10th grade

What is the compound name fo HC2H3O2?

  1. 0
  2. 1
asked by jhgjgk
  1. http://acronyms.thefreedictionary.com/HC2H3O2

    posted by Ms. Sue

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry

    At 20 degrees celsius ,if the equation is C7H6O3(s)+C4H6O3(l)=C9H8O4+HC2H3O2(l), then how many liters of acetic acid, HC2H3O2 , would be formed if the density of HC2H3O2 is 1.05 g/ml?
  2. chemistry

    What is the pH of the solution created by combining 2.40 mL of the 0.10 M NaOH(aq) with with 8.00 mL of the 0.10 M HC2H3O2(aq)? So, here's my working so far: .00024 mol NaOH .0008 mol HC2H3O2 .0008 - .00024 = .00056 mol HC2H3O2
  3. Chemistry

    Hi Dr. Bob, this is a chemistry question. I don't know how to go about solving this problem: What is the pH of the solution created by combining 11.40 mL of the 0.10 M NaOH(aq)with 8.00 mL of the 0.10 M HC2H3O2(aq)? Here's what I
  4. chemistry

    What is the pH of the solution created by combining 2.80 mL of the 0.10 M NaOH(aq) with 8.00 mL of the 0.10 M HCl(aq)? with 8.00 mL of the 0.10 M HC2H3O2(aq)? mL of NaOH pH w/HCl pH w/HC2H3O2 2.80 ? ? okay, so i tried m1v1=m2v2
  5. chem

    What is the pH of the solution created by combining 2.40 mL of the 0.10 M NaOH(aq) with 8.00 mL of the 0.10 M HCl(aq)? with 8.00 mL of the 0.10 M HC2H3O2(aq)? I understand how to find the pH for the NaOH + HCl solution. However,
  6. Chemistry

    What is the pH of the solution created by combining 12.20 mL of the 0.10 M NaOH(aq) with 8.00 mL of the 0.10 M HCl(aq)? with 8.00 mL of the 0.10 M HC2H3O2(aq)? mL NaOH pH w/HCl pH w/HC2H3O2 12.20
  7. Chemistry

    Can a buffer solution with pH = 4.70 be prepared using water, 6.0 M HC2H3O2 and 6.0 M NaOH? Justify your answer. Ka = 1.8 x 10-5 for HC2H3O2 , K = 1.0 x 10-14 .
  8. Chemistry

    A solution that is prepared by mixing 20.0 mL of 0.32 M HC2H3O2 with 20.0 mL of 0.36 M NaC2H3O2 would have a pH of ___. For HC2H3O2, Ka = 1.8 x 10-5.
  9. CHEM 111

    What is the Ka value of acetic acid from the pH of the buffered solution? pH=4.39 of 25ml of HC2H3O2 with .410g NaC2H3O2 added. Ka = [H3O][C2H3O2] / [HC2H3O2]
  10. Chemistry 2

    calculate the PH of a mixture containing 30 mL, 0.10M HC2H3O2? (Ka=1.8x10^-8 of HC2H3O2)

More Similar Questions