chemistry

what is the IUPAC name for CH3CH2C(CH3)2CH2CH(CH3)2?

  1. 👍
  2. 👎
  3. 👁
  1. 1,1,3,3-tetramethylpentane

    1. 👍
    2. 👎
  2. I would name this 2,4,4-trimethylhexane.
    See if this site shows the same molecule you drew.
    http://www.chemspider.com/Chemical-Structure.26066.html

    1. 👍
    2. 👎
  3. That is correct. The IUPAC name is 2,4,4-trimethylhexane.

    1. 👍
    2. 👎
  4. What is the IUPAC name for CH3—C(CH3)2—CH2—CH(CH3)—CH3

    1. 👍
    2. 👎
  5. (CH3)3(CH2CH(CH3)2

    1. 👍
    2. 👎
  6. (CH3)3CC(CH3)3

    1. 👍
    2. 👎
  7. 2,4,4-trimethyhexane

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 B) 1.00 x 10^-6

  2. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  3. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  4. Chemistry - - Hydrocarbons

    Name the following hydrocarbons. A) CH3-CH2-CH-CH2-CH2-CH3 | CH3 I don't know if this will show up correctly after I post. But the CH3 at the bottom is supposed to be under the CH. I don`t get how to name. I counted up all the

  1. organic chemistry!

    Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural

  2. chemistry

    Draw the structural formula and give the IUPAC names of the following hydrocarbon.a)CH3CHBrCHBrCH(CH3)CH3

  3. chemistry 101

    What alcohol(s) could be used to produce each of the following compounds? Enter the IUPAC names of the alcohol(s). If there are more than one alcohol, enter them separated with commas. 1.CH3-CH2-O-CH2-CH3 2.CH3-CH2-C=CH-CH3

  4. Organic Chemistry

    What is the hybridization of all the atoms (other than hydrogen) in each of the following species? a) NH3 e) +NH4 i) H3O+ b) BH3 f) +CH3 j)H2C=O c) -CH3 g) HCN d)*CH3 h) C(CH3)4 There are a couple I don't know how to do. Please

  1. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8.

  2. Chemistry

    IGNORE MY FIRST POST. I CORRECTED THIS ONE Write IUPAC name of the following alkanes: 1. (CH3)3 -C-CH2-CH2-CH3 all the numbers are subscripts. So there are 3 CH3's, C,CH2,CH2, and CH3 This is what my teacher has in my homework.

  3. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and

  4. Chemistry

    how do you expect the following series of compounds to compare in behavior in the two tests? The two tests performed were... A. Sodium Iodide in Acetone (SN2) B. Silver Nitrate in Ethanol (SN1) 1. CH3-CH=CH-CH2-Br 2. CH3-C=CH-CH3

You can view more similar questions or ask a new question.