Chemistry - Molecular Structure

61,389 results

chemistry

can you check my answers in the parenthesis 1)The molecular structure around the oxygen in water is (bent) 2)The molecular structure around all the carbons in ethanol is (tetrahedral)

chemistry

The molecular structure around the oxygen in water is ? The molecular structure around all the carbons in ethanol is ?

chemistry

The molecular structure around the oxygen in water is . The molecular structure around all the carbons in ethanol is .

chemistry

What is the molecular structure around the oxygen in water? What is the molecular structure around all the carbons in ethanol?

Chemistry

The molecular structure around the oxygen in water is ?????? The molecular structure around all the carbons in ethanol is ?????

chem

A molecular compound is composed of 58.8% Xe, 7.2% O, and 34.0% F, by mass. If the molecular weight is 223 g/mol, what is the molecular formula? Draw the correct Lewis structure. Predict the molecular geometry using the VSEPR model.

chemistry

what is the molecular geometry of IO3- when the angle is 105 degrees? What is it when the molecular geometry is 120 degrees? Which angle creates the most stable structure with the highest Boltzmann Distribution? Create a lewis structure that agrees with your findings?

Chemistry - Molecular Structure

What is the molecular geometry of a molecule with 5 outer atoms and 1 lone pair on the central atom?

chem

The fact that ice is less dense than water is related to the fact that ____. the molecular structure of ice is much less orderly than that of water the molecules of ice are held to each other by covalent bonding ice has a molecular structure in which water molecules are ...

chemistry

what is the molecular geometry of trans-difluroethylene: trans-C2H2F2? I know how to draw the lewis structure but I'm not sure how to find the molecular geometry. I think it's a tetrahedral

Chemistry

What is the molecular structure of methylated spirit

Chemistry (organic)

What is the molecular formula for the below line-angle structure? The structure is a pentagon with one line connected to a corner. I'm sorry if that doesn't make any sense but the picture will not paste here. a C6H11 b C5H11 c C7H12 d C5H13 e C6H12 Thank you so much in advance!!

chemistry

what is the molecular structure around oxygen in water?

chemistry

The molecular structure around the oxygen in water is???

Advanced Chemistry

What is the (name of the) molecular structure of AlCl3NH3 ?

Chemistry

The molecular structure around the oxygen in water is _________ I don't know what to put

chemistry

The molecular structure around the oxygen in water is . ---is the answer bent or angular?

Chemistry

The molecular structure around all the carbons in ethanol is ________ I don't know what to put

chemistry

draw the structure of 2,4-dimethyl-3-ethyl-2-heptanol and give the molecular formula.

chemistry

Determine the structure of the compound by using the IR and 1H NMR of a spectra that has the molecular formula: C4H8O2

chemistry

C4 H10 O or diethyl ether or with a formula of CH3CH2OCH2CH3 its stick structure is H H H H ! ! ! ! .. H-C-C-C-C- O-H ! ! ! ! .. H H H H I used the this ! sign as a sign for bond. pls help me to determine the geometry for each central atom in this structure. 1) C Trigonal 2) C...

organic chemistry

Determine the structure of the compound by using the IR and 1H NMR of a spectra that has the molecular formula:C4H7ClO2

chemistry

Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3

chemistry

What is the molecular structure of the molecule AlCl3? What characteristic is notable about the structure that helps us to understand the acidic nature of AlCl3?Write a chemical reaction between AlCl3 and NH3 ignoring any reaction between AlCl3 and the solvent. Show and name ...

Honors Chemistry

What is the molecular structure of the molecule AlCl3? What characteristic is notable about the structure that helps us to understand the acidic nature of AlCl3?Write a chemical reaction between AlCl3 and NH3 ignoring any reaction between AlCl3 and the solvent. Show and name ...

Chemistry

Give the molecular orbital description [e.g. sigma(sp3-sp3)] for each unique bond in the following structure. CH3NCHCCH I know how to draw the lewis structure and what a sigma and pi bond is, but I don't understand what the (sp3-sp3) part after the bond means or how you ...

Molecular biology

What is the importance of the tertiary structure of a tRNA? I know the structure, but I'm not sure what is the importance of it. Is it stabilization?

organic chemistry

How is overall molecular polarity affected by molecular symmetry (specifically shown for alkenes in book)? And what are the consequences for melting and boiling points (in cases of high molecular symmetry versus low molecular symmetry)?

Organic Chemistry

If 3-bromo-1-propanol is treated with NaOH, a compound of molecular formula C3H6O is formed. suggest a structure for this product.

chemistry

Explain in terms of molecular structure why sugars have a relatively high melting point compared to hydrocarbons of a similar size.

Chemistry

What is the Lewis structure formula, electron pair geometry and the molecular geometry for SO4^2-

chemistry

How is overall molecular polarity affected by molecular symmetry (specifically shown for alkenes in book)? And what are the consequences for melting and boiling points (in cases of high molecular symmetry versus low molecular symmetry)? I looked for help in the book but it ...

Chemistry

Which of the following is not true about molecular orbital theory? A. The bonding molecular orbital is filled before the antibonding orbital. B. Each molecular orbital can accommodate only one electron. C. The number of molecular orbitals formed is often equal to the number of...

chemistry

I have a chart and I have to draw the structure,name the shape snd lable the bond angle of some compounds. I've done most of them but im stuck on a few so heres what I need.Please and thank you structure of NF3 structure,shape and bond angle of TeCl2 bond angle of CCl4 CCl4 is...

help needed !!! URGENT

Can some one help me I don’t know what to take out from the aspirin molecule, for the following structures? I have to generate a copy of the molecular structure of aspirin and then for each of the molecular features listed in (i) – (iii) have to produce a related structure...

chemistry

explain what is meant by the term 'Hybridisation' in molecular orbital theory and show how the concept can be used to explain the structure and bonding in ethane C2H6 ETHENE C2H4 AND ETHYNE C2H2

chemistry

When water freezes and becomes solid ice, the hydrogen bonds create a crystal structure and there is fixed space between each water molecule. This causes ice to? a.become more dense than liquid water because it is a solid* b.become less dense than liquid water and therefore ...

Chemistry

1) If 0.5 moles of a mono alkanoic acid weighs 44g,determine the molecular formular. 2) molecular formular =emprical * n. 3) molecular formular = 44*0.5

Science

How do the properties of methane relate to its molecular structure?

Chemisty

The molecular structure around the oxygen in water is....????

Organic chemistry

compound with a molecular formula C8H16O has the following H-nmr spectrum: 3H triplet at 0.90, 1.0 to 1.6 8H multiplet, 2.05 3H singlet, 2.25 2H triplet. What is the structure of this compound? I think it is 2-octanone but not sure

science

Can some one help me I don’t know what to take out from the aspirin molecule, for the following structures? I have to generate a copy of the molecular structure of aspirin and then for each of the molecular features listed in (i) – (iii) have to produce a related structure...

Chemistry

If I am given a molecular hydrocarbon structure, how would I be able to tell how sp3 hybridized carbons it possesses? Like my current question asks How many sp3-hydridized carbon atoms does 11-cis-retinal possess?

chem

Determine the electron and molecular geometries of each of the following molecules. For those with more than one central atom, indicate the geometry about each central atom. (Enter your answers in the order given in the skeletal structure from left to right.) CH3OH (skeletal ...

Chemistry

# Electron Pairs # Lone Pairs Electronic Geometry Molecular Geometry Lewis Structure Sketch of Shape I need to do the above things for SBr6 and BrCl5. If anybody can help that would be great!

chemistry(check my answer)

how do resonance structure related to its real structure? resonance structure is just another way to write the lewis dot with different formal charges and bond order

Chemistry

Reaction of gaseous fluorine with compound x yields a single product y, whose mass percent composition is 61.7% F and 38.3%Cl. (a) What is a probable molecular formula for product Y, and what is a probable molecular formula for X? (b) Draw an electron-dot structure for Y, and ...

Chemistry

Identify the true statement about Lewis structures. Select all the correct answers. 1. Hydrogen is usually surrounded by 4 electrons in a valid Lewis structure. 2. A single bond in a Lewis structure represents 2 electrons. 3. A double bond in a Lewis structure represents 2 ...

biology

describe 2 structures of bacterial cells what they look like and their molecular structure

chemistry

what transition metal complex is responsible for transporting oxygen in our blood? Also, what is its structure? The transition metal (there are several transition series---I assume you are referring to the 3d transition metals) is iron. As to its sturcure, the iron itself has ...

chemistry.

The relative molecular mass of A is 116. Determine the molecular formula for A.

chemistry

Based on their molecular structure, how can you figure out which is stronger between two oxyacids? Our textbook is really vague. I thought it had to do with which had more oxygen but one of the question compares CH3COOH and CCl3COOH so now I'm lost again.

chemistry

Can a molecular formula be used to predict the molecular shape of a small molecule? Please explain how.

chemistry

a compound is found to be 94.1% o and 5.90% h. its molecular mass is 34.0. what is its molecular formula A. H3O2 B. OH C. H2O D. H2O2 I think D

chemistry

how can you determine molecular polarity based on molecular shape?

chemistry

molecular weight is 284.5 g/mol what is the molecular formula.76.0% C, 12.8% H, 11,2%O.

chemistry

Polyglycolic acid, PGA, is a polymer that we know rather well how to control the structure of (even though there are currently only limited applications). So in the lab we have created two types of PGA for testing, a linear chain PGA and a branched chain PGA. Assume comparable...

Science

Describe how the structure of DNA is correlated with its role as the molecular basis of inheritance in Biology.

Chemistry

if a student finds the molecular weight of an unknown liquid to be 115 g/mole and the molecular formula of the liquid is CHCl3, what is the percent error in the student's molecular weight?

Chemistry

Find the molecular formula of a compound that is 48.38% carbon, 8.12% hydrogen, and 53.5% oxygen by mass and has a molecular weight of 328 g/mol.

chemistry!

Of the four general types of solids [molecular, ionic, network covalent, metallic], which one[s] are generally soluble in nonpolar solvents? I'm thinking either molecular or ionic. Are either [or both] correct? molecular: like dissolves like is the rule of thumb.

chemistry// organic

This is a pushing question. We discussed how phenols are typically more acidic than alcohols, even though they both contain the same hydroxyl functional group, because phenols possess an aromatic ring that delocalizes the negative charge after a proton is removed. Consider the...

chemistry

Based on their molecular structure, why are these acids thes stronger of the two binary acids given? HCl stronger than HF HF stronger than H2O H2Se stronger than H2S Is this because of bond strength due to placement on the table of elements? thanks

chemistry

7.25 g of iron were reacted with sulfur until the product reached a constant mass of 13.50 g. If the experimental molecular mass of the product was measured as 572 u, what is the molecular formula of the product? What is the actual molecular mass of the product?

chemistry

7.25 g of iron were reacted with sulfur until the product reached a constant mass of 13.50 g. If the experimental molecular mass of the product was measured as 572 u, what is the molecular formula of the product? What is the actual molecular mass of the product?

Chemistry

Draw the structure of the product formed by the reaction between methyl alcohol and formic acid and give the molecular formula HCOOH + HOCH3 ==> HCOOCH3 + H2O determine this molar concentration 58g of lithium in 54-ml of water molarity = mols/L mols Li = 58/atomic mass Li...

chemistry

Which of the following statements concerning differences between ionic and molecular compounds is correct? Molecular compounds contains two elements, and ionic compounds contain three of more elements ionic compounds contain oxygen, and molecular compounds do not. molecular ...

chem

Using the VSEPR theory, predict the molecular structure of each of the following molecules. (a)NI3 (b)AsH3 (c)OF2

Chem

O=S=O what is this molecular structure Sulfur dioxide? It wants it's binary compound name and formula it is written this way SO2?

Chemistry

Draw the structure of the product formed by the reaction between methyl alcohol and formic acid and give the molecular formula? I did not understand the answer that you gave me it did not make sense to me and I couldn't find it to respond back im sorry. If you wouldnt mind can...

Chemistry: Electron Configuration

The following questions relate to the bonding in the OH-1 ion. (16 points) Write the electron configuration for H. (1 point) Write the electron configuration for O. (1 point) Draw the molecular orbital diagram for OH-1. (5 points) Draw the Lewis Structure for OH-1. (3 points) ...

Chemistry

Compound K is a hydrocarbon. Combustion of 6.51 g of K gave 20.47 g of carbon dioxide and 8.36 g of water. The relative molecular mass of K was found to be 84. Calculate the empirical and molecular formula of K

biology

how to label the ecstasy molecular structure plz name each part the formula is C11 H15 NO2 HCl

General Chemistry

How do the vapour pressure of two substance at the same temperature but with different strengths of the inter-molecular forces compare. Give a molecular explanation of why this is so.

Chemistry

A compound of B and H is found to have a mass percent composition of 81.1% Boron. Its empirical formula is B2H5. A mass spectrometry experiment tells us that the molecular mass is 53.3 g/mol. What is its molecular formula? So I feel like this is a trick question, because I ...

Chemistry

Write the structure for the alkane: molecular mass = 72 u; forms four monochlorination products. Well since its 72u and its an alkane, I figured out that the formula is C5H12. But what does it mean that it "forms 4 monochlorination products"?

Chemistry

Calculate the mass in grams of hydrgen chloride produced when 5.85 L of molecular hydrogen measured at STP reacts with an excess of molecular chlorine gas. H2 + Cl2 ---> 2HCl

chemistry

what is the lewis dot structure for SO4 -2 and the ideal bonds, mollecular structure and hybrid orbitals?

chemistry

what is the molecular geometry of trans-difluroethylene: trans-C2H2F2? i want to say it is a tetrahedral because it has four atoms and no lone pairs, but im not sure. the bond angles of this is 109.5 and that is is the bond angles for tetrahedrals so is it good to conclude ...

chemistry

Describe the structure of the water molecule and indicate how this structure is responsible for many of the unique properties of this vital compound.

chemistry

how to draw atomic structure for elements from scandium to zinc ?and what is their valency number.plz show me the shell structure.

Chemistry(the)

An optically active compound having molecular formula C6H12O6 is found in two isomeric forms (A) and (B) in nature. When (A) and (B) are dissolved in water they show the following equilibrium. (A) Equilibrium mixture (B) D = 1110 52.20 19.20 (i) What are such isomers called? (...

Chemistry

What is the structure of a tripeptide where glycine is first, serine is second, and alanine is third. Draw the structure in the proper zwitterionic form.

Chemistry

Given the Empirical formula: C6H7N, and a molecular mass of 372.52 g/mol, How do I find the MOLECULAR formula for the compound?

chemistry

An unknown sample with a molecular mass of 180.0g is analyzed to yield 40% C, 6.7% H, and 53.3% O. What is the empirical formula and the molecular formula of this compound?

Chemistry

A carbohydrate P contains 40% carbon,6.67% hydrogen.If P has a relative molecular mass of 60.Determine it; 1)Empirical formula 2)molecular formula [H=1,C=12,O=16]

science

Are there any related structure from an asprin? To show how important an asprin is from using a carboxylic acid. You need to clarify your question. I need to produce a related structure of the molecular features of carboxyli acid, size hydrocarbon group on ester and distance ...

Chemistry

Explain why alcohols of lower molecular weight are generally soluble in water but those of higher molecular weights are generally not.

chemistry

can anyone tell me about the molecular orbital energy order in energy level diagrams????its molecular n not atomic.....

Chemistry

A compound of molecular weight 70.1 has the following composition: Carbon 85.63% and hydrogen 14.37%. What is the empirical formula? What is the molecular formula?

Chemistry

An organic compound that has the empirical formula CHO has a molecular mass of 145 amu. Its molecular formula is?

chemistry

Which is the molecular formula of a compound with the empirical formula BCH3 and a molecular mass of 103.38g/mole?

Biology

Could somebody check this formula for the structure of hyroloysis of lactose C12H22O11+H20 ...> C6H12O6H12O6 OBVIOUSLY THE FIGURES ARE ALL SUBSCRIPT Many thanks Is that not the molecular formulae ???

chemistry

What is high molecular symmetry and low molecular symmetry and give examples of both please help!!!

chemistry

calculate the mass in grams of hydrogen chloride produced when 5.25 L of a molecular hydrogen measured at STP reacts with an excess of molecular chlorine gas

CHEMISTRY

Two gases A and B having the same volume diffuse through a porous in 20 and 10 seconds respectively .The molecular mass of A is 49u.Molecular mass of B will be

Chemistry

To draw the lewis dot structure of H3COH3, Do I need to rearrange the formula as CH3OCH3? If not, On paper I have O H H C O C H H H I am not sure if this is the right structure.

chemistry

a sample of compound C,H,N and O with a mass of 0.6216 was found to contain 0.1735g C,0.01455g H,0.2024g N.Its molecular mass 129.calculate its epirical and molecular formulas.

chemistry

'the vapour density of certain gas x is 4 times that of y the molecular mass of x is m the molecular mass of y is ?'

Chemistry

A compound has an empirical formula of CH2 and molecular mass of 84g. What is it's molecular formula?

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100