What are the condensed structure of each of the following: a.)2-pentene b.)1chloro 3 metyl 2 -pentene c.)3 methyl 1 butyne d.)2,3dimethyl pentane e.)2 ethyl 1 methyl hexane
Assistance needed.
To find the condensed structure for each compound, we can start by knowing the molecular formula of each compound and then arranging the atoms in the correct order.
a.) 2-pentene: The molecular formula for pentene is C5H10. The "2" in 2-pentene indicates that the double bond is between the second and third carbon atoms. So, the condensed structure of 2-pentene is:
CH3-CH=CH-CH2-CH3
b.) 1-chloro-3-methyl-2-pentene: The molecular formula for this compound is also C5H10 but with an additional chlorine atom. The "1" indicates the position of the chlorine atom, "3-methyl" indicates the position of the methyl group, and the "2" indicates the position of the double bond. Therefore, the condensed structure is:
CH3-CH(Cl)-CH=C(CH3)-CH2-CH3
c.) 3-methyl-1-butyne: The molecular formula for this compound is C5H8. The "3-methyl" indicates the position of the methyl group, and "1" indicates the position of the triple bond. Therefore, the condensed structure is:
CH3-C≡C-CH2-CH3
d.) 2,3-dimethylpentane: The molecular formula for this compound is C7H16. The "2,3-dimethyl" indicates the position of the two methyl groups. Therefore, the condensed structure is:
(CH3)2-CH-CH2-CH2-CH3
e.) 2-ethyl-1-methylhexane: The molecular formula for this compound is C9H20. The "2-ethyl" indicates the position of the ethyl group, and "1-methyl" indicates the position of the methyl group. Therefore, the condensed structure is:
CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH3
Remember, when drawing condensed structures, hydrogen atoms are usually not shown explicitly, and the dashes (-) represent single bonds, the double bond is indicated by an = sign, and the triple bond is indicated by a ≡ sign.