Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
Fe(NH4)2(SO4)2 · 12H2O + KMnO4 + H2SO4 = Fe2(SO4)3 + (NH4)2SO4 + MnSO4 + K2SO4 + H2O
To balance the equation Fe(NH4)2(SO4)2.12H2O + KMnO4 + H2SO4, you will need to follow these steps:
Step 1: Write down the unbalanced equation.
Fe(NH4)2(SO4)2.12H2O + KMnO4 + H2SO4 → ??
Step 2: Count the number of each type of atom on both sides of the equation. This will help you determine which elements are unbalanced.
Fe(NH4)2(SO4)2.12H2O: Fe = 1, N = 2, H = 48, S = 2, O = 28
KMnO4: K = 1, Mn = 1, O = 4
H2SO4: H = 2, S = 1, O = 4
Step 3: Balance the elements that are not in balance. Start with the most complex molecule first.
Looking at the Fe(NH4)2(SO4)2.12H2O, you can see that there is only one Fe atom on the left side, but no Fe on the right side. To balance the Fe, you will need to add a coefficient of 5 in front of KMnO4.
5Fe(NH4)2(SO4)2.12H2O + KMnO4 + H2SO4 → ??
Now, there are 5 Fe atoms on both sides.
Step 4: Next, balance the Mn atom. There is only one Mn atom on the left side, but no Mn on the right side. To balance the Mn, you will need to add a coefficient of 5 in front of H2SO4.
5Fe(NH4)2(SO4)2.12H2O + 5KMnO4 + 5H2SO4 → ??
Now, there are 5 Mn atoms on both sides.
Step 5: Finally, balance the remaining elements. Start with O, then N, and finally H. Adjust the coefficients as needed until the number of each atom is equal on both sides.
5Fe(NH4)2(SO4)2.12H2O + 5KMnO4 + 5H2SO4 → 5Fe2(SO4)3 + 5MnSO4 + 2N2 + 160H2O + K2SO4
The balanced equation is:
5Fe(NH4)2(SO4)2.12H2O + 5KMnO4 + 5H2SO4 → 5Fe2(SO4)3 + 5MnSO4 + 2N2 + 160H2O + K2SO4
To balance the equation Fe(NH4)2(SO4)2·12H2O + KMnO4 + H2SO4, you need to make sure that the number of each type of atom on both sides of the equation is the same. Here's how you can balance it step by step:
1. Start by counting the number of atoms for each element on both sides of the equation.
Fe(NH4)2(SO4)2·12H2O:
- Fe: 1
- N: 2
- H: 96 (12 H2O * 2 H atoms each)
- S: 2
- O: 32 (2 SO4 * 4 O atoms each)
- Total: 133 atoms
KMnO4:
- K: 1
- Mn: 1
- O: 4
- Total: 6 atoms
H2SO4:
- H: 2
- S: 1
- O: 4
- Total: 7 atoms
2. Let's balance the Fe atoms first by putting a coefficient of 6 in front of Fe(NH4)2(SO4)2·12H2O to have 6 Fe atoms on both sides:
6 Fe(NH4)2(SO4)2·12H2O + KMnO4 + H2SO4
Now we have 6 Fe atoms on the left side.
3. Next, let's balance the Mn atoms by putting a coefficient of 5 in front of KMnO4 to have 5 Mn atoms on both sides:
6 Fe(NH4)2(SO4)2·12H2O + 5 KMnO4 + H2SO4
Now we have 5 Mn atoms on both sides.
4. Now let's balance the sulfur (S) atoms by putting a coefficient of 6 in front of H2SO4 to have 6 S atoms on both sides:
6 Fe(NH4)2(SO4)2·12H2O + 5 KMnO4 + 6 H2SO4
Now we have 6 S atoms on both sides.
5. Finally, let's balance the oxygen (O) atoms. On the left side, we have 96 O atoms from the water molecules and 32 O atoms from the Fe(NH4)2(SO4)2 compound, totaling 128 O atoms. To balance this, we need to add 128/4 = 32 KMnO4 molecules on the right side, each contributing 4 O atoms:
6 Fe(NH4)2(SO4)2·12H2O + 32 KMnO4 + 6 H2SO4
Now we have 128 O atoms on both sides.
The balanced equation is:
6 Fe(NH4)2(SO4)2·12H2O + 32 KMnO4 + 6 H2SO4 → 6 FeSO4 + 2(NH4)2SO4 + 12 (NH4)2MnO4 + 24 H2O