Chemistry-Balancing equations

Write a single, balanced equation for the formation of ozone from the high-temperature reaction of atmospheric nitrogen and atmospheric oxygen.

  1. 👍 0
  2. 👎 0
  3. 👁 273
  1. http://www.chemistry.wustl.edu/~edudev/LabTutorials/AirQuality/Ozone.htm

    1. 👍 0
    2. 👎 0

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    Write a balanced chemical equation for the reaction that occurs when dimethylether, , is combusted in air. Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  2. Chemistry

    Hydrogen peroxide can act as either an oxidizing agent or a reducing agent, depending on the species present in solution. Write balanced half-reaction equations for each of the following: (a) H2O2(aq) acting as an oxidizing agent

  3. chemistry

    Write a balanced chemical equation for the reaction that occurs when Mg(s)reacts with Cl2(g). Express your answer as a balanced chemical equation. Identify all of the phases in your answer.

  4. chemistry

    In the reaction between formic acid (HCHO2) and sodium hydroxide, water and sodium formate (NaCHO2) are formed. To determine the heat of reaction, 75.0 mL of 1.07 M HCHO2 was placed in a coffee cup calorimeter at a temperature of

  1. chemistry -check over work

    Naphthalene (C10H8)is a solid aromatic compound often sold as mothballs.The complete combustion of this substance to yield CO2(g)and H2O(l)at 25 ْC yields -5154 kJ/mol. A. write balanced equation for the combustion of C10H8.

  2. AP Chemistry

    Hydrogen gas is blown over hot iron (ii) oxide. a. Write the balanced reduction half reaction that occurs. b. Write the balanced oxidation half reaction that occurs. c. Write the balanced net ionic equation for this reaction.

  3. Chem Help!

    I really need help for my homework on how to write the balanced equation for the following reactions. 1) Sodium reacts with iron(lll)oxide to produce sodium oxide and iron. Type of reaction: Balanced Equation: 2) Hydrogen bromide

  4. chemistry

    Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation.

  1. Chemistry

    Propane (C3H8) burns according to the following balanced equation: C3H8(g)+5O2(g)→3CO2(g)+4H2O(g) Calculate ΔH∘rxn for this reaction using standard enthalpies of formation. (The standard enthalpy of formation of gaseous

  2. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

  3. Chemistry!

    When 2.5g of NaOH were dissolved in 49.0g water in a calorimeter at 24.0 C, the temperature of the solution went up to 37.1 C. a. Is the solution reaction exothermic? Why? The temperature or the water went from 24.0 to 37.1 which

  4. chemistry-balanced redox equations

    Use the following steps to balance the redox reaction below: Mg + Au+ Mg2+ + Au a. Write the oxidation and reduction half-reactions. Make sure each half-reaction is balanced for number of atoms and charge b. Multiply each

You can view more similar questions or ask a new question.