CHEMISTRY

WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3
2. CH3CH(C2H5)CH2CH3
3. CH3CH2CHCLCH2CH2CH2CH2Cl
4. CH3CH2CH2CH2OH
5. CH3CH2CH2CH2COOH
6. CH2=C(CH3)CH2CH(CH3)CH3
7. (CH3)2CHCl
8. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3
10. CH3C(triple bond)CCH3

  1. 👍
  2. 👎
  3. 👁
  1. We can't draw structures on this forum.l Here is the best attempt I can do. I hope it helps.
    ..H.H.H.H.H
    ..|.|.|.|.|
    H-C-C-C-C-C-H
    ..|.|.|.|.|
    ..H.H.H.|.H
    ......H-C-H
    ........|
    ........H
    The IUPAC name is 2-methylpentane

    1. 👍
    2. 👎
  2. As you can see the periods that were supposed to work as spacers didn't do the job.

    1. 👍
    2. 👎
  3. I should hae done this first.
    https://www.google.com/search?q=2-methylpentane

    1. 👍
    2. 👎
  4. methylepropyle

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    name the compound CH3CH=C(CH3)CH(CH3)2.

  2. chemistry

    What is the IUPAC name for the following molecules: 1. CH3CH2N(CH2CH2CH3)CH2CH3 2. CH3CH2N(CH3)CH2CH3 I tried N,N-diethylpropanamine for the first one and N-methyl-3,4-ethanamine for the second one, but my instructor said they

  3. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  4. Science

    what is the name of (ch3)2chch2ch(ch2ch3)ch(oh)ch2ch3

  1. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  2. chemistry

    Draw the structural formula and give the IUPAC names of the following hydrocarbon.a)CH3CHBrCHBrCH(CH3)CH3

  3. chemistry

    The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 B) 1.00 x 10^-6

  4. chemistry

    please name this compound CH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3

  1. organic chemistry!

    Just wanted to know if I have named the following compounds correctly..and wanted to know if there are any short-hand or easier methods of naming organic compounds because they are a bit confusing!I tried drawing structural

  2. chemistry

    CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound

  3. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2-dimethylpentane? Wouldn't it look like this: CH3-C-CH2-CH2-CH3 with a CH3 on the top and bottom of the C, which would be the 2nd carbon...

  4. Chem

    Lewis structure of [(CH3)3O]+. Be sure to show all atoms, bonds, lone pairs, and formal charges. Convert CH3CH(Cl)CH(OH)CH3 into a skeletal structure. If you could explain it, it would help. Or somehow do some of it here and

You can view more similar questions or ask a new question.