Biology

Write an equation to summarize the photo reaction of photosynthesis.

Since this is not my area of expertise, I searched Google under the key words "photosynthesis equation" to get these possible sources:

(Broken Link Removed)
http://en.wikipedia.org/wiki/Photosynthesis
http://biology.about.com/od/plantbiology/a/aa050605a.htm

I hope this helps. Thanks for asking.

  1. 👍 0
  2. 👎 0
  3. 👁 222

Respond to this Question

First Name

Your Response

Similar Questions

  1. chemistry

    Consider the following reaction: Na2CO3 + NiCl2 ¨ NiCO3 + 2NaCl Using the solubility rules determine the solubility of all reactants and products. Explain your answer Please. Which product is the precipitate in this reaction?

    asked by Eagertolearn on February 23, 2013
  2. Chemistry

    Write the equation for the reaction associated with the Ka2 of sulfuric acid, H2SO4. Write the equation for the reaction associated with the Kb2 of carbonate, CO32–.

    asked by Darrin on January 27, 2013
  3. Chemistry

    Hydrogen peroxide can act as either an oxidizing agent or a reducing agent, depending on the species present in solution. Write balanced half-reaction equations for each of the following: (a) H2O2(aq) acting as an oxidizing agent

    asked by Alexis on April 28, 2014
  4. Chemistry Equation

    1) Write the equation for the reaction associated with the Ka2 of sulfuric acid, H2SO4. 2)Write the equation for the reaction associated with the Kb2 of carbonate, CO3^(2-).

    asked by Mizuhara on October 13, 2014
  5. Biology

    Cellular Respiration and Photosynthesis co-exist as paired metabolic processes. Photosynthesis uses light energy to convert carbon dioxide into glucose, a simple sugar, in two steps, the light dependent and light independent

    asked by Tammy on June 12, 2009
  1. chemistry

    Precipitation Reactions Write a molecular equation for the precipitation reaction that occurs (if any) when the following solutions are mixed. If no reaction occurs, write NO REACTION. Express your answer as a chemical equation.

    asked by Jake on February 9, 2009
  2. chemistry

    For the electrolysis of molten potassium bromide: (a) write the equation for the reaction at cathode. (b) write the equation for the reaction at anode. (c) write the equation for the overall reaction.

    asked by Shane on September 10, 2014
  3. math

    a square photo display is made up of 60 rows of 60 photos each. the area of each square photo is 4 square inches. how long is each side of the display board?

    asked by josh on September 4, 2014
  4. Chemistry

    Green plants use light from the sun to drive photo synthesis. Photosynthesis is a chemical reaction in which water (H2O) and carbon Dioxide (CO2) chemically react to form the simple sugar glucose (C6H12O6) and oxygen gas (O2).

    asked by bob on August 28, 2019
  5. Chemistry

    1. Write a balanced molecular equation for the reaction of solid AgNO3 with aqueous NaCl. Be sure to include the correct number of coefficients and the state of the species (aq, s, l or g). 2. Write the total ionic equation for

    asked by Jess on November 26, 2014
  6. Chemistry

    write the balanced chemical equation for reaction the following chemical reaction ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-CßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas

    asked by Susan on March 12, 2012

You can view more similar questions or ask a new question.