Draw the compound that would produce 4-ethyl-3-hexanol in the presence of a nickel catalyst and hydrogen.Please help!!!!!
To draw the compound 4-ethyl-3-hexanol, we need to understand the structural formula of hexanol and its numbering system.
Hexanol is an alcohol with a chain of six carbon atoms (hex-). The suffix "-ol" indicates that it belongs to the alcohol functional group. To differentiate the various carbons in the chain, we number them from the end closest to the functional group, which, in this case, is the hydroxyl group (OH).
1. Start by drawing a straight chain of six carbon atoms connected by single bonds.
CH3-CH2-CH2-CH2-CH2-CH3
2. Number the carbon atoms from the end closest to the OH group.
CH3-CH2-CH2-CH2-CH2-CH3
1 2 3 4 5 6
3. Add the ethyl group (C2H5) to the fourth carbon atom in the chain.
CH3-CH2-CH2-CH2-CH2-CH3
1 2 3 4 5 6
|
C2H5
4. Finally, add the hydroxyl group (OH) to the third carbon atom.
CH3-CH2-CH(OH)-CH2-CH2-CH3
1 2 3 4 5 6
|
C2H5
This is the structural formula for 4-ethyl-3-hexanol.
To produce this compound in the presence of a nickel catalyst and hydrogen (nickel catalyzed hydrogenation), the unsaturated compound of 4-ethyl-3-hexene (hexene with a double bond between the third and fourth carbon atoms) would react with hydrogen gas (H2) under the catalytic action of nickel (Ni) to form 4-ethyl-3-hexanol.