math

y=cos(2(x-30 degree)+1) is a funstion right?is it?
how about 2^x-4?

  1. 👍 0
  2. 👎 0
  3. 👁 116

Respond to this Question

First Name

Your Response

Similar Questions

  1. Pre-Cal (Trig) Help?

    The following relationship is known to be true for two angles A and B: cos(A)cos(B)-sin(A)sin(B)=0.957269 Express A in terms of the angle B. Work in degrees and report numeric values accurate to 2 decimal places. So I'm pretty

  2. maths

    Cos square 30 degree cos square 45 degree + 4 sec square 60 degree + 1/2 cos square 90 degree - 2 tan square 60 degree

  3. math

    if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that cos(B-C)=cos(C-A)=cos(A-B)=-1/2

  4. Algebra

    Write an equation for the translation of the function. y = cos x; translated 6 units up A. y = cos x- ­ 6 B. y = cos(x + 6) C. y = cos x + 6 D. y = cos(x ­ 6) I think its B or c..

  1. Math

    Let f(x) be a polynomial such that f(cos theta) = cos(4 theta) for all theta. Find f(x). (This is essentially the same as finding cos(4 theta) in terms of cos theta; we structure the problem this way so that you can answer as a

  2. PHYSICS 1 ..

    as she pick up her riders a bus driver traverses four successive displacements represented by the expression (-6.30 b)i-(4.00 b cos 40)i-(4.00 sin 40)j+(3.00 b cos 50)i-(3.00 b sin 50)j-(5.00 b)j here b represents one city block,a

  3. Math

    Given that sin(x + 60) degree = cos(2x) degree, find tan(x + 60) degree.

  4. Pre-Calc

    Please check my answers I really need to do my homeowrk!;This are polar coordinates we're studying-I'm almost positive the first two are correct. 1.Which of the folowing is another representation of (-3,pi)? (3,120degree) (3,0

  1. math (trigonometry)

    if tan A/2 =cosecA-sin A then prove cos^2 A/2=cos 36 degree

  2. Studying for Pre Cal exam

    Find the fourth roots of − 1/2 + (square root)3/2 i Write the roots in trigonometric form. A - w 1=cos(35°)+isin(35°) w2 =cos(125°)+isin(125°) w3 =cos(215°)+isin(215°) w4 =cos(305°)+isin(305°) B - w1

  3. Math

    Explain how to do this with steps please. 1. Simplify cos(x-y)+cos(x+y)/cosx I did some of these so far, don't know if it is correct. Formula: cosxcosy= cos(x+y)+cos(x-y)/2 cos(x-y)+cos(x+y)/cosx =cosxcosy/2cosx

  4. UNIVERSITY PHYSICS 1

    as she pick up her riders a bus driver traverses four successive displacements represented by the expression (-6.30 b)i-(4.00 b cos 40)i-(4.00 sin 40)j+(3.00 b cos 50)i-(3.00 b sin 50)j-(5.00 b)j here b represents one city block,a

You can view more similar questions or ask a new question.