Give the IUPAC name of thish hydrocarbon
ch3ch2c(ch3)2ch2ch2ch2ch3
I believe that's 3,3- dimethylheptane
To determine the IUPAC name of a hydrocarbon, you need to follow a set of rules provided by the International Union of Pure and Applied Chemistry (IUPAC) for naming organic compounds.
In this case, let's break down the structure of the hydrocarbon:
CH3 CH2 C(CH3)2 CH2 CH2 CH2 CH3
1. Identify the longest continuous carbon chain: In this case, the longest continuous carbon chain contains 7 carbon atoms.
CH3 CH2 C(CH3)2 CH2 CH2 CH2 CH3
|---------|
2. Number the carbon chain: Assign the lowest numbers to the substituents on the chain. Start assigning numbers to the carbons such that the substituents are on the lowest possible numbered carbons.
CH3 CH2 C(CH3)2 CH2 CH2 CH2 CH3
1 2 3 4 5 6 7
3. Identify and name the substituent groups: In this case, we have two substituent groups attached to the main chain. The first group is a methyl (CH3) group attached to the carbon at position 3, and the second group is a methyl (CH3) group attached to the carbon at position 4.
4. Combine the names: Using the substituent names and the main chain name, combine them to give the IUPAC name.
CH3 CH2 C(CH3)2 CH2 CH2 CH2 CH3
3-Methyl-4-methylheptane
Therefore, the IUPAC name of the hydrocarbon CH3CH2C(CH3)2CH2CH2CH2CH3 is 3-Methyl-4-methylheptane.