CHEMISTRY (WEBWORK)

59,669 results, page 94

  1. chemistry

    Draw the lewis structure for: SiO3 -2 CNO- TeO4 -2 F2PPCl2 thanks!
  2. Chemistry

    Determine the correct oxidation number assigned to carbon in CaCO3
  3. chemistry

    50 ml of.10 M HNO3 is added to 50 ml of .2M CaCl2. Calculate amount of precipitate formed?
  4. chemistry

    How many moles of sugar are required to react completely with 3.26 mol of oxygen?
  5. Chemistry

    If you use a different mass of magensium metal in an experiment would the empirical formula of the compund be the same?
  6. Chemistry

    What is the effect of aqeour ammonia on (NH4)2SO4.FeSO4.6H2O?
  7. Chemistry

    Rank the following atoms in order of decreasing electronegativity, putting the most electronegative first: F, Ne, O, N, C
  8. chemistry

    Calculate the new molarity when 150 mL of water is added to 125 mL of 8.55 M HBr.
  9. chemistry

    Sorryy but I still don't understand will you show the calculations for my previous question
  10. chemistry

    Calculate the [H3O+] of the following polyprotic acid solution: 0.145 M H3C6H5O3?
  11. chemistry

    At what temperature does the rms speed of Cl2 molecules equal 401 m/s?
  12. chemistry

    sodium hydroxide and carbonic acid net ionic equation
  13. chemistry

    CuCl2(aq) and Na2CO3(aq) are mixed.Write the balanced equation for the process.
  14. Chemistry

    2.00 L of 0.800 M NaNO3 must be prepareds from a solution which 1.50 M in concentration. How many mL of the 1.50 M are required ? I am not sure weather " 2.00 L " is my V1 or V2 .
  15. Chemistry

    Please help, thanks! what exactly are the formulae these functional groups? carboxylic carboxylate caboxyl carbonyl
  16. chemistry

    If a block of wood with the length 1.05 m, height 5.24 cm, and width 3.36 cm and a mass of 2.56 kg what is the density?
  17. Chemistry

    Calculate the solubility of AgCl in the following solution: 100mL of .004 M CaCl2
  18. Chemistry

    What is the formula of the precipitate formed from the precipitation reaction of Li2CO3 and ZnCl2?
  19. Chemistry

    The solutions of both Ag+ and Zn2+ ions have no color. What does this suggest about their electron configurations?
  20. Chemistry

    I'm having trouble balancing this equation: SO3^2- --> S2O4^2- It's in a basic solution. Thanks.
  21. General chemistry

    How much energy is released by the combustion of 1.00 mol of octane, C8H18?
  22. Chemistry

    What is the yield of the synthesis of ammonia to 400° C and 500 atm of pressure?
  23. Chemistry

    100mls of propane gas in grams. Pressure is equal to one atmosphere
  24. Chemistry

    What is the ppm of 4.50mg of ddt in 10kg of seal fat Please show how
  25. CHEMISTRY

    The pressure exerted by 6.0g of methane gas in a 0.03m3 vessel at 129degreeC is.
  26. Chemistry

    What is the average mean of the following data set: 2, 8, 6, 4, 2, 4, 5 (round your answer to 2 decimal points)?
  27. Organic chemistry

    What is the name of this alkene CH3CH2CH(BR)CH=C(BONDED TO A METHYL ON ONE SIDE AND AN ETHYL ON THE OTHER)
  28. chemistry

    Determine the theoretical yield of CO2 if 250.0 g CaCO3 is heated.
  29. chemistry

    what is the molarity of an aqueous solution that is 6.75% glucose by mass? Assume a density of 1.03 g/ml
  30. basic chemistry

    a substance that cannot be broken down into susbtances by ordinary chemical means is
  31. Chemistry

    Describe how you could make approximately 5 g of a 3% (w/w) ferrous ammonium sulfate solution
  32. Chemistry

    Calculate the pH of a solution made with 0.240 M H3PO3 and 0.480 M NaH2PO3.
  33. Chemistry

    How many grams of CuSO4 * 5H2O are needed to prepare 100mL of a 0.10 M solution ?
  34. Chemistry

    What gas involved during the reaction between zinc and hydrochloric acid? I know it's hydrogen, but why?
  35. Chemistry

    What gas involved during the reaction between zinc and hydrochloric acid? I know it's hydrogen, but why?
  36. Chemistry

    Determine which is larger member of each pair A) Mg2+ or Al3+ B) N3- or O2-? Explain
  37. Chemistry

    Calculate the solubility of silver chloride in a solution that is 0.140 M in NH3.
  38. Chemistry

    calculate the volume occupied by 7g of N2 gas at 27 degree c and 750mm Hg pressure
  39. Chemistry

    calculate the frequency of an xray having a wavelength of 3.5*10to the negative seven m. (meters).
  40. chemistry

    what is the pH of a solution prepared by adding 0.65mol of LiOH(aq) to 1.0L of 0.30mol/L HNO3(aq)>
  41. chemistry

    if 125 ml of H2O is added to 50 ml of 0.35 M NaCl, what is the molarity of the resulting solution?
  42. Chemistry

    What energy is associated with a photon in the infared region of the spectrum having a frequency of 4.5*10^12s^-1
  43. Chemistry

    What happens to the current flow with time in an electrolytic cell ? explain. thank for helping~
  44. Chemistry

    How much oxygen (in grams) will form from 44.2 mg of N2O5? 2N2O5(s) → 4NO2(g) + O2(g) ____× 10^-3(g) O2
  45. CHEMISTRY

    15.0g of KCLO3 was crushed and heated with about 0.1g of MnO2.Write an equation for the reaction.
  46. Chemistry

    Calculate the mass of water that will be produced when 5.0 grams of H2 is reacted with excess O2.
  47. chemistry

    What is the molar concentration of sodium ions in a 0.450 M Na3PO4 solution?
  48. Organic chemistry - Nitration

    Why does the amount of dinitration increase at high temperatures?
  49. Chemistry

    How many kilojoules are required to change 85g of water at 25 C to steam at 100 C?
  50. Chemistry

    Which of the following solutions is the most basic? (a) 0.6 M NH3, (b) 0.150 M KOH, (c) 0.100 M Ba(OH)2. Explain.
  51. Chemistry

    How do you find the mass of iron in audio tapes per metre of tape?
  52. Chemistry

    What are ways in which pka values for weak acids can be experimentally determined?
  53. Chemistry help

    Why it is important for there to be no further bubbling before the final mass of the reaction beaker is obtained?
  54. Chemistry

    Calculate the mass of water that will be produced when 5.0 grams of H2 is reacted with excess O2.
  55. chemistry

    How do you balance this redox rxn? Al + HNO3 ----> Al(NO3)3 + NH4NO3 +H2O
  56. Chemistry

    A sample of C3H8O that contains 200. molecules contains ________ carbon atoms.
  57. chemistry

    An atom whose nucleus contains 7 neutrons and which has a mass number of 12 is an isotope of what element?
  58. Chemistry

    How do you find unpaired electrons in a metal ion in CuSO4·5H20?
  59. Chemistry

    'calculate the mass in amu of 2.879 1023 xenon atoms'
  60. chemistry

    what is the net ionic equation for manganese sulfide and hydrobromic acid?
  61. chemistry

    the wavelength(nm)of a ball bearing with a mass of 10g, and a velocity of 10cm/s is what?
  62. Chemistry

    Hoe much carbon dioxide is produced from 2.0 L of propane combusting at STP?
  63. Chemistry

    If it takes 45 days for 80.0 mg of a particular radioactive isotope to decay to 10.0 mg what is its half-life?
  64. chemistry

    hpw would i draw a lewis structure for a molecule with 3.5 bonds for example NO2???
  65. chemistry

    how many moles of Na2SO4 are present in 850cm3 of a solution which has a concentration of .6 mol d/m3
  66. chemistry

    By what factor is the rate of a reaction changed if an enzyme lowers the Ea by 9.0 kJ/mol at 37°C?
  67. Chemistry

    Describe the processes involved in the equilibrium that exists between a liquid and its vapor.
  68. chemistry

    what is the molarity of the solution comtaining 2.5g of acetic acid in 75g of benzene
  69. Chemistry

    True or false? 1 mole of ozone has 1.8 x 10^24 atoms? correct if wrong THANK YOU!
  70. Chemistry

    Calculate the wavelength of a photon of yellow light whose frequency is 6.3*10^5m. (meters)
  71. Chemistry - DrBob Help!

    Draw product for chlorination of 2methylbutane through a 2nd radical
  72. Chemistry

    Calculate the frequency of a photon of orange light whose wavelength is 6.2*10^5m. (meters)
  73. Chemistry

    How much energy is associated with a photon in the gamma ray region of the spectrum with a frequency of 6.6*10^5s^-1
  74. Chemistry

    The Ka values of H2CO3 are shown below. Ka1 4.6 10-7 Ka2 4.4 10-11 What is the pH of a 0.17 M solution of Na2CO3?
  75. chemistry

    The densities of the liquid and solid states of a substance are often similar. Explain.
  76. chemistry

    Give the IUPAC name of thish hydrocarbon ch3ch2c(ch3)2ch2ch2ch2ch3
  77. Chemistry

    In an acid/base titration, why must the indicator (phenolphthalein) be a strong dye?
  78. chemistry

    A Bronsted-Lowry acid is a proton donor. True or False
  79. Chemistry

    How many moles of NaOH must be added to 1.0 L of 2.2 M HF to produce a solution buffered at each pH? (a) pH = pKa (b) pH = 4.24 (c) pH = 4.60
  80. College Chemistry

    How many grams of BaCl2 are needed to make a 250mL of 15% solution?
  81. chemistry

    why is the energy difference for t-butylcyclohexane significantly greater than the corresponding value calculated for methylcyclohexane?
  82. Chemistry

    How do halogens (Cl2, Br2, I2) react with halides (Cl-, Br-, I-)? Can we explain this reactivity?
  83. Chemistry

    Calculate the change in heat for the reaction SO2 + 1/2O2 --> SO3
  84. chemistry

    Net Ionic Reaction and molecular Equations of Ca3(PO4)2
  85. Chemistry

    What is the molarity of nitrate ions in a solution containing 2.20 mg of Mg(NO3)2 dissolved in 7.35 L of water?
  86. Chemistry

    Net Ionic Equation for reaction between bromide and silver nitrate
  87. Chemistry

    2H2O --> 2H2 + O2 if 30 mL of hydrogen in the above reaction, how many milliliters of oxygen are produced?
  88. chemistry

    Calculate a value for the solubility of (NH4)2C2O4H2O in g/100 cm3 at 298 K
  89. chemistry

    Air is a gas solution where oxygen is the solvent. True or False
  90. Chemistry

    Rank the following Bronsted acids from strongest to weakest: H-SH H-CH3 H-NH2 H-F H-I
  91. Organic Chemistry

    What would have happened if we had forgotten to neutralize the aqueous solution before recrystallization?
  92. Chemistry

    Calculate the boiling temperature of a 0.50 M solution of sucrose. Assume that the concentration is 0.50 m.
  93. chemistry

    How is phenol converted into salicylic acid. Give chemical equation?
  94. Chemistry

    2H2O --> 2H2 + O2 if 30 mL of hydrogen in the above reaction, how many milliliters of oxygen are produced?
  95. Chemistry

    2H2O --> 2H2 + O2 if 30 mL of hydrogen in the above reaction, how many milliliters of oxygen are produced?
  96. chemistry

    if burning one mole releases 1310.0 kj, then how many moles will release 227.30?
  97. chemistry

    DETERMINE the enthalpy for the reaction CH4(g)+NH3(g)->HCN(g)+3H2(g)
  98. Chemistry

    what is the solubility of Pb(NO3)2, PbCl2, PbCrO4, and PbS from highest to lowest
  99. chemistry

    if I have 3 tablespoons of sugar (15 grams) and dissolve it in 1 cup (~237 mL) and take out 30 mL what is the molarity in the 30 mL?
  100. chemistry

    0.315 M 2(NH4)SO4 and 0.488 M NH3 Calculate concentration of OH
  1. Pages:
  2. 1
  3. 2
  4. 3
  5. 4
  6. 5
  7. 6
  8. 7
  9. 8
  10. 9
  11. 10
  12. 11
  13. 12
  14. 13
  15. 14
  16. 15
  17. 16
  18. 17
  19. 18
  20. 19
  21. 20
  22. 21
  23. 22
  24. 23
  25. 24
  26. 25
  27. 26
  28. 27
  29. 28
  30. 29
  31. 30
  32. 31
  33. 32
  34. 33
  35. 34
  36. 35
  37. 36
  38. 37
  39. 38
  40. 39
  41. 40
  42. 41
  43. 42
  44. 43
  45. 44
  46. 45
  47. 46
  48. 47
  49. 48
  50. 49
  51. 50
  52. 51
  53. 52
  54. 53
  55. 54
  56. 55
  57. 56
  58. 57
  59. 58
  60. 59
  61. 60
  62. 61
  63. 62
  64. 63
  65. 64
  66. 65
  67. 66
  68. 67
  69. 68
  70. 69
  71. 70
  72. 71
  73. 72
  74. 73
  75. 74
  76. 75
  77. 76
  78. 77
  79. 78
  80. 79
  81. 80
  82. 81
  83. 82
  84. 83
  85. 84
  86. 85
  87. 86
  88. 87
  89. 88
  90. 89
  91. 90
  92. 91
  93. 92
  94. 93
  95. 94
  96. 95
  97. 96
  98. 97
  99. 98
  100. 99
  101. 100