chemistry

Nucleophile or electrophile?

(1) CH3COOH

(2) CH3COO-

At first, I thought that they were both Nucleophiles, but now Ive confused myself and Im not sure.. Please help!

  1. 👍
  2. 👎
  3. 👁
  1. Nucleophiles are Lewis bases; i.e., electron pair donors.
    This link may help.
    http://en.wikipedia.org/wiki/Nucleophile
    So anions are nucleophiles.

    1. 👍
    2. 👎
  2. So CH3COO- is a nucleophile. It has a extra electron pair on the O- that can be donated.

    But, doesnt CH3COOH also have extra valence electrons on the two O atoms that could be donated. So is it also a nucleophile, even though it does not have a negative charge?

    1. 👍
    2. 👎
  3. It might be easier to see if you ionize the RCOOH to RCOO^- + H^+, then of course the RCOO^- is a nucleophile. But I think with the H^+ ATTACHED, it would be a weaker (much weaker?) nucleophile than when it exists as the anion alone.

    1. 👍
    2. 👎

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    Rank the relative nucleophilicity of the indicated species in ethanol. CH3COOH CH3OH CH3COO- CH3S- CH3O- THANK YOU!

  2. Chemistry

    For the reaction CH3COOH- CH3COO + H+, which of the following statements is true? CH3COO- is an Arrhenius base. CH3COO- is a conjugate CH3COOH- is a Brønsted-Lowry acid.

  3. Chemistry

    what is the 1. chemical equation 2. complete ionic equation 3. net ionic equation include phase of HCH3COO+NaHCO3 pls correct my answers 1. CH3COOH(aq)+NaHCO3(aq)+CH3COONa(aq)+H2O(l)+CO2(g) 2.

  4. Chemistry

    Which represents the ionization of a strong electrolyte? CH3OH(l) mc015-1.jpg CH3OH(aq) K3PO4(s) mc015-2.jpg 3K+(aq) + PO43–(aq) H2CO3(aq) mc015-3.jpg H+(aq) + HCO3–(aq) CH3COOH(aq) + H2O(l) mc015-4.jpg H3O+(aq) +

  1. chemistry

    Which of the following chemical reactions represents a neutralization reaction? A. CH4 + 2O2 CO2 + H2O B. HCl + NaOH H2O + NaCl C. NH3 + H2O NH4++ OH- D. CH3COOH + H2O CH3COO- + H3O+

  2. Chemistry

    In the equilibrium system CH3COOH(aq) + H2O(l) —> — H3O+ CH3COO-(aq) .

  3. Chemistry

    A solution is made by mixing exactly 500 mL of 0.178 M NaOH with exactly 500 mL of 0.100 M CH3COOH. Calculate the equilibrium concentrations of H+, CH3COOH, CH3COO-, OH-, and Na+.

  4. Chemistry

    CH3COO-(aq) + H3O+(aq) → CH3COOH + H2O is spontaneous or non spontaneous rxn?

  1. Chemistry

    Acetic acid ionizes in water as follows: CH3COOH + H2O CH3COO– + H3O+ Fewer than 1% of ethanoic acid molecules are ionized at any instant. The acetate ion (CH3COO– ) is therefore ____. A.a poor hydrogen-ion acceptor B.a good

  2. Chemistry

    Acetic acid ionizes in water as follows: CH3COOH + H2O --> CH3COO– + H3O+

  3. chemistry

    What is the equilibrium expression for the following acid dissociation reaction? CH3COOH + H2O CH3COO- + H3O+ A. [CH3COO-][H3O+]/[CH3COOH][H3O] B. [CH3COOH][H2O]/[CH3COO-][H3O+] C. [CH3COOH]/[CH3COO-][H3O-] D.

  4. chem

    Are these correct? Rank the following species in order of increasing acidity. Explain your reasons of ordering them as you do. NH3 ,H2SO4, CH3OH, CH3COOH CH3COOH > H2SO4> CH3OH >NH3 Rank the following species in order of

You can view more similar questions or ask a new question.