C6H12O6+CO2=2C2H5OH+2CO2, how many moles of CO2 are produce when .490 mol of C6H12O6 react with this equation

47,027 results, page 5

Chemistry

Due to increased CO2 in the atmosphere, the pH of rainwater is more acidic than in the previous century. Use the following data to calculate the pH of unpolluted rainwater at 25°C: vol% in air of CO2 = 0.033; solubility of CO2 in pure water at 25°C and 1 atm = 88 mL CO2 per ...

chemistry

Due to increased CO2 in the atmosphere, the pH of rainwater is more acidic than in the previous century. Use the following data to calculate the pH of unpolluted rainwater at 25°C: vol% in air of CO2 = 0.033; solubility of CO2 in pure water at 25°C and 1 atm = 88 mL CO2 per ...

chemistry

How many moles of dextrose (C6H12O6) are in 264mL of solution with a concentratino of 0.78M?

Chemistry

Write balanced complete ionic equation for HC2H3O2(aq) + K2CO3(aq)-----> H2O(l)+CO2(g)+KC2H3O2(aq) I put 2H+(aq)+2C2H3O2-2(aq)2K+(ag)+CO3-2(aq)------>H2O(l)+CO2(g)+2K+(aq)+C2H3O2-2(aq) and said it was wrong, but I got this part right. 2H+(aq)+CO3 2-(aq)----->H2O(l)+...

chemistry

i have 2 questions stoichiometry loss of CO2 1. record the amount of CO2 produced vs the amount of Na2CO3. I did 7 beakers with 20ml of 3M H2SO4 and add varying amounts of Na2CO3 to each. 2. discuss your results in terms of moles. is there a linear relationship between the ...

chemistry

Aluminum metal reacts with iron(III) oxide to produce aluminum oxide and iron metal. (a) How many moles of Fe2O3 are required to completely react with 55 g Al? mol (b) How many moles of Fe are produced by the reaction of 3.00 mol Fe2O3 and 97.7 g Al? mol (c) How many atoms of ...

Science

The biochemical conversion of Glucose, C6H12O6, into pyruvic acid, C3H4O3, is an important step in the TCA (Kreb’s) cycle which forms a part of the metabolic breakdown of glucose (to produce energy). C6H12O6 (s) + O2 (g) → 2C3H4O3(l) + 2H2O (l) glucose oxygen pyruvic ...

Chem

calculate the mass in grams of carbon needed to produce 160 grams of CO2 burning. C + O2 -> CO2

Chemistry

Sample of 10.7g of O2 reacts completely with CO to form CO2 3a) How many grams of CO2 will be formed. So 10.7g (1mol/32g) (2molCO2/2molCO2)(22.01gCO2/1molCO2) = 14.7g. Please is this right 3b) is the mass of CO2 ypu determined in the equation (3a) the minimum or the maximum ...

chemistry

Unsure how to solve this without a formula... I think its combustion analysis? CxHy + O2 --> CO2 + H20 CxHY has a MW=78g/mol. 100g of CxHy yields 338g CO2 and 138g of H2O. What is the formula CxHY (what are x and y)? Balance the reaction equation. Any help at all is ...

chemistry

Calculate Delta G for each reaction using Delta Gf values: answer kJ ...thank you a) H2(g)+I2(s)--->2HI(g) b) MnO2(s)+2CO(g)--->Mn(s)+2CO2(g) c) NH4Cl(s)--->NH3(g)+HCl(g) is this correct? a) H2(g)+I2(s)--->2HI(g) From tables: G HI = +1.3 kJ/mol G H2 = 0 G I2 = 0 dG...

Chemistry

How many moles of gases will be produced if we decompose 10 moles of the reactant in the following chemical equation? 3 C2H8O4Cl4 = 12 HCl (g) + 6 CO2 (g) +6 H2 (g)

Chemistry

write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O . When balancing the equation , use the ...

chemistry

CH4 + 2O2 = CO2 + 2H2O Starting with 13.6 g of CH4, calculate the mass in grams of CO2 produced if there is enough O2 gas to react with all of the CH4

chemistry

If you react 25.25 g of Na2CO3 with 50.0 mL of 6.0M HCl, answer the following questions: Na2CO3 + 2 HCl -> 2 NaCl + H2O + CO2 question: a) How many moles of HCl do you need to react completely with the 25.25 g of NaCO3? b) What is limiting reagent?

chemistry

How many moles of water will produced at equilibrium be if there is 1.0 mole of carbon dioxide formed at equilibrium? 2 C2 H6(g) + 7 O2(g) <==> 4 CO2(g) + 6 H2 O(g) ... [CO2]^4[H20]^6/[C2 H6]^2[O2]^7

Chemistry

Given the balanced equation representing a reaction: 2CO(g)+O2(g)-->2CO2(g) what is the mole ration of CO(g) to CO2(g)in this reaction? (1)1:1 (2)1:2 (3)2:1 (4)3:2

help

Methane, CH4, burns in oxygen gas to form water and carbon dioxide. What is the correct balanced chemical equation for this reaction? A. CH4 + O → H2O + CO2 B. CH4 + 4O → 2H2O + CO2 C. CH4 + O2 → H2O + CO2 D. CH4 + 2O2 → 2H2O + CO2

chemistry

A mixture consisting of 1 mol of H2O (g) and 1 mol CO (g) is placed in a 11 L reaction vessel at 800 K. At equilibrium 0.647 mol CO2 (g) is present as a result of the reaction: CO(g) + H2O (g) --> CO2(g) + H2 What is K(equilibrium constant) at 800 K?

Chemistry

Consider this reaction: 3 K2CO3 (aq) + 2 CrCl3 (aq) -> Cr2(CO3)3 (s) + 6 KCl (aq) If 1.2 moles of CrCl3 react, how many moles of K2CO3 will react with it? A. 0.80 mol K2CO3 B. 1.2 mol K2CO3 C. 1.8 mol K2CO3 D. 2.4 mol K2CO3 I'm not sure where to even begin, I know how to ...

Chemistry

I need help the question is Convert 25 x 10 to the 25th molecules of CO2 to grams of CO2. I know that one molecule of CO2 is 44.01 g but the answers are .106g,9.44g,1.8x10^4 g, and 2.5 x 10^4 g I don't get it can anyone help me!

Chemistry

When 85g of CH4 are mixed with 85g of O2 according to this equation: CH4 + 2O2 - cO2 + 2H2O What is the theoretical yield in gams of CO2? What is the percent yield if 45.7g of CO2 are produced? Please explain!

Chemistry

Mass (before reaction): test tube + HCl(aq) + stir bar + capsule 26.600 g Mass (after reaction): test tube + HCl(aq) + stir bar + capsule 25.300 g Volume of water displaced from the squirt bottle 148 mL Temperature of the CO2(g) 287.4 K Pressure (atm) 1.032 atm Using this data...

chemistry

Calculate the Delta G(not) for the reaction: C(s) + CO2 (g) --> 2 CO Delta Gf : CO2 = -394.4 kj/mol Delta Gf : CO = -137.2 kj/mol

chemistry

vinegar/water = 0ml/35ml initial mass (g) = 82.420 final mass with AS(g) = 84.925 How do I figure out initial mass of AS (g)= mass of CO2 evolved = moles of CO2(moles)= Mass of NaHCO3 (g)=

chemistry

For the combustion of ethane, beginning with 2.6 mol of CH3CH3, 2CH3CH3(g) + 7O2(g) → 4CO2(g) + 6H2O(g) a. how many moles of O2 are required to completely consume the CH3CH3? 9.1 moles b. how many moles of CO2 are obtained when the CH3CH3 is completely combusted? 5.2 ...

chemistry

Given the balanced equation: C2H4 + 3O2 ¨ 2CO2 + 2H2O How many liters of CO2 are produced when 15 liters of O2 are consumed?

chemistry ap

Assume that 29.7 g of Al react with HCl according to the equation Al(s) + HCl(aq) −→ AlCl3(aq) + H2(g) at STP. How many moles of Al react? Remember to balance the equation first. Answer in units of mol. How many moles of H2 are produced? Answer in units of mol. How...

Chemistry

How many moles of ethane does it take to produce 8112 KJ in the reaction 2 C2H6 + 7O2 yields 4 CO2 + 6 H2O + 3120 KJ? I got 8112 kJ x 2 moles ethane/3120 kJ (5.2 moles).

Chemistry

CO2(g) + 2 NH3(g) CO(NH2)2(s) + H2O(g) What volumes of CO2 and NH3 at 193 atm and 450.°C are needed to produce 2.54 kg of urea, assuming the reaction goes to completion?

Chemistry

the molar mass of triolein is 885 g/mol, how may moles of CO2 molecules do i have

Chemistry 2

A mixture containing KCLO3, K2CO3, KHCO3, and KCL was heated, producing CO2, O2, and H2O (water) gases according following equations: 2KCLO3 -> 2KCL + O2 2KHCO3 -> K2O + H2O + 2CO2 2CO3 -> K2O + CO2 The KCL does not reacnder the conditions of the reaction. If 100.0g ...

Chemistry

CH4 + 2O2 --> CO2 + 2H2O a. How many grams of methane are needed to produce 1.5 X 10^-2 grams of carbon dioxide? b. How many grams of oxygen are needed to react to form the 1.5 X 10^-2 grams moles of carbon dioxide?

Chemistry

CH4 + 2O2 --> CO2 + 2H2O a. How many grams of methane are needed to produce 1.5 X 10^-2 grams of carbon dioxide? b. How many grams of oxygen are needed to react to form the 1.5 X 10^-2 grams moles of carbon dioxide?

Chemistry

CH4 + 2O2 --> CO2 + 2H2O a. How many grams of methane are needed to produce 1.5 X 10^-2 grams of carbon dioxide? b. How many grams of oxygen are needed to react to form the 1.5 X 10^-2 grams moles of carbon dioxide?

Chemistry 2

The solubility of CO2 in water is 3.2 x 10^2 M at 25 C and 1 atm pressure. What is the Henry's Law constant for CO2 in mol/(L atm)? c=kP 0.25= kP p=kc p/k=kc/k =Px 1/k Please help!

chemistry

Ibuprofen, the active ingredient in advil, is made up of carbon, hydrogen, and oxygen atoms. When a sample of ibuprofen, weighing 5.000 g, burns in oxygen, 13.86 g of CO2 and 3.926 g of water are obtained. What is the simplest formula of ibuprofen? My work: 13.86 g CO2/ 12.01 ...

CHEMISTRY

given this balance equation, C2H5OH+3O2=3H2O+2CO2 HOW MANY GRAMS OF CO2 ARE PRODUCED FROM 18.5 GRAMS OF OXYGEN GAS?

chemistry

calculate the number of moles and mass of methane (ch4) required to produce 11 kg of carbondoxide(co2) when combusted ?

help...chemistry

i am stumped on this. please help. Balance the following equation and give the value of the stoichiometric coefficient marked with a question mark. 48KNO3 + _ C12H22O11 ---> ? CO2 +_ N2 + _K2CO3 +_ H2O thanks I left the CO2 for you but it will balance. 48KNO3 + 5C12H22O11...

science

Given the following reaction (it IS balanced), how many grams of CO2 are produced when 0.700 moles of toluene (C7H8) is allowed to completely combust? C7H8 + 9 O2 ¨ 7 CO2 + 4 H2O

Chemistry

The question is with a lab that I have already done. Here are my numbers moles of malachite in 1g 221.12 moles of CuO produced 141.57 ratio of moles of CuO produced per moles of malachite decomposed 79.55 Use the mole ratio of CuO produced per mole of malachite to write a ...

chemistry help

Determine the number of moles of each specified atom or ion in the given samples of the following compunds.( Hint: the formula tells you how many atoms or ions are in each molecule of formula unit.) a. O atom in 3.161x10^21 molecules of CO2 b. C atom in 3.161x10^21 molecules ...

equilbrium II

when CO2 (.15mol) and H2 (.302g) in a 500L vessel at 576'C are allowed to come to equilibrium the mixture contains .000183 mol/L of H20. what is the equilibrium concentration of CO? CO2 + H2 --> <-- CO +H2O The equilibrium concentration of H2O = the equilibrium ...

Chemistry

Please help! Calculate the standard change in enthalpy, ΔH°rxn, for the decomposition of calcium carbonate to calcium oxide CaCO3 (s) → CaO (s) + CO2 (g) Given that: ΔH°f CaCO3 (s) = -1206.9 kJ/mol ΔH°f CaO (s) = -635.1 kJ/mol ΔH°f CO2 (g) = -393....

Urgent Chemistry Problem!!

Calculate Delta G at 298 K for the following reactions. Ca(s) + CO2(g) + 1/2O2(g) -> CaCO3(s) 2KClO3(g) -> 2KCl(s) + 3O2(g) CH4(g) + 3Cl2(g) -> CHCl3(g) + 3HCl(g) Delta G^0f CHCl3 is - 70.4 kJ/mol The following reactions are important ones in catalytic converters in ...

Chemistry Dr. Bob

Plastic Cup B Mass of cup, water and stirrer: 53.75g mass of sodium bicarbonate: 2.02g mass of citric acid: 1.52g total mass of all: 57.29g mass of cup, solution, stirrer after reaction: 56.59g difference (CO2): 0.70 g Now, Here's the problems it's basically just like before, ...

chemistry

I don't know how to do this How many moles of water can be made from 4 moles of oxygen gas and 16 moles of hydrogen gas? What is the limiting reagent? Write the balanced equation. 2H2 + O2 ==> 2H2O 2 mols H2 + 1 mol O2 will produce 2 mol H2O. So 16 mols H2 will require 8 ...

CHEM

Given the equation 2C8H18 + 25O2 = 16 CO2 + 18H2O: The combustion of octane produces carbon dioxide and water. If you start with 10.0 moles of octane, what mass of water (in grams) would you expect to produce?

chemistry

Please let me know if my equation is correct,taken from the following word problem. If you react Iron(111)oxide with carbon monoxide,you will produce liquid iron and carbon dioxide. Fe2O3 + CO --> Fe + CO2. If I'm correct..how do I balance this. Thanks for your help.

Chemistry

We have of ice at -11.9°C and it is ultimately completely converted to liquid at 9.9°C. For ice, use a specific heat (Cs) of 2.01 J/gK, for liquid water use a specific heat of 4.18 J/gK, and ΔHfusion = 6.01kJ/mole, Molar mass H20 = 18.01g/mol. If 1 mole of ice at -11.9...

chemistry

(a) A pressure vessel contains a large volume of CO2 gas at 10 atm pressure. A membrane composed of a poly(ether ketone) polymer with thickness 100 microns and net effective area of 100 cm2 covers a small perforated port in the container. The solubility of CO2 at 10 atm is 6....

Chemistry

(a) A pressure vessel contains a large volume of CO2 gas at 10 atm pressure. A membrane composed of a poly(ether ketone) polymer with thickness 100 microns and net effective area of 100 cm2 covers a small perforated port in the container. The solubility of CO2 at 10 atm is 6....

chemistry

liquid heptane C7H16 is completely combusted to produce CO2 and H2O: C7H16 + 11O2 --> 7CO2 + 8H2O the heat combustion for one mole of C7H16 is -4.85*10^-3 CO2 heat of comb. = -393.5 H2O h of c= -285.8 a) calc. the vale of heat of cumbustion for C7H16 in kJ/mol a .0108 mol ...

Chemistry

I am trying to answer my questions for thermal decomposition of malachite lab. I have moles of malachite in 1g= 0.0045 moles of Cuo produced= 0.0009 ratio of moles of Cuo produced per moles of malachite decomposed=0.0045/0.0009=5.1 the balanced euation = CuCo3*Cu9OH)2 ----->...

Chemistry

Calculate the adiabatic flame temperature of burning CH4 (g) at 1 atm when burned with 50% excess air, and the reactants enter at 25oC. Standard heat of formation: Ch4: Hr = -49.963kj/mol CO2: Hr = - 393.25 kJ/mol H20(g) : Hr = - 241.835 kj/mol Heat capacities (J/mol), T in oC...

Chem 2

A mixture containing KCLO3, K2CO3, KHCO3, and KCL was heated, producing CO2, O2, and H2O (water) gases according to the following equations: 2KCLO3 -> 2KCL + O2 2KHCO3 -> K2O + H2O + 2CO2 K2CO3 -> K2O + CO2 The KCL does not reacnder the conditions of the reaction. If ...

ap chemistry

Carbon monoxide reacts with oxygen to form carbon dioxide by the following reaction: 2CO2 + O2 yields 2CO2 Delta H for this reaction is -566 kJ/mol run. What is the delta H for CO? 1). +270 kJ/mol 2). -110 kJ/mol 3). +65 kJ/mol 4). -405 kJ/mol 5). -65 kJ/mol 6). -182 kJ/mol 7...

Chemistry

Please help me with this question from my homework package What is the minimum number of photons with wavelength 645nm needed to prepare 135 grams of glucose? When the thermochemical equation is C6H12O6(s)+ 6O2(g)--> 6CO2(g)+ 6H2O(g) Reaction is -2539.01 Kj/mol

Chemistry

0.717 g of a compound containing carbon, hydrogen, and oxygen is burned and found to produce 1.02 g CO2 and 0.624 g H2O. The molar mass of the compound is 124 g/mol. (a) Write a chemical equation for the combustion of this unknown hydrocarbon. (b) Determine the # of g and ...

Chemistry/Calorimetry

You buy coffee (200.0 ml) served in a styrofoam cup. You are up late working in a chemistry lab, and want to drink the coffee right away, but at 95.0 degrees C, it is too hot to drink. You like the temperature of your coffee to be 79.0 ± 1.0 degrees C. You decide that the ...

chemistry

Methanol (CH3OH) is used in the production of many chemicals. Methanol is made by reacting carbon monoxide and hydrogen at high temperature and pressure. CO(g) + 2 H2(g) CH3OH(g) (a) How many moles of each reactant are needed to produce 4.83 102 g CH3OH? CO mol H2 mol (b) ...

chemistry

Methanol (CH3OH) is used in the production of many chemicals. Methanol is made by reacting carbon monoxide and hydrogen at high temperature and pressure. CO(g) + 2 H2(g) CH3OH(g) (a) How many moles of each reactant are needed to produce 4.83 102 g CH3OH? CO mol H2 mol (b) ...

chem

CaCo3 reacts with aq HCl to give CaCl2+CO2. What mass of CaCo3 is required to react completely with 50cm^3 of 0.60M HCl. Calculate volume of CO2 produced at STP.

Chemistry

Calculate the enthalpy (ΔHo) of reaction (kJ) for the equation as written. If the answer is negative, enter the sign and then the magnitude. 2 HCOOH(l) + O2(g) → 2 CO2(g) + 2 H2O(l) . ΔHof (kJ/mol) HCOOH(l) -409 O2(g) 0 CO2(g) -393.5 H2O(l) -285.83 the answer ...

Chemistry

A pressure vessel contains a large volume of CO2 gas at 10 atm pressure. A membrane composed of a poly(ether ketone) polymer with thickness 100 microns and net effective area of 100 cm2 covers a small perforated port in the container. The solubility of CO2 at 10 atm is 6.97 x ...

chemistry

(a) A pressure vessel contains a large volume of CO2 gas at 10 atm pressure. A membrane composed of a poly(ether ketone) polymer with thickness 100 microns and net effective area of 100 cm2 covers a small perforated port in the container. The solubility of CO2 at 10 atm is 6....

Chemistry

(a) A pressure vessel contains a large volume of CO2 gas at 10 atm pressure. A membrane composed of a poly(ether ketone) polymer with thickness 100 microns and net effective area of 100 cm2 covers a small perforated port in the container. The solubility of CO2 at 10 atm is 6....

CHEMISTRY

(a) A pressure vessel contains a large volume of CO2 gas at 10 atm pressure. A membrane composed of a poly(ether ketone) polymer with thickness 100 microns and net effective area of 100 cm2 covers a small perforated port in the container. The solubility of CO2 at 10 atm is 6....

Chemistry

In a chemical reaction, exactly 2 mol of substance A react to produce exactly 3 mol of substance B 2A ---> 3B How many molecules of substance B are produced when 27.9 g of substance A reacts? the molar mass of substance A is 24.7 g/mol STEP 1: convert the mass of A to moles...

Chemistry

In winemaking, the sugars in grapes undergo fermentationby yeast to yield CH3CH2OH and CO2. During cellularrespiration, sugar and enthanol are "burned" to water vapor andCO2. A) Using C6H12O6 for sugar, calculate ÄH of fermentation and of respiration(combustion). B) Write a ...

chemistry

In winemaking, the sugars in grapes undergo fermentationby yeast to yield CH3CH2OH and CO2. During cellularrespiration, sugar and enthanol are "burned" to water vapor andCO2. A) Using C6H12O6 for sugar, calculate ÄH of fermentation and of respiration(combustion). B) Write a ...

chemistry

In winemaking, the sugars in grapes undergo fermentationby yeast to yield CH3CH2OH and CO2. During cellularrespiration, sugar and enthanol are "burned" to water vapor andCO2. A) Using C6H12O6 for sugar, calculate ÄH of fermentation and of respiration(combustion). B) Write a ...

Chemistry

Gasohol contains ethanol (C2H4OH)(l), which when burned reacts with oxygen to produce CO2(g) and H2O(g). How much heat is released when 12.5g of ethanol burns? C2H5OH(l) + 3 O2(g) --> 2 CO2(g) + 3H2O(l) Delta H = -1368kJ

Chemistry

Diethyl ether (also known as “ether”), C4H10O (l), is an organic compound that has long been used as a surgical anesthetic. The complete combustion of 1 mol of C4H10O (l) to CO2 (g) and H2O (l) yields ΔH °=-2723.7 kJ. a) Write a balanced equation for the combustion ...

science

How many moles of carbon monoxide are needed to react completely with 108 kg of Fe2O3. Fe2O3(s)+CO(g)→Fe(s)+CO2(g)

Chemistry

The standard heat of combustion of eicosane, C20H42 (s), a typical component of candle wax, is -1.332 x 104 kJ/mol (consider this number to be exact in your calculations), when it burns in pure oxygen, and the products are cooled to 25°C. The only products are CO2 (g) and H2O...

chemistry

From the following combustion: 1-butanol + oxygen+ carbon dioxide + water. How many grams of carbon dioxide and water are produced when 130.6 grams of 1-butanol is completely burned? I wrote out the equation and got C4H10) + 02= CO2 + H2O. i balanced the equation and got ...

chemistry

how many moles of carbon dioxide will be produced when 2.8 moles of oxygen react (consider the combustion of ethylene: C2H4 + 3 Oxygen2 -->2CO2 +2H2Oxygen

chemistry

how many moles of carbon dioxide will be produced when 2.8 moles of oxygen react (consider the combustion of ethylene: C2H4 + 3 Oxygen2 -->2CO2 +2H2Oxygen

chemistry

A 0.8378 g sample of calcium oxalate is heated to 1000oC, CaC2O4 = CaO + CO + CO2 Calculate (a) the moles of CaO remaining after ignition (b) the mmoles of CO evolved (c) the weight of CO2 produced.

Chemistry

The combustion reaction of propane is described by the reaction. C3H8 + 5O2 → 4H2O + 3CO2. How many moles of O2 are required to generate 3 moles of CO2? 2.5 moles 3 moles 4 moles 5 moles

Chemistry

The question representing the production of tetraphosphorus trisulfide (P4S3), a substance used in some match hears, is 8P4 + 3S8 ---> 8P4S3. Determine if each of the following statements is correct. If the statement is incorrect, rewrite it to make it correct. a. To ...

Chemistry

2) What is the empirical formula of a compound containing C, H, O if combustion of 1.23g of the compound yields 1.8g CO2 and .74g of H2O 3) What are the empirical and molecular formulas of a hydrocarbon if combustion of 2.10g of the compound yields 6.59g CO2 and 2.7g H20 and ...

Chemistry

When the following equation is blanced with the lowest ratio whole number, coefficient the cofficient of CO2 is C4H10(g) + O2 -> CO2(g) + H2O

chemistry

what volume of CO2 would be formed if 84.2 g of calcium carbonate decomposed according to the following equation: CaCO3---> CaO+CO2

chemistry

if there is 10.0g of CO2 in a 20.0L cylinder @ pressure of 0.300 atm and im finding temperature of the CO2 sample does n=10.0g in the equation and should I set it up pv=nRT

chemistry

What mass in grams of dextrose (C6H12O6) will be required to produce 6.00 L of a 0.15M aqueous solution? Question 5 answers

CHEMISTRY

How many grams of CH4 are required to produce 43 g of Cu according to the following equation: 4CuO + CH4 --> CO2 + 2H20 + 4Cu? I already tried to work the problem myself, and I may have gotten this right, but I do not have an answer key to compare to. #gCH4 = (43gCu) x (1 ...

ELAC

Consider equation 3A+B=C+D. You react 4 moles of A with 2 moles of B. Which of the following is true? 1) L.R. is one with higher molar mass 2) A is L.R. because you need 6 moles of A and have only 4 moles 3) B is L.R. because you have fewer moles of B than A 4) B is L.R. ...

Chemistry

Copper is changed to copper(II) ions by nitric acid according to the following equation: 4HNO3 + Cu → Cu(NO3)2 + 2NO2 + 2H2O How many moles of HNO3 must react to produce 0.961 mol of NO2?

HELP!! Chemistry

Round your answer to the correct number of significant digits and show work. 1. How many grams of NaI would be used to produce a 2.0 M solution with a volume of 10.00 L? 2. What is the molarity of a 2.50 x 102 cm3 solution containing 450.0 g of C6H12O6 ? 3. How many moles of ...

chemistry

use the molar volume of a gas to solve the following at STP: a. the number of moles of O2 in 44.8 L O2 gas. b. the number of moles of CO2 in 4.00L CO2 gas. c. the volume(L) of 6.40g O2. d. the volume(mL) occupied by 50.0g neon.

Chemistry

Gasohol contains ethanol (C2H4OH)(l), which when burned reacts with oxygen to produce CO2(g) and H2O(g). How much heat is released when 12.5g of ethanol burns? C2H5OH(l) + 3 O2(g) --> 2 CO2(g) + 3H2O(l) Delta H = -1368kJ How do I solve this problem?

Chemistry-Urgent

The partial pressure of CO2 inside a bottle of soft drink is 4.0 atm at 25°C. The solubility of CO2 is 0.12 mol/L. When the bottle is opened, the partial pressure drops to 3.0 ✕ 10-4 atm. What is the solubility of CO2 in the open drink? Express your answer in grams per liter.

Chemistry - check answer

A 20.0 L reaction vessel contains 0.016 moles CO2, 1.05 moles of CO, and 2.00 moles of C. The mixture is approaching the following equilibrium: CO2(g) + C(s) <--> 2CO(g) a) Calculate the reaction quotient Q. b) If value of K is 1.17, predict which direction the reaction ...

chemistry

How do the boiling points of 3.0 m C6H12O6 and 3.0 m CaCl2 compare? A. The boiling point of 3.0 m C6H12O6 is higher. B. The boiling point of 3.0 m CaCl2 is higher. C. They are the same. D. The difference cannot be determined from the information given. I think the answer is D...

Chemistry

The reaction through which carbon changes from graphite to diamond form is represented by the equation C(graphite) ---> C(diamond) delta H: ? Using the reactions below, determine the amount of heat absorbed in the change of one mole of graphite to one mole of diamond C(...

Chemistry

Based on the following balanced equation: 2 NH3 + 2 O2 -->N2O + 3 H2O a. How many moles of O2 are required to react completely with 6.00 moles of NH3? b. How many grams of O2 are required to react completely with 6.00 moles of NH3? c. How many moles of H2O are produced ...

chem

Assuming that you have 0.4g of Y(OH)3, calculate the mass of of BaO2 required to react stoichiometrically (1Y:2Ba:3Cu) to produce YBa2Cu3O7. Now calculate the mass of of CuO required to react stoichiometrically (1Y:2Ba:3Cu) to produce YBa2Cu3O7. please help!! .4gY(OH)3> ...

Pages

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
  21. 21
  22. 22
  23. 23
  24. 24
  25. 25
  26. 26
  27. 27
  28. 28
  29. 29
  30. 30
  31. 31
  32. 32
  33. 33
  34. 34
  35. 35
  36. 36
  37. 37
  38. 38
  39. 39
  40. 40
  41. 41
  42. 42
  43. 43
  44. 44
  45. 45
  46. 46
  47. 47
  48. 48
  49. 49
  50. 50
  51. 51
  52. 52
  53. 53
  54. 54
  55. 55
  56. 56
  57. 57
  58. 58
  59. 59
  60. 60
  61. 61
  62. 62
  63. 63
  64. 64
  65. 65
  66. 66
  67. 67
  68. 68
  69. 69
  70. 70
  71. 71
  72. 72
  73. 73
  74. 74
  75. 75
  76. 76
  77. 77
  78. 78
  79. 79
  80. 80
  81. 81
  82. 82
  83. 83
  84. 84
  85. 85
  86. 86
  87. 87
  88. 88
  89. 89
  90. 90
  91. 91
  92. 92
  93. 93
  94. 94
  95. 95
  96. 96
  97. 97
  98. 98
  99. 99
  100. 100