draw each of the following compounds using condensed formulas:
a) 3,3,5-trimethyl-1-hexene
b) 1-bromo-3-chloro-1-heptyne
c) 3-heptyne
Not sure if I am doing this right, but for a) i put CH3C(CH3)2CH=CH3
a. You've drawn 1-butene with groups hanging from it. You have only two methyl groups but the name has three. And you place the two methyl groups on the 2-carbon. You start numbering from the double bond. Finally the terminal CH3 on the right has a five-valent carbon which is a no-no.
I think you want this.
CH3CH2CH2CH2CH2CH3 is hexane. Make it 1-hexene by
CH3CH2CH2CH2CH=CH2
Then hang CH3 group on 3,3, and 5
CH3CH(CH3)CH2C(CH3)2CH=CH2
6...5.....4...3.....2...1
To draw the condensed formulas for the given compounds, you need to represent each atom using its chemical symbol and consider the number of carbon atoms in each compound. Let's break down each compound:
a) 3,3,5-trimethyl-1-hexene
Starting with the prefix "tri-", which implies three substitutions of the methyl group (CH3), we can position these three methyl groups on the third (3), third (3), and fifth (5) carbon atoms. Therefore, the condensed formula for this compound would be:
CH3CH(CH3)C(CH3)=CH(CH2)2CH3
b) 1-bromo-3-chloro-1-heptyne
In this compound, "bromo" indicates the presence of a bromine atom (Br) and "chloro" indicates the presence of a chlorine atom (Cl). These halogens are attached to the first (1) and third (3) carbon atoms, respectively. Since it is a triple bond (yne), we can represent it as follows:
BrCH2CH2C≡CCH2CH2CH3
c) 3-heptyne
For this compound, it's a simple alkyne with a triple bond (yne) between the third (3) and fourth (4) carbon atoms. The condensed formula is:
CH3CH2CH≡CHCH2CH2CH3
Remember that these are condensed formulas, so the hydrogen atoms attached to the carbon atoms are not explicitly shown.