Organic Chemistry

Hi, this is a sterechemistry problem. If you have a fisher projection problem with Ch3 at the top, Cl on the left, ethyl group on the right, and a CH double bonded to a CH2 (CH=CH2)on the bottom, it is an S nomenclature correct?

I figured out that Cl is 1st priority, and CH3 is 4th priority....but can you explain to me why the ethyl group is of higher priority than the CH=CH2?

  1. 👍
  2. 👎
  3. 👁

Respond to this Question

First Name

Your Response

Similar Questions

  1. Physics

    A body is projected such that the horizontal range is twice the maximum height of projection. Find the angle of projection; and the time of flight if the velocity of projection is 5m/s

  2. Chemistry

    Write IUPAC name of the following alkanes: 1. (CH3)3-C-CH2-CH2-CH3 Would the name be 2,2,4-trimethylhexane? 2. CH3CHCH2CHCH2CH2CH3 with a CH3 attached to the 2nd carbon and the 4th carbon. Would the name be 2,4-diheptane? 3.

  3. chemistry

    The reaction CH3- N≡C → CH3- C≡N is a first-order reaction. At 230.3°C, k = 6.29 x 10^-4 s^- 1. If [CH3 -N≡ is 1.00 x 10^-3 initially, C] [CH3-N ≡ C] is __________ after 1.000 x 10^3 s. A) 5.33 x 10^-4 B) 1.00 x 10^-6

  4. CHEMISTRY

    WHAT IS THE COMPLETE STRUCTURAL FORMULA AND NAME FOR CH3CH2CH2CH(CH3)CH3 2. CH3CH(C2H5)CH2CH3 3. CH3CH2CHCLCH2CH2CH2CH2Cl 4. CH3CH2CH2CH2OH 5. CH3CH2CH2CH2COOH 6. CH2=C(CH3)CH2CH(CH3)CH3 7. (CH3)2CHCl 8.

  1. Chemistry

    1)Which compound below would be expected to have the highest boiling point? a) CH3-CH2-CH2-CH2-CH2-CH2-CH3 b) CH3-CH2-CH2-CH2-CH-CH3 | CH3 c) CH3-CH-CH2-CH-CH3 | | CH3 CH3 d) CH3 | CH3-CH-C-CH3 | | CH3 CH3 Do I use molar mass to

  2. Algebra

    Use the above graph of f(x) to complete the following table for values of its inverse function, f^{-1}(x). The graph has a point on (2,2)the y-intercept is 4 the x intercept is 3 x =-4, 8, 0, -2, 2 f^{-1}(x) Note: You can earn

  3. chemistry

    CH3 CH3-C-CH3 CH3CH2CH2-C-CH2CH2CH2CH3 CH3 give the IUPAc name for this compound? is it 4-methyl-4-tert-methyloctane?

  4. Chemistry

    Name the following compounds 1. CH3-CH=CH-CH2 l Cl 2. CH3-CH-C=(tripple bond)C-CH3 l CH3 3. Cl Cl l l CH = C-CH3 4. Complete the following reactions and name the products a. CH2-CH=CH3+Cl2>>>> b. CH3-C=C-CH3+Br2 >>> Please help!

  1. Social Studies

    Which method of showing Earth's surface is the most accurate? A. An equal-area projection B. A scale-model globe C. A Mercator projection D. A Robinson projection

  2. Ms. Sue PLZ HELP!!!(Civics)

    3. Which of the following statements best describes a foreign policy issue? A problem that affects every citizen on a single continent A problem that cannot be contained within a country’s borders *** A problem shared among

  3. Chemistry

    Write the balanced chemical equation for reaction the following chemical reaction ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and

  4. Math

    End My Exam you have 47 hours and 40 minutes remaining47:24:13 Course, current location Discussion Progress Resources Course Exam 1 Exam 1 1. Previous Next Completedother Exam Rules problem 1. problem 2. problem 3. problem 4.

You can view more similar questions or ask a new question.