Gaseous carbon monoxide reacts with hydrogen gas to form gaseous methane ({\rm CH}_{4}) and liquid water

55,467 results, page 6

chemistry

How many grams of carbon dioxide will form if 4.4 g of propane reacts with 16.0 g of oxygen producing 7.2 g of water?

chemistry

The gaseous product of a reaction is collected in a 30.0 L container at 37 degrees C. The pressure in the container is 2.5 atm and the gas has a mass of 85.0 grams. What is the molar mass of this gas? I know the correct answer is 28.8 g/mol but I need to know how to get the ...

chemistry

Under SATP, magnesium was reacted with acid and 500 ml of hydrogen gas was collected over water. A) what is the vapor pressure of water? B) What is the pressure of the hydrogen gas? C) What amount of hydrogen was produced? I only know how to do the law of partial pressures and...

chemistry

Write a balanced equation for the following reaction. Use whole number coefficients and subscripts appropriately. When hydrochloric acid is mixed with sodium hydrogen carbonate, the mixture fizzes. The fizzing occurs because the reaction produces a gas, namely carbon dioxide. ...

college Chemistry

Why was there condensation of the beaker of cold water when a blue flame was passes underneath? This experiment is from the Gas Burner experiment. A) the product of carbon dioxide from combustion (B) the product of hydrogen dioxide from combustion (C) left over unburned oxygen...

Chemistry

Use the following information to identify element A and come pound B, then answer questions a and b. An empty glass container has a mass of 658.572 g. It has a mass of 659.452 g after it has been filled with nitrogen gas at a pressure of 790. torr and a temperature of 15°C. ...

chem

Carbon monoxide is detected in air samples by its reaction with diiodine pentoxide to form carbon dioxide and elemental iodine: CO+I2O5 --> CO2+I2. Balance the equation.

chm I

Lithium hydride reacts with water as follows. LiH(s) + H2O(l) -->LiOH(aq) + H2(g) During World War II, U.S. pilots carried LiH tablets. In the event of a crash landing at sea, the LiH would react with the seawater and fill their life belts and lifeboats with hydrogen gas. ...

Science

Balanced chemical equation for the carbon monoxide gas for motor car engines combines with the oxygen gas in the air to produce carbo dioxide

Chemistry

First two hw of 50 that I am trying to get a handle on. Any help would be appreciated. 3.What gaseous substance is driven off of succrose when it is heated? is the answer CO2? 7.What gaseous substance is driven off of succrose when it is reacted with acid? 17. What is the back...

chemistry

Methane gas is burned releasing Carbon Dioxide into the atmosphere. How much CO2 (g) is released if 78.5 Liters of Methane is burned? CH4 + O2 --> CO2 + H2O

7th grade Science

1. The atmosphere of Earth is an example of a ______solution.(1point) liquid-liquid gas-liquid gas-gas** solid-liquid Am I correct?

Chemistry

Calculate E°cell (in volts) for a fuel cell that employs the reaction between methane gas and oxygen to form carbon dioxide and water. (to 4 significant figures) ∆G⁰f for CH4 = -50.5 kJ/mol ∆G⁰f for CO2 = -394.4 kJ/mol F = 96485/mol e- I got 0.4455 V ...

Chemistry

When naming a molecular compound, such as CO, would I write it as mono carbon monoxide or carbon monoxide? My textbook has the rule written as prefix+1st element prefix+2nd element, but I am not sure if the mono applies to the carbon or not.

chemistry

what is the percent yield of reaction in which 455g of tungsten (VI) oxide (WO3) reacts with excess hydrogen gas to produce metallic tungsten and 9.60 cm^3 of water.(density of water = 1.00 g/cm^3) ???

CHEMISTRY

1 In the group of the alkali metals the degree of hydration-------- down the group. decreases increases is constant has no fixed pattern 2 Which of these statements is not true? liquid ammonia is is used to form carbides All metals react with carbon to form carbides lithium ...

chemistry

when calcium carbonate, caco3(s) is heated, it decomposes to form calcium oxide, cao(s) and carbon dioxide gas. how many liters of carbon dioxide will be produced at stp if 2.38 kg of calcium carbonate reacts completely?

Chemistry

If 3.0 liters of oxygen gas react with excess carbon monoxide at STP, how many liters of carbon dioxide can be produced under the same conditions? 2 CO (g) + O2 (g) ---> 2 CO2 (g)

chemistry

Please let me know if my equation is correct,taken from the following word problem. If you react Iron(111)oxide with carbon monoxide,you will produce liquid iron and carbon dioxide. Fe2O3 + CO --> Fe + CO2. If I'm correct..how do I balance this. Thanks for your help.

Chemistry

the gaseous product of a reaction is collected in a 25.0L container at 27c. the pressure in the container is 300.0 kpa and the gas has a mass of 96.0g. what is the molar mass of the gas?

Chemistry

The gaseous product of a reaction is collected in a 25 L container at 27 degrees Celsius. The pressure in a container is 300 kPa and the gas has a mass of 96 g. What is the formula mass of the gas?

Chemistry

So I do know how to work out letter a) but I'm still very confused with parts b and c. Appreciate the help! 2FeN(s) + 3H2(g) --> 2Fe(s) + 2NH3(g) Suppose that the reaction is carried out at 300C and 3.00 atm. 1.00 grams of iron (III) nitride reacts. a)What is the volume of ...

Chemistry

A 1.5 gram sample of a gaseous hydrocarbon has a volume of 820 mL when measured at 227 oC and 2.50 atm. Which of the following is the formula for the gas?

chemistry

pure hydrogen gas is burns gently, combining with the oxygen gas of the air to form water vapor

Chemistry-DrBob222

I got 62.9 mL. Is this correct? I think HCl is the LR. A piece of solid magnesium is reacted with hydrochloric acid to form hydrogen gas: Mg (s) + 2HCl (aq) ---> MgCl2 (aq) + H2 (g) What volume of hydrogen gas (in mL) is collected over water at 25 degrees Celsius by ...

Chemistry

A gaseous mixture of O2, H2, and N2 has a total pressure of 1.50 atm and contains 8.20 g of each gas. Find the partial pressure of each gas in the mixture They don't give you Volume and Temperature. Please explain it to me, thank you!

chemistry

A 3.00- flask is filled with gaseous ammonia, . The gas pressure measured at 28.0 is 1.55 . Assuming ideal gas behavior, how many grams of ammonia are in the flask?

Chemistry

The gaseous product of a reaction is collected in a 25.0-L container at 27 C. The pressure in the container is 216 kPa, and the gas has a mass of 96.0 g. What is the molar mass of the gas?

Chemistry

The gaseous product of a reaction is collected in a 25.0-L container at 27 C. The pressure in the container is 216 kPa, and the gas has a mass of 96.0g. What is the molar mass of the gas?

science

A 3.00- flask is filled with gaseous ammonia, . The gas pressure measured at 28.0 is 1.25 . Assuming ideal gas behavior, how many grams of ammonia are in the flask?

chemistry

A 3.00- flask is filled with gaseous ammonia, . The gas pressure measured at 28.0 is 2.35 . Assuming ideal gas behavior, how many grams of ammonia are in the flask?

chemistry

A 3.00- flask is filled with gaseous ammonia, . The gas pressure measured at 28.0 is 2.35 . Assuming ideal gas behavior, how many grams of ammonia are in the flask?

chemistry

The gaseous product of a reaction is collected in a 12.0 L container at 280C. The pressure in the container is 3.5 atm and the gas has a mass of 96.0 g. What is the molecular mass of the gas?

science

The aquarium was sealed and placed at a bright corner. After two weeks, both the number of water plants and water snails increased. (a) Besides their gaseous needs, state one other way in which the water snail and the water plant are interdependent.

Chemistry-Please help

A 3.00-L flask is filled with gaseous ammonia, . The gas pressure measured at 17.0 degree celsius is 2.35atm . Assuming ideal gas behavior, how many grams of ammonia are in the flask?

Chemistry

The question is: Hydrogen and oxygen gas combine explosively to produce water. Write a balanced chemical equation for this process. If 10 mol of hydrogen reacted with oxygen, what volume of liquid water could be produced? Is this right for the balanced equation? 4H + O₂...

Chemistry - Combustion

The standard enthalpies of formation of gaseous propylene (C3H6) and propane (C3H8) are +20.4kJ/mol and -103.8 kJ/mol. Their respective combustion reactions may be written as follows, where one mole of either gas is consumed by oxyen to yield carbon dioxide and water. ...

Chemistry

Hi! I am having some trouble with this question, can you please help me? Which of the following describe chemical properties? Check all that apply. - Iodine (a purple solid) becomes a purple gas. - Titanium is less dense that iron . - Water freezes at 0'C - Sugar burns in air ...

Chemistry

I need help classifying these as physical and chemical properties! 1. sodium metal in chlorine gas releases luster. 2. sodium metal has a metallic silver luster. 3. sodium metal in water porduces hydrogen gas. 4. sodium metal melts to a liquid at 98 degrees. 5. sodium metal ...

Chemistry

4.0 L of hydrogen gas reacts with 2.0 L of nitrogen gas (at the same temperature and pressure), producing ammonia gas, NH3. Find the limiting reactant.

Chemistry 1201

An unknown compound contains only carbon, hydrogen, and oxygen (C?H?O?). Combustion of 6.50 of this compound produced 9.53 g of carbon dioxide and 3.90 g of water. 1) How many moles of Carbon? 2) How many moles of Hydrogen?

chemistry

you are given an unknown gaseous binary compound. when 10.0g of the compound isburned in excess oxygen, 16.3g of water is produced. the compound has 1.38 times that of oxygen gas at the same conditions of temperature and pressure. give a possible identity for the compound.

chemistry

A 211 g sample of barium carbonate, BaCO3, reacts with a solution of nitric acid to give bar- ium nitrate, carbon dioxide and water. If the acid is present in excess, what mass and volume of dry carbon dioxide gas at STP will be produced

chemistry/check please

923.85 grams of gaseous ammonia condenses into liquid.How much energy was released? answer: 1268.28852 = 1268 kj

chemistry

what volume of carbon dioxide is formed when 11 of CS2 reacts with 18 L O2 to produce carbon dioxide gas and sulfur dioxide gas at STP?

chemistry

calculate the standard molar entropy change for the combustion of methane gas using S naught values from standard thermodynamic tables. Assume that liquid water is one of the products.

Chemistry

A(n) ____ reaction is one in which oxygen reacts with another compound to form carbon dioxide, water, and heat.

Carbon

#1 where and in what form does carbon enter long term stores? It enters long-term stores in the form of Carbon dioxide, and is found in intermediate and deep ocean waters. On land, it is found in coal-deposits and in oil and gas deposits. #2 where and in what form does carbon ...

Chemistry please check

1. An ionic compound solution is a(an)________ of electric current. non-conductor absorber emitter good conductor reverser ans: good conductor 2. Hydrogen bonding in water accounts for water's higher than expected boiling temperature the fact that ice floats in liquid water ...

chem

Lithium hydride reacts with water as follows. LiH(s) + H2O(l) -->LiOH(aq) + H2(g) During World War II, U.S. pilots carried LiH tablets. In the event of a crash landing at sea, the LiH would react with the seawater and fill their life belts and lifeboats with hydrogen gas. ...

chemistry

I am a freshman in college, and am taking a placement test soon, but haven't seen chemistry since 10th grade. I'd appreciate any help I can get from anyone here to help me solve this problem: Hydrogen and sulfur chemically combine to form the gas hydrogen sulfide, according to...

science

what are the arrangement and motions of molecules of substances in the solid phase, liquid phase, and gaseous phase?

Physical Science

What kind(s) of particles make up (a) gaseous compound (b) liquid compound (c) solid compound?

ap chemistry

A 6.9 gram sample of a gaseous substance occupies 10 L at 63C and 537 torr. What is the density of the gas under these conditions? Answer in units of g/L

Chemistry

Calculate the volume of amonia gas is produced at STP when 140g of nitrogen gas reacts with 30g of hydrogen gas (Atomic mass N=14u,H=1u)

Chemistry

metal hydrides react with water to form hydrogen gas and the metal hydroxide. How do you calculate the mass of hydrogen gas that can be prepared from 3.78 g of SrH2 and 3.5 g of H2O? a) how many moles of H2 can be produced from given mass of SrH2? b) How many grams of H2? ...

Chemistry

In the balanced equation for the combustion of 2,2,4-trimethyloctane (C11H24), the coefficient of the organic compound is...the coefficient of oxygen gas is ...the coefficient of carbon dioxide gas is...and the coefficient of liquid water is.

physical chemistry

For the process CH4(g) = C(s) + 2H2(g) A reaction is started in a rigid vessel at 1000 K with 1 mole of methane and 1 mole of hydrogen gas at 10 bar. Use table C.3 from your text to determine how many grams of carbon should be formed after the reaction has reached equilibrium.

Science

BP -164°C ΔHvap 8.136 kJ/mol sg 2.205 J/g°C MP -182°C ΔHfus 0.928 kJ/mol sl 2.41 J/g°C Using the data above for methane, CH4, calculate the heat needed to convert 150. g of liquid methane at -175°C to a gas at 25°C.

chemistry

Here is the question: sodium hydride reacts with excess water to produce aqueous sodium hydroxide and hydrogen gas: NaH(s)+H2O-->NaOH(aq)+H2(g) A sample of NaH weighing ________g will produce 982mL of gas at 28.0 C and 765 torr, when the hydrogen is collected over water. ...

Physics

What kind (s) of particles make up (a) gaseous compounds, (b) liquid compounds, and (c) solid compounds?

Chemistry

A mixture of gases containing equal weights of carbon dioxide, carbon monoxide, and ammonia exerts an overall pressure of 450.0 torr. What pressure is exerted by each gas individually??

Chemistry

Calculate the ratio of moles of CO2 produced to moles of the original gas mixture? A mixture of methane (CH4) and ethane (C2H6) is stored in a container at 294 mmHg. The gases are burned in air to form CO2 and H2O. If the pressure of CO2 is 351 mmHg measures at the same ...

Chemistry

Calculate the ratio of moles of CO2 produced to moles of the original gas mixture? A mixture of methane (CH4) and ethane (C2H6) is stored in a container at 294 mmHg. The gases are burned in air to form CO2 and H2O. If the pressure of CO2 is 351 mmHg measures at the same ...

chemistry

Gaseous arsine reacts according to the balanced equation. If a total of -3663 KJ of heat is produced in the reaction as written, how many grams of AsH3 are consumed? (Enthalpy= -1867.2) 2 AsH3(g) + 3 O2(g) --> As2O3(s) + 3 H2O(l)

Science

3. Kamir and Alexis are studying the properties of water. They conducted a variety of experiments to determine its physical and chemical properties. Of the tests the students conducted, which one illustrates a chemical property of water? a. Salt dissolves in water b. Oil and ...

chem

what is the balanced equation for ozone gas reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

chemistry

potassium-a metal that catches fire whet it reacts with water, chlorine-a green poisonous gas bromine-a reddish brown liquid lithium-the least reactive of the alkali metals neon-an nonreactive gas iron-a metal with very high melting point

chem

Elemental Sulfur can be formed through the combustion of Hydrogen Sulfide (found in Methane gas) give in equation H2S+O--->S + H2 4 tell how much sulfur is made from 250 grams of methane 2 H2S + O2---->2S +2 H2O s=32

science

calculate the number of molecules of hydrogen and carbon present in 4 gof methane.

chemistry

A furnace that provides heat by burning methane gas must have the correct mixture of air and fuel to operate efficiently. What is the mole ratio of air to methane gas in the combustion of methane? Hint: Air is 20% oxygen.

CHEMISTRY

Select all substances with a hydrogen atom that would participate in hydrogen bonding with an appropriate acceptor atom. (CH3)2CO acetone CO carbon monoxide S8 octasulfur CHClCHCl cis-1,2-dichloroethene CF3CF3 hexafluoroethane CH3COCH3CH2 methylethylketone

CHEMISTRY

Select all substances with a hydrogen atom that would participate in hydrogen bonding with an appropriate acceptor atom. (CH3)2CO(acetone), CO(carbon monoxide), S8(octasulfur), CHClCHCl (cis-1,2-dichloroethene),CF3CF3(hexafluoroethane),CH3COCH3CH2 (methylethylketone)

Chemistry

[10:58am]: Wn 4.5g of liquid water was formed by burning hydrogen gas in oxygen,-72kj of heat was given off.calc d standad heat formation of water

Chemistry. Please :(

1. If 23.00 grams of carbon dioxide and 18.75 grams of water are formed from the combustion reaction. What is the percent yield for CO2 and H20. How much in grams of the excess reactant remains? 2. Balance the equation and determine the mass in grams of hydrogen gas produced ...

Chemistry

Convert the information described below into balanced equation: (a) When a mixture of copper(II) oxide and carbon is heated, elemental copper forms and carbon monoxide evolves into the atmosphere. (b) When a concentrated solution of sodium hydroxide is added to an aqueous ...

chemistry

how do I write a balanced equation showing aqueous hydrogen carbonate, to give liquid water and carbon dioxide gas H2O(l) + CO2(g) ==>H2CO3(aq) to show the formation of dihydrogen carbonate (carbonic acid). To show the decomposition of H2CO3. H2CO3(aq) ==> H2O(l) + CO2(g)

Chemistry

In planning to administer a gaseous anesthetic to a patient, a. Why must the anesthesiologist take into account the fact that during surgery the gaseous anesthetic is used both at room (18 degrees C) and the patient's body temperature (37 degrees C)? The warmer the temperature...

CHEMISTRY

Write a balanced chemical equation for the reaction of solid vanadium(V)({\rm V}) oxide with hydrogen gas to form solid vanadium(III)({\rm III}) oxide and liquid water.

AP Chemistry

A 2.8 gram sample of a gaseous substance occupies 12 L at 47 degrees C and 683 torr. What is the density of the gas under these conditions? Answer in units of g/L

Chemistry

Write and balance equations for the following reactions. A)Iron metal and Chlorine gas react to form solid iron(III) chloride. B)Solid aluminum carbonate decomposes to form solid aluminum oxide and carbon dioxide gas. C)Solid magnesium reacts with aqueous silver nitrate to ...

Living a Healthy Life

The most effective way to prevent carbon monoxide poisoning is by A. heating buildings with oil or electricity. B. installing and maintaining carbon monoxide detectors. C. keeping an adequate supply of breathing masks at hand. D. remaining alert to the odor. B.

Chemistry

I've worked through this problem so many times and I keep getting the same thing yet when I submit it, it says its wrong.. Am I missing something? Q:Calcium hydride (solid) reacts with water to form calcium hydroxide (aqueous) and hydrogen gas. Write a balanced chemical ...

chemistry

hydrogen gas has a Henry's law constant of 1.07e-6 M/mm Hg at 25 Celsius when dissolving in water. if the total pressure of gas (H2 gas plus water vapor) over water is 1.0atm, what is the concentration of H2 in the water in grams per milliliter?

chemistry

80.0 g of iodine (v) oxide reacts with 28.0 g of carbon monoxide determine the mass of iodine

chemistry

80.0 g of iodine (v) oxide reacts with 28.0 g of carbon monoxide determine the mass of iodine

CHE102

Some commercial drain cleaners contain sodium hydroxide (NaOH) and powdered aluminium (Al). When the mixture is poured into a clogged drain the reaction given by the following balanced equation occurs: 2Al + 2NaOH + 6H2O → 2NaAl(OH)4 + 3H2 The heat generated by the reaction ...

chemistry

If you collect hydrogen gas over water at a temperature of 45 degrees celcius, what is the volume of jst te hydrogen if the pressure of hydrogen is 1.23 atm and the grams of hydrogen was 2.6? What is the volume of the water?

Chemistry

Which must be the same when comparing 1 mol of oxygen gas, O2, with 1 mol of carbon monoxide gas, CO?

Chemistry

A hungry backpacker needs to boil 150 mL of water to prepare a cup of Ramen Noodles. The filtered river water is at a temperature of 14.2 oC. The pressure is 760 mm Hg and he wants to eat the chicken flavored noodles. How many mL of his liquid butane camping fuel will he use ...

Chemistry

Hydrogen gas,H2 , reacts with nitrogen gas,N2 , to form ammonia gas,NH3 , according to the equation 3H2+N2-2NH3 How many grams ofNH3 can be produced from 2.90mol ofN2 ? How many grams ofH2 are needed to produce 13.75g of NH3 ? How many molecules (not moles) ofNH3 are produced ...

physical science

why does the temperature of boiling water remain the same as long as the boiling continues? Because it is a pure compound undergoing a phase change. The constant temperature is a requirement of the Gibbs Phase Rule. It is not obvious why this happens. If the compound is not ...

chemistry

1. Given that 50 grams of ice is heated at -20.0 °C to steam at 135.0 °C. i. Show the graph of the changes from ice to steam ii. Calculate the energy needed to change the ice to steam Please use these values: Heat of fusion = 334.16 J g¯1 Heat of vaporization = 2259 J g¯1 ...

chemistry

How much heat energy is given off when one kilogram of hydrogen gas at 25C and one atmosphere is combined with enough oxygen gas to make liquid water at 25C?

Physics/Chem

an experiment, a 0.280-kg piece of ceramic superconducting material at 23 °C is placed in liquid nitrogen at its boiling point (−195.8 °C) to cool. The nitrogen is in a perfectly insulated flask that allows the gaseous N2 to escape immediately. How much mass of liquid ...

chemistry

If 600 mL of 0.283 M aqueous NaBr and 15.9 L of gaseous Cl2 measured at STP are reacted stoichiometrically according to the balanced equation, how many liters of gaseous Cl2 measured at STP remain? Round your answer to 3 significant figures. 2NaBr(aq) + Cl2(g) ¡æ 2NaCl(aq...

CHEMISTRY

AT 25 DEGREES CELSIUS THE STANDARD ENTHALPY OF COMBUSTION OF GASEOUS PROPANE IS -2219.0 KJ PER MOLE OF PROPANE AND THER STANDARD ENTHALPY OF GASEOUS PORPYLENE IS -2058.3 KJ PER MOLE OF P[ROPYLENE. wHAT IS THE STANDARD ENTHALPY CHANGE FOR THE FOLLOWING REACTION C3H6 + H2 ---C3H8

chemistry

Now "react" methane (CH4) with oxygen (O2) to produce carbon dioxide (CO2) and water (H2O). Start with one molecule of methane and one molecule of oxygen. Continue reacting molecules of CH4 and O2 until all the reactant atoms have been used to form products. Summarize what ...

Chemistry

If 920 mL of 0.0402 M aqueous LiOH reacts stoichiometrically according to the balanced equation, what mass (g) of gaseous CO2 is required? 2 LiOH(aq) + CO2(g) → Li2CO3(aq)

General Chemistry

Answer Check Please... A compund contains only hydrogen and nitrogen and is 12.6% hydrogen by mass. A gaseous sample of the compound has desity of 0.925g/L at 690 torr and 110 degrees Celsius. What is the molecular formula of the compound? My Empirical Formula = H2N Molecular ...

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100