chemistry

I think it is a trick question as I can not balance this equation .

Balance this equation

Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2

  1. 0
  2. 6
asked by Julia

Respond to this Question

First Name

Your Response

Similar Questions

  1. Chemistry Balancing

    To balance an equation For example if the equation was CaOH2 + HCl ---> CaCl2 + H20 the question is , if i want to balance , should i count the OH ( hydroxide ) as a whole thing or separately so the O goes with the other oxygens
  2. Algebra

    You invest $5,500 into a 4.5% one-year CD. Find the balance of the account after five years if it's compounded: a. Quarterly Equation:______________________ Balance: $_________________ b. Annually Equation:______________________
  3. Chemistry

    For each reaction, complete and balance the equation and give the net ionic equation. a) KOH(aq)+ZnCl2(aq)-> KCl2+ZnOH The second half of the equation is how i had done on the exam but he said its not balanced. How do I balance
  4. Science

    I am learning how to balance a chemical equation but I don't understand it at all. I read that in order to balance the equation, you need to find the number of atoms. How do I do that? How do you balance a chemical equation?
  5. art

    Colors are used in the image "Figures Veiwing Lake" to create all of the following except a. emphasis the central figure b. symmetrical balance c. unity d. radical balance*** I think d because it anit balance on each side....can
  6. ap chemistry

    home / study / questions and answers / science / chemistry / balance the following example of a heterogeneous ... Your question has been answered! Rate it below. Let us know if you got a helpful answer. . Question Balance the
  7. Chemistry

    hi I'm having a serious problem with balancing chemical equations , can someone explain to me how we can do them also if i had a word equation hhow can i convert it into a symbolic equation and balance it e.g can someone show me
  8. Chemistry

    hi I'm having a serious problem with balancing chemical equations , can someone explain to me how we can do them also if i had a word equation hhow can i convert it into a symbolic equation and balance it e.g can someone show me
  9. Accounting

    After the closing entries are posted to the ledger, each revenue account will have a zero balance: a. a zero balance, b. a debit balance, c. a credit balance, or d. either a debit or a credit balance.
  10. accounting

    After the closing entries are posted to the ledger, each revenue account will have a zero balance: a. a zero balance, b. a debit balance, c. a credit balance, or d. either a debit or a credit balance.

More Similar Questions