygen gas to form carbon dioxide and water. How many moles of carbon dioxide will be formed from 8.0g of methane?

Science

What chemical equation would represent methane (CH4) burning in the presence of oxygen gas (O2) to form water and carbon dioxide? (Make sure it's balanced)

Chemistry

Methane burns with oxygen to produce carbon dioxide and water as a gas. The balanced thermochemical equation is Ch4(g) + 2)2(g) ---> CO2(g) + 2H2O(g) H = -802kJ How much methane, in grams, must be burned to release 544 kJ of heat? My answer: 544/802 = 0.678 0.678*16= 10....

Chemistry

In the lab, 5.8 L of methane gas is burned with excess oxygen gas at SATP. How much carbon dioxide gas is produced? **Based on the balanced chemical equation the ratio of methane gas to carbon dioxide is 1:1, this being said, does it make sense that as 5.8 L of methane gas is ...

chemistry

Gaseous methane CH4 will react with gaseous oxygen O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . Suppose 0.481 g of methane is mixed with 2.9 g of oxygen. Calculate the maximum mass of carbon dioxide that could be produced by the chemical reaction. Be sure ...

chemistry

1)The reaction of methane and oxygen yields carbon dioxide gas and water. The unbalanced reaction is as follows: CH4(g) + O2(g)CO2(g) + H2O(g) A. If 0.718 grams of methane are reacted, how many grams of water vapor are produced? B. If 1.621 grams CO2 are released, how many ...

Chemistry

1. Hydrogen gas combines with oxygen gas to yield water. if 15 g O2 is present in the reaction, compute how much water will be produced. 2. Ten (10)grams methane gas combines with oxygen gas to form water and carbon dioxide. How much water is produced from the given reaction? ...

Chemistry

Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2o) . What is the theoretical yield of carbon dioxide formed from the reaction of 0.16g of methane and 0.83g of oxygen gas?

Chemistry

A mole of methane reacts with 64g of oxygen at 1 atm, 425 K. There are two ways in which methane can react with oxygen. It can either form water vapor and carbon dioxide or water vapor and carbon monoxide. After reaction the final gas density is 0.7282 g/L. What is the ...

Chemistry

Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

Chemistry

Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

chemistry

Question 1. A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a.b.c or d? A. ...

Chemistry

Methane gas (carbon tetrahydride) reacts with oxygen by combustion: CH4 + 2O2 -> CO2 + 2H2O a.)How many moles of methane are needed to produce 3.5*10-4 moles of carbon dioxide? b.)How many moles of oxygen are needed to react form the 3.5*10-4 moles of carbon dioxide? c.)How...

Science, NATS

Consider the following chemical reaction. Molecular hydrogen and carbon dioxide react to form water and methane. H2+CO2-->H2O+CH4 A)Explain why this equation is not balanced and what law of nature does it break in its current form? B) Astronauts from the Earth carry large ...

Chemistry

Question 1. (SEE QUESTION 2 ) A Compound Containing 3 Atoms Of Carbon & 8 Atoms Of Hydrogen Is Combined In A Reaction With Oxygen Molecules. The 2 End Products Of This Equation Are Carbon Dioxide &water. What Element Should You Look At 1st In Balancing This Equation? Choose a....

chemistry

Methane (CH4) is the main component of natural gas. It is burned for fuel in a combustion reaction. The unbalanced combustion reaction for methane is shown below. CH4 + O2 CO2 + H2O + heat When the reaction is balanced, how many carbon dioxide molecules are produced for every ...

Chemistry

A compound containg 3 atoms of carbon and 8 atoms of hydrogen is combined in a reaction with oxygen molecules. The two end products of this equation are carbon dioxide (CO2) and water. What element should you look at first in balancing this equation? Is the answer a.b.c or d? ...

Chemistry

A compound containg 3 atoms of carbon and 8 atoms of hydrogen is combined in a reaction with oxygen molecules. The two end products of this equation are carbon dioxide (CO2) and water. What element should you look at first in balancing this equation? Is the answer a.b.c or d? ...

Chemistry

Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality.

Chemistry

1. Pentane gas (C5H12) combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to reality

Chem 2

Propane (C3H8) burns in oxygen to produce carbon dioxide and water vapor. The balance equation for this reaction is C3H8 + 5O2 ----> 4H20 + 3CO2. What volume of carbon dioxide id produced when 2.8 L of oxygen are consumed? Here are the steps for solving stoichiometry ...

Chemistry

So I have the balanced equation: c3H8 +502 = 3C02 +4H20 Question: At STP propane (C3H8) burns in oxygen to form 2.15L of carbon dioxide and water. So I've got 2.15 L x 1 mole /22.4 L But when I try to do the mole ratio, I don't know what to do since the 2.15 L is of carbon ...

Chemistry

64g of oxygen reacts completely with methane gas to form 44g of carbon dioxide gas and 36 g of water vapour. Calculate the amount of methane that takes part in the reaction .

chemistry

In the formation of acid rain, sulfur dioxide reacts with oxygen and water in the air to form sulfuric acid. Write the balanced chemical equation for the reaction. (Type your answer using the format CH4 for CH4.)

Chem Help!

I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide forms from hydrogen and bromine. Type of ...

Chemistry

If methane burns with oxygen and form carbon dioxide and water,so why the carbon dioxide doesn't extinguish heat produced .

science

Octane (C8H18) is a liquid that combusts with oxygen gas (O2) to form water (H2O) and carbon dioxide (CO2). Write a balanced chemical equation for this reaction and explain the scientific principle (statement) that requires the balancing of an equation to make it conform to ...

chem help

The reaction of methane and oxygen yields carbon dioxide gas and water. The unbalanced reaction is as follows: CH4(g) + O2(g)CO2(g) + H2O(g) A. If 1.26 grams of methane are reacted, how many grams of water vapor are produced? B. If 2.796 grams CO2 are released, how many grams ...

Chemistry (My previous post lacked something)

Question: At STP propane (C3H8) burns in oxygen to form 2.15L of carbon dioxide and water. The question is in 4 parts. I just need the first: a)What mass of oxygen is necessary for this reaction? So far I've got 2.15 L x 1 mole /22.4 L But when I try to do the mole ratio, I ...

Chemistry

Hi! I am having some trouble with this question, can you please help me? Which of the following describe chemical properties? Check all that apply. - Iodine (a purple solid) becomes a purple gas. - Titanium is less dense that iron . - Water freezes at 0'C - Sugar burns in air ...

Please help me!!!!

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Chemistry

Hydrogen sulfide gas burns in the presence of oxygen to produce sulfur dioxide gas and water vapor. Write a balanced chemical equation, including the physical state

Chem Help please!!!!!

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Chem- REALLY URGENT!!!

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Chemistry

132 grams of CH4 reacts with Oxygen gas to produce carbon dioxide and water vapor. give the mass of the oxygen needed to react with all the methane and give the mass of the carbon dioxide and water vapor produced. can somebody explain this to me? i'm lost. . .

Chemistry ASAP

3. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

Adv AP Honors Chemistry

2. Methane (CH4), ammonia (NH3), and oxygen (O2) can react to form hydrogen cyanide (HCN) and water according to this equation: CH4 + NH3 + O2  HCN + H2O You have 8 g of methane and 10 g of ammonia in excess oxygen. Answer the following questions: • What is the ...

chemistry

I got E) for the first and couldn't figure out the other one. Can any one verify the first and help with the second?? In which of the following processes is there a decrease in the potential energy of the substances involved? A) a coil spring is compressed B) two particles of ...

Chemistry

A 5.00 g mixture of methane (CH4) and ethane (C2H6) is combusted in oxygen gas to produce carbon dioxide and water. If 14.09 g of CO2 is produced, how many grams of methane was in the original 5.00 g mixture ?

Chemistry

Hydrogen gas is used for many purposes, including the hydrogenation of vegetable oils to make margarine. The most common industrial process for producing hydrogen is "steam reforming," in which methane gas, CH4, from natural gas reacts with water vapor to form carbon monoxide ...

Chemistry

Hydrogen gas is used for many purposes, including the hydrogenation of vegetable oils to make margarine. The most common industrial process for producing hydrogen is "steam reforming", in which methane gas, CH4, from natural gas reacts with water vapor to form carbon monoxide ...

chemistry

Now "react" methane (CH4) with oxygen (O2) to produce carbon dioxide (CO2) and water (H2O). Start with one molecule of methane and one molecule of oxygen. Continue reacting molecules of CH4 and O2 until all the reactant atoms have been used to form products. Summarize what ...

Chemisry

Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical equation. Identify all of the phases in your ...

chemistry

Write and balance the chemical reaction when gaseous carbon monoxide reacts with hydrogen gas to form gaseous methane (CH4) & liquid water

chem

which of the following is a chemical reaction? A) propane forms a flame and emits heat as it burns. B) Acetone feels cold as it evaporates from the skin. C) Bubbling is observed when potassium carbonate and hydrochloric acid solutions are mixed. D) Heat is felt when a warm ...

chemistry

a compound containing 3 atoms of carbon and 8 atoms ofhydrgen is combined in a reaction with oxegyn molecules the two end products of this equation are carbon dioxide co 2 and water what elemement should i look at first in balancing this equation oxygen hydrgen carbon or ...

chemistry

I got E) for the first and couldn't figure out the other one. Can any one verify the first and help with the second?? In which of the following processes is there a decrease in the potential energy of the substances involved? A) a coil spring is compressed B) two particles of ...

Chemistry

Methane gas burns in air to give carbon dioxide and water. a) give a chemical equation b) How can the mixture of these gases be separated b) Which gases does it mean?? Can anyone tell me.. Pleease.

Chemistry

Propane gas (C3H8) burns completely in the presence of oxygen gas (O2) to yield carbon dioxide gas (CO2) and water vapor (H2O). Write a balanced equation for this reaction. Assuming that all volume measurements occur at the same temperature and pressure, how many liters of ...

Chemistry

Propane gas (C3H8) burns completely in the presence of oxygen gas (O2) to yield carbon dioxide gas (CO2) and water vapor (H2O). Write a balanced equation for this reaction. Assuming that all volume measurements occur at the same temperature and pressure, how many liters of ...

Chemistry

Please write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O When balancing the equation , ...

Astronomy

Which of these gasses are outgased by our volcanic eruptions? a)oxygen, methane,ammonia b)carbon dioxide, water vapor, oxygen c)ammonia, water vapor, oxygen d) water vapor, methane, carbon dioxide e)helium, carbon dioxide, methane

Please help me!!! Chemistry

Multiple choice When methane is burned with oxygen, the products are carbon dioxide and water. If you produce 18 grams of water from 8 grams of methane and 32 grams of oxygen, how many grams of carbon dioxide were produced in the reaction? a)40 b)22 c)58 D)18

chemistry

Oxygen gas and aqueous benzoic acid react to form carbon dioxide gas and water gas. Determine the mass of water in grams if 5.43×104 milligrams of oxygen reacts with an excess of benzoic acid. I balanced the equation to 2C7H6O2+15O2=14CO2+6H2O

Chemistry

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...

chemistry

I need help with a,b,and c. I tried to balance it but im having a little trouble Ethane gas, C2H6, burns in air and produces carbon dioxide and water vapor. a)write a balanced equation for this reaction. I know this isnt balanced but is this what im working with? C2H6 + O ---&...

Science/Chemistry

Write a Balanced equation for the chemcial reaction Acetylene gas (C2H2) burns in a welding torch with oxygen to form carbon dioxide gas and water vapor. C2H2(g) + O2(g) ==> CO2(g) + H2O(g) It isn't balanced. I will leave that for you. How do i balance it? trial and error. ...

Chemistry

Calculate E°cell (in volts) for a fuel cell that employs the reaction between methane gas and oxygen to form carbon dioxide and water. (to 4 significant figures) ∆G⁰f for CH4 = -50.5 kJ/mol ∆G⁰f for CO2 = -394.4 kJ/mol F = 96485/mol e- I got 0.4455 V ...

Chemistry

Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

Biology Asap!

1. A hypothesis and a theory are related because A.a Theory is always used to develop a hypothesis B.They are both developed in the absence of observations. C. the data collected when a hypothesis is tested can support a theory. D. an experiment is done before the formation of...

chemistry

Need Help Finishing: Purpose: • To observe a chemical reaction. Materials: • Vinegar (acetic acid, CH3COOH) • Baking soda (NaHCO3) • Measuring cups and spoons • Cup Procedure: 1. Place ½ cup of vinegar in the cup. 2. Add 1 tablespoon on baking soda. 3. Record your ...

Chemistry

Calculate the ΔHrxn for the following reactions using the heats of formation given in the table at the end of this assignment: a)The complete combustion of methane, CH4, producing water as a liquid. b)The complete combustion of glucose, C6H12O6, producing water as a ...

Science (chemistry)

Write a balanced chemical equation and state the reaction type for each of the following reactions: a.) nitrogen gas reacts with hydrogen gas forming ammonia (NH3) b.) carbonic acid breaks down to form carbon dioxide gas and water c.) aluminum foil reacts with copper II ...

chemistry

During combustion, methine yeilds carbon dioxide and water. the unbalanced equation for this reaction is : CH4(g)+O2(g)>CO2(g)+H2O(i) what will the mole ratios for the balanced equation be?(what coefficients are needed in order to balanced the equation?)

Chemistry

Write a balanced equation using the correct formulas and include conditions (s,l,g or aq) for each of the following reactions. 1)Carbon monoxide gas reacts oxygen gas to produce carbon dioxide gas. Express your answer as a chemical equation. Identify all of the phases in your ...

Chemistry

Calculate the ΔHrxn for the following reactions using the heats of formation given in the table at the end of this assignment: a)The complete combustion of methane, CH4, producing water as a liquid. b)The complete combustion of glucose, C6H12O6, producing water as a ...

chemistry

An explosive whose chemical formula is C3H6N6O6 produces water, carbon dioxide, and nitrogen gas when detonated in oxygen. write the chemical equation for the detonation reaction of this explosive.

chemistry

1. Chlorobenzene, C6H5Cl, is used in the production of chemicals such as aspirin and dyes. One way that chlorobenzene is prepared is by reacting benzene, C6H6, with chlorine gas according to the following BALANCED equation. C6H6 (l) + Cl2 (g) „³ƒnC6H5Cl (s) + HCl (g) a. ...

Chemistry

The combustion of methanol (CH3OH) forms carbon dioxide and water vapor. A combustion reaction refers to a reaction of a substance with oxygen gas. What is the balanced equation?

Chemistry

Just having some trouble with this chemistry problem.. Thanks for help! Toxic carbon monoxide (CO) gas is produced when fossil fuels such as petroleum burn without enough oxygen. The CO can eventually be converted to CO2 in the atmosphere. Automobile catalytic converters are ...

Chemistry

Please check to see if I got these right and specifically for #2, I am not sure if I have this balanced correctly. Write the complete balanced equations for the following: 1) Potassium metal reacts with oxygen gas to form solid potassium oxide. My answer: 4K(s)+O2(g)=4KO2(s) 2...

Chemistry

If 5.4 moles of methane react with 3.5 moles of oxygen gas, how much carbon dioxide will be produced? Use the following equation: CH4 + 2O2 = CO2 + 2H20

chemistry

water vapor and nitrogen dioxide gas NO2 are cimbined to manufacture ammonia. a by product of this reaction is oxygen gas. write a balanced equation for this reaction. i do not understand this at all please help me figure it out

chemistry

decomposition of water to form elemental Hydrogen and Oxygen gas. What will be the balanced chemical equation, type of reaction and the driving force of the reaction?

chemistry

Methane burns in air to give carbon dioxide and water. Give a chemical equation . Show(State ) how the mixtures of these gases can be separated

Science

Balanced chemical equation for the carbon monoxide gas for motor car engines combines with the oxygen gas in the air to produce carbo dioxide

physical science with earth science

Write a balanced chemical equation for the reaction for propane C3H8 burning in oxygen to for carbon dioxide and water vapor

Chemistry

Methane reacts with oxygen to produce carbon dioxide, water and heat. If the percent yield of the reaction is 90.0%, how many grams of methane must be burned to produce 150.0 kJ of energy? ___ CH4 (g)+ ___ O2 (g) → ___ CO2 (g) + ___ H2O(g) + 802 kJ

Chemistry

A 10.0 gram sample of a mixture of CH4 and C2H4 reacts with oxygen at 25°C and 1 atm to product carbon dioxide gas and liquid water. If the reaction produces 520 kJ of heat, what is the mass percentage of CH4 in the mixture? I am all out of tries on the homework, but I would ...

chem

The problem is :2.8 grams of ethene burns in oxygen to form carbon dioxide and water Calculate a)the number of moles in 2.8g of ethene b)the number of carbon dioxide(mole ratio) dioxide formed c)the mass of carbon dioxide formed D)the volume of carbon dioxide formed

Chemistry

Did I do these right? Can someone let me know if I did them correctly? I had someone help me with the problems but know I want to make sure their the right answers? 1. Methane burns in oxygen according to the following equation: CH4 + 2O2 ----> CO2 + 2H2O What is the mass ...

Chemistry

The electrolysis (decomposition) of water produces hydrogen gas at the rate of 30.0 mL/min. A) Write a balanced chemical equation for this reaction and include phase designations. 2H2O(aq)---> 4H2(g)O2(g) Is whatever I've done above correct? B) What volume of hydrogen gas ...

chemistry

Acetylene gas, c2h2, burns in oxygen to produce carbon dioxide and water. If 61.4 g of co2 are produced when 22.7g c2h2 react with sufficient oxygen, what is the percent yield for the reaction?

chemistry

determine the percent yield when 5.00g benzene burns in oxygen gas to form 1.50g of carbon dioxide and water vapor.

chemistry

Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

chemistry PLEASE HELP!!!

Acetylene gas (C2H2) is used in welding. During one job, a welder burns 48.0 g of acetylene. Using a balanced equation for the complete combustion of acetylene, calculate the following: What is the balanced equation. The mass of oxygen used? The mass of carbon dioxide produced...

science

Represent this reaction with balanced chemical equation. Disilane gas (Si2H6) undergoes combustion to form solid silicon dioxide and water.

chemistry

Acettlene gas (C2H2) is used in welding. During one job, a welder burns 48.0 g of acetylene. Using a balanced equation for the complete combustion of acetylene, calculate the following: Balanced Equation a) the mass of oxygen used b) the mass if carbon dioxide produced c) the ...

chemistry

Write word equations for the following chemical reactions. a. Pure copper can be produced by heating copper(II) sulfide in the presence of diatomic oxygen from the air. Sulfur dioxide gas is also produced in this reaction. b. Water is formed by the explosive reaction between ...

Chemistry

If a sample of pure hydrogen gas is ignited very carefully, the hydrogen burns gently, combining with the oxygen gas of the air to form water vapor. Write the unbalanced chemical equation for this reaction.

Astronomy

Hi! ____ 11. What molecules can be found in the interstellar medium? (1 point) a) water, carbon dioxide, and hydrogen b) oxygen, nitrogen, and ammonia c) nitrogen, carbon dioxide, and oxygen d) hydrogen, helium, and methane My Answer: B Could someone please check my answer? ...

Chemistry

A 10.0 gram sample of a mixture of CH4 and C2H4 reacts with oxygen at 25°C and 1 atm to product carbon dioxide gas and liquid water. If the reaction produces 520 kJ of heat, what is the mass percentage of CH4 in the mixture? PLEASE HELP! I do not know where to even start!

Chemistry

What is the chemical equation for the combustion reaction between methanol and air? CH4 + O2 ==> CO2 + H2O. All hydrocarbons produce CO2 and H2O when they are combusted in air. The above equation isn't balanced. I assume you can do that? If not, ask OR take a shot at it and...

chemistry

If 8.00g of methane is burned with 6.00g of oxygen. How much methane,oxygen,carbon dioxide,and water remain after the reaction is complete in grams?

Chemistry

When 50 grams of hydrocarbon X are burned with oxygen the products are carbon dioxide and water. If 65 grams of water and 100 grams of carbon dioxide are produced, how many grams of oxygen were needed for the reaction? This was a question on my chemistry homework but I'm ...

Chemistry

A(n) ____ reaction is one in which oxygen reacts with another compound to form carbon dioxide, water, and heat.

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100