Write the structural formula of 2,3,5-trimethyl-4-propylheptane.
To write the structural formula of 2,3,5-trimethyl-4-propylheptane, we need to understand the molecular structure and naming conventions of organic compounds.
Step 1: Analyze the compound name
- The compound name is "2,3,5-trimethyl-4-propylheptane"
- This tells us that there are three methyl (CH3) groups attached at positions 2, 3, and 5 of the parent heptane (7 carbon) chain. Additionally, there is a propyl group attached at position 4.
Step 2: Determine the parent chain
- The parent chain is heptane, which consists of seven carbon atoms in a linear arrangement.
Step 3: Add the substituents
- The compound has three methyl (CH3) groups attached at positions 2, 3, and 5 of the parent heptane chain.
- It also has a propyl group (CH(CH2)2CH3) attached at position 4.
Step 4: Combine the substituents with the parent chain
- Start by drawing a straight chain with seven carbon atoms.
- Attach the methyl groups at positions 2, 3, and 5 on the parent chain.
- Attach the propyl group at position 4.
The resulting structural formula of 2,3,5-trimethyl-4-propylheptane is:
CH3-CH(CH3)-C(CH3)2-CH2-CH(CH2CH3)-CH2-CH3
- Remember that the prefix "iso" is used if there is a branching methyl group at position 2 of the parent chain. However, in this case, there is no need for the prefix since the methyl group is attached at positions 2, 3, and 5.