How do I draw the condensed formula for:
1. 2,3-dimethyl-2-butene
2. 4-ethyl-2-hexyne
3. 3,3,6-trimathylnonane
4. 3-ethyl-4-propylheptane
5. 3-octanol
See my response to your question above Katrina/Cinnamon.
1.CH3C(CH3)double bond C(CH3)CH3
5.CH3CH2CHOHCH2CH2CH2CH2CH3
To draw the condensed formula for these compounds, you need to understand the rules of naming organic compounds and be familiar with the structures of various functional groups. I'll explain the steps to determine and draw the condensed formula for each of the compounds you mentioned.
1. 2,3-dimethyl-2-butene:
Start by identifying the parent chain, which in this case is butene, a four-carbon chain with a double bond between the second and third carbon. The "2,3-dimethyl" prefix indicates that there are two methyl groups attached at positions 2 and 3. To draw the condensed formula, write the parent chain with the double bond (C=C) between the second and third carbon, and add the methyl groups as substituents: CH3-CH=C(CH3)-CH3.
2. 4-ethyl-2-hexyne:
Again, start by identifying the parent chain, which is hexyne, a six-carbon chain with a triple bond between the second and third carbon. The "4-ethyl" prefix indicates that there is an ethyl group attached at position 4. To draw the condensed formula, write the parent chain with the triple bond (C≡C) between the second and third carbon, and add the ethyl group as a substituent: CH3-CH2-C≡C-CH2-CH3.
3. 3,3,6-trimathylnonane:
The parent chain in this case is nonane, a nine-carbon chain. The "3,3,6-trimethyl" prefix indicates that there are three methyl groups attached at positions 3, 3, and 6. To draw the condensed formula, write the parent chain and add the three methyl groups as substituents: CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH(CH3)-CH(CH3)-CH3.
4. 3-ethyl-4-propylheptane:
The parent chain is heptane, a seven-carbon chain. The "3-ethyl" prefix indicates that there is an ethyl group attached at position 3, and the "4-propyl" prefix indicates that there is a propyl group attached at position 4. To draw the condensed formula, write the parent chain and add the ethyl and propyl groups as substituents: CH3-CH2-CH2-CH(CH3)-CH2-CH2-CH2-CH2-CH3.
5. 3-octanol:
Given that "3-octanol" is an alcohol, it contains a hydroxyl group (-OH) attached to a carbon atom. The parent chain is octane, an eight-carbon chain. The "3-" prefix indicates that the hydroxyl group is attached at position 3. To draw the condensed formula, write the parent chain and add the hydroxyl group as a substituent: CH3-CH2-CH(OH)-CH2-CH2-CH2-CH2-CH3.
Remember, in the condensed formula, carbon atoms are implied and not explicitly written out, and only the atoms other than carbon and hydrogen are shown.
I hope this helps you draw the condensed formulas for the compounds you mentioned!