Draw the structure of:
(E)-1,2-dibromo-3-isopropyl-2-hexene
Can this please be explained, I don't know how to draw it.
We can't draw structures on these boards. You can go to google and type in the name. Probably you can see the structure that way.
Yeah, I have already tried googling it a lot. But got no hope. At least can the theory be explained?
I found it first cat out of the bag. Page 8, part d.
(Broken Link Removed)
Sure! I'll explain how to draw the structure of (E)-1,2-dibromo-3-isopropyl-2-hexene step by step.
1. Start by identifying the parent chain, which is the longest continuous chain of carbon atoms in the molecule. In this case, it is a hexene, so the parent chain contains 6 carbon atoms.
2. Determine the double bond position. Since it is a 2-hexene, the double bond is between the second and third carbon atoms in the parent chain.
3. Add substituents to the parent chain. In this case, there are two bromine atoms (Br) attached to the first and second carbon atoms. Additionally, there is an isopropyl group attached to the third carbon atom.
4. Draw the parent chain, including the double bond. Start by drawing six consecutive carbon atoms in a line. Then, place the double bond between the second and third carbon atoms by replacing one of the single bonds with a double bond.
The structure so far is: CH3-CH=CH-CH2-CH2-CH3
5. Add the substituents. Place a Br atom on the first carbon and another Br atom on the second carbon. Additionally, attach an isopropyl group [(CH3)2CH] to the third carbon.
The final structure of (E)-1,2-dibromo-3-isopropyl-2-hexene is:
CH3-CH(Br)-CH(Br)-CH(C(CH3)2)-CH2-CH3.
Remember that the (E) prefix indicates that the bromine atoms are on the opposite sides of the double bond.