Chemistry

25.0 mL of 0.100 M acetic acid (Ka= 1.8 x 10^-5) is titrated with 0.100 M NaOH. Calculate the pH after the addtion of 27.00 mL of 0.100M NaOH.

my work
CH3COOH + H2O <-> H3O^+ + CH3COO^-

25mL x 0.100 mmol/ml = 2.5mmol CH3COOH
27mL x 0.100 mmol/ml = 2.7mmol NaOH

There are more base than acid.... so what do I do?

__________________________
• Chem - DrBob222, Tuesday, June 29, 2010 at 4:30pm
• So the base neutralizes all of the acetic acid and one is left with 2.5 mmoles of the salt (sodium acetate) + an excess of (2.7-2.5 = 0.2 mmoles NaOH. The volume is 25 + 27 mL = ??

__________________________

Hi, I am still confuse on how to work this problem out

2.7-2.5=0.2

So I have 0.2 NaOH
Can I convert it to CH3COOH?
CH3COOH + OH^- --> H2O + CH3COO^-
0.2 OH^- = 0.2 CH3COO^-

Then, 2.7 mmol would be how much CH3COO produced?

Total Volume: 52 mL

[CH3COO]= 2.7/52= ....M
[CH3COOH] = 0.2/52=....M

I would like to know if I am going in the right direction in this problem, or if I'm doing it completely wrong. Thanks.

asked by Anonymous
  1. blah

    posted by Anonymous

Respond to this Question

First Name

Your Answer

Similar Questions

  1. Chem

    25.0 mL of 0.100 M acetic acid (Ka= 1.8 x 10^-5) is titrated with 0.100 M NaOH. Calculate the pH after the addtion of 27.00 mL of 0.100M NaOH. my work CH3COOH + H2O <-> H3O^+ + CH3COO^- 25mL x 0.100 mmol/ml = 2.5mmol CH3COOH
  2. Chemistry

    You are carrying out the titration of 100.0 mL of 1.000M acetic acid with 1.000 M sodium hydroxide. Ka = 1.76x10^-5 of acetic acid. (a) Calculate the initial pH of your acetic acid sample. (b) Calculate the pH of the solution
  3. Chem

    Write the equation for dissocation of acetic acid in water: My Answer: CH2COOH + H2O <=> H3O+ + CH3COO- Equation for hydrolysis of acetate anion in water: My Answer: CH3COO- + H2O <=> CH3COOH + OH- Now, using the above
  4. chemistry

    A student prepared a .10M solution of acidic acid. Acidic acid has a Ka of 1.75 x 10-3. What are the hydronium ion concentration and the PH of the solution? I think the PH is 1.76 because I hit -log(1.75 x 10-3) on my calculator
  5. Chemistry

    Calculate the pH at the equivalence point of 25.0 mL of a 0.100 M acetic acid, CH3COOH, titrated with a 0.100 M sodium hydroxide, NaOH. Ka of acetic acid is 1x10^-5
  6. science ap chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.
  7. Chemistry

    In the titration of 14.0 mL of 0.10M acetic acid with 0.40 M NaOH, (A) How many mL of NaOH needed to completely neutralize the acid? Given the balanced equation: CH3COOH (aq) + NaOH (aq) 􏰀 CH3COO Na (aq) + H2O
  8. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.
  9. Chemistry

    Consider a weak acid-strong base titration in which 25.0 mL of 0.100 M acetic acid is titrated with 0.100 M NaOH. a) Calculate the pH after the addition of 3.00mL of NaOH. b) What is the pH of the solution before the addition of
  10. Chemistry

    Commercial vinegar was titrated with NaOH solution to determine the content of acetic acid, HC2H3O2. For 20.0 milliliters of the vinegar 26.7 milliliters of 0.600-molar NaOH solution was required. What was the concentration of

More Similar Questions