1. Questions

Chemistry

write the balanced chemical equation for reaction the following chemical reaction

ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O .

When balancing the equation , use the molecular formula of the organic compound

I am not sure how to write the initial equation:

O3 + ?? --> CO2 + H20

  1. 👍
  2. 👎
  3. 👁
  4. ℹ️
  5. 🚩
Susan

  1. For the ?? in your equation, substitute the formula you have in the problem. Then it's just a matter of balancing it.

    1. 👍
    2. 👎
    3. ℹ️
    4. 🚩
    DrBob222

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    A student claims that the reaction of hydrogen and oxygen to form hydrogen peroxide is evidence supporting the claim that mass is conserved in a chemical reaction. The chemical equation the student uses for the reaction is H2 + O2

  2. chemistry

    A student claims that the reaction of hydrogen and oxygen to form water is evidence supporting the claim that mass is conserved in a chemical reaction. The chemical equation the student uses for the reaction is H2 + O2 --> H2O.

  3. Chemistry

    Write a balanced chemical equation for nitrogen gas reacts with oxygen gas to produce nitrogen dioxide gas

  4. chemistry

    Write a balanced chemical equation for the reaction that occurs when barium carbonate decomposes into barium oxide and carbon dioxide gas when heated. Express your answer as a balanced chemical equation. Identify all of the phases

  1. chem

    Which purpose is served by an unbalanced chemical equation versus a balanced chemical equation? (1 point) An unbalanced chemical equation demonstrates a general reaction that occurs between several compounds. A balanced chemical

  2. chem

    Magnesium can react with aqueous nitric acid, HNO3, to form hydrogen gas and magnesium nitrate. Write down the balanced chemical equation for this reaction, remembering to use the state symbols.

  3. Chemistry

    Write the balanced chemical equation for the decomposition of sodium azide. If this is a redox reaction, show half reactions and determine if spontaneous. The chemical equation is 2NaN3(s) -> 2Na(s)+3N2(g) right? I am confused on

  4. Chemistry

    In a reaction chamber, 3.0mol of aluminum is mixed with 5.3mol Cl2 and reacts. The reaction is described by the following balanced chemical equation. 2Al + 3Cl2 ==> 2AlCl3 a)Identify the limiting reagent for the reaction.

  1. Chemistry

    Answer the following question: In a space shuttle, the CO2 that the crew exhales is removed from the air by a reaction within canisters of lithium hydroxide. Let's assume that one astronaut exhales about 537. L of CO2 daily. What

  2. Calculus

    A chemical reaction proceeds in such a way that after the first second, the amount of a certain chemical involved in the reaction changes at a rate that’s inversely proportional to the product of the mass of the chemical present

  3. Chemistry

    A student claims that the reaction of hydrogen and oxygen to form water is evidence supporting the claim that mass is conserved in a chemical reaction. The chemical equation the student uses for the reaction is H2 + O2 --> H2O.

  4. Chemistry

    how do you write a chemical equation with this reaction? can u help me solve these 1.Liquid carbon disulfide reacts with oxygen gas, producing carbon dioxide gas and sulfur dioxdie gas. 2. Solid zinc and aqueous hydrogen sulfate

View more similar questions or ask a new question.